DE1544375B1 - Wasserunloesliche Monoazofarbstoffe - Google Patents
Wasserunloesliche MonoazofarbstoffeInfo
- Publication number
- DE1544375B1 DE1544375B1 DE19651544375 DE1544375A DE1544375B1 DE 1544375 B1 DE1544375 B1 DE 1544375B1 DE 19651544375 DE19651544375 DE 19651544375 DE 1544375 A DE1544375 A DE 1544375A DE 1544375 B1 DE1544375 B1 DE 1544375B1
- Authority
- DE
- Germany
- Prior art keywords
- blue
- red
- violet
- parts
- ruby
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 title claims description 23
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 2
- 239000010979 ruby Substances 0.000 description 19
- 229910001750 ruby Inorganic materials 0.000 description 19
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- -1 substituted alkyl radicals Chemical class 0.000 description 12
- 244000172533 Viola sororia Species 0.000 description 11
- 230000008878 coupling Effects 0.000 description 10
- 238000010168 coupling process Methods 0.000 description 10
- 238000005859 coupling reaction Methods 0.000 description 10
- 239000004952 Polyamide Substances 0.000 description 9
- 229920002647 polyamide Polymers 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 7
- 235000005811 Viola adunca Nutrition 0.000 description 7
- 240000009038 Viola odorata Species 0.000 description 7
- 235000013487 Viola odorata Nutrition 0.000 description 7
- 235000002254 Viola papilionacea Nutrition 0.000 description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 7
- 229920000728 polyester Polymers 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000004040 coloring Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- LZDSILRDTDCIQT-UHFFFAOYSA-N dinitrogen trioxide Chemical compound [O-][N+](=O)N=O LZDSILRDTDCIQT-UHFFFAOYSA-N 0.000 description 4
- 229940081735 acetylcellulose Drugs 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229920002301 cellulose acetate Polymers 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 239000010981 turquoise Substances 0.000 description 3
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- YLNDNABNWASMFD-UHFFFAOYSA-N 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)C=CN1C YLNDNABNWASMFD-UHFFFAOYSA-N 0.000 description 2
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 150000008049 diazo compounds Chemical class 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 2
- HYVGFUIWHXLVNV-UHFFFAOYSA-N 2-(n-ethylanilino)ethanol Chemical compound OCCN(CC)C1=CC=CC=C1 HYVGFUIWHXLVNV-UHFFFAOYSA-N 0.000 description 1
- FENJKTQEFUPECW-UHFFFAOYSA-N 3-anilinopropanenitrile Chemical compound N#CCCNC1=CC=CC=C1 FENJKTQEFUPECW-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 244000154870 Viola adunca Species 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 238000006149 azo coupling reaction Methods 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000006232 ethoxy propyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- PEMGGJDINLGTON-UHFFFAOYSA-N n-(3-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(N)=C1 PEMGGJDINLGTON-UHFFFAOYSA-N 0.000 description 1
- VSHTWPWTCXQLQN-UHFFFAOYSA-N n-butylaniline Chemical compound CCCCNC1=CC=CC=C1 VSHTWPWTCXQLQN-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- HVZWVEKIQMJYIK-UHFFFAOYSA-N nitryl chloride Chemical compound [O-][N+](Cl)=O HVZWVEKIQMJYIK-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B44/00—Azo dyes containing onium groups
- C09B44/10—Azo dyes containing onium groups containing cyclammonium groups attached to an azo group by a carbon atom of the ring system
- C09B44/20—Thiazoles or hydrogenated thiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0082343 | 1965-06-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1544375B1 true DE1544375B1 (de) | 1969-12-11 |
Family
ID=6981468
