DE1543331A1 - Verfahren zur Herstellung von N,N-disubstituierten p-Alkylmercaptoanilinen - Google Patents
Verfahren zur Herstellung von N,N-disubstituierten p-AlkylmercaptoanilinenInfo
- Publication number
- DE1543331A1 DE1543331A1 DE19661543331 DE1543331A DE1543331A1 DE 1543331 A1 DE1543331 A1 DE 1543331A1 DE 19661543331 DE19661543331 DE 19661543331 DE 1543331 A DE1543331 A DE 1543331A DE 1543331 A1 DE1543331 A1 DE 1543331A1
- Authority
- DE
- Germany
- Prior art keywords
- disubstituted
- parts
- anilines
- aniline
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229910052757 nitrogen Inorganic materials 0.000 title claims description 12
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 3
- 150000003462 sulfoxides Chemical class 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 150000001448 anilines Chemical class 0.000 claims description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 150000003951 lactams Chemical class 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 2
- 150000003141 primary amines Chemical class 0.000 claims description 2
- 150000003335 secondary amines Chemical class 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- -1 N, N-disubstituted anilines Chemical class 0.000 description 7
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- VDQQJMHXZCMNMU-UHFFFAOYSA-N 1-phenylpyrrolidine Chemical compound C1CCCN1C1=CC=CC=C1 VDQQJMHXZCMNMU-UHFFFAOYSA-N 0.000 description 2
- VVBLNCFGVYUYGU-UHFFFAOYSA-N 4,4'-Bis(dimethylamino)benzophenone Chemical compound C1=CC(N(C)C)=CC=C1C(=O)C1=CC=C(N(C)C)C=C1 VVBLNCFGVYUYGU-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 150000003857 carboxamides Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LOWMYOWHQMKBTM-UHFFFAOYSA-N 1-butylsulfinylbutane Chemical compound CCCCS(=O)CCCC LOWMYOWHQMKBTM-UHFFFAOYSA-N 0.000 description 1
- WFJXYIUAMJAURQ-UHFFFAOYSA-N 2-propan-2-ylsulfinylpropane Chemical compound CC(C)S(=O)C(C)C WFJXYIUAMJAURQ-UHFFFAOYSA-N 0.000 description 1
- WYRNRZQRKCXPLA-UHFFFAOYSA-N 3-(n-ethylanilino)propanenitrile Chemical compound N#CCCN(CC)C1=CC=CC=C1 WYRNRZQRKCXPLA-UHFFFAOYSA-N 0.000 description 1
- FHQRDEDZJIFJAL-UHFFFAOYSA-N 4-phenylmorpholine Chemical compound C1COCCN1C1=CC=CC=C1 FHQRDEDZJIFJAL-UHFFFAOYSA-N 0.000 description 1
- MQHMPIIBHDVCGG-UHFFFAOYSA-N COCCC=1C=C(C=CC1)NCC Chemical compound COCCC=1C=C(C=CC1)NCC MQHMPIIBHDVCGG-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000004816 dichlorobenzenes Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- CCAFPWNGIUBUSD-UHFFFAOYSA-N diethyl sulfoxide Chemical compound CCS(=O)CC CCAFPWNGIUBUSD-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 230000004992 fission Effects 0.000 description 1
- 150000002466 imines Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DEB0085662 | 1966-02-04 |
Publications (1)
Publication Number | Publication Date |
---|---|
DE1543331A1 true DE1543331A1 (de) | 1969-08-07 |
Family
ID=6983015
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19661543331 Pending DE1543331A1 (de) | 1966-02-04 | 1966-02-04 | Verfahren zur Herstellung von N,N-disubstituierten p-Alkylmercaptoanilinen |
Country Status (5)
Country | Link |
---|---|
BE (1) | BE693439A (en:Method) |
