DE1694208A1 - Thermoplastische Formmassen auf Basis gesaettigter Polyester - Google Patents
Thermoplastische Formmassen auf Basis gesaettigter PolyesterInfo
- Publication number
- DE1694208A1 DE1694208A1 DE19671694208 DE1694208A DE1694208A1 DE 1694208 A1 DE1694208 A1 DE 1694208A1 DE 19671694208 DE19671694208 DE 19671694208 DE 1694208 A DE1694208 A DE 1694208A DE 1694208 A1 DE1694208 A1 DE 1694208A1
- Authority
- DE
- Germany
- Prior art keywords
- thermoplastic molding
- molding compositions
- compositions according
- polyester
- contain
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000728 polyester Polymers 0.000 title claims description 24
- 238000009757 thermoplastic moulding Methods 0.000 title claims description 10
- 229920006395 saturated elastomer Polymers 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 title description 5
- -1 aromatic dicarboxylic acids Chemical class 0.000 claims description 19
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 11
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 10
- 239000012188 paraffin wax Substances 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- HHSPVTKDOHQBKF-UHFFFAOYSA-J calcium;magnesium;dicarbonate Chemical compound [Mg+2].[Ca+2].[O-]C([O-])=O.[O-]C([O-])=O HHSPVTKDOHQBKF-UHFFFAOYSA-J 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 239000011521 glass Substances 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- 229910044991 metal oxide Inorganic materials 0.000 claims description 3
- 150000004706 metal oxides Chemical class 0.000 claims description 3
- 239000000843 powder Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 239000001993 wax Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 150000002009 diols Chemical class 0.000 claims description 2
- 125000003700 epoxy group Chemical group 0.000 claims description 2
- 125000001033 ether group Chemical group 0.000 claims description 2
- 229910003480 inorganic solid Inorganic materials 0.000 claims description 2
- 239000002245 particle Substances 0.000 claims description 2
- 229920005862 polyol Polymers 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 claims 1
- 150000002118 epoxides Chemical class 0.000 claims 1
- 150000003077 polyols Chemical class 0.000 claims 1
- 239000008187 granular material Substances 0.000 description 15
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 12
- 238000002347 injection Methods 0.000 description 9
- 239000007924 injection Substances 0.000 description 9
- 235000019589 hardness Nutrition 0.000 description 8
- 238000007373 indentation Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000011575 calcium Substances 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 238000000465 moulding Methods 0.000 description 4
- 239000002667 nucleating agent Substances 0.000 description 4
- SDRZFSPCVYEJTP-UHFFFAOYSA-N 1-ethenylcyclohexene Chemical compound C=CC1=CCCCC1 SDRZFSPCVYEJTP-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 150000002924 oxiranes Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- HTJFSXYVAKSPNF-UHFFFAOYSA-N 2-[2-(oxiran-2-yl)ethyl]oxirane Chemical compound C1OC1CCC1CO1 HTJFSXYVAKSPNF-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001279 adipic acids Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 1
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/18—Oxygen-containing compounds, e.g. metal carbonyls
- C08K3/24—Acids; Salts thereof
- C08K3/26—Carbonates; Bicarbonates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/15—Heterocyclic compounds having oxygen in the ring
- C08K5/151—Heterocyclic compounds having oxygen in the ring having one oxygen atom in the ring
- C08K5/1515—Three-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Injection Moulding Of Plastics Or The Like (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19671694208 DE1694208A1 (de) | 1967-10-19 | 1967-10-19 | Thermoplastische Formmassen auf Basis gesaettigter Polyester |
| US762980A US3583935A (en) | 1967-10-19 | 1968-09-26 | Thermoplastic moulding compositions of saturated polyesters,epoxides and wax |
