DE1445225B2 - Verfahren zur polymerisation von monoalpha olefinen mit drei oder mehr kohlenstoffatomen - Google Patents
Verfahren zur polymerisation von monoalpha olefinen mit drei oder mehr kohlenstoffatomenInfo
- Publication number
- DE1445225B2 DE1445225B2 DE19601445225 DE1445225A DE1445225B2 DE 1445225 B2 DE1445225 B2 DE 1445225B2 DE 19601445225 DE19601445225 DE 19601445225 DE 1445225 A DE1445225 A DE 1445225A DE 1445225 B2 DE1445225 B2 DE 1445225B2
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- polymerization
- olefins
- antimony
- arsenic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000006116 polymerization reaction Methods 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 8
- 150000001336 alkenes Chemical class 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 19
- 239000003054 catalyst Substances 0.000 claims description 16
- 229910052751 metal Inorganic materials 0.000 claims description 15
- 239000002184 metal Substances 0.000 claims description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 14
- 150000002739 metals Chemical class 0.000 claims description 10
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 claims description 8
- 229910052787 antimony Inorganic materials 0.000 claims description 8
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 8
- 229920000642 polymer Polymers 0.000 claims description 8
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 7
- 229910052785 arsenic Inorganic materials 0.000 claims description 7
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 7
- 229910052797 bismuth Inorganic materials 0.000 claims description 7
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 229910052698 phosphorus Inorganic materials 0.000 claims description 7
- 239000011574 phosphorus Substances 0.000 claims description 7
- 150000002902 organometallic compounds Chemical class 0.000 claims description 6
- 230000000737 periodic effect Effects 0.000 claims description 6
- 238000009835 boiling Methods 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052711 selenium Inorganic materials 0.000 claims description 2
- 239000011669 selenium Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 229910052714 tellurium Inorganic materials 0.000 claims description 2
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 229910052782 aluminium Inorganic materials 0.000 description 13
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 13
- -1 titanium halides Chemical class 0.000 description 10
- 229920001155 polypropylene Polymers 0.000 description 5
- 239000004743 Polypropylene Substances 0.000 description 4
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 4
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 4
- 229910052719 titanium Inorganic materials 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 4
- 125000002524 organometallic group Chemical group 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910021551 Vanadium(III) chloride Inorganic materials 0.000 description 1
- DIXUOFSVRUVVTO-UHFFFAOYSA-N [As].CCCCCCC Chemical compound [As].CCCCCCC DIXUOFSVRUVVTO-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229910000413 arsenic oxide Inorganic materials 0.000 description 1
- 229960002594 arsenic trioxide Drugs 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- AHXGRMIPHCAXFP-UHFFFAOYSA-L chromyl dichloride Chemical compound Cl[Cr](Cl)(=O)=O AHXGRMIPHCAXFP-UHFFFAOYSA-L 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000002638 heterogeneous catalyst Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- DHOUOTPZYIKUDF-UHFFFAOYSA-N imino(triphenyl)-$l^{5}-phosphane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=N)C1=CC=CC=C1 DHOUOTPZYIKUDF-UHFFFAOYSA-N 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- IUYHWZFSGMZEOG-UHFFFAOYSA-M magnesium;propane;chloride Chemical group [Mg+2].[Cl-].C[CH-]C IUYHWZFSGMZEOG-UHFFFAOYSA-M 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- MDDUHVRJJAFRAU-YZNNVMRBSA-N tert-butyl-[(1r,3s,5z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane Chemical compound C1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C(=C)\C1=C/CP(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 MDDUHVRJJAFRAU-YZNNVMRBSA-N 0.000 description 1
