DE1443957B1 - 9 alpha-Chlor- bzw. 9 alpha-Fluor-16 beta-methyl-prednisolon-17,21-diester und ein Verfahren zu deren Herstellung - Google Patents
9 alpha-Chlor- bzw. 9 alpha-Fluor-16 beta-methyl-prednisolon-17,21-diester und ein Verfahren zu deren HerstellungInfo
- Publication number
- DE1443957B1 DE1443957B1 DE19641443957 DE1443957A DE1443957B1 DE 1443957 B1 DE1443957 B1 DE 1443957B1 DE 19641443957 DE19641443957 DE 19641443957 DE 1443957 A DE1443957 A DE 1443957A DE 1443957 B1 DE1443957 B1 DE 1443957B1
- Authority
- DE
- Germany
- Prior art keywords
- betamethasone
- methyl
- dione
- diene
- fluoro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000002360 preparation method Methods 0.000 title claims description 9
- 238000000034 method Methods 0.000 title claims description 6
- 229960002537 betamethasone Drugs 0.000 claims description 20
- UREBDLICKHMUKA-DVTGEIKXSA-N betamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-DVTGEIKXSA-N 0.000 claims description 20
- 150000003431 steroids Chemical class 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 4
- FEBLZLNTKCEFIT-VSXGLTOVSA-N fluocinolone acetonide Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@]1(F)[C@@H]2[C@@H]2C[C@H]3OC(C)(C)O[C@@]3(C(=O)CO)[C@@]2(C)C[C@@H]1O FEBLZLNTKCEFIT-VSXGLTOVSA-N 0.000 claims description 4
- CIWBQSYVNNPZIQ-XYWKZLDCSA-N betamethasone dipropionate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)COC(=O)CC)(OC(=O)CC)[C@@]1(C)C[C@@H]2O CIWBQSYVNNPZIQ-XYWKZLDCSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 229940043075 fluocinolone Drugs 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 64
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 42
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 23
- 238000004458 analytical method Methods 0.000 description 23
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 21
- 239000003208 petroleum Substances 0.000 description 20
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- 238000000354 decomposition reaction Methods 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 238000002425 crystallisation Methods 0.000 description 10
- 230000008025 crystallization Effects 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000012043 crude product Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- JYGXADMDTFJGBT-VWUMJDOOSA-N hydrocortisone Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 JYGXADMDTFJGBT-VWUMJDOOSA-N 0.000 description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- FPVRUILUEYSIMD-QZIXMDIESA-N [(8s,9r,10s,11s,13s,14s,16s,17r)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(OC(C)=O)[C@@]1(C)C[C@@H]2O FPVRUILUEYSIMD-QZIXMDIESA-N 0.000 description 5
- 230000003110 anti-inflammatory effect Effects 0.000 description 5
- 150000005690 diesters Chemical class 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 5
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- -1 isobutyryl Chemical group 0.000 description 4
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 4
- 229960005205 prednisolone Drugs 0.000 description 4
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 230000000699 topical effect Effects 0.000 description 4
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 210000000245 forearm Anatomy 0.000 description 3
- 229960000890 hydrocortisone Drugs 0.000 description 3
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 229940070710 valerate Drugs 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 206010047139 Vasoconstriction Diseases 0.000 description 2