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651544375 Pending DE1544375B1 (de) | 1965-06-10 | 1965-06-10 | Wasserunloesliche Monoazofarbstoffe |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3455898A (enExample) |
| AT (1) | AT256279B (enExample) |
| DE (1) | DE1544375B1 (enExample) |
| NL (1) | NL6608032A (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE756638A (fr) * | 1969-09-27 | 1971-03-25 | Basf Ag | Nouveaux colorants monoazoiques insolubles dans l'eau de la serie du benzisothiazole |
| US3985726A (en) * | 1970-08-07 | 1976-10-12 | Ciba-Geigy Ag | Benzisothiazole and indazole azo compounds |
| US4052379A (en) * | 1975-12-18 | 1977-10-04 | Eastman Kodak Company | Dyes from trifluoromethyl-2-aminobenzothiazole diazo components |
| DE2507460C3 (de) * | 1975-02-21 | 1979-01-25 | Basf Ag, 6700 Ludwigshafen | Azofarbstoffe mit Benzisothiazol-Diazokomponenten, ihre Herstellung und Verwendung zum Färben von synthetischen und halbsynthetischen organischen Fasern |
| DE2524481A1 (de) * | 1975-06-03 | 1976-12-23 | Hoechst Ag | Verfahren zum faerben von synthetischen fasermaterialien |
| DE2807933A1 (de) * | 1978-02-24 | 1979-08-30 | Hoechst Ag | Photopolymerisierbares gemisch |
| DE2837960A1 (de) * | 1978-08-31 | 1980-03-13 | Bayer Ag | Azofarbstoffe |
| DE2849471A1 (de) * | 1978-11-15 | 1980-06-04 | Basf Ag | Azofarbstoffe mit heterocyclischen diazokomponenten |
| US4464181A (en) * | 1982-02-12 | 1984-08-07 | Basf Aktiengesellschaft | Mixtures of benzisothiazole mono-azo dyes for cellulose acetate |
| DE3345417A1 (de) * | 1983-12-15 | 1985-07-04 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von aetzdrucken |
| DE3425127A1 (de) * | 1984-07-07 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Azofarbstoffe |
| IT1218151B (it) * | 1986-08-01 | 1990-04-12 | Sandoz Ag | Composti monoazoici,loro preparazione e loro impiego come coloranti |
| DE3821338A1 (de) * | 1988-06-24 | 1989-12-28 | Bayer Ag | Mischungen blauer dispersionsazofarbstoffe |
| EP0434609B1 (de) * | 1989-12-06 | 1994-09-21 | Ciba-Geigy Ag | Verfahren zum Färben von Polyacrylnitrilmaterialien |
| CA2074745A1 (en) * | 1991-07-31 | 1993-02-01 | Hitoshi Koshida | Dyestuff for heat sensitive transfer record and transfer sheet containing same |
| US5691458A (en) * | 1996-09-18 | 1997-11-25 | Polaroid Corporation | Benzoisothiazole azo dyes |
| US7497878B2 (en) * | 2005-06-30 | 2009-03-03 | L'oreal, S.A. | Azo dyes containing a sulphonamide or amide function for the dyeing of human keratin fibers and method of dyeing and dyeing compositions containing them |
| CN100404630C (zh) * | 2006-08-09 | 2008-07-23 | 杭州吉华化工有限公司 | 一种分散染料的混合物及其制品 |
| CN101768375B (zh) * | 2009-12-31 | 2014-03-12 | 上虞市金冠化工有限公司 | 一种黑色分散染料组合物 |
Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1065542B (de) * | 1959-09-17 | Eastman Kodak Company, Rochester, N. Y. (V. St. A.) | Verfahren zur Herstellung von Monoazofarbstoffe!! | |
| DE1069313B (enExample) * | 1959-11-19 | |||
| DE1113772B (de) * | 1958-02-05 | 1961-09-14 | Sandoz Ag | Verfahren zur Herstellung von Monoazofarbstoffen der Benzothiazolreihe |
| US3057848A (en) * | 1957-09-25 | 1962-10-09 | Interchem Corp | 2-amino-4, 6-dinitrobenzothiazole and azo dyestuffs therefrom |
| GB944250A (en) * | 1960-06-28 | 1963-12-11 | Yorkshire Dyeware & Chem Co | Improvements in and relating to the manufacture of azo dyes and the dyeing of synthetic thermoplastic material therewith |
| FR1368033A (fr) * | 1963-09-04 | 1964-07-24 | Eastman Kodak Co | Nouveaux colorants azoïques |
| US3161631A (en) * | 1962-10-22 | 1964-12-15 | Eastman Kodak Co | Benzothiazole azo compounds containing a dicarboximido radical |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2149051A (en) * | 1934-05-15 | 1939-02-28 | Gen Aniline Works Inc | Water-insoluble azo dyestuffs |
| US2349899A (en) * | 1938-07-28 | 1944-05-30 | Gen Aniline & Film Corp | Production of azo dyestuffs |
