DE1300728B - Totales Voraulfaufherbizid - Google Patents
Totales VoraulfaufherbizidInfo
- Publication number
- DE1300728B DE1300728B DES71895A DES0071895A DE1300728B DE 1300728 B DE1300728 B DE 1300728B DE S71895 A DES71895 A DE S71895A DE S0071895 A DES0071895 A DE S0071895A DE 1300728 B DE1300728 B DE 1300728B
- Authority
- DE
- Germany
- Prior art keywords
- group
- benzaldoxime
- substituted
- salts
- spraying
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 9
- 239000004009 herbicide Substances 0.000 title claims description 6
- 150000003839 salts Chemical class 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- VTWKXBJHBHYJBI-UHFFFAOYSA-N n-benzylidenehydroxylamine Chemical class ON=CC1=CC=CC=C1 VTWKXBJHBHYJBI-UHFFFAOYSA-N 0.000 claims description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000005031 thiocyano group Chemical group S(C#N)* 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- FQSNZBSZVFWEFW-UHFFFAOYSA-N 2,6-dichloro-n'-hydroxybenzenecarboximidamide;hydrochloride Chemical group Cl.O\N=C(/N)C1=C(Cl)C=CC=C1Cl FQSNZBSZVFWEFW-UHFFFAOYSA-N 0.000 claims 1
- VTWKXBJHBHYJBI-SOFGYWHQSA-N (ne)-n-benzylidenehydroxylamine Chemical class O\N=C\C1=CC=CC=C1 VTWKXBJHBHYJBI-SOFGYWHQSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 8
- 238000005507 spraying Methods 0.000 description 8
- 239000000969 carrier Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- 241000196324 Embryophyta Species 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000007788 liquid Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- -1 α-substituted benzaldoximes Chemical class 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 244000075850 Avena orientalis Species 0.000 description 4
- 235000007319 Avena orientalis Nutrition 0.000 description 4
- 244000056139 Brassica cretica Species 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- GYHKODORJRRYBU-CLFYSBASSA-N (z)-n-hydroxybenzenecarboximidoyl chloride Chemical compound O\N=C(/Cl)C1=CC=CC=C1 GYHKODORJRRYBU-CLFYSBASSA-N 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- 235000007558 Avena sp Nutrition 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 241000209510 Liliopsida Species 0.000 description 2
- 240000006240 Linum usitatissimum Species 0.000 description 2
- 235000004431 Linum usitatissimum Nutrition 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000010426 asphalt Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 235000004426 flaxseed Nutrition 0.000 description 2
- 230000009036 growth inhibition Effects 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012184 mineral wax Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- 235000019508 mustard seed Nutrition 0.000 description 2
- YBSXDWIAUZOFFV-UHFFFAOYSA-N n-[(2,6-dichlorophenyl)methylidene]hydroxylamine Chemical compound ON=CC1=C(Cl)C=CC=C1Cl YBSXDWIAUZOFFV-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- YOYAIZYFCNQIRF-UHFFFAOYSA-N 2,6-dichlorobenzonitrile Chemical compound ClC1=CC=CC(Cl)=C1C#N YOYAIZYFCNQIRF-UHFFFAOYSA-N 0.000 description 1
- CBQDTCDOVVBGMN-UHFFFAOYSA-N 2-methyl-3-octylphenol Chemical compound CCCCCCCCC1=CC=CC(O)=C1C CBQDTCDOVVBGMN-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 1
- 240000000972 Agathis dammara Species 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- 239000004859 Copal Substances 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 229920002871 Dammar gum Polymers 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 206010053759 Growth retardation Diseases 0.000 description 1
- 241000782205 Guibourtia conjugata Species 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- LRHTZTDCOZYOKX-UHFFFAOYSA-N N-[(2-chlorophenyl)methylidene]hydroxylamine hydrochloride Chemical compound Cl.ClC1=C(C=NO)C=CC=C1 LRHTZTDCOZYOKX-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 244000234281 Tamarix gallica Species 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000012241 calcium silicate Nutrition 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 231100000001 growth retardation Toxicity 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000011419 magnesium lime Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000010688 mineral lubricating oil Substances 0.000 description 1
- 239000012170 montan wax Substances 0.000 description 1
- 125000005608 naphthenic acid group Chemical group 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical class [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 235000019830 sodium polyphosphate Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/56—X being a nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB131/60A GB949371A (en) | 1960-01-01 | 1960-01-01 | Alpha substituted benzaldoximes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1300728B true DE1300728B (de) | 1969-08-07 |