- MRMOZBOQVYRSEM-UHFFFAOYSA-N tetraethyllead Chemical group CC[Pb](CC)(CC)CC MRMOZBOQVYRSEM-UHFFFAOYSA-N 0.000 description 1
- RWWNQEOPUOCKGR-UHFFFAOYSA-N tetraethyltin Chemical group CC[Sn](CC)(CC)CC RWWNQEOPUOCKGR-UHFFFAOYSA-N 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical group C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- HQYCOEXWFMFWLR-UHFFFAOYSA-K vanadium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[V+3] HQYCOEXWFMFWLR-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S526/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S526/906—Comminution of transition metal containing catalyst
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0059518 | 1960-09-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1445225A1 DE1445225A1 (de) | 1968-12-12 |
| DE1445225B2 true DE1445225B2 (de) | 1971-11-18 |
Family
ID=31496614
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19601445225 Pending DE1445225B2 (de) | 1960-09-24 | 1960-09-24 | Verfahren zur polymerisation von monoalpha olefinen mit drei oder mehr kohlenstoffatomen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3502634A (enExample) |
| BE (1) | BE608467A (enExample) |
| CA (2) | CA934497A (enExample) |
| DE (1) | DE1445225B2 (enExample) |
| FR (1) | FR1301698A (enExample) |
| GB (1) | GB921954A (enExample) |
| NL (1) | NL132629C (enExample) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3389129A (en) * | 1962-08-03 | 1968-06-18 | Teijin Ltd | Process for the polymerization of olefinic hydrocarbons in the presence of aluminium alkyl dihalide or sesquihalide, titanium halide and a phosphorus oxyhalide |
| NL297926A (enExample) * | 1962-09-17 | |||
| US3330816A (en) * | 1962-09-20 | 1967-07-11 | Asahi Chemical Ind | Method for the production of alpha-olefin polymers |
| DE1495046B2 (de) * | 1962-11-24 | 1969-10-30 | Asahi Kasei Kogyo Kabushiki Kaisha, Osaka (Japan) | Verfahren zur Herstellung von kristallinen Polypropylen |
| BE637068A (enExample) * | 1963-01-21 | |||
| US3280205A (en) * | 1963-10-08 | 1966-10-18 | Toyo Rayon Co Ltd | Process for synthesizing cyclododecatriene-(1, 5, 9) |
| US3390196A (en) * | 1966-02-07 | 1968-06-25 | Columbian Carbon | Polymerization process employing a chromium coordination catalyst |
| US3366701A (en) * | 1966-06-10 | 1968-01-30 | Columbian Carbou Company | Process for polymerizing ethylenically unsaturated monomers |
| DE1720262C3 (de) * | 1967-02-11 | 1981-11-26 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Polymerisation von α-Olefinen |
| US3429940A (en) * | 1967-08-28 | 1969-02-25 | Columbian Carbon | Trimethyl cyclododecatriene process |
| US3494910A (en) * | 1967-09-25 | 1970-02-10 | Asahi Chemical Ind | Process for polymerizing alpha-olefins utilizing a novel ternary catalyst |
| NL162664B (nl) * | 1969-06-20 | 1980-01-15 | Montedison Spa | Werkwijze om een katalysator te bereiden voor de poly- merisatie van alkenen-1. |
| US4057680A (en) | 1969-11-26 | 1977-11-08 | Showa Denko Kabushiki Kaisha | Method of polymerizing α-olefins |
| FR2099150A5 (enExample) * | 1970-06-18 | 1972-03-10 | Mitsui Toatsu Chemicals | |
| US4226963A (en) * | 1971-06-25 | 1980-10-07 | Montedison S.P.A. | Process for the stereoregular polymerization of alpha-olephins |
| US4107413A (en) * | 1971-06-25 | 1978-08-15 | Montedison S.P.A. | Process for the stereoregular polymerization of alpha olefins |
