DE1768964A1 - Chemische Verfahren und Produkte - Google Patents
Chemische Verfahren und ProdukteInfo
- Publication number
- DE1768964A1 DE1768964A1 DE19681768964 DE1768964A DE1768964A1 DE 1768964 A1 DE1768964 A1 DE 1768964A1 DE 19681768964 DE19681768964 DE 19681768964 DE 1768964 A DE1768964 A DE 1768964A DE 1768964 A1 DE1768964 A1 DE 1768964A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- phenyl
- lower alkyl
- alkoxy
- meaning
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000001311 chemical methods and process Methods 0.000 title description 2
- -1 faphthyl Chemical group 0.000 claims description 177
- 229910052739 hydrogen Inorganic materials 0.000 claims description 156
- 239000001257 hydrogen Substances 0.000 claims description 153
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 122
- 150000002431 hydrogen Chemical class 0.000 claims description 104
- 125000000217 alkyl group Chemical group 0.000 claims description 90
- 125000003545 alkoxy group Chemical group 0.000 claims description 61
- 238000000034 method Methods 0.000 claims description 51
- 229910052736 halogen Inorganic materials 0.000 claims description 41
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 39
- 150000002367 halogens Chemical group 0.000 claims description 39
- 125000003282 alkyl amino group Chemical group 0.000 claims description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 28
- 150000001875 compounds Chemical class 0.000 claims description 26
- 125000003342 alkenyl group Chemical group 0.000 claims description 25
- 125000001589 carboacyl group Chemical group 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 21
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 235000008206 alpha-amino acids Nutrition 0.000 claims description 16
- 229940024606 amino acid Drugs 0.000 claims description 16
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 15
- 125000004076 pyridyl group Chemical group 0.000 claims description 14
- 125000001624 naphthyl group Chemical group 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 11
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 10
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000004442 acylamino group Chemical group 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 9
- 150000007513 acids Chemical class 0.000 claims description 8
- 125000004414 alkyl thio group Chemical group 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 5
- 150000001371 alpha-amino acids Chemical class 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 150000001768 cations Chemical class 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 5
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- 239000004201 L-cysteine Substances 0.000 claims description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 3
- 125000005153 alkyl sulfamoyl group Chemical group 0.000 claims description 3
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims description 3
- 125000006323 alkenyl amino group Chemical group 0.000 claims description 2
- 125000000179 alkoxyanilino group Chemical group 0.000 claims description 2
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims 6
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 6
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims 4
- 239000008194 pharmaceutical composition Substances 0.000 claims 4
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 claims 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 2
- 239000004744 fabric Substances 0.000 claims 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims 2
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 2
- 229910014033 C-OH Inorganic materials 0.000 claims 1
- 229910014570 C—OH Inorganic materials 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- 239000000243 solution Substances 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 17
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- 239000000047 product Substances 0.000 description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 14
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 13
- 229910021529 ammonia Inorganic materials 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000007983 Tris buffer Substances 0.000 description 10
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 9
- 229960002433 cysteine Drugs 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 8