| NL6814375A NL6814375A (enExample) | 1967-10-19 | 1968-10-08 | |
| ES359003A ES359003A1 (es) | 1967-10-19 | 1968-10-09 | Procedimiento de obtencion de masas de moldeo termoplasti- cas a base de poliesteres saturados. |
| CH1557068A CH508685A (de) | 1967-10-19 | 1968-10-17 | Thermoplastische Formmassen auf Basis gesättigter Polyester |
| BR203258/68A BR6803258D0 (pt) | 1967-10-19 | 1968-10-18 | Composicoes termoplasticas moldaveis com base em poliesteres saturados |
| GB1239455D GB1239455A (enExample) | 1967-10-19 | 1968-10-21 | |
| FR1587553D FR1587553A (enExample) | 1967-10-19 | 1968-10-21 | |
| BE722638D BE722638A (enExample) | 1967-10-19 | 1968-10-21 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19671694208 DE1694208A1 (de) | 1967-10-19 | 1967-10-19 | Thermoplastische Formmassen auf Basis gesaettigter Polyester |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1694208A1 true DE1694208A1 (de) | 1971-04-08 |
Family
ID=5687785
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671694208 Pending DE1694208A1 (de) | 1967-10-19 | 1967-10-19 | Thermoplastische Formmassen auf Basis gesaettigter Polyester |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3583935A (enExample) |
| BE (1) | BE722638A (enExample) |
| BR (1) | BR6803258D0 (enExample) |
| CH (1) | CH508685A (enExample) |
| DE (1) | DE1694208A1 (enExample) |
| ES (1) | ES359003A1 (enExample) |
| FR (1) | FR1587553A (enExample) |
| GB (1) | GB1239455A (enExample) |
| NL (1) | NL6814375A (enExample) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1099567B (de) * | 1956-11-23 | 1961-02-16 | Hans G Nissen | Heizbarer, liegender zylindrischer Lagerbehaelter fuer fluessige oder thermoplastische Stoffe |
| DE1189106B (de) * | 1961-09-13 | 1965-03-18 | Ernst Otto Heise | Behaelter zum Transportieren und Schmelzen von Bitumen u. dgl. |
| DE1204249B (de) * | 1961-12-23 | 1965-11-04 | Asphalt Und Tiefbau G M B H De | Fahrbare Vorrichtung zum Transportieren und Schmelzen von Gussasphalt |
| DE1234253B (de) * | 1961-08-23 | 1967-02-16 | Westhydraulik Becker K G Masch | Vorrats- und Lagerbehaelter zum Aufbereiten von Bindemitteln fuer den Strassenbau |
| DE2363758A1 (de) * | 1972-12-28 | 1974-07-11 | Toray Industries | Polyestermasse |
| DE2501988A1 (de) * | 1975-01-18 | 1976-07-22 | Basf Ag | Formmassen mit verbesserten eigenschaften |
| DE2848719A1 (de) * | 1977-11-09 | 1979-05-17 | Teijin Ltd | Polyestermasse |
| EP0273149A3 (en) * | 1986-12-30 | 1989-02-08 | General Electric Company | Poly (cyclohexanedimethanol terephthalate) molding compositions |
| WO1994024201A1 (de) * | 1993-04-08 | 1994-10-27 | Du Pont De Nemours (Deutschland) Gmbh | Polyesterzusammensetzung |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3872040A (en) * | 1972-10-02 | 1975-03-18 | Ppg Industries Inc | Wax-containing powder coatings |
| GB1512516A (en) * | 1974-07-31 | 1978-06-01 | Ici Ltd | Polyester composition |
| DE2453577A1 (de) * | 1974-11-12 | 1976-05-13 | Zimmer Ag | Verfahren zur feststoff-polykondensation von linearen polyestern |
| AU527855B2 (en) * | 1978-10-09 | 1983-03-24 | Teijin Limited | Glass fiber-reinforced thermoplastic polyester composition |
| EP0057415B1 (en) * | 1981-01-30 | 1987-04-29 | Teijin Limited | Polyester resin composition |
| US4539352A (en) * | 1981-08-21 | 1985-09-03 | Ethyl Corporation | Injection-moldable thermoplastic polyester composition |
| US4486561A (en) * | 1981-08-21 | 1984-12-04 | Ethyl Corporation | Injection-moldable thermoplastic polyester composition |
| US4390649A (en) * | 1982-02-18 | 1983-06-28 | Allied Corporation | Injection moldable poly(ethylene terephthalate) |
-
1967
- 1967-10-19 DE DE19671694208 patent/DE1694208A1/de active Pending
-
1968
- 1968-09-26 US US762980A patent/US3583935A/en not_active Expired - Lifetime
- 1968-10-08 NL NL6814375A patent/NL6814375A/xx unknown
- 1968-10-09 ES ES359003A patent/ES359003A1/es not_active Expired