- ITYMTTQVNYAJAA-XGQKBEPLSA-N [(8s,9r,10s,11s,13s,14s,16s,17r)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(OC(=O)CC)[C@@]1(C)C[C@@H]2O ITYMTTQVNYAJAA-XGQKBEPLSA-N 0.000 description 2
- SIKHQNIGPLUJDX-ZEQQQVMLSA-N [2-[(8s,9s,10r,13s,14s,17s)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)COC(=O)CC)[C@@]1(C)CC2 SIKHQNIGPLUJDX-ZEQQQVMLSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- VXOWJCTXWVWLLC-REGDIAEZSA-N betamethasone butyrate propionate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)COC(=O)CC)(OC(=O)CCC)[C@@]1(C)C[C@@H]2O VXOWJCTXWVWLLC-REGDIAEZSA-N 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000006196 drop Substances 0.000 description 2
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 235000019388 lanolin Nutrition 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 229910052919 magnesium silicate Inorganic materials 0.000 description 2
- 235000019792 magnesium silicate Nutrition 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 150000007530 organic bases Chemical group 0.000 description 2
- 229950010765 pivalate Drugs 0.000 description 2
- 239000011505 plaster Substances 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 230000025033 vasoconstriction Effects 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- FUFLCEKSBBHCMO-UHFFFAOYSA-N 11-dehydrocorticosterone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)C(=O)CO)C4C3CCC2=C1 FUFLCEKSBBHCMO-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- MFYSYFVPBJMHGN-ZPOLXVRWSA-N Cortisone Chemical compound O=C1CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 MFYSYFVPBJMHGN-ZPOLXVRWSA-N 0.000 description 1
- MFYSYFVPBJMHGN-UHFFFAOYSA-N Cortisone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)(O)C(=O)CO)C4C3CCC2=C1 MFYSYFVPBJMHGN-UHFFFAOYSA-N 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- FOGXJPFPZOHSQS-UHFFFAOYSA-N Hydrocortisone 17-butyrate 21-propionate Natural products C1CC2=CC(=O)CCC2(C)C2C1C1CCC(C(=O)COC(=O)CC)(OC(=O)CCC)C1(C)CC2O FOGXJPFPZOHSQS-UHFFFAOYSA-N 0.000 description 1
- FOGXJPFPZOHSQS-AYVLZSQQSA-N Hydrocortisone butyrate propionate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)COC(=O)CC)(OC(=O)CCC)[C@@]1(C)C[C@@H]2O FOGXJPFPZOHSQS-AYVLZSQQSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241001183191 Sclerophthora macrospora Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QSZKFXMOBKKROF-YCUXZELOSA-N [(8s,9r,10s,11s,13s,14s,16s,17r)-17-(2-acetyloxyacetyl)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)COC(C)=O)(OC(=O)CCCC)[C@@]1(C)C[C@@H]2O QSZKFXMOBKKROF-YCUXZELOSA-N 0.000 description 1
- JZUOTTDVXIVTTR-RPPPWEFESA-N [(8s,9s,10r,11s,13s,14s,17r)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1h-cyclopenta[a]phenanthren-17-yl] propanoate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)CO)(OC(=O)CC)[C@@]1(C)C[C@@H]2O JZUOTTDVXIVTTR-RPPPWEFESA-N 0.000 description 1
- WCJFIJOMPOXJJA-YBYOAESISA-N [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] pentanoate Chemical compound C(CCCC)(=O)OCC([C@H]1CC[C@H]2[C@@H]3CCC4=CC(C=C[C@]4(C)[C@H]3CC[C@]12C)=O)=O WCJFIJOMPOXJJA-YBYOAESISA-N 0.000 description 1