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 235000018417 cysteine Nutrition 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- RUKDRPDKKIFZHD-UHFFFAOYSA-N 1-[chloro-bis(3-fluorophenyl)methyl]-3-fluorobenzene Chemical compound FC1=CC=CC(C(Cl)(C=2C=C(F)C=CC=2)C=2C=C(F)C=CC=2)=C1 RUKDRPDKKIFZHD-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 4
- 235000001014 amino acid Nutrition 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- LMSWYOHFMJDYAF-UHFFFAOYSA-N 1-chloro-4-[chloro(diphenyl)methyl]benzene Chemical compound C1=CC(Cl)=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 LMSWYOHFMJDYAF-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 3
- 150000001241 acetals Chemical class 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 229960001138 acetylsalicylic acid Drugs 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- 150000001945 cysteines Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- LJRDOKAZOAKLDU-UDXJMMFXSA-N (2s,3s,4r,5r,6r)-5-amino-2-(aminomethyl)-6-[(2r,3s,4r,5s)-5-[(1r,2r,3s,5r,6s)-3,5-diamino-2-[(2s,3r,4r,5s,6r)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-hydroxycyclohexyl]oxy-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxyoxane-3,4-diol;sulfuric ac Chemical compound OS(O)(=O)=O.N[C@@H]1[C@@H](O)[C@H](O)[C@H](CN)O[C@@H]1O[C@H]1[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](N)C[C@@H](N)[C@@H]2O)O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)N)O[C@@H]1CO LJRDOKAZOAKLDU-UDXJMMFXSA-N 0.000 description 2
- PNAZUQUHTIOEHF-UHFFFAOYSA-N (3-methylphenyl)methanethiol Chemical compound CC1=CC=CC(CS)=C1 PNAZUQUHTIOEHF-UHFFFAOYSA-N 0.000 description 2
- KHVJXWFCBMQXLH-UHFFFAOYSA-N (4-chlorophenyl)-diphenylmethanol Chemical compound C=1C=CC=CC=1C(C=1C=CC(Cl)=CC=1)(O)C1=CC=CC=C1 KHVJXWFCBMQXLH-UHFFFAOYSA-N 0.000 description 2
- MXQXXDCHJLTHLF-UHFFFAOYSA-N 2-chloro-1,1-dimethoxybutane Chemical compound CCC(Cl)C(OC)OC MXQXXDCHJLTHLF-UHFFFAOYSA-N 0.000 description 2
- RWAKBGVDMQRDNA-UHFFFAOYSA-N 2-chloro-1-phenylbutan-1-one Chemical compound CCC(Cl)C(=O)C1=CC=CC=C1 RWAKBGVDMQRDNA-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 235000012501 ammonium carbonate Nutrition 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 230000003356 anti-rheumatic effect Effects 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical class SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 229940078469 dl- cysteine Drugs 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229940091173 hydantoin Drugs 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- XCVNDBIXFPGMIW-UHFFFAOYSA-N n-ethylpropan-1-amine Chemical compound CCCNCC XCVNDBIXFPGMIW-UHFFFAOYSA-N 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 229960001639 penicillamine Drugs 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 230000002085 persistent effect Effects 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- 125000005323 thioketone group Chemical group 0.000 description 2
- 238000005891 transamination reaction Methods 0.000 description 2
- BYCZMBJMRZGEDH-UHFFFAOYSA-N (1-bromo-2,2-dimethoxyethyl)benzene Chemical compound COC(OC)C(Br)C1=CC=CC=C1 BYCZMBJMRZGEDH-UHFFFAOYSA-N 0.000 description 1
- UJNSDLRPHRMVGZ-UHFFFAOYSA-N (2-bromophenyl)methanethiol Chemical compound SCC1=CC=CC=C1Br UJNSDLRPHRMVGZ-UHFFFAOYSA-N 0.000 description 1
- UMJTYEUXQGJEIZ-UHFFFAOYSA-N (2-fluorophenyl)methanethiol Chemical compound FC1=CC=CC=C1CS UMJTYEUXQGJEIZ-UHFFFAOYSA-N 0.000 description 1
- PJUDFYDAJBQPEA-UHFFFAOYSA-N (2-methylphenyl)methanethiol Chemical compound CC1=CC=CC=C1CS PJUDFYDAJBQPEA-UHFFFAOYSA-N 0.000 description 1
- YVTDPUKNXWITNA-UHFFFAOYSA-N (2-nitrophenyl)methanethiol Chemical compound [O-][N+](=O)C1=CC=CC=C1CS YVTDPUKNXWITNA-UHFFFAOYSA-N 0.000 description 1
- XWRZKLKALVJDDS-REOHCLBHSA-N (2r)-2-(diaminomethylideneamino)-3-sulfanylpropanoic acid Chemical compound NC(N)=N[C@@H](CS)C(O)=O XWRZKLKALVJDDS-REOHCLBHSA-N 0.000 description 1
- SMLNREUXXJESLR-BYPYZUCNSA-N (2r)-2-(ethylamino)-3-sulfanylpropanoic acid Chemical compound CCN[C@@H](CS)C(O)=O SMLNREUXXJESLR-BYPYZUCNSA-N 0.000 description 1
- NZBONMFLYFGTAC-BYPYZUCNSA-N (2r)-2-amino-2-methyl-3-sulfanylpropanoic acid Chemical compound SC[C@@](N)(C)C(O)=O NZBONMFLYFGTAC-BYPYZUCNSA-N 0.000 description 1
- MCXLRWIRNLPGBF-SECBINFHSA-N (2r)-2-amino-2-phenyl-3-sulfanylpropanoic acid Chemical compound SC[C@](N)(C(O)=O)C1=CC=CC=C1 MCXLRWIRNLPGBF-SECBINFHSA-N 0.000 description 1