| US2373700A (en) * | 1940-06-29 | 1945-04-17 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2785157A (en) * | 1952-11-05 | 1957-03-12 | Eastman Kodak Co | Benzothiazoleazoaniline compounds |
| IT545975A (enExample) * | 1954-12-15 | |||
| US2891942A (en) * | 1955-07-13 | 1959-06-23 | Saul & Co | Water-insoluble monoazo dyestuffs |
-
1965
- 1965-06-10 DE DE19651544375 patent/DE1544375B1/de active Pending
-
1966
- 1966-06-03 US US554989A patent/US3455898A/en not_active Expired - Lifetime
- 1966-06-09 NL NL6608032A patent/NL6608032A/xx unknown
- 1966-06-10 AT AT554366A patent/AT256279B/de active
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1065542B (de) * | 1959-09-17 | Eastman Kodak Company, Rochester, N. Y. (V. St. A.) | Verfahren zur Herstellung von Monoazofarbstoffe!! | |
| DE1069313B (enExample) * | 1959-11-19 | |||
| US3057848A (en) * | 1957-09-25 | 1962-10-09 | Interchem Corp | 2-amino-4, 6-dinitrobenzothiazole and azo dyestuffs therefrom |
| DE1113772B (de) * | 1958-02-05 | 1961-09-14 | Sandoz Ag | Verfahren zur Herstellung von Monoazofarbstoffen der Benzothiazolreihe |
| GB944250A (en) * | 1960-06-28 | 1963-12-11 | Yorkshire Dyeware & Chem Co | Improvements in and relating to the manufacture of azo dyes and the dyeing of synthetic thermoplastic material therewith |
| US3161631A (en) * | 1962-10-22 | 1964-12-15 | Eastman Kodak Co | Benzothiazole azo compounds containing a dicarboximido radical |
| FR1368033A (fr) * | 1963-09-04 | 1964-07-24 | Eastman Kodak Co | Nouveaux colorants azoïques |
Also Published As
| Publication number | Publication date |
|---|---|
| US3455898A (en) | 1969-07-15 |
| AT256279B (de) | 1967-08-10 |
| NL6608032A (enExample) | 1966-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1544375B1 (de) | Wasserunloesliche Monoazofarbstoffe | |
| DE1544391A1 (de) | Verfahren zur Herstellung wasserunloeslicher Monoazofarbstoffe | |
| DE1644069C3 (de) | Wasserunlösliche Monoazofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE1940685C3 (de) | Dispersionsfarbstoffe der Amino pyrazolreihe, Verfahren zu ihrer Her Stellung und Verwendung | |
| DE1644150A1 (de) | Wasserunloesliche Azofarbstoffe und Verfahren zu deren Herstellung und Verwendung | |
| EP0084150B1 (de) | Benzisothiazolazofarbstoffe | |
| DE1544375C (de) | Wasserunlösliche Monoazofarbstoffe | |
| DE1544392A1 (de) | Verfahren zur Herstellung wasserunloeslicher Monoazofarbstoffe | |
| DE1544368C (de) | Wasserunlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1544391C (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| DE1644074B2 (de) | Sulfonsäuregruppenhaltige Monoazofarbstoffe, Verfahren zu deren Herstellung und Farbstoffzubereitungen | |
| DE1644061C3 (de) | Wasserunlösliche Azofarbstoffe der Benzisothiazolreihe, ihre Herstellung und Verwendung für die Herstellung von Farbstoffzubereitungen | |
| DE2116315A1 (de) | Azoverbindungen | |
| DE1644051A1 (de) | Verfahren zur Herstellung neuer,wasserunloeslicher Monoazofarbstoffe | |
| DE1769237C (de) | In Wasser schwerlösliche Monoazo farbstoffe Ausscheidung aus 1282212 | |
| DE1231364B (de) | Verfahren zur Herstellung wasserunloeslicher Azofarbstoffe | |
| DE1794201A1 (de) | Neue wasserunloesliche Monoazofarbstoffe | |
| DE686053C (de) | Verfahren zur Herstellung von o-Oxyazofarbstoffen | |
| DE1644094C3 (de) | Wasserunlösliche Azofarbstoffe | |
| DE1644122C3 (de) | Sulfonsäure- und carbonsäuregruppenfreie wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE1544368A1 (de) | Verfahren zur Herstellung wasserunloeslicher Monoazofarbstoffe | |
| DE1959774A1 (de) | Disazofarbstoffe | |
| DE1644061A1 (de) | Wasserloesliche Azofarbstoffe der Benzisothiazolreihe und ihre Herstellung | |
| DE1221746B (de) | Verfahren zur Herstellung wasserunloeslicher Monoazofarbstoffe | |
| DE1917691A1 (de) | Wasserunloesliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung |