DE1769729A1 - Thermoplastische Polyester enthaltende Formmasse - Google Patents
Thermoplastische Polyester enthaltende FormmasseInfo
- Publication number
- DE1769729A1 DE1769729A1 DE19681769729 DE1769729A DE1769729A1 DE 1769729 A1 DE1769729 A1 DE 1769729A1 DE 19681769729 DE19681769729 DE 19681769729 DE 1769729 A DE1769729 A DE 1769729A DE 1769729 A1 DE1769729 A1 DE 1769729A1
- Authority
- DE
- Germany
- Prior art keywords
- polyester
- epoxypropanol
- thermoplastic polyester
- optionally
- dicarboxylic acids
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000728 polyester Polymers 0.000 title claims description 26
- 238000000465 moulding Methods 0.000 title claims description 7
- 229920001169 thermoplastic Polymers 0.000 title claims description 4
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 4
- 239000000203 mixture Substances 0.000 title description 3
- -1 aromatic dicarboxylic acids Chemical class 0.000 claims description 19
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical class OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 claims description 3
- 150000001735 carboxylic acids Chemical class 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000000732 arylene group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 2
- 150000002009 diols Chemical class 0.000 claims description 2
- 229910003480 inorganic solid Inorganic materials 0.000 claims description 2
- 239000002245 particle Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 239000008187 granular material Substances 0.000 description 7
- 238000002347 injection Methods 0.000 description 7
- 239000007924 injection Substances 0.000 description 7
- 238000001746 injection moulding Methods 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 6
- 229920000139 polyethylene terephthalate Polymers 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 239000005020 polyethylene terephthalate Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 2
- 239000002667 nucleating agent Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- WMRCTEPOPAZMMN-UHFFFAOYSA-N 2-undecylpropanedioic acid Chemical compound CCCCCCCCCCCC(C(O)=O)C(O)=O WMRCTEPOPAZMMN-UHFFFAOYSA-N 0.000 description 1
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- YTEYRFRJIYWPAT-UHFFFAOYSA-N C(CCC(=O)O)(=O)O.C(C1CO1)O.C(C1CO1)O Chemical compound C(CCC(=O)O)(=O)O.C(C1CO1)O.C(C1CO1)O YTEYRFRJIYWPAT-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- OTGHWLKHGCENJV-UHFFFAOYSA-N glycidic acid Chemical class OC(=O)C1CO1 OTGHWLKHGCENJV-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/15—Heterocyclic compounds having oxygen in the ring
- C08K5/151—Heterocyclic compounds having oxygen in the ring having one oxygen atom in the ring
- C08K5/1515—Three-membered rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Injection Moulding Of Plastics Or The Like (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681769729 DE1769729A1 (de) | 1968-07-04 | 1968-07-04 | Thermoplastische Polyester enthaltende Formmasse |
| NL6909819A NL6909819A (enExample) | 1968-07-04 | 1969-06-26 | |
| US838686A US3673144A (en) | 1968-07-04 | 1969-07-02 | Thermoplastic molding compositions containing polyesters |
| GB33849/69A GB1224684A (en) | 1968-07-04 | 1969-07-04 | Thermoplastic moulding compositions containing polyesters |
| AT646169A AT292314B (de) | 1968-07-04 | 1969-07-04 | Thermoplastische Polyesterformmasse auf der Basis gesättigter Polyester |
| FR6922770A FR2012311A1 (enExample) | 1968-07-04 | 1969-07-04 | |
| BE735677D BE735677A (enExample) | 1968-07-04 | 1969-07-04 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681769729 DE1769729A1 (de) | 1968-07-04 | 1968-07-04 | Thermoplastische Polyester enthaltende Formmasse |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1769729A1 true DE1769729A1 (de) | 1972-01-27 |
Family
ID=5700247
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681769729 Pending DE1769729A1 (de) | 1968-07-04 | 1968-07-04 | Thermoplastische Polyester enthaltende Formmasse |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3673144A (enExample) |
| AT (1) | AT292314B (enExample) |
| BE (1) | BE735677A (enExample) |
| DE (1) | DE1769729A1 (enExample) |
| FR (1) | FR2012311A1 (enExample) |
| GB (1) | GB1224684A (enExample) |
| NL (1) | NL6909819A (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4071504A (en) * | 1975-05-02 | 1978-01-31 | The Goodyear Tire & Rubber Company | Process for producing low carboxyl polyester fibers and other articles |
| US4435546A (en) | 1976-11-23 | 1984-03-06 | Bayer Aktiengesellschaft | Polyesters compositions which crystallize rapidly |
| US4223125A (en) | 1976-11-23 | 1980-09-16 | Bayer Aktiengesellschaft | Polyester compositions which crystallize rapidly |
| US4115350A (en) * | 1977-07-27 | 1978-09-19 | Allied Chemical Corporation | Production of thermally stabilized polyester |