- XYUBQWNJDIAEES-QMMMGPOBSA-N (2r)-2-amino-3-phenylsulfanylpropanoic acid Chemical compound OC(=O)[C@@H](N)CSC1=CC=CC=C1 XYUBQWNJDIAEES-QMMMGPOBSA-N 0.000 description 1
- LGEYIBKMWLDPJV-QMMMGPOBSA-N (2r)-2-anilino-3-sulfanylpropanoic acid Chemical compound OC(=O)[C@H](CS)NC1=CC=CC=C1 LGEYIBKMWLDPJV-QMMMGPOBSA-N 0.000 description 1
- IOOMXPHYBWAZAQ-REOHCLBHSA-N (2r)-3-sulfanyl-2-(sulfanylamino)propanoic acid Chemical class OC(=O)[C@H](CS)NS IOOMXPHYBWAZAQ-REOHCLBHSA-N 0.000 description 1
- USZCENBBGPLSRD-UHFFFAOYSA-N (3,5-dimethylphenyl)methanethiol Chemical compound CC1=CC(C)=CC(CS)=C1 USZCENBBGPLSRD-UHFFFAOYSA-N 0.000 description 1
- PMZGGJCLPBGARD-UHFFFAOYSA-N (3-fluorophenyl)methanethiol Chemical compound FC1=CC=CC(CS)=C1 PMZGGJCLPBGARD-UHFFFAOYSA-N 0.000 description 1
- MNNASYKPIIJEJF-UHFFFAOYSA-N (3-nitrophenyl)methanethiol Chemical compound [O-][N+](=O)C1=CC=CC(CS)=C1 MNNASYKPIIJEJF-UHFFFAOYSA-N 0.000 description 1
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- CUCKXDPCCYHFMQ-UHFFFAOYSA-N (4-bromophenyl)methanethiol Chemical compound SCC1=CC=C(Br)C=C1 CUCKXDPCCYHFMQ-UHFFFAOYSA-N 0.000 description 1
- NZKUEFLYULXWHD-UHFFFAOYSA-N (4-chlorophenyl)-diphenylmethanethiol Chemical compound C=1C=CC=CC=1C(C=1C=CC(Cl)=CC=1)(S)C1=CC=CC=C1 NZKUEFLYULXWHD-UHFFFAOYSA-N 0.000 description 1
- AGFYZLVFPSGUIX-UHFFFAOYSA-N (4-methylphenyl)methanethiol Chemical compound CC1=CC=C(CS)C=C1 AGFYZLVFPSGUIX-UHFFFAOYSA-N 0.000 description 1
- ACFHLWCEZHYYKX-UHFFFAOYSA-N (4-nitrophenyl)methanethiol Chemical compound [O-][N+](=O)C1=CC=C(CS)C=C1 ACFHLWCEZHYYKX-UHFFFAOYSA-N 0.000 description 1
- PFMNHBLMRAOCSB-UHFFFAOYSA-N (4-phenylphenyl)methanethiol Chemical compound C1=CC(CS)=CC=C1C1=CC=CC=C1 PFMNHBLMRAOCSB-UHFFFAOYSA-N 0.000 description 1
- YMXAYMSJCVGYEM-UHFFFAOYSA-N 1-Chloro-2-(chlorophenylmethyl)benzene Chemical compound C=1C=CC=C(Cl)C=1C(Cl)C1=CC=CC=C1 YMXAYMSJCVGYEM-UHFFFAOYSA-N 0.000 description 1
- ZPDZOJFTVUINLH-UHFFFAOYSA-N 1-[bromo(phenyl)methyl]-2-fluorobenzene Chemical compound FC1=CC=CC=C1C(Br)C1=CC=CC=C1 ZPDZOJFTVUINLH-UHFFFAOYSA-N 0.000 description 1
- LSUOXWBIPPDBHB-UHFFFAOYSA-N 1-[bromo(phenyl)methyl]-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1C(Br)C1=CC=CC=C1 LSUOXWBIPPDBHB-UHFFFAOYSA-N 0.000 description 1
- RUXWULLFBASCJB-UHFFFAOYSA-N 1-[bromo(phenyl)methyl]-4-methylbenzene Chemical compound C1=CC(C)=CC=C1C(Br)C1=CC=CC=C1 RUXWULLFBASCJB-UHFFFAOYSA-N 0.000 description 1
- DNPUOCDJCMLJRY-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-2-fluorobenzene Chemical compound FC1=CC=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 DNPUOCDJCMLJRY-UHFFFAOYSA-N 0.000 description 1
- NFQOUIXXQRHXFQ-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-2-methylbenzene Chemical compound CC1=CC=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 NFQOUIXXQRHXFQ-UHFFFAOYSA-N 0.000 description 1
- XRNFDHBNDUQTNB-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-2-phenylbenzene Chemical compound C=1C=CC=CC=1C(C=1C(=CC=CC=1)C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 XRNFDHBNDUQTNB-UHFFFAOYSA-N 0.000 description 1
- XURJOVWXWPQFBN-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-3-methylbenzene Chemical compound CC1=CC=CC(C(Cl)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 XURJOVWXWPQFBN-UHFFFAOYSA-N 0.000 description 1
- GOMIRHDQMYEKAM-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-4-fluorobenzene Chemical compound C1=CC(F)=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 GOMIRHDQMYEKAM-UHFFFAOYSA-N 0.000 description 1
- VUTZFAOGDXUYEJ-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-4-methylbenzene Chemical compound C1=CC(C)=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 VUTZFAOGDXUYEJ-UHFFFAOYSA-N 0.000 description 1
- UUPIKHFEQCQMCV-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-4-nitrobenzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 UUPIKHFEQCQMCV-UHFFFAOYSA-N 0.000 description 1
- XLYVCSVBEHGPCM-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-4-propylbenzene Chemical compound C1=CC(CCC)=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 XLYVCSVBEHGPCM-UHFFFAOYSA-N 0.000 description 1
- YJWSBQXSJOQRKG-UHFFFAOYSA-N 1-[chloro(phenyl)methyl]-2-ethylbenzene Chemical compound CCC1=CC=CC=C1C(Cl)C1=CC=CC=C1 YJWSBQXSJOQRKG-UHFFFAOYSA-N 0.000 description 1