CH (1) | CH477422A (en:Method) |
DE (1) | DE1543331A1 (en:Method) |
FR (1) | FR1510363A (en:Method) |
GB (1) | GB1175002A (en:Method) |
Families Citing this family (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5145970A (en) * | 1990-10-24 | 1992-09-08 | Ciba-Geigy Corporation | Stabilizers derived from 3,5-dialkyl-4-aminobenzenethiol |
-
1966
- 1966-02-04 DE DE19661543331 patent/DE1543331A1/de active Pending
-
1967
- 1967-01-25 CH CH110367A patent/CH477422A/de not_active IP Right Cessation
- 1967-01-31 BE BE693439D patent/BE693439A/xx unknown
- 1967-02-03 GB GB527667A patent/GB1175002A/en not_active Expired
- 1967-02-03 FR FR93579A patent/FR1510363A/fr not_active Expired
Also Published As
Publication number | Publication date |
---|---|
CH477422A (de) | 1969-08-31 |
BE693439A (en:Method) | 1967-07-31 |
GB1175002A (en) | 1969-12-23 |
FR1510363A (fr) | 1968-01-19 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE69206745T2 (de) | Herstellung von neopentylglycol | |
DE2439879A1 (de) | Verfahren zur oxidation von olefinverbindungen | |
DE2114887C3 (de) | Verfahren zur Herstellung von substituierten 1 ^-Dihydro-1-hydroxy-2-iminopyrimidinen | |
DE68914956T2 (de) | Methode zur Herstellung von Dialkyl- und Diallyldicarbonaten. | |
DE1229102B (de) | Verfahren zur Herstellung von Monochlor-9-thiabicyclo-2-nonenen sowie deren 9-Oxyden und 9, 9-Dioxyden | |
DE2331878B2 (de) | Verfahren zur herstellung von diphenylamin und dessen derivaten | |
DE1543331A1 (de) | Verfahren zur Herstellung von N,N-disubstituierten p-Alkylmercaptoanilinen | |
EP0006180B1 (de) | 3-Phenoxybenzylidenamine und 3-Benzylbenzylidenamine, ein Verfahren zu deren Herstellung sowie deren Verwendung zur Herstellung der entsprechenden Aldehyde | |
DE2121325C2 (de) | Verfahren zur Herstellung von Methoxypropionitril | |
DE2060197C3 (de) | Verfahren zur Herstellung von 2-Aminobenzothiazol und dessen N-Alkylsubstitutionsprodukten | |
DE1060397B (de) | Verfahren zur Herstellung von metallorganischen Verbindungen des Nickels | |
DE958922C (de) | Verfahren zur Dimerisierung von ª-Methylenglutarsaeuredinitril und ª-Methylglutaconsaeuredinitril | |
DE2231097A1 (de) | Verfahren zur herstellung von 5-cyan-3,4-dichlorisothiazol | |
DE2655794A1 (de) | Verfahren zur herstellung von aethylencyanhydrin | |
DE1190944B (de) | Verfahren zur Herstellung von heterocyclischen N-Vinylverbindungen | |
DE951933C (de) | Verfahren zur Herstellung von organischen Hydroxylaminverbindungen | |
DE2306335C3 (de) | Verfahren zur Herstellung von Dichloracetaldehyd | |
DE1793319C3 (de) | Verfahren zur Herstellung von Allylruthenlumtricarbonylhalogenlden | |
DE2429757C3 (de) | Verfahren zur Herstellung von 3-Hexin-1-ol | |
DE3149653A1 (de) | Verfahren zur herstellung von reinem 2,5-dihydroxy-1,4-dithian | |
DE952088C (de) | Verfahren zur Herstellung von Oximen | |
DE1018414B (de) | Verfahren zur Herstellung von Thiophosphinsaeurehalogeniden | |
DE2834852A1 (de) | Verfahren zur herstellung von 2-imino- arylenothiazolin-verbindungen | |
DE963519C (de) | Verfahren zur Herstellung von N, N'-Dibenzyl-aethylendiamin | |
DE894243C (de) | Verfahren zur Herstellung von Carbonsaeureamiden oder Carbonsaeuren bzw. Thioamiden |