DE1618677A1 - Verfahren zur Herstellung von Tricyclohexylzinnhydroxyd - Google Patents
Verfahren zur Herstellung von TricyclohexylzinnhydroxydInfo
- Publication number
- DE1618677A1 DE1618677A1 DE19671618677 DE1618677A DE1618677A1 DE 1618677 A1 DE1618677 A1 DE 1618677A1 DE 19671618677 DE19671618677 DE 19671618677 DE 1618677 A DE1618677 A DE 1618677A DE 1618677 A1 DE1618677 A1 DE 1618677A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction mixture
- reaction
- hydroxide
- parts
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 26
- WCMMILVIRZAPLE-UHFFFAOYSA-M cyhexatin Chemical compound C1CCCCC1[Sn](C1CCCCC1)(O)C1CCCCC1 WCMMILVIRZAPLE-UHFFFAOYSA-M 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 22
- 239000011541 reaction mixture Substances 0.000 claims description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 15
- -1 tricyclohexyltin halide Chemical class 0.000 claims description 15
- 239000000243 solution Substances 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 13
- 239000004215 Carbon black (E152) Substances 0.000 claims description 12
- 229930195733 hydrocarbon Natural products 0.000 claims description 12
- 150000002430 hydrocarbons Chemical class 0.000 claims description 11
- 239000012044 organic layer Substances 0.000 claims description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 9
- 239000003085 diluting agent Substances 0.000 claims description 7
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 claims description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 238000001556 precipitation Methods 0.000 claims description 5
- 239000008096 xylene Substances 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 238000010790 dilution Methods 0.000 claims description 2
- 239000012895 dilution Substances 0.000 claims description 2
- 150000004679 hydroxides Chemical class 0.000 claims description 2
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 claims 1
- 150000001805 chlorine compounds Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000002562 thickening agent Substances 0.000 claims 1
- 239000000047 product Substances 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 108010021119 Trichosanthin Proteins 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000007818 Grignard reagent Substances 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 150000004795 grignard reagents Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 4
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- WMJMABVHDMRMJA-UHFFFAOYSA-M [Cl-].[Mg+]C1CCCCC1 Chemical compound [Cl-].[Mg+]C1CCCCC1 WMJMABVHDMRMJA-UHFFFAOYSA-M 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- QULMZVWEGVTWJY-UHFFFAOYSA-N dicyclohexyl(oxo)tin Chemical compound C1CCCCC1[Sn](=O)C1CCCCC1 QULMZVWEGVTWJY-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- CVNKFOIOZXAFBO-UHFFFAOYSA-J tin(4+);tetrahydroxide Chemical compound [OH-].[OH-].[OH-].[OH-].[Sn+4] CVNKFOIOZXAFBO-UHFFFAOYSA-J 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- VUFKMYLDDDNUJS-UHFFFAOYSA-N 2-(ethoxymethyl)oxolane Chemical compound CCOCC1CCCO1 VUFKMYLDDDNUJS-UHFFFAOYSA-N 0.000 description 1
- BTHLKLUTMYTDFM-UHFFFAOYSA-N 2-ethoxyoxane Chemical compound CCOC1CCCCO1 BTHLKLUTMYTDFM-UHFFFAOYSA-N 0.000 description 1
- JWUJQDFVADABEY-UHFFFAOYSA-N 2-methyltetrahydrofuran Chemical compound CC1CCCO1 JWUJQDFVADABEY-UHFFFAOYSA-N 0.000 description 1
- 125000004352 2-phenylcyclohexyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000854350 Enicospilus group Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- AQNQQHJNRPDOQV-UHFFFAOYSA-N bromocyclohexane Chemical compound BrC1CCCCC1 AQNQQHJNRPDOQV-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- BESRBWLUVPELTD-UHFFFAOYSA-K cyclohexyltin(3+);trichloride Chemical compound Cl[Sn](Cl)(Cl)C1CCCCC1 BESRBWLUVPELTD-UHFFFAOYSA-K 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- OBBQDLHBLQTARQ-UHFFFAOYSA-N hexan-1-amine;hydrate Chemical compound [OH-].CCCCCC[NH3+] OBBQDLHBLQTARQ-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- UNFUYWDGSFDHCW-UHFFFAOYSA-N monochlorocyclohexane Chemical compound ClC1CCCCC1 UNFUYWDGSFDHCW-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/22—Tin compounds
- C07F7/2224—Compounds having one or more tin-oxygen linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US538219A US3402189A (en) | 1966-03-29 | 1966-03-29 | Process for preparing tricyclohexyl tin hydroxide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1618677A1 true DE1618677A1 (de) | 1971-02-25 |
Family
ID=24145992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671618677 Pending DE1618677A1 (de) | 1966-03-29 | 1967-03-29 | Verfahren zur Herstellung von Tricyclohexylzinnhydroxyd |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3402189A (enExample) |
| AT (1) | AT275551B (enExample) |
| CH (1) | CH507989A (enExample) |
| DE (1) | DE1618677A1 (enExample) |
| DK (1) | DK129941B (enExample) |
| ES (1) | ES338558A1 (enExample) |
| FR (1) | FR1515649A (enExample) |
| GB (1) | GB1136534A (enExample) |
| IL (1) | IL27690A (enExample) |
| NL (1) | NL6704497A (enExample) |
| SE (1) | SE338774B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3435717A1 (de) * | 1984-09-28 | 1986-04-10 | Lentia GmbH Chem. u. pharm. Erzeugnisse - Industriebedarf, 8000 München | Verfahren zur herstellung von tricyclohexylzinnhydroxid |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL42501A (en) * | 1972-06-24 | 1976-12-31 | Oxon Italia Spa | Process for preparing tricyclohexyltin derivatives |
| US4174346A (en) * | 1976-01-30 | 1979-11-13 | Albright & Wilson Limited | Process for preparing organotin compounds |
| US4113758A (en) * | 1976-03-30 | 1978-09-12 | Albright & Wilson Ltd. | Process for preparing organotin halides |
| US4222950A (en) * | 1978-08-10 | 1980-09-16 | M&T Chemicals Inc. | Method for preparing triorganotin halide |
| IT1121958B (it) * | 1979-06-27 | 1986-04-23 | Oxon Italia Spa | Procedimento per ottenere tricicloesilstagno idrossido di elevata purezza con alte rese |
| EP0346506A1 (en) * | 1988-06-14 | 1989-12-20 | Yoshitomi Pharmaceutical Industries, Ltd. | Process for the fractional production of organotin compounds |
| US4923068A (en) * | 1989-02-07 | 1990-05-08 | Cdp Product Development Corporation | Automatic filter system |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3082236A (en) * | 1959-04-29 | 1963-03-19 | Wallace & Tiernan Inc | Peroxy esters of p-menthane hydroperoxides |
| GB1084076A (enExample) * | 1964-04-08 | 1900-01-01 |
-
1966
- 1966-03-29 US US538219A patent/US3402189A/en not_active Expired - Lifetime
-
1967
- 1967-03-26 IL IL27690A patent/IL27690A/en unknown
- 1967-03-28 ES ES338558A patent/ES338558A1/es not_active Expired
- 1967-03-28 DK DK160267AA patent/DK129941B/da not_active IP Right Cessation
- 1967-03-28 FR FR100377A patent/FR1515649A/fr not_active Expired