- VTZTUKIBJQCCMO-UHFFFAOYSA-N 1-[chloro(phenyl)methyl]-2-methylbenzene Chemical compound CC1=CC=CC=C1C(Cl)C1=CC=CC=C1 VTZTUKIBJQCCMO-UHFFFAOYSA-N 0.000 description 1
- CFPYBVHEZBNWTR-UHFFFAOYSA-N 1-[chloro(phenyl)methyl]-3-methylbenzene Chemical compound CC1=CC=CC(C(Cl)C=2C=CC=CC=2)=C1 CFPYBVHEZBNWTR-UHFFFAOYSA-N 0.000 description 1
- LYKVCCHDBARSHV-UHFFFAOYSA-N 1-[chloro(phenyl)methyl]-4-nitrobenzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(Cl)C1=CC=CC=C1 LYKVCCHDBARSHV-UHFFFAOYSA-N 0.000 description 1
- IZPCLXOUGPFBBF-UHFFFAOYSA-N 1-[chloro(phenyl)methyl]-4-phenoxybenzene Chemical compound C=1C=C(OC=2C=CC=CC=2)C=CC=1C(Cl)C1=CC=CC=C1 IZPCLXOUGPFBBF-UHFFFAOYSA-N 0.000 description 1
- HSVIAUJGCMPSQO-UHFFFAOYSA-N 1-[chloro(phenyl)methyl]-4-phenylbenzene Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1C(Cl)C1=CC=CC=C1 HSVIAUJGCMPSQO-UHFFFAOYSA-N 0.000 description 1
- WHSYADDTYUHRLL-UHFFFAOYSA-N 1-[chloro-(2,4-dimethylphenyl)methyl]-2,4-dimethylbenzene Chemical compound CC1=CC(C)=CC=C1C(Cl)C1=CC=C(C)C=C1C WHSYADDTYUHRLL-UHFFFAOYSA-N 0.000 description 1
- NUDUHGRVSIFZNY-UHFFFAOYSA-N 1-[chloro-(2-ethylphenyl)methyl]-2-ethylbenzene Chemical compound ClC(C1=C(C=CC=C1)CC)C1=C(C=CC=C1)CC NUDUHGRVSIFZNY-UHFFFAOYSA-N 0.000 description 1
- BUAJFEJSDOBJOE-UHFFFAOYSA-N 1-[chloro-(2-methylphenyl)-phenylmethyl]-2-methylbenzene Chemical compound CC1=CC=CC=C1C(Cl)(C=1C(=CC=CC=1)C)C1=CC=CC=C1 BUAJFEJSDOBJOE-UHFFFAOYSA-N 0.000 description 1
- BDKVUSHDWONRDM-UHFFFAOYSA-N 1-[chloro-(2-methylphenyl)methyl]-2-methylbenzene Chemical compound CC1=CC=CC=C1C(Cl)C1=CC=CC=C1C BDKVUSHDWONRDM-UHFFFAOYSA-N 0.000 description 1
- WVGCPDYDOXXUKX-UHFFFAOYSA-N 1-[chloro-(2-propan-2-ylphenyl)methyl]-2-propan-2-ylbenzene Chemical compound ClC(C1=C(C=CC=C1)C(C)C)C1=C(C=CC=C1)C(C)C WVGCPDYDOXXUKX-UHFFFAOYSA-N 0.000 description 1
- LGHZDEQZBPIRRN-UHFFFAOYSA-N 1-[chloro-(3-methylphenyl)methyl]-3-methylbenzene Chemical compound CC1=CC=CC(C(Cl)C=2C=C(C)C=CC=2)=C1 LGHZDEQZBPIRRN-UHFFFAOYSA-N 0.000 description 1
- OPILNPZLPSUHOD-UHFFFAOYSA-N 1-[chloro-(4-ethylphenyl)-phenylmethyl]-4-methylbenzene Chemical compound C1(=CC=CC=C1)C(Cl)(C1=CC=C(C=C1)CC)C1=CC=C(C=C1)C OPILNPZLPSUHOD-UHFFFAOYSA-N 0.000 description 1
- QSPQSNFWOIPURQ-UHFFFAOYSA-N 1-[chloro-(4-methoxyphenyl)methyl]-4-phenoxybenzene Chemical compound C1=CC(OC)=CC=C1C(Cl)C(C=C1)=CC=C1OC1=CC=CC=C1 QSPQSNFWOIPURQ-UHFFFAOYSA-N 0.000 description 1
- QKOPYEDBKRYHMW-UHFFFAOYSA-N 1-[chloro-(4-methylphenyl)-phenylmethyl]-4-methylbenzene Chemical compound C1=CC(C)=CC=C1C(Cl)(C=1C=CC(C)=CC=1)C1=CC=CC=C1 QKOPYEDBKRYHMW-UHFFFAOYSA-N 0.000 description 1
- XXHJRVRLLABZBJ-UHFFFAOYSA-N 1-[chloro-(4-methylphenyl)methyl]-4-methylbenzene Chemical compound C1=CC(C)=CC=C1C(Cl)C1=CC=C(C)C=C1 XXHJRVRLLABZBJ-UHFFFAOYSA-N 0.000 description 1
- OTQAIHOEFHAQDM-UHFFFAOYSA-N 1-[chloro-bis(4-fluorophenyl)methyl]-4-fluorobenzene Chemical compound C1=CC(F)=CC=C1C(Cl)(C=1C=CC(F)=CC=1)C1=CC=C(F)C=C1 OTQAIHOEFHAQDM-UHFFFAOYSA-N 0.000 description 1
- OBFCMKPFILBCSQ-UHFFFAOYSA-N 1-[chloro-bis(4-methoxyphenyl)methyl]-4-methoxybenzene Chemical compound C1=CC(OC)=CC=C1C(Cl)(C=1C=CC(OC)=CC=1)C1=CC=C(OC)C=C1 OBFCMKPFILBCSQ-UHFFFAOYSA-N 0.000 description 1
- XXABZPJLQMPUJK-UHFFFAOYSA-N 1-[chloro-bis(4-methylsulfanylphenyl)methyl]-4-methylsulfanylbenzene Chemical compound C1=CC(SC)=CC=C1C(Cl)(C=1C=CC(SC)=CC=1)C1=CC=C(SC)C=C1 XXABZPJLQMPUJK-UHFFFAOYSA-N 0.000 description 1
- VRCXLAZSCVTRIG-UHFFFAOYSA-N 1-[chloro-bis(4-nitrophenyl)methyl]-4-nitrobenzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(Cl)(C=1C=CC(=CC=1)[N+]([O-])=O)C1=CC=C([N+]([O-])=O)C=C1 VRCXLAZSCVTRIG-UHFFFAOYSA-N 0.000 description 1
- VCWALPPIUQCSLK-UHFFFAOYSA-N 1-[chloro-bis(4-phenylphenyl)methyl]-4-phenylbenzene Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1C(C=1C=CC(=CC=1)C=1C=CC=CC=1)(Cl)C(C=C1)=CC=C1C1=CC=CC=C1 VCWALPPIUQCSLK-UHFFFAOYSA-N 0.000 description 1
- LIQJHDWTWXVXFT-UHFFFAOYSA-N 1-bromo-1-phenylbutan-2-one Chemical compound CCC(=O)C(Br)C1=CC=CC=C1 LIQJHDWTWXVXFT-UHFFFAOYSA-N 0.000 description 1
- TYSIABGIEWSXEI-UHFFFAOYSA-N 1-bromo-2-[bromo(phenyl)methyl]benzene Chemical compound C=1C=CC=C(Br)C=1C(Br)C1=CC=CC=C1 TYSIABGIEWSXEI-UHFFFAOYSA-N 0.000 description 1
- XQJCFOOAJAADSR-UHFFFAOYSA-N 1-bromo-4-[bromo(phenyl)methyl]benzene Chemical compound C=1C=C(Br)C=CC=1C(Br)C1=CC=CC=C1 XQJCFOOAJAADSR-UHFFFAOYSA-N 0.000 description 1
