DE1592677B1 - Verfahren zur Herstellung eines gekoernten Duengemittels - Google Patents
Verfahren zur Herstellung eines gekoernten DuengemittelsInfo
- Publication number
- DE1592677B1 DE1592677B1 DE19661592677 DE1592677A DE1592677B1 DE 1592677 B1 DE1592677 B1 DE 1592677B1 DE 19661592677 DE19661592677 DE 19661592677 DE 1592677 A DE1592677 A DE 1592677A DE 1592677 B1 DE1592677 B1 DE 1592677B1
- Authority
- DE
- Germany
- Prior art keywords
- urea
- melt
- percent
- quaternary ammonium
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003337 fertilizer Substances 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 238000000034 method Methods 0.000 title description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 22
- 239000004202 carbamide Substances 0.000 claims description 22
- 239000004009 herbicide Substances 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 10
- 230000002363 herbicidal effect Effects 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- 239000000155 melt Substances 0.000 claims description 5
- 231100001184 nonphytotoxic Toxicity 0.000 claims description 4
- 239000003630 growth substance Substances 0.000 claims description 3
- UHZZMRAGKVHANO-UHFFFAOYSA-M chlormequat chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 10
- 241000196324 Embryophyta Species 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 101000742062 Bos taurus Protein phosphatase 1G Proteins 0.000 description 3
- 239000005574 MCPA Substances 0.000 description 3
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- -1 methyl- Chemical group 0.000 description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000005575 MCPB Substances 0.000 description 2
- 101150039283 MCPB gene Proteins 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000011552 falling film Substances 0.000 description 2
- 230000004720 fertilization Effects 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- FNQXFLGLLXHONX-UHFFFAOYSA-N 2-chloro-2-phenoxybutanoic acid Chemical compound CCC(Cl)(C(O)=O)OC1=CC=CC=C1 FNQXFLGLLXHONX-UHFFFAOYSA-N 0.000 description 1
- RORFIYBSDKQWBH-UHFFFAOYSA-N 2-chloro-2-phenoxypropanoic acid Chemical compound OC(=O)C(Cl)(C)OC1=CC=CC=C1 RORFIYBSDKQWBH-UHFFFAOYSA-N 0.000 description 1
- 239000001763 2-hydroxyethyl(trimethyl)azanium Substances 0.000 description 1
- LLWADFLAOKUBDR-UHFFFAOYSA-N 2-methyl-4-chlorophenoxybutyric acid Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- DISYDHABSCTQFK-UHFFFAOYSA-N 7-methoxy-2,3-dihydrochromen-4-one Chemical compound O=C1CCOC2=CC(OC)=CC=C21 DISYDHABSCTQFK-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000019743 Choline chloride Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- YUWBVKYVJWNVLE-UHFFFAOYSA-N [N].[P] Chemical compound [N].[P] YUWBVKYVJWNVLE-UHFFFAOYSA-N 0.000 description 1
- RDXARWSSOJYNLI-UHFFFAOYSA-N [P].[K] Chemical class [P].[K] RDXARWSSOJYNLI-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- PPBAJDRXASKAGH-UHFFFAOYSA-N azane;urea Chemical compound N.NC(N)=O PPBAJDRXASKAGH-UHFFFAOYSA-N 0.000 description 1
- NGLMYMJASOJOJY-UHFFFAOYSA-O azanium;calcium;nitrate Chemical compound [NH4+].[Ca].[O-][N+]([O-])=O NGLMYMJASOJOJY-UHFFFAOYSA-O 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- ZCMUUOGAFPDEPA-UHFFFAOYSA-M bromomethyl(trimethyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)CBr ZCMUUOGAFPDEPA-UHFFFAOYSA-M 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- SGMZJAMFUVOLNK-UHFFFAOYSA-M choline chloride Chemical compound [Cl-].C[N+](C)(C)CCO SGMZJAMFUVOLNK-UHFFFAOYSA-M 0.000 description 1
- 229960003178 choline chloride Drugs 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- IDVSELVVGYIOEX-UHFFFAOYSA-M ethenyl(trimethyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)C=C IDVSELVVGYIOEX-UHFFFAOYSA-M 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- FMMTUUIZTMQIFC-UHFFFAOYSA-M trimethyl(prop-2-enyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)CC=C FMMTUUIZTMQIFC-UHFFFAOYSA-M 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Chemical group 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05C—NITROGENOUS FERTILISERS
- C05C9/00—Fertilisers containing urea or urea compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1148065A CH486399A (de) | 1964-08-10 | 1965-08-16 | Verfahren zur Herstellung von Düngemitteln |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1592677B1 true DE1592677B1 (de) | 1971-12-02 |
Family
ID=4373904
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661592677 Pending DE1592677B1 (de) | 1965-08-16 | 1966-08-11 | Verfahren zur Herstellung eines gekoernten Duengemittels |