| US4483955A (en) * | 1980-08-06 | 1984-11-20 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4444931A (en) * | 1980-08-06 | 1984-04-24 | Celanese Corporation | Polyester blends |
| US4351758A (en) * | 1980-08-06 | 1982-09-28 | Celanese Corporation | Polyester blends |
| US4425457A (en) | 1980-08-06 | 1984-01-10 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4533679A (en) * | 1982-06-28 | 1985-08-06 | Mobay Chemical Corporation | Reinforced polyester composition having an improved strength |
| US4879328A (en) * | 1987-05-18 | 1989-11-07 | Toray Industries | Aromatic polyester composition and process for producing the same |
| US5389710A (en) * | 1992-11-23 | 1995-02-14 | Dege; Gerald J. | Crystallization modifier for polyester molding compositions |
| US6818293B1 (en) * | 2003-04-24 | 2004-11-16 | Eastman Chemical Company | Stabilized polyester fibers and films |
| NZ564176A (en) * | 2005-06-09 | 2011-03-31 | Beaulieu Group Llc D B A Beaulieu Of America | Thermoplastic polymer compositions including silica-containing nucleating agents for carpet backing |
| US20090156714A1 (en) * | 2007-12-17 | 2009-06-18 | Subramaniam Narayan | Flame retardant compositions |
| JP5928665B1 (ja) * | 2014-11-19 | 2016-06-01 | 東レ株式会社 | 熱可塑性ポリエステル樹脂組成物および成形品 |
| CN110922570B (zh) * | 2019-12-05 | 2021-08-13 | 中国林业科学研究院林产化学工业研究所 | 一步法制备生物基超支化聚酯增塑剂及其在pvc电缆料中的应用 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2781333A (en) * | 1952-09-10 | 1957-02-12 | American Cyanamid Co | Polymerizable compositions containing polyglycidyl esters of polycarboxylic acids |
| US3060147A (en) * | 1961-05-03 | 1962-10-23 | American Cyanamid Co | Polyester resin compositions |
| GB1158348A (en) * | 1966-12-09 | 1969-07-16 | Ici Ltd | Mouldable Polyester Compositions. |
| DE1769097A1 (de) * | 1968-04-03 | 1971-10-21 | Hoechst Ag | Thermoplastische Polyester enthaltende Formmassen |
| US3516957A (en) * | 1968-04-29 | 1970-06-23 | Eastman Kodak Co | Thermoplastic polyester composition containing organic ester mold release agent |
-
1968
- 1968-07-04 DE DE19681769729 patent/DE1769729A1/de active Pending
-
1969
- 1969-06-26 NL NL6909819A patent/NL6909819A/xx unknown
- 1969-07-02 US US838686A patent/US3673144A/en not_active Expired - Lifetime
- 1969-07-04 FR FR6922770A patent/FR2012311A1/fr not_active Withdrawn
- 1969-07-04 GB GB33849/69A patent/GB1224684A/en not_active Expired
- 1969-07-04 AT AT646169A patent/AT292314B/de not_active IP Right Cessation
- 1969-07-04 BE BE735677D patent/BE735677A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT292314B (de) | 1971-08-25 |
| BE735677A (enExample) | 1970-01-05 |
| GB1224684A (en) | 1971-03-10 |
| NL6909819A (enExample) | 1970-01-06 |
| FR2012311A1 (enExample) | 1970-03-20 |
| US3673144A (en) | 1972-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1769729A1 (de) | Thermoplastische Polyester enthaltende Formmasse | |
| DE2702027C2 (enExample) | ||
| CH417943A (de) | Verfahren zur Herstellung von formfesten Spritzgussartikeln aus Polyestern aromatischer Dicarbonsäuren | |
| DE2124336C3 (de) | Thermoplastische Polyesterformmassen | |
| DE1769230A1 (de) | Thermoplastische Polyester enthaltende Formmassen | |
| DE69923420T2 (de) | Verfahren zur Herstellung von Polyesterharzen | |
| DE1769097A1 (de) | Thermoplastische Polyester enthaltende Formmassen | |
| US3578623A (en) | Compositions of saturated polyesters,inorganic solids,and cyclic carbonates | |
| DE60101871T2 (de) | Verfahren zur herstellung von alkydharz | |
| DE1769224C3 (de) | Herstellung rasch kristallisierender Formmassen auf Basis gesättigter Polyester | |
| DE1945101A1 (de) | Thermoplastische Formmassen auf Basis gesaettigter Polyester | |
| DE1933235A1 (de) | Natriumfluoridhaltige thermoplastische Polyesterformmassen | |
| DE1814149C3 (de) | Herstellung rasch kristallisierender Formmassen auf Basis gesättigter Polyester | |
| DE69027160T2 (de) | Verminderung der Azidität von Polyestern durch Verkappung der Endgruppen durch Reaktion in der Schmelze mit Dialkyloxalat | |
| DE1933969C3 (de) | Thermoplastische Formmassen auf Basis gesättigter Polyester | |
| DE1954588A1 (de) | Polyester-Spritzgussmassen | |
| DE1934719A1 (de) | Verfahren zur Herstellung hochmolekularer Polyester fuer Spritzgusszwecke | |
| DE2138789A1 (de) | Verfahren zur Herstellung von amorphen transparenten Formkorpern nach dem Spritz blasverfahren | |
| DE2138754A1 (de) | Verfahren zur Herstellung von kristal linen opaken Formkorpern nach dem Spritz blas Verfahren | |
| DE1544673B2 (de) | Verfahren zum herstellen aushaertbarer kunststoff-formmassen | |
| DE4311748A1 (de) | Polyesterzusammensetzung | |
| DE2152245A1 (de) | Verfahren zur Herstellung hochmolekularer Polykondensate | |
| DE1794114C3 (de) | Herstellung rasch kristallisierender Formmassen auf Basis gesättigter Polyester | |
| DE1271397B (de) | Verfahren zur Herstellung von spinnfaehigem Poly-(aethylenglykolterephthalat) | |
| AT278368B (de) | Verfahren zur Herstellung von Spritzguß- bzw. Extrusionsartikeln aus Polyestern bzw. Copolyestern |