- OPEXJOQTXYBVTJ-UHFFFAOYSA-N 1-bromo-4-[bromo-(4-bromophenyl)methyl]benzene Chemical compound C=1C=C(Br)C=CC=1C(Br)C1=CC=C(Br)C=C1 OPEXJOQTXYBVTJ-UHFFFAOYSA-N 0.000 description 1
- NOMHRYCAVGPGEC-UHFFFAOYSA-N 1-bromo-4-[chloro(phenyl)methyl]benzene Chemical compound C=1C=C(Br)C=CC=1C(Cl)C1=CC=CC=C1 NOMHRYCAVGPGEC-UHFFFAOYSA-N 0.000 description 1
- LXVVTEYTOQQQGB-UHFFFAOYSA-N 1-bromo-4-[chloro-(4-chlorophenyl)methyl]benzene Chemical compound C=1C=C(Br)C=CC=1C(Cl)C1=CC=C(Cl)C=C1 LXVVTEYTOQQQGB-UHFFFAOYSA-N 0.000 description 1
- KFPLPFVPPOJDFF-UHFFFAOYSA-N 1-chloro-1-phenylpropan-2-one Chemical compound CC(=O)C(Cl)C1=CC=CC=C1 KFPLPFVPPOJDFF-UHFFFAOYSA-N 0.000 description 1
- JFLSOKIMYBSASW-UHFFFAOYSA-N 1-chloro-2-[chloro(diphenyl)methyl]benzene Chemical compound ClC1=CC=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 JFLSOKIMYBSASW-UHFFFAOYSA-N 0.000 description 1
- JIOMOSMOFRFEGZ-UHFFFAOYSA-N 1-chloro-3-[chloro(diphenyl)methyl]benzene Chemical compound ClC1=CC=CC(C(Cl)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 JIOMOSMOFRFEGZ-UHFFFAOYSA-N 0.000 description 1
- FCSFSWLSKOMQFX-UHFFFAOYSA-N 1-chloro-3-[chloro(phenyl)methyl]benzene Chemical compound C=1C=CC(Cl)=CC=1C(Cl)C1=CC=CC=C1 FCSFSWLSKOMQFX-UHFFFAOYSA-N 0.000 description 1
- LKBJQRZQDCMBBJ-UHFFFAOYSA-N 1-chloro-4-[chloro-(4-chlorophenyl)methyl]benzene Chemical compound C=1C=C(Cl)C=CC=1C(Cl)C1=CC=C(Cl)C=C1 LKBJQRZQDCMBBJ-UHFFFAOYSA-N 0.000 description 1
- AALRHBLMAVGWRR-UHFFFAOYSA-N 1-chlorobutan-2-one Chemical compound CCC(=O)CCl AALRHBLMAVGWRR-UHFFFAOYSA-N 0.000 description 1
- BTFWJAUZPQUVNZ-UHFFFAOYSA-N 1-methyl-3-[(3-methylphenyl)methyl]benzene Chemical compound CC1=CC=CC(CC=2C=C(C)C=CC=2)=C1 BTFWJAUZPQUVNZ-UHFFFAOYSA-N 0.000 description 1
- YAXQOLYGKLGQKA-UHFFFAOYSA-N 1-morpholin-4-ylpropan-2-ol Chemical compound CC(O)CN1CCOCC1 YAXQOLYGKLGQKA-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- GBMSZXWHMSSBGP-UHFFFAOYSA-N 2,3-dimethylbutan-1-amine Chemical compound CC(C)C(C)CN GBMSZXWHMSSBGP-UHFFFAOYSA-N 0.000 description 1
- RNDNSYIPLPAXAZ-UHFFFAOYSA-N 2-Phenyl-1-propanol Chemical compound OCC(C)C1=CC=CC=C1 RNDNSYIPLPAXAZ-UHFFFAOYSA-N 0.000 description 1
- VZXHNYMLNDXSHK-UHFFFAOYSA-N 2-[chloro(diphenyl)methyl]-1,4-dimethylbenzene Chemical compound CC1=CC=C(C)C(C(Cl)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 VZXHNYMLNDXSHK-UHFFFAOYSA-N 0.000 description 1
- RCQVGZTVKGXABV-UHFFFAOYSA-N 2-[chloro(diphenyl)methyl]thiophene Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CS1 RCQVGZTVKGXABV-UHFFFAOYSA-N 0.000 description 1
- XDMJPFIBKSOHLV-UHFFFAOYSA-N 2-[chloro(phenyl)methyl]-1,3-diethylbenzene Chemical compound ClC(C1=CC=CC=C1)C1=C(C=CC=C1CC)CC XDMJPFIBKSOHLV-UHFFFAOYSA-N 0.000 description 1
- RVRDOBZEOANKPA-UHFFFAOYSA-N 2-[chloro(phenyl)methyl]-1,3-dimethylbenzene Chemical compound CC1=C(C(C2=CC=CC=C2)Cl)C(=CC=C1)C RVRDOBZEOANKPA-UHFFFAOYSA-N 0.000 description 1
- GLQAFHLNXDQBPR-UHFFFAOYSA-N 2-[chloro-(2-ethylphenyl)methyl]-1,3-diethylbenzene Chemical compound ClC(C1=C(C=CC=C1)CC)C1=C(C=CC=C1CC)CC GLQAFHLNXDQBPR-UHFFFAOYSA-N 0.000 description 1
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 1
- ZUAFAIVEEWFGAR-UHFFFAOYSA-N 2-bromo-1,1-dimethoxy-2-methylpropane Chemical compound COC(OC)C(C)(C)Br ZUAFAIVEEWFGAR-UHFFFAOYSA-N 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- NUJHTYRNHYOUKO-UHFFFAOYSA-N 2-chloro-2-methyl-1-phenylpropan-1-one Chemical compound CC(C)(Cl)C(=O)C1=CC=CC=C1 NUJHTYRNHYOUKO-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- QPRQEDXDYOZYLA-UHFFFAOYSA-N 2-methylbutan-1-ol Chemical compound CCC(C)CO QPRQEDXDYOZYLA-UHFFFAOYSA-N 0.000 description 1
- WBDRVMIJNFZLMN-UHFFFAOYSA-N 2-phenylpropane-2-thiol Chemical compound CC(C)(S)C1=CC=CC=C1 WBDRVMIJNFZLMN-UHFFFAOYSA-N 0.000 description 1
- UNIIVAXJUCKZHT-UHFFFAOYSA-N 2-piperidin-1-ylpropan-1-amine Chemical compound NCC(C)N1CCCCC1 UNIIVAXJUCKZHT-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- WGTASENVNYJZBK-UHFFFAOYSA-N 3,4,5-trimethoxyamphetamine Chemical compound COC1=CC(CC(C)N)=CC(OC)=C1OC WGTASENVNYJZBK-UHFFFAOYSA-N 0.000 description 1
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- DHYHYLGCQVVLOQ-UHFFFAOYSA-N 3-bromoaniline Chemical compound NC1=CC=CC(Br)=C1 DHYHYLGCQVVLOQ-UHFFFAOYSA-N 0.000 description 1
- ASVKKRLMJCWVQF-UHFFFAOYSA-N 3-buten-1-amine Chemical compound NCCC=C ASVKKRLMJCWVQF-UHFFFAOYSA-N 0.000 description 1