Country Status (6)
| Country | Link |
|---|---|
| AT (1) | AT269913B (cg-RX-API-DMAC7.html) |
| BE (1) | BE685470A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1592677B1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK117154B (cg-RX-API-DMAC7.html) |
| GB (1) | GB1113735A (cg-RX-API-DMAC7.html) |
| NL (1) | NL6611457A (cg-RX-API-DMAC7.html) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU5603486A (en) * | 1985-04-11 | 1986-10-16 | Commonwealth Scientific And Industrial Research Organisation | Fertilizing in conjunction with algicides |
| US7776125B2 (en) * | 2006-05-31 | 2010-08-17 | Oms Investments, Inc. | Composition and method for inhibiting caking in a urea containing fertilizer |
| MX2009008934A (es) | 2007-02-26 | 2009-08-28 | Dow Agrosciences Llc | Proceso para la preparacion de algunas sulfiliminas sustituidas. |
| EP4015492A1 (en) * | 2020-12-21 | 2022-06-22 | Yara International ASA | Method for the manufacture of a urea-based composition comprising the addition of an additive in an aqueous form |
| CN116235733B (zh) * | 2023-02-10 | 2025-05-23 | 河南省莱恩坪安园林植保有限公司 | 一种覆盖式草坪专用生长网 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT222145B (de) * | 1960-12-15 | 1962-07-10 | Chemie Linz Ag | Stickstoffhaltiges anorganisches oder organisches Düngemittel mit einer die Standfestigkeit der Getreidepflanzen erhöhenden Wirkung |
-
1966
- 1966-08-11 DE DE19661592677 patent/DE1592677B1/de active Pending
- 1966-08-12 DK DK413966A patent/DK117154B/da unknown
- 1966-08-12 GB GB3626366A patent/GB1113735A/en not_active Expired
- 1966-08-12 BE BE685470D patent/BE685470A/xx unknown
- 1966-08-15 NL NL6611457A patent/NL6611457A/xx unknown
- 1966-08-16 AT AT777066A patent/AT269913B/de active
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT222145B (de) * | 1960-12-15 | 1962-07-10 | Chemie Linz Ag | Stickstoffhaltiges anorganisches oder organisches Düngemittel mit einer die Standfestigkeit der Getreidepflanzen erhöhenden Wirkung |
| FR1308179A (fr) * | 1960-12-15 | 1962-11-03 | Basf Ag | Engrais azotés minéraux ou organiques |
Also Published As
| Publication number | Publication date |
|---|---|
| BE685470A (cg-RX-API-DMAC7.html) | 1967-01-16 |
| GB1113735A (en) | 1968-05-15 |
| DK117154B (da) | 1970-03-23 |
| AT269913B (de) | 1969-04-10 |
| NL6611457A (cg-RX-API-DMAC7.html) | 1967-02-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0529473A1 (de) | Ammonium- oder harnstoffhaltige Düngemittel und Verfahren zu ihrer Herstellung | |
| DE830430C (de) | Unkrautvertilgung | |
| DE69123863T2 (de) | Glyphosatformulierungen | |
| DE1592753A1 (de) | Aus einer Harnstoff-Formaldehyd-Loesung hergestelltes Duengemittel sowie Verfahren zur Herstellung desselben | |
| EP0096787B1 (de) | Graswuchshemmende Mittel | |
| DE3586371T2 (de) | Verfahren zur behandlung des bodens und zusammensetzung zur konservierung von stickstoff im boden. | |
| DE1592677B1 (de) | Verfahren zur Herstellung eines gekoernten Duengemittels | |
| DE2702284C2 (de) | Stickstoffdüngemittel | |
| EP0289757A2 (de) | Nitrifikationshemmendes Mittel | |
| DE1667982A1 (de) | Netzmittelzusammensetzung | |
| EP1211942B1 (de) | Verfahren zur herstellung von polyvinylpyrrolidon-iod in wässriger lösung | |
| DD156890A5 (de) | Herbizide zusammensetzungen | |
| EP1106591B1 (de) | Düngemittelformulierungen die Polysulfonsäuren enthalten | |
| DE1542972C3 (de) | Herbicide Mittel | |
| AT396785B (de) | Blattdünger und spritzbrühe zur blattdüngung enthaltend pflanzennährstoffe und eine säure | |
| DE1695915C3 (de) | Verfahren zur Verhinderung der Nitrifikation von Ammonium-Stickstoff | |
| DE1296455B (de) | Verfahren zur Foerderung des Pflanzenwachstums | |
| DE2739618A1 (de) | Organisches duengemittel aus kaffeehaeutchen und/oder erdnusshaeutchen | |
| DD230523A3 (de) | Mittel zur hemmung bzw. regelung der nitrifikation von ammoniumstickstoff in kulturboeden | |
| DE1592673C (de) | Verfahren zur Herstellung eines ge körnten Dungemitteis aus Harnstoff und einem Salz einer quaternaren Ammoniumbase | |
| DE2240047C3 (de) | Verwendung von Kationenaustauschern als Stickstoffdüngemittel | |
| CH418055A (de) | Beständiges Herbizid | |
| DE1592688C3 (de) | Verfahren zur Herstellung eines cyanationenfreien Düngemittels mit einem Gehalt von mindestens etwa 95% Biuret | |
| AT358080B (de) | Spurenelemente enthaltender pflanzenkunst- duenger | |
| DE1592673A1 (de) | Verfahren zur Herstellung eines prillierten Duengemittels |