- 1968-10-17 CH CH1557068A patent/CH508685A/de not_active IP Right Cessation
- 1968-10-18 BR BR203258/68A patent/BR6803258D0/pt unknown
- 1968-10-21 FR FR1587553D patent/FR1587553A/fr not_active Expired
- 1968-10-21 BE BE722638D patent/BE722638A/xx unknown
- 1968-10-21 GB GB1239455D patent/GB1239455A/en not_active Expired
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1099567B (de) * | 1956-11-23 | 1961-02-16 | Hans G Nissen | Heizbarer, liegender zylindrischer Lagerbehaelter fuer fluessige oder thermoplastische Stoffe |
| DE1234253B (de) * | 1961-08-23 | 1967-02-16 | Westhydraulik Becker K G Masch | Vorrats- und Lagerbehaelter zum Aufbereiten von Bindemitteln fuer den Strassenbau |
| DE1189106B (de) * | 1961-09-13 | 1965-03-18 | Ernst Otto Heise | Behaelter zum Transportieren und Schmelzen von Bitumen u. dgl. |
| DE1204249B (de) * | 1961-12-23 | 1965-11-04 | Asphalt Und Tiefbau G M B H De | Fahrbare Vorrichtung zum Transportieren und Schmelzen von Gussasphalt |
| DE2363758A1 (de) * | 1972-12-28 | 1974-07-11 | Toray Industries | Polyestermasse |
| DE2501988A1 (de) * | 1975-01-18 | 1976-07-22 | Basf Ag | Formmassen mit verbesserten eigenschaften |
| DE2848719A1 (de) * | 1977-11-09 | 1979-05-17 | Teijin Ltd | Polyestermasse |
| EP0273149A3 (en) * | 1986-12-30 | 1989-02-08 | General Electric Company | Poly (cyclohexanedimethanol terephthalate) molding compositions |
| WO1994024201A1 (de) * | 1993-04-08 | 1994-10-27 | Du Pont De Nemours (Deutschland) Gmbh | Polyesterzusammensetzung |
Also Published As
| Publication number | Publication date |
|---|---|
| NL6814375A (enExample) | 1969-04-22 |
| ES359003A1 (es) | 1970-05-16 |
| US3583935A (en) | 1971-06-08 |
| BR6803258D0 (pt) | 1973-04-17 |
| FR1587553A (enExample) | 1970-03-20 |
| GB1239455A (enExample) | 1971-07-14 |
| CH508685A (de) | 1971-06-15 |
| BE722638A (enExample) | 1969-04-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1694208A1 (de) | Thermoplastische Formmassen auf Basis gesaettigter Polyester | |
| DE1945967C3 (de) | Polyester-SpritzguBformmasse | |
| DE1096600B (de) | Verfahren zur Herstellung ausgehaerteter Kunstharze durch Umsetzung von Epoxydgruppen aufweisenden Kunstharzen | |
| US3547873A (en) | Compositions of saturated polyesters,inorganic solids,and polyfunctional epoxides | |
| DE2124336B2 (de) | Thermoplastische Polyesterformmassen | |
| DE1694232A1 (de) | Titandioxydhaltige thermoplastische Polyesterformmassen | |
| ES358935A1 (es) | Procedimiento de fabricacion de masas termoplasticas de moldeo de poliesteres. | |
| DE1814148C3 (de) | Herstellung rasch kristallisierender Formmassen auf Basis gesättigter Polyester | |
| US3547872A (en) | Saturated polyesters containing cyclic epoxides and nucleating agents | |
| US3578623A (en) | Compositions of saturated polyesters,inorganic solids,and cyclic carbonates | |
| DE1954588C3 (de) | Polyester-Spritzgußmassen | |
| DE1694197A1 (de) | Thermoplastische Formmassen aus Polyestern | |
| DE1945101B2 (de) | Spritzgußformmasse aus Polyestern | |
| DE1769224C3 (de) | Herstellung rasch kristallisierender Formmassen auf Basis gesättigter Polyester | |
| DE1519155C3 (de) | Pulverförmiges und hitzehärtbares Überzugsmittel | |
| AT282965B (de) | Thermoplastische Formmassen aus Basis gesättigter Polyester, die Nukleierungsmittel enthalten | |
| DE1814149C3 (de) | Herstellung rasch kristallisierender Formmassen auf Basis gesättigter Polyester | |
| DE1950252A1 (de) | Thermoplastische Polyesterformmassen | |
| DE1794114C3 (de) | Herstellung rasch kristallisierender Formmassen auf Basis gesättigter Polyester | |
| DE2138789A1 (de) | Verfahren zur Herstellung von amorphen transparenten Formkorpern nach dem Spritz blasverfahren | |
| AT283752B (de) | Thermoplastische Formmassen auf Basis gesättigter Polyester | |
| DE1694242A1 (de) | Thermoplastische Formmassen auf Basis gesaettigter Polyester | |
| DE2149649A1 (de) | Thermoplastische polyesterformmassen | |
| DE1694190C3 (de) | Thermoplastische Formmassen | |
| DE2611691B1 (de) | Pulverfoermige UEberzugsmittel |