- CKSIBFLEDRJUTN-UHFFFAOYSA-N 3-chloropentan-2-one Chemical compound CCC(Cl)C(C)=O CKSIBFLEDRJUTN-UHFFFAOYSA-N 0.000 description 1
- KLEBMSJOJMXVFP-UHFFFAOYSA-N 3-phenylpropylazanium;chloride Chemical compound [Cl-].[NH3+]CCCC1=CC=CC=C1 KLEBMSJOJMXVFP-UHFFFAOYSA-N 0.000 description 1
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical compound C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 description 1
- AWCKLOPZHLHTAD-UHFFFAOYSA-N 4-[4-(4-carbamimidoyl-2-methoxyphenoxy)butoxy]-3-methoxybenzenecarboximidamide Chemical compound COC1=CC(C(N)=N)=CC=C1OCCCCOC1=CC=C(C(N)=N)C=C1OC AWCKLOPZHLHTAD-UHFFFAOYSA-N 0.000 description 1
- NHIXRQUPXNEJAF-UHFFFAOYSA-N 4-[chloro(diphenyl)methyl]pyridine Chemical compound C=1C=CC=CC=1C(C=1C=CN=CC=1)(Cl)C1=CC=CC=C1 NHIXRQUPXNEJAF-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- JLRAWVOPMUYZEP-UHFFFAOYSA-N 4-chlorohexan-3-one Chemical compound CCC(Cl)C(=O)CC JLRAWVOPMUYZEP-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- IJJWOSAXNHWBPR-HUBLWGQQSA-N 5-[(3as,4s,6ar)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-n-(6-hydrazinyl-6-oxohexyl)pentanamide Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)NCCCCCC(=O)NN)SC[C@@H]21 IJJWOSAXNHWBPR-HUBLWGQQSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- GPDZANYUWQMISQ-UHFFFAOYSA-N C1=CC(CC)=CC=C1C(Cl)C1=CC=CC=C1 Chemical compound C1=CC(CC)=CC=C1C(Cl)C1=CC=CC=C1 GPDZANYUWQMISQ-UHFFFAOYSA-N 0.000 description 1
- YMQLTWRVXCVJCD-UHFFFAOYSA-N CCC(C(C(=O)O)N)SSCC(C(=O)O)N Chemical compound CCC(C(C(=O)O)N)SSCC(C(=O)O)N YMQLTWRVXCVJCD-UHFFFAOYSA-N 0.000 description 1
- JIFSJXDMRUAFOC-UHFFFAOYSA-N COC1=CC=CC=C1C(C1=CC=C(C=C1)OC)(C1=CC=CC=C1)Cl Chemical compound COC1=CC=CC=C1C(C1=CC=C(C=C1)OC)(C1=CC=CC=C1)Cl JIFSJXDMRUAFOC-UHFFFAOYSA-N 0.000 description 1
- YCPYDJCMQJAIMJ-UHFFFAOYSA-N COC=1C=C(C=CC=1)C(C1=CC(=CC=C1)OC)(C1=CC(=CC=C1)OC)Cl Chemical compound COC=1C=C(C=CC=1)C(C1=CC(=CC=C1)OC)(C1=CC(=CC=C1)OC)Cl YCPYDJCMQJAIMJ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- AZEZXQNBULMXRZ-UHFFFAOYSA-N ClC(C1=C(C=C(C=C1Cl)Cl)Cl)C1=C(C=C(C=C1Cl)Cl)Cl Chemical compound ClC(C1=C(C=C(C=C1Cl)Cl)Cl)C1=C(C=C(C=C1Cl)Cl)Cl AZEZXQNBULMXRZ-UHFFFAOYSA-N 0.000 description 1
- KOBYDOHILSXVPY-UHFFFAOYSA-N ClC(C1=CC=CC=C1)(C1=CC=C(C=C1)[N+](=O)[O-])C1=CC=C(C=C1)[N+](=O)[O-] Chemical compound ClC(C1=CC=CC=C1)(C1=CC=C(C=C1)[N+](=O)[O-])C1=CC=C(C=C1)[N+](=O)[O-] KOBYDOHILSXVPY-UHFFFAOYSA-N 0.000 description 1
- RWUHXEWXHIKLHI-UHFFFAOYSA-N ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC(=CC=C1)F Chemical compound ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC(=CC=C1)F RWUHXEWXHIKLHI-UHFFFAOYSA-N 0.000 description 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 208000006313 Delayed Hypersensitivity Diseases 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- XTCOKRVUJVIAOL-UHFFFAOYSA-N FC=1C=C(C=CC1)C(SC(C(OC)OC)CC)(C1=CC(=CC=C1)F)C1=CC(=CC=C1)F Chemical compound FC=1C=C(C=CC1)C(SC(C(OC)OC)CC)(C1=CC(=CC=C1)F)C1=CC(=CC=C1)F XTCOKRVUJVIAOL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 1
- 102100033070 Histone acetyltransferase KAT6B Human genes 0.000 description 1
- 101100019690 Homo sapiens KAT6B gene Proteins 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 235000013878 L-cysteine Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 238000007059 Strecker synthesis reaction Methods 0.000 description 1
- 241000746181 Therates Species 0.000 description 1
- 241000656145 Thyrsites atun Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- VLSOAXRVHARBEQ-UHFFFAOYSA-N [4-fluoro-2-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=C(F)C=C1CO VLSOAXRVHARBEQ-UHFFFAOYSA-N 0.000 description 1
- MUBKMWFYVHYZAI-UHFFFAOYSA-N [Al].[Cu].[Zn] Chemical compound [Al].[Cu].[Zn] MUBKMWFYVHYZAI-UHFFFAOYSA-N 0.000 description 1
- ZDVDCDLBOLSVGM-UHFFFAOYSA-N [chloro(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(Cl)C1=CC=CC=C1 ZDVDCDLBOLSVGM-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000004716 alpha keto acids Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- 125000005002 aryl methyl group Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- VNWKTOKETHGBQD-YPZZEJLDSA-N carbane Chemical class [10CH4] VNWKTOKETHGBQD-YPZZEJLDSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 1