| US4098976A (en) * | 1971-07-13 | 1978-07-04 | Imperial Chemical Industries Limited | Process for the production of olefin polymers using an organo-phosphorus catalyst compound |
| US4015060A (en) | 1971-11-08 | 1977-03-29 | Standard Oil Company (Indiana) | Catalyst and process for the polymerization of olefins |
| US4317898A (en) * | 1972-01-31 | 1982-03-02 | Standard Oil Company (Indiana) | Catalyst and process for the polymerization of olefins |
| US4051307A (en) * | 1972-06-09 | 1977-09-27 | Imperial Chemical Industries Limited | Polymerization process |
| US3972866A (en) * | 1972-06-09 | 1976-08-03 | Imperial Chemical Industries Limited | Polymerization process |
| IT998191B (it) * | 1972-07-03 | 1976-01-20 | Mo Neftepererabatyvajuschy | Metodo per la produzione di polipropilene |
| DE2301136C3 (de) * | 1973-01-11 | 1980-08-28 | Basf Ag, 6700 Ludwigshafen | Verfahren zum Herstellen einer modifizierten Titan-Komponente fur Katalysatoren des Ziegler-Natta-Typs |
| FR2217066B1 (enExample) | 1973-02-14 | 1977-09-16 | Int Synthetic Rubber | |
| US3926928A (en) * | 1973-08-27 | 1975-12-16 | Standard Oil Co | Catalyst and process for the polymerization of alpha-olefins |
| IE40215B1 (en) * | 1973-12-04 | 1979-04-11 | Ici Ltd | Olefine polymer, olefine polymerisation process and catalyst |
| DD124254A5 (enExample) * | 1974-01-18 | 1977-02-09 | ||
| IT1052079B (it) * | 1975-01-10 | 1981-06-20 | Nippon Oil Co Ltd | Procedimento per la produzione di poliolefine |
| US4209601A (en) * | 1975-01-10 | 1980-06-24 | Nippon Oil Company, Limited | Process for the production of polyolefins |
| US4209602A (en) * | 1975-01-10 | 1980-06-24 | Nippon Oil Company, Limited | Process for the production of polyolefins |
| US4444967A (en) * | 1975-12-22 | 1984-04-24 | Stauffer Chemical Company | Substantially agglomeration-free catalyst component |
| JPS5282988A (en) * | 1975-12-30 | 1977-07-11 | Mitsubishi Chem Ind Ltd | Preparation of polyolefins |
| US4189556A (en) * | 1976-06-16 | 1980-02-19 | Standard Oil Company (Indiana) | Polymerization process |
| US4258168A (en) * | 1976-06-16 | 1981-03-24 | Standard Oil Company (Indiana) | Polymerization process |
| US4130503A (en) * | 1977-12-23 | 1978-12-19 | Phillips Petroleum Company | Phosphite in MgX2 supported TiX3 /AlCl3 catalyst system |
| US4237029A (en) * | 1979-01-29 | 1980-12-02 | Phillips Petroleum Company | Catalyst comprising intensely mixed triaryl phosphite, aluminum trihalide, titanium trihalide component |
| US4433123A (en) * | 1979-01-29 | 1984-02-21 | Conoco Inc. | Polymerization process for drag reducing substances |
| DE3066951D1 (en) * | 1979-06-20 | 1984-04-19 | Sumitomo Chemical Co | Method for production of highly crystalline olefin polymers |
| US4260711A (en) * | 1980-04-21 | 1981-04-07 | Hercules Incorporated | 1-Olefin polymerization catalyst |
| DE3269975D1 (en) | 1981-08-07 | 1986-04-24 | Ici Plc | Spraying solid |
| US4386011A (en) * | 1981-09-28 | 1983-05-31 | Phillips Petroleum Company | Olefin polymerization with catalysts containing food grade additives |
| US4396532A (en) * | 1981-11-25 | 1983-08-02 | Societe Chimique Des Charbonnages S.A. | Activator comprising a dialkylaluminum monofluoride for the polymerization of ethylene |
| US5064795A (en) * | 1982-08-27 | 1991-11-12 | Phillips Petroleum Company | Polymerization of olefins |
| IT1241093B (it) * | 1990-03-30 | 1993-12-29 | Himont Inc | Componenti e catalizzatori per la polimerizzazione di olefine |
| WO2004016405A1 (en) * | 2002-08-16 | 2004-02-26 | Johnson & Johnson Vision Care, Inc. | Molds for producing contact lenses |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB602467A (en) * | 1943-02-06 | 1948-05-27 | John Lawrence Chaney | Improvements in inclinometers |