- GTECTIGXIMGLJQ-UPJXLQJGSA-N [2-[(8s,9r,10s,11s,13s,14s,16s,17r)-11-acetyloxy-9-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)COC(C)=O)(O)[C@@]1(C)C[C@@H]2OC(C)=O GTECTIGXIMGLJQ-UPJXLQJGSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 208000002399 aphthous stomatitis Diseases 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- ASGJEMPQQVNTGO-UHFFFAOYSA-N benzene chloroform Chemical compound C(Cl)(Cl)Cl.C1=CC=CC=C1.C1=CC=CC=C1 ASGJEMPQQVNTGO-UHFFFAOYSA-N 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical class [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- AKUJBENLRBOFTD-QZIXMDIESA-N betamethasone acetate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)COC(C)=O)(O)[C@@]1(C)C[C@@H]2O AKUJBENLRBOFTD-QZIXMDIESA-N 0.000 description 1
- SNHRLVCMMWUAJD-SUYDQAKGSA-N betamethasone valerate Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(OC(=O)CCCC)[C@@]1(C)C[C@@H]2O SNHRLVCMMWUAJD-SUYDQAKGSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960002242 chlorocresol Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229960004544 cortisone Drugs 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940079360 enema for constipation Drugs 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- IXAXVYMFIJYCSG-UHFFFAOYSA-N pentan-1-one Chemical compound CCCC[C]=O IXAXVYMFIJYCSG-UHFFFAOYSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/56—Compounds containing cyclopenta[a]hydrophenanthrene ring systems; Derivatives thereof, e.g. steroids
- A61K31/57—Compounds containing cyclopenta[a]hydrophenanthrene ring systems; Derivatives thereof, e.g. steroids substituted in position 17 beta by a chain of two carbon atoms, e.g. pregnane or progesterone
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Steroid Compounds (AREA)
- Insulated Conductors (AREA)
- Combinations Of Kitchen Furniture (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB23223/63A GB1047518A (en) | 1963-06-11 | 1963-06-11 | 17ª-monoesters of 11,17,21-trihydroxy steroid compounds |
| GB362364 | 1964-01-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1443957B1 true DE1443957B1 (de) | 1970-01-02 |
Family
ID=26238483
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641443958 Pending DE1443958B1 (de) | 1963-06-11 | 1964-06-10 | 9 alpha-Chlor- bzw. 9 alpha-Fluor-16 beta-methyl-prednisolon-17-monoester und ein Verfahren zu deren Herstellung |
| DE19641443957 Pending DE1443957B1 (de) | 1963-06-11 | 1964-06-10 | 9 alpha-Chlor- bzw. 9 alpha-Fluor-16 beta-methyl-prednisolon-17,21-diester und ein Verfahren zu deren Herstellung |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641443958 Pending DE1443958B1 (de) | 1963-06-11 | 1964-06-10 | 9 alpha-Chlor- bzw. 9 alpha-Fluor-16 beta-methyl-prednisolon-17-monoester und ein Verfahren zu deren Herstellung |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3312590A (enExample) |
| BE (2) | BE649170A (enExample) |
| BR (2) | BR6459937D0 (enExample) |
| CH (2) | CH450410A (enExample) |
| CY (1) | CY544A (enExample) |
| DE (2) | DE1443958B1 (enExample) |
| DK (2) | DK116205B (enExample) |
| ES (2) | ES300814A1 (enExample) |
| FR (1) | FR4548M (enExample) |
| GB (1) | GB1047518A (enExample) |
| MY (1) | MY7000131A (enExample) |
| NL (2) | NL142157B (enExample) |
| NO (2) | NO125533B (enExample) |
| SE (2) | SE313562B (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2512915A1 (de) * | 1974-03-27 | 1975-10-09 | Plurichemie Anstalt | 16-methyl-9 alpha-halogen-steroide ester, aether und verfahren zu ihrer herstellung |
| EP0029151A3 (en) * | 1979-11-16 | 1981-08-26 | Sterosynt Ltd. | 6-alpha-fluoro-9-alpha-chloro-prednisolone-17,21 diesters, pharmaceutical compositions containing them and intermediates |
| EP0110041A1 (de) * | 1982-11-22 | 1984-06-13 | Schering Aktiengesellschaft | Neue 6alpha-Methylkortikoide, ihre Herstellung und Verwendung |
| EP0170500B1 (en) * | 1984-07-25 | 1990-10-10 | Hovione Inter Ltd. | Novel 9 alpha-fluoro- or chloro-corticosteroid esters and a process for their preparation |
| US6536427B2 (en) | 1990-03-02 | 2003-03-25 | Glaxo Group Limited | Inhalation device |
| US7225808B2 (en) | 1990-03-02 | 2007-06-05 | Glaxo Group Limited | Inhalation device |
Families Citing this family (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3475466A (en) * | 1965-08-30 | 1969-10-28 | Schering Corp | Novel 17,21-diesters of 16alpha-methyl-9alpha,11beta-dichloro-1,4- pregnadienes |
| US3422193A (en) * | 1966-08-11 | 1969-01-14 | Schering Corp | 17-mono esters of corticoids |
| IT1061787B (it) * | 1967-03-01 | 1983-04-30 | Vismara Francesco Spa | Miglioramenti relativi alla preparazione di 17 benzoato di betametazone |
| GB1281689A (en) * | 1968-10-14 | 1972-07-12 | Glaxo Lab Ltd | Steroid 21-phosphates |
| US3694471A (en) * | 1970-06-08 | 1972-09-26 | Warner Lambert Pharmaceutical | 17-valerate ester of 6{60 ,9{60 -difluorohydrocortisone, its compositions and use as an anti-inflammatory agent |
| DK135267A (enExample) * | 1971-02-25 | |||
| US3789121A (en) * | 1971-11-26 | 1974-01-29 | Warner Lambert Co | 17{60 ,21-orthobutyrates of 6{60 , 9{60 -difluoro-hydrocortisone and 6{60 , 9{60 -difluoroprednisolone, compositions containing same and the use thereof as anti-inflammatory agents |
| US4044126A (en) * | 1972-04-20 | 1977-08-23 | Allen & Hanburys Limited | Steroidal aerosol compositions and process for the preparation thereof |
| GB1429184A (en) * | 1972-04-20 | 1976-03-24 | Allen & Hanburys Ltd | Physically anti-inflammatory steroids for use in aerosols |
| US4018918A (en) * | 1975-05-20 | 1977-04-19 | The Upjohn Company | Topical clindamycin preparations |
| DE2645104C2 (de) * | 1976-10-04 | 1986-04-24 | Schering AG, 1000 Berlin und 4709 Bergkamen | 11β-Hydroxy-1,4,8-pregnatrien-3,20-dion-Derivate und Verfahren zu ihrer Herstellung |
| US4070462A (en) * | 1976-10-26 | 1978-01-24 | Schering Corporation | Steroid ointment |
| JPS6040439B2 (ja) * | 1978-03-29 | 1985-09-11 | 大正製薬株式会社 | ヒドロコルチゾン誘導体 |
| US4350690A (en) * | 1980-10-27 | 1982-09-21 | Cressington Investments Ltd. | Steroid composition |
| US4346086A (en) * | 1981-06-09 | 1982-08-24 | Beiersdorf Aktiengesellschaft | Corticosteroid-containing cream |
| IL66432A0 (en) * | 1981-08-04 | 1982-12-31 | Plurichemie Anstalt | Process for the preparation of steroidal esters |
| DE3133081A1 (de) * | 1981-08-18 | 1983-03-10 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue 6(alpha)-methylprednisolon-derivate, ihre herstellung und verwendung |
| FR2515041A1 (fr) * | 1981-10-26 | 1983-04-29 | Besins Jean | Medicament a base de progesterone pour le traitement des affections mammaires |
| EP0095894A3 (en) * | 1982-05-31 | 1985-01-02 | Ohta Seiyaku Kabushiki Kaisha. | 6 alpha-methylprednisolone derivatives |
| DE3227312A1 (de) * | 1982-07-19 | 1984-01-19 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue 6,16-dimethylkortikoide, ihre herstellung und verwendung |
| US4489070A (en) * | 1983-05-13 | 1984-12-18 | Schering Corporation | Betamethasone dipropionate cream |
| US4482539A (en) * | 1983-05-13 | 1984-11-13 | Schering Corporation | Betamethasone dipropionate cream |
| DE3400188A1 (de) * | 1984-01-02 | 1985-07-11 | Schering AG, Berlin und Bergkamen, 1000 Berlin | Neue 6(alpha),16(alpha)-dimethylkortikoide |