- 229960003067 cystine Drugs 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000005553 drilling Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 229940031005 ethyl cysteine Drugs 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229960002442 glucosamine Drugs 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 150000001469 hydantoins Chemical class 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 229940072221 immunoglobulins Drugs 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 229960001913 mecysteine Drugs 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- NNBBQNFHCVVQHZ-UHFFFAOYSA-N methyl carbamimidothioate;sulfuric acid Chemical compound CSC(N)=N.OS(O)(=O)=O NNBBQNFHCVVQHZ-UHFFFAOYSA-N 0.000 description 1
- MCZPBVIMEOAMRR-UHFFFAOYSA-N n-ethylpropan-1-amine;hydrochloride Chemical compound Cl.CCCNCC MCZPBVIMEOAMRR-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- BBNYLDSWVXSNOQ-UHFFFAOYSA-N oxolane-2-carbaldehyde Chemical compound O=CC1CCCO1 BBNYLDSWVXSNOQ-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- IMACFCSSMIZSPP-UHFFFAOYSA-N phenacyl chloride Chemical compound ClCC(=O)C1=CC=CC=C1 IMACFCSSMIZSPP-UHFFFAOYSA-N 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 235000002020 sage Nutrition 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 229910001467 sodium calcium phosphate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005846 sugar alcohols Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
- AXORVIZLPOGIRG-UHFFFAOYSA-N β-methylphenethylamine Chemical compound NCC(C)C1=CC=CC=C1 AXORVIZLPOGIRG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
- C07C319/20—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides by reactions not involving the formation of sulfide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
- C07D233/76—Two oxygen atoms, e.g. hydantoin with substituted hydrocarbon radicals attached to the third ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/56—Radicals substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/18—Radicals substituted by singly bound hetero atoms other than halogen by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Saccharide Compounds (AREA)
- Pyridine Compounds (AREA)
- Manufacture And Refinement Of Metals (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US65604167A | 1967-07-26 | 1967-07-26 | |
US72835168A | 1968-05-10 | 1968-05-10 |
Publications (1)
Publication Number | Publication Date |
---|---|
DE1768964A1 true DE1768964A1 (de) | 1972-01-27 |
Family
ID=27097099
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19681768964 Pending DE1768964A1 (de) | 1967-07-26 | 1968-07-18 | Chemische Verfahren und Produkte |
Country Status (12)
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0001193A1 (fr) * | 1977-09-01 | 1979-03-21 | SCIENCE UNION ET Cie SOCIETE FRANCAISE DE RECHERCHE MEDICALE | Amino-acides cycliques, leurs procédés d'obtention et compositions pharmaceutiques les contenant |
Families Citing this family (7)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
BE733993A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1968-06-14 | 1969-12-03 | ||
FR2434149A1 (fr) * | 1978-06-22 | 1980-03-21 | Parcor | Nouveaux derives de la l-cysteine |
US4246263A (en) * | 1979-10-15 | 1981-01-20 | Pfizer Inc. | Antiinflammatory and immunoregulatory pyrimidines, their method of use and pharmaceutical compositions |
DE3303344A1 (de) * | 1983-02-02 | 1984-08-02 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von n-alkylierten aminosaeuren und deren estern |
NZ525143A (en) | 2000-09-14 | 2005-12-23 | Gruenenthal Chemie | Beta-thio-amino acids |
DE10045831A1 (de) * | 2000-09-14 | 2002-04-04 | Gruenenthal Gmbh | Thio-Aminosäuren |
US9074553B2 (en) | 2010-12-29 | 2015-07-07 | Ford Global Technologies, Llc | Cylinder block assembly |
-
1968
- 1968-07-11 NL NL686809834A patent/NL144484B/xx not_active IP Right Cessation
- 1968-07-15 IL IL30369A patent/IL30369A/en unknown
- 1968-07-15 NO NO2800/68A patent/NO124205B/no unknown
- 1968-07-16 IE IE849/68A patent/IE32515B1/xx unknown
- 1968-07-17 SE SE09792/68A patent/SE364040B/xx unknown
- 1968-07-18 DE DE19681768964 patent/DE1768964A1/de active Pending
- 1968-07-22 GB GB34780/68A patent/GB1191042A/en not_active Expired
- 1968-07-24 ES ES356488A patent/ES356488A1/es not_active Expired
- 1968-07-25 FR FR1586146D patent/FR1586146A/fr not_active Expired
- 1968-07-25 BE BE718559D patent/BE718559A/xx unknown