- 1967-03-29 DE DE19671618677 patent/DE1618677A1/de active Pending
- 1967-03-29 AT AT299367A patent/AT275551B/de active
- 1967-03-29 CH CH434767A patent/CH507989A/de not_active IP Right Cessation
- 1967-03-29 NL NL6704497A patent/NL6704497A/xx unknown
- 1967-03-29 GB GB14352/67A patent/GB1136534A/en not_active Expired
- 1967-03-29 SE SE04288/67A patent/SE338774B/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3435717A1 (de) * | 1984-09-28 | 1986-04-10 | Lentia GmbH Chem. u. pharm. Erzeugnisse - Industriebedarf, 8000 München | Verfahren zur herstellung von tricyclohexylzinnhydroxid |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1136534A (en) | 1968-12-11 |
| CH507989A (de) | 1971-05-31 |
| FR1515649A (fr) | 1968-03-01 |
| NL6704497A (enExample) | 1967-10-02 |
| SE338774B (enExample) | 1971-09-20 |
| IL27690A (en) | 1971-06-23 |
| DK129941B (da) | 1974-12-02 |
| US3402189A (en) | 1968-09-17 |
| ES338558A1 (es) | 1968-04-16 |
| AT275551B (de) | 1969-10-27 |
| DK129941C (enExample) | 1975-05-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2540210B2 (de) | Verfahren zur Herstellung von Organozinntrihalogeniden und sich davon ableitende Organozinn-Stabilisatoren | |
| DE1618677A1 (de) | Verfahren zur Herstellung von Tricyclohexylzinnhydroxyd | |
| DE2826498A1 (de) | In kohlenwasserstoffen loeslicher organomagnesiumkomplex und verfahren zu seiner herstellung | |
| DE1906401A1 (de) | Verfahren zur Herstellung von 4-Acyloxy-azetidin-2-onen | |
| DE1493222A1 (de) | Verfahren zur Herstellung von Diorganozinkverbindungen | |
| DE955417C (de) | Verfahren zur Herstellung von quartaeren Ammoniumsalzen | |
| DE2226774C3 (de) | Verfahren zur Herstellung von Distannanen der Formel R↓3↓Sn-Sn R↓3↓ | |
| DE3640383A1 (de) | Kohlenwasserstoff-loesliche metallorganische komplexe von magnesium und alkalimetallen sowie ein verfahren zu deren herstellung | |
| DE1261507B (de) | Verfahren zur Gewinnung von Trialkylphosphinen aus einem Reaktionsgemisch | |
| DE847900C (de) | Verfahren zur Herstellung von mindestens eine AEthergruppe enthaltenden tertiaeren und quaternaeren Diaminen | |
| DE1157617C2 (de) | Verfahren zur Herstellung von einheitlichen Zinnalkylverbindungen | |
| DE1223383B (de) | Verfahren zur Herstellung von Pentafluorophenylmagnesiumchlorid | |
| DE2460288C3 (de) | Verfahren zur Herstellung von Tricyclohexylzinnchlorid oder -bromid | |
| DE2227688A1 (de) | Verfahren zur Herstellung von Dialkylzinnoxid | |
| DE2615351C2 (de) | Organomagnesiumkomplexe und Verfahren zu ihrer Herstellung | |
| DE1272291B (de) | Verfahren zur Herstellung von Triorganozinnsulfaten und -sulfiten | |
| DE2414878A1 (de) | Verfahren zur herstellung von 1.1.3.3tetramethyldisiloxan | |
| DE1568667A1 (de) | Cyclopolysiloxane sowie Verfahren zu ihrer Herstellung | |
| DE1568448A1 (de) | Verfahren zur Herstellung von Zinn-Dialkyl-Verbindungen | |
| DE1271114B (de) | Verfahren zur Herstellung von Tricyclohexylzinnchlorid oder -bromid | |
| DE1618678A1 (de) | Verfahren zur Herstellung eines Diphenylsilandiols | |
| DE1252680B (de) | Verfahren zur Herstellung von Phosphinsäureestern | |
| DE1908883A1 (de) | Verfahren zur Herstellung von Dibutylzinnmaleat | |
| EP1284253A2 (de) | Verfahren zur Herstellung von Monochlorkohlenwasserstoffen mit hoher Isomerenreinheit | |
| DE1102735B (de) | Verfahren zur Herstellung von Titan und Aluminium enthaltenden organischen Komplexverbindungen |