| SK280967B6 (sk) | 1990-03-02 | 2000-10-09 | Glaxo Group Limited | Inhalačný prístroj |
| US6759398B2 (en) * | 2000-08-05 | 2004-07-06 | Smithkline Beecham Corporation | Anti-inflammatory androstane derivative |
| US6777399B2 (en) * | 2000-08-05 | 2004-08-17 | Smithkline Beecham Corporation | Anti-inflammatory androstane derivative compositions |
| US6858596B2 (en) * | 2000-08-05 | 2005-02-22 | Smithkline Beecham Corporation | Formulation containing anti-inflammatory androstane derivative |
| SI1305329T2 (sl) * | 2000-08-05 | 2015-07-31 | Glaxo Group Limited | S-fluorometil ester 6alfa,9alfa-difluoro-17alfa-(2-furanilkarboksil)oksi-11beta-hidroksi- 16alfa-metil-3-okso-androst-1,4-dien-17-karbotiojske kisline kot protivnetno sredstvo |
| GB0019172D0 (en) * | 2000-08-05 | 2000-09-27 | Glaxo Group Ltd | Novel compounds |
| CA2445839A1 (en) | 2001-04-30 | 2002-11-07 | Glaxo Group Limited | Anti-inflammatory 17.beta.-carbothioate ester derivatives of androstane with a cyclic ester group in position 17.alpha |
| JP2005500290A (ja) * | 2001-06-12 | 2005-01-06 | グラクソ グループ リミテッド | 抗炎症性の、17β−カルボチオアートアンドロスタン誘導体である17α複素環エステル |
| AU2002356759A1 (en) * | 2001-12-01 | 2003-06-17 | Glaxo Group Limited | 17.alpha. -cyclic esters of 16-methylpregnan-3,20-dione as anti-inflammatory agents |
| US20050175545A1 (en) * | 2002-02-04 | 2005-08-11 | Keith Biggadike | Formulation for inhalation comprising a glucocorticoid and a beta 2-adrenoreceptor agonist |
| GB0202635D0 (en) * | 2002-02-05 | 2002-03-20 | Glaxo Wellcome Mfg Pte Ltd | Formulation containing novel anti-inflammatory androstane derivative |
| GB2389530B (en) | 2002-06-14 | 2007-01-10 | Cipla Ltd | Pharmaceutical compositions |
| RU2387646C2 (ru) * | 2003-08-29 | 2010-04-27 | Рэнбакси Лабораториз Лимитед | Ингибиторы фосфодиэстеразы типа-iv |
| EP1694655A2 (en) * | 2003-11-26 | 2006-08-30 | Ranbaxy Laboratories Limited | Phosphodiesterase inhibitors |
| US20080009535A1 (en) * | 2004-08-30 | 2008-01-10 | Sarala Balachandran | Inhibitors of phosphodiesterase type-IV |
| GB0507165D0 (en) * | 2005-04-08 | 2005-05-18 | Glaxo Group Ltd | Novel crystalline pharmaceutical product |
| EP1934219A1 (en) | 2005-09-16 | 2008-06-25 | Ranbaxy Laboratories Limited | Substituted pyrazolo [3,4-b] pyridines as phosphodiesterase inhibitors |
| WO2007045979A1 (en) | 2005-10-19 | 2007-04-26 | Ranbaxy Laboratories Limited | Pharmaceutical compositions of muscarinic receptor antagonists |
| CA2626628A1 (en) * | 2005-10-19 | 2007-04-26 | Ranbaxy Laboratories Limited | Compositions of phosphodiesterase type iv inhibitors |
| GB0615108D0 (en) * | 2006-07-28 | 2006-09-06 | Glaxo Group Ltd | Novel formulations |
| US20100029728A1 (en) * | 2006-09-22 | 2010-02-04 | Ranbaxy Laboratories Limited | Phosphodiesterase inhibitors |
| AU2007298549A1 (en) * | 2006-09-22 | 2008-03-27 | Ranbaxy Laboratories Limited | Inhibitors of phosphodiesterase type-IV |
| US20080207659A1 (en) * | 2007-02-15 | 2008-08-28 | Asit Kumar Chakraborti | Inhibitors of phosphodiesterase type 4 |
| EP2124943A1 (en) * | 2007-03-14 | 2009-12-02 | Ranbaxy Laboratories Limited | Pyrazolo [3, 4-b]pyridine derivatives as phosphodiesterase inhibitors |
| EP2124944B1 (en) * | 2007-03-14 | 2012-02-15 | Ranbaxy Laboratories Limited | Pyrazolo[3,4-b]pyridine derivatives as phosphodiesterase inhibitors |
| US8796248B2 (en) | 2007-10-05 | 2014-08-05 | Nektar Therapeutics | Oligomer-corticosteroid conjugates |
| EP2111861A1 (en) | 2008-04-21 | 2009-10-28 | Ranbaxy Laboratories Limited | Compositions of phosphodiesterase type IV inhibitors |
| CN112358522B (zh) * | 2020-05-18 | 2021-11-16 | 河南利华制药有限公司 | 一种倍他米松二丙酸酯的精制方法及倍他米松二丙酸酯 |
| CN111944002A (zh) * | 2020-07-29 | 2020-11-17 | 河南利华制药有限公司 | 一种倍氯米松二丙酸酯中间体及制备方法 |
| CN116023425B (zh) * | 2023-03-28 | 2023-06-20 | 南京师范大学 | 曲安西龙衍生物及其医药用途 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3147249A (en) * | 1961-06-13 | 1964-09-01 | Vismara Francesco Spa | 17alpha, 21-substituted methylenedioxy steroids and methods therefor |
| DE1214677B (de) * | 1961-06-24 | 1966-04-21 | Vismara Francesco Spa | Verfahren zur Herstellung von 17alpha-Acyloxy-21-hydroxysteroiden |
| CH429716A (de) * | 1961-06-24 | 1967-02-15 | Vismara Francesco Spa | Verfahren zur Herstellung von 17a-Acyloxy-21-hydroxy-Steroiden |
-
1963
- 1963-06-11 GB GB23223/63A patent/GB1047518A/en not_active Expired
-
1964
- 1964-06-09 CH CH752364A patent/CH450410A/de unknown
- 1964-06-09 CH CH752464A patent/CH457422A/de unknown
- 1964-06-09 US US373837A patent/US3312590A/en not_active Expired - Lifetime
- 1964-06-10 FR FR977701A patent/FR4548M/fr not_active Expired
- 1964-06-10 DK DK291064AA patent/DK116205B/da unknown
- 1964-06-10 DK DK291164AA patent/DK116128B/da unknown
- 1964-06-10 DE DE19641443958 patent/DE1443958B1/de active Pending
- 1964-06-10 ES ES300814A patent/ES300814A1/es not_active Expired
- 1964-06-10 DE DE19641443957 patent/DE1443957B1/de active Pending
- 1964-06-10 ES ES300811A patent/ES300811A1/es not_active Expired
- 1964-06-10 SE SE7049/64A patent/SE313562B/xx unknown
- 1964-06-10 NO NO153602A patent/NO125533B/no unknown
- 1964-06-10 NO NO153601A patent/NO125532B/no unknown
- 1964-06-10 SE SE7048/64A patent/SE320066B/xx unknown
- 1964-06-11 BR BR159937/64A patent/BR6459937D0/pt unknown
- 1964-06-11 NL NL646406614A patent/NL142157B/xx not_active IP Right Cessation
- 1964-06-11 BE BE649170D patent/BE649170A/xx unknown
- 1964-06-11 BR BR159936/64A patent/BR6459936D0/pt unknown
- 1964-06-11 NL NL646406615A patent/NL141378B/xx not_active IP Right Cessation
- 1964-06-11 BE BE649171D patent/BE649171A/xx unknown
-
1970
- 1970-07-02 CY CY54470A patent/CY544A/xx unknown
- 1970-12-31 MY MY1970131A patent/MY7000131A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2512915A1 (de) * | 1974-03-27 | 1975-10-09 | Plurichemie Anstalt | 16-methyl-9 alpha-halogen-steroide ester, aether und verfahren zu ihrer herstellung |
| EP0029151A3 (en) * | 1979-11-16 | 1981-08-26 | Sterosynt Ltd. | 6-alpha-fluoro-9-alpha-chloro-prednisolone-17,21 diesters, pharmaceutical compositions containing them and intermediates |
| EP0110041A1 (de) * | 1982-11-22 | 1984-06-13 | Schering Aktiengesellschaft | Neue 6alpha-Methylkortikoide, ihre Herstellung und Verwendung |
| EP0170500B1 (en) * | 1984-07-25 | 1990-10-10 | Hovione Inter Ltd. | Novel 9 alpha-fluoro- or chloro-corticosteroid esters and a process for their preparation |
| US6536427B2 (en) | 1990-03-02 | 2003-03-25 | Glaxo Group Limited | Inhalation device |
| US7225808B2 (en) | 1990-03-02 | 2007-06-05 | Glaxo Group Limited | Inhalation device |
| US7389775B2 (en) | 1990-03-02 | 2008-06-24 | Glaxo Group Limited | Inhalation device |
Also Published As
| Publication number | Publication date |
|---|---|
| CY544A (en) | 1970-07-02 |
| BE649170A (enExample) | 1964-12-11 |
| NL6406614A (enExample) | 1964-12-14 |
| FR4548M (enExample) | 1966-11-02 |
| NO125532B (enExample) | 1972-09-25 |
| DE1443958B1 (de) | 1970-01-02 |
| GB1047518A (en) | 1966-11-02 |
| ES300811A1 (es) | 1962-12-16 |
| BR6459937D0 (pt) | 1973-08-07 |
| SE320066B (enExample) | 1970-02-02 |
| MY7000131A (en) | 1970-12-31 |
| DK116205B (da) | 1969-12-22 |
| NL142157B (nl) | 1974-05-15 |
| BE649171A (enExample) | 1964-12-11 |
| BR6459936D0 (pt) | 1973-08-02 |
| NO125533B (enExample) | 1972-09-25 |
| CH450410A (de) | 1968-01-31 |
| ES300814A1 (es) | 1964-12-01 |
| US3312590A (en) | 1967-04-04 |
| CH457422A (de) | 1968-06-15 |
| SE313562B (enExample) | 1969-08-18 |
| DK116128B (da) | 1969-12-15 |
| NL141378B (nl) | 1974-03-15 |
| NL6406615A (enExample) | 1964-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1443957B1 (de) | 9 alpha-Chlor- bzw. 9 alpha-Fluor-16 beta-methyl-prednisolon-17,21-diester und ein Verfahren zu deren Herstellung | |
| EP0135476B1 (de) | Steroid Carbonsäureester | |
| WO1994022899A1 (de) | Neue prednisolonderivate | |
| CH505802A (de) | Verfahren zur Herstellung von Estern von 17a-Hydroxysteroiden der Pregnanreihe | |
| DE2607418A1 (de) | Terpenoidester von steroiden, verfahren zu ihrer herstellung und sie enthaltende praeparate | |
| EP0110041A1 (de) | Neue 6alpha-Methylkortikoide, ihre Herstellung und Verwendung | |
| DE2538595A1 (de) | Steroidverbindungen | |
| CH537917A (de) | Verfahren zur Herstellung von 20-Hydroperoxysteroiden | |
| DE1443957C (de) | 9 alpha-Chlor- bzw. 9 alpha-Fluor-. 16 beta-methyl-prednisolon-17,21-diester und ein Verfahren zu deren Herstellung | |
| DE1518994A1 (de) | Verfahren zur Herstellung von neuen Beta,10Alpha-Steroiden | |
| DE2852055C2 (enExample) | ||
| DE1618993B1 (de) | Verfahren zur Herstellung von 3-(2'-Chloräthylthio)-6-formyl-steroiden | |
| DE2365992B2 (de) | 6α-Fluor-17,21-dihydroxy-16β-methylpregna-4,9(11)-dien-3,20-dion-17,21-diacetat und Verfahren zu dessen Herstellung | |
| DE1443958C (de) | 9alpha-Chlor- bzw. 9alpha-Fluor-16beta-methyl-prednisolon-17-monoester und ein Verfahren zu deren Herstellung | |
| DE1493178C3 (de) | 6 alpha-Fluor-16 alpha-methyl-1,4pregnadien-3,20-dion-derivate und Verfahren zu ihrer Herstellung | |
| DE1593518C3 (de) | Verfahren zur Herstellung eines 17 alpha-Esters der Pregnanreihe | |
| CH626633A5 (enExample) | ||
| DE2756550C2 (de) | Verfahren zur Herstellung von 3,20-Dioxo-7α-halogen-4-pregnenen und 1,4-Pregnadienen, 3,20-Dioxo-7α-chlor und Brom-1,4-pregnadiene und letztere enthaltende Arzneimittel | |
| DE2508136C3 (de) | Neue Steroide, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Mittel | |
| DD229702A5 (de) | Verfahren zur herstellung von neuen corticoidderivaten | |
| CH634081A5 (en) | Process for the preparation of novel androstadiene-17beta-carboxylic acid esters | |
| DE1493344B1 (de) | Verfahren zur Herstellung von 16 alpha-Chlor- oder -Fluor-17(20)-pregnen-21-saeureestern und daraus erhaeltlichen 16 alpha-Chlor- oder -Fluor-17 alpha-hydroxy-20-keto-21-acyloxyverbindungen der Pregnanreihe | |
| DE1768673C (de) | 6 alpha, 9 alpha-Difluorprednisolon-17,21-diester | |
| DE1493313C (de) | 16b, 17 Cycloenolather des 17alpha Hydroxy öalpha methyl 3,20 dioxo 4 pregnen 16alpha acetaldehyds und des 1 lbeta, 17alpha Dihydroxy 9alpha fluor 6alpha methyl 3,20 dioxo 1,4 pregnadien 16alpha acetaldehyds und Verfahren zu ihrer Herstellung | |
| DE1768673B1 (de) | 6alpha,9alpha-Difluorprednisolon-17,21-diester |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 |