- 1968-07-25 CH CH1113468A patent/CH534138A/de not_active IP Right Cessation
- 1968-07-25 FR FR160545A patent/FR7960M/fr not_active Expired
- 1968-07-25 JP JP43052196A patent/JPS5019543B1/ja active Pending
-
1969
- 1969-10-09 ES ES372359A patent/ES372359A1/es not_active Expired
- 1969-10-09 ES ES372357A patent/ES372357A1/es not_active Expired
- 1969-10-09 ES ES372358A patent/ES372358A1/es not_active Expired
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0001193A1 (fr) * | 1977-09-01 | 1979-03-21 | SCIENCE UNION ET Cie SOCIETE FRANCAISE DE RECHERCHE MEDICALE | Amino-acides cycliques, leurs procédés d'obtention et compositions pharmaceutiques les contenant |
Also Published As
Publication number | Publication date |
---|---|
IE32515B1 (en) | 1973-09-05 |
CH534138A (de) | 1973-02-28 |
ES356488A1 (es) | 1970-04-01 |
NL6809834A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1969-01-28 |
NO124205B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1972-03-20 |
IL30369A (en) | 1973-08-29 |
GB1191042A (en) | 1970-05-06 |
ES372358A1 (es) | 1971-10-16 |
ES372359A1 (es) | 1971-10-16 |
IE32515L (en) | 1969-01-26 |
SE364040B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1974-02-11 |
ES372357A1 (es) | 1972-01-16 |
FR1586146A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1970-02-13 |
FR7960M (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1970-06-01 |
BE718559A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1969-01-27 |
NL144484B (nl) | 1975-01-15 |
IL30369A0 (en) | 1968-09-26 |
JPS5019543B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-07-08 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2709820C2 (de) | N-(Mercaptoacyl)-L oder DL-cysteine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende mucolytische Mittel | |
DE1958918A1 (de) | Chemische Verfahren und Produkte | |
DE3529247A1 (de) | Verwendung von thienylharnstoffen und -isoharnstoffen als leistungsfoerdernde mittel bei tieren, neue thienylharnstoffe und -isoharnstoffe und ihre herstellung | |
DE1815452A1 (de) | Aryl- und Heteroaryl-methylthiopropionsaeuren und Verfahren zu deren Herstellung | |
DE2031233A1 (de) | Substituierte Phenylsulfamyl oder sulfonamido Sahcylsauren und deren Her stellung | |
DE1668420A1 (de) | N-substituierte Perfluoralkylsulfonamide | |
DE1768964A1 (de) | Chemische Verfahren und Produkte | |
EP0131221A2 (de) | Thioether, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
DE2122273C3 (de) | Substituierte Phenylessigsäureverbindungen, sie enthaltende entzündungshemmende, antipyretische und analgetische Mittel und Verfahren zu ihrer Herstellung | |
DE3105285A1 (de) | 2-amino-3-(hydroxy(phenyl)methyl)-phenylessigsaeure und ihre derivate, verfahren zur herstellung dieser verbindungen und therapeutische zubereitungen, welche diese verbindungen enthalten | |
DE2165752A1 (de) | Kosmetische Gemische auf Basis von Derivaten des Pyridin-N-oxyds, neue Verbindungen und Verfahren zur Herstellung dieser Verbindungen | |
DE2903615A1 (de) | Guajakacylester von mercaptopropionsaeurederivaten, verfahren zu ihrer herstellung und ihre therapeutische verwendung | |
DE3204854C2 (de) | 2-Amino-3-(halogenbenzoyl)-methylphenylessigsäuren, deren Ester und Salze, pharmazeutische Zubereitungen, welche diese Verbindungen enthalten | |
DE2711225A1 (de) | N-(mercaptoacyl)-histidine | |
DE2124103A1 (de) | Nitroimidazolderivate | |
CH625215A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
AT345781B (de) | Verfahren zur herstellung von neuen 3- aminomethyl-2-phenylbicyclo (2,2,2) octanen und -octenen sowie deren saeureadditionssalzen | |
DE2609574C3 (de) | 1 -^-Fluor-S-trifluormethylthiophenyD-piperazin, dessen Salze, Verfahren zu dessen Herstellung und Arzneimittel | |
DE1695790A1 (de) | Thiaminthionocarbonate vom Thioltyp | |
DE2051497C3 (de) | Thiamin-Derivate und ihre Säureadditionssalze | |
AT299910B (de) | Verfahren zur Herstellung von neuen Cysteinderivaten | |
DE1543757A1 (de) | Polythiosubstituierte Carbonsaeuren und Verfahren zu deren Herstellung | |
DE1543771A1 (de) | 2-Hydroxy-3-subst.-propyl-1,4'-naphthochinone und Verfahren zu deren Herstellung | |
DE1124496B (de) | Verfahren zur Herstellung von tertiaeren Aminen, ihren Saeureadditionssalzen und quaternaeren Ammoniumverbindungen | |
DE2501833A1 (de) | 4'-chlor-4-aethinylbiphenyl, verfahren zur herstellung dieser verbindung und diese verbindung enthaltende mittel |