| FR1171437A (fr) * | 1958-01-27 | 1959-01-26 | Eastman Kodak Co | Procédé de fabrication de polyoléfines, produits obtenus et catalyseurs pour la mise en oeuvre de ce procédé |
| NL134019C (enExample) * | 1958-06-27 |
-
1960
- 1960-09-24 DE DE19601445225 patent/DE1445225B2/de active Pending
-
1961
- 1961-09-22 NL NL269526A patent/NL132629C/xx active
- 1961-09-22 GB GB33972/61A patent/GB921954A/en not_active Expired
- 1961-09-22 CA CA832334A patent/CA934497A/en not_active Expired
- 1961-09-22 BE BE608467A patent/BE608467A/xx unknown
- 1961-09-25 FR FR874129A patent/FR1301698A/fr not_active Expired
-
1966
- 1966-09-21 US US580856A patent/US3502634A/en not_active Expired - Lifetime
-
1973
- 1973-05-03 CA CA170,289A patent/CA987848A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3502634A (en) | 1970-03-24 |
| GB921954A (en) | 1963-03-27 |
| NL269526A (enExample) | 1964-06-25 |
| NL132629C (enExample) | 1971-10-15 |
| DE1445225A1 (de) | 1968-12-12 |
| BE608467A (enExample) | 1962-03-22 |
| CA934497A (en) | 1973-09-25 |
| CA987848A (en) | 1976-04-20 |
| FR1301698A (fr) | 1962-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1445225B2 (de) | Verfahren zur polymerisation von monoalpha olefinen mit drei oder mehr kohlenstoffatomen | |
| DE1939074C3 (de) | Verfahren zur katalytischen Polymerisation oder Mischpolymerisation von Olefinen | |
| DE3028479C2 (de) | Verfahren zur Polymerisation von Äthylen sowie zu dessen Copolymerisation mit einem α-Olefin mit 3 bis 20 Kohlenstoffatomen oder mit Butadien bzw. Isopren in flüssiger Phase und titanhaltige bzw. titan- und vanadiumhaltige Katalysatorkomponente zur Durchführung dieses Verfahrens | |
| DE1420365A1 (de) | Verfahren zur Herstellung fester kristalliner Polymerisate aus Olefinen | |
| DE2515211C2 (enExample) | ||
| DE2630585C3 (de) | Katalysatoren für die Polymerisation von α -Olefinen, mit 2 bis 6 Kohlenstoffatomen und deren Verwendung für die Polymerisation von α -Olefinen mit 2 bis 6 Kohlenstoffatomen | |
| DE2623332A1 (de) | Hochtemperaturkatalysator mit hohem wirkungsgrad fuer die polymerisation von olefinen | |
| DE2906769A1 (de) | Katalysator und verfahren zur herstellung von hochstereospezifischen alpha- olefinpolymerisaten sowie deren verwendung | |
| DE2633195C2 (de) | Verfahren zum Polymerisieren von Propylen | |
| DE2513849A1 (de) | Verfahren zur polymerisation von alpha-olefinen | |
| DE1520693A1 (de) | Verfahren zur Polymerisation von alpha-Olefinen | |
| DE2905330C2 (enExample) | ||
| DE3031573A1 (de) | Verfahren zur herstellung von hochkristallinen (alpha)-olefin-polymerisaten und katalysator zur durchfuehrung des verfahrens | |
| DE1445225C (de) | Verfahren zur Polymerisation von Mono alpha olefinen mit drei oder mehr Kohlen Stoffatomen | |
| EP0007061B1 (de) | Verfahren zur Polymerisation von 1-Oelfinen | |
| DE1520567A1 (de) | Verfahren zur Herstellung von kristallinen Polyolefinen | |
| AT230090B (de) | Verfahren zur Polymerisation von Mono-α-olefinen mit drei oder mehr Kohlenstoffatomen | |
| DE1745228C3 (de) | Verfahren zur Polymerisation von 1-Olefinen | |
| DE1942734B2 (de) | Verfahren zur Polymerisation von alpha-Olefinen | |
| DE3027956A1 (de) | Katalysator fuer die polymerisation von olefinen | |
| DE1957815A1 (de) | Verfahren zur Herstellung von linearem Polyaethylen | |
| DE1767215C3 (de) | Verfahren zur Herstellung eines Polymerisationskatalysatorsystems und dessen Verwendung | |
| DE1958585B2 (de) | Verfahren zur Herstellung von Äthylenhomopolymerisaten oder -copolymerisaten mit a-Olefinen | |
| DE1595135C (de) | Verfahren zur Polymerisation eines aliphatischen 1 Olefins | |
| DE1105416B (de) | Verfahren zur Herstellung von neuen, kristallisierbaren Titan und Aluminium enthaltenden metallorganischen Komplexverbindungen |