Family
ID=9698964
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DES71895A Pending DE1300728B (de) | 1960-01-01 | 1960-12-30 | Totales Voraulfaufherbizid |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3234255A (enExample) |
| BE (1) | BE598730A (enExample) |
| CH (1) | CH423350A (enExample) |
| DE (1) | DE1300728B (enExample) |
| DK (1) | DK121023B (enExample) |
| FR (1) | FR1280847A (enExample) |
| GB (1) | GB949371A (enExample) |
| IT (1) | IT643195A (enExample) |
| MY (1) | MY6400128A (enExample) |
| NL (2) | NL259617A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2947772A1 (de) * | 1978-11-29 | 1980-06-12 | Montedison Spa | Praeparate zur behandlung und/oder immunisierung von nutzpflanzen gegen fungusinfektionen |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3310566A (en) * | 1963-11-18 | 1967-03-21 | American Home Prod | Substituted 4-piperidino-butyrophenone oximes |
| US3394181A (en) * | 1964-06-29 | 1968-07-23 | Sterling Drug Inc | Phenoxy-lower-alkyl-amidoximes and phenylamino-lower-alkyl-amidoximes |
| US3448199A (en) * | 1966-01-20 | 1969-06-03 | American Cyanamid Co | Phthalaldehyde dioximes as microbiocides |
| US3408176A (en) * | 1966-06-27 | 1968-10-29 | Gulf Research Development Co | Chemical control of pigweed |
| US3493614A (en) * | 1966-10-17 | 1970-02-03 | Geigy Chem Corp | O-acrylyl- and o-methacrylyl amidoximes |
| US3483246A (en) * | 1966-12-05 | 1969-12-09 | Mobil Oil Corp | Aromatic glyoxynitrile oximino carbanates |
| US3655751A (en) * | 1968-01-03 | 1972-04-11 | Velsicol Chemical Corp | N o-dicarbamoyl-n-phenylhydroxyl-amines |
| US3687998A (en) * | 1968-12-16 | 1972-08-29 | Robert D Trepka | Aliphatic sulfonoxyphenylureas |
| US3495968A (en) * | 1969-04-17 | 1970-02-17 | Mobil Oil Corp | Herbicidal composition and method of use |
| US3694482A (en) * | 1970-04-15 | 1972-09-26 | Exxon Research Engineering Co | Malononitrile oxime derivatives |
| US3852339A (en) * | 1970-06-15 | 1974-12-03 | Squibb & Sons Inc | Aminoalkoxyphenylurea derivatives |
| JPS5644044B2 (enExample) * | 1972-02-26 | 1981-10-16 | ||
| US4018645A (en) | 1972-03-16 | 1977-04-19 | Somar Manufacturing Co., Ltd. | Method of controlling slime during paper manufacture using alpha-chloro-acylbenzaldoxime derivatives |
| GB1516404A (en) * | 1975-04-22 | 1978-07-05 | Fujisawa Pharmaceutical Co | Carbonic acid esters and the preparation thereof |
| US4014915A (en) * | 1975-04-22 | 1977-03-29 | Fujisawa Pharmaceutical Co., Ltd. | Oxime carbonates |
| CH624552A5 (enExample) * | 1975-09-04 | 1981-08-14 | Ciba Geigy Ag | |
| GB1538097A (en) * | 1976-01-26 | 1979-01-10 | Lafon Labor | Substituted phenyl-amidines |
| US4123255A (en) * | 1977-01-03 | 1978-10-31 | Chevron Research Company | O-sulfonyl-alpha-cyano 2,6-dihalobenzaldoximes |
| US4125397A (en) * | 1977-01-03 | 1978-11-14 | Chevron Research Company | O-Sulfonyl-alpha-halo-2,6-dihalobenzaldoximes |
| IT1110460B (it) * | 1977-03-02 | 1985-12-23 | Ciba Geigy Ag | Prodotti che favoriscono la crescita delle piante e prodotti che proteggono le piante a base di eteri di ossime e di esteri di ossime loro preparazione e loro impiego |
| CH632130A5 (en) * | 1977-03-02 | 1982-09-30 | Ciba Geigy Ag | Compositions on the basis of oxime ethers, oxime esters or oxime carbamates which are suitable in agriculture for crop protection |
| US4294772A (en) * | 1978-08-31 | 1981-10-13 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
| US4416686A (en) * | 1978-08-31 | 1983-11-22 | Ciba-Geigy Corporation | 3,4-Dichlorophenylacetonitrile-N-tert.butylcarbamoyloxy ether for the protection of crops against injury by herbicides |
| US4347372A (en) * | 1978-09-01 | 1982-08-31 | Ciba-Geigy Corporation | Benzoxazolyl-glyoxylonitrile-2-oxime ether derivatives |
| US4270947A (en) * | 1979-07-02 | 1981-06-02 | Stauffer Chemical Company | α-(Phenylazo)-2,6-dichlorobenzaldimino esters and their use as herbicides |
| US4490167A (en) * | 1979-08-06 | 1984-12-25 | Ciba-Geigy Corporation | Oxime derivatives of diphenyl ethers and their use in herbicidal compositions |
| PH17601A (en) * | 1981-08-10 | 1984-10-05 | Sumitomo Chemical Co | Trifluoromethanessulfonanilides,and their use |
| US4564386A (en) * | 1982-08-03 | 1986-01-14 | Sumitomo Chemical Company, Limited | Trifluoromethanesulfonanilides, and their production and use |
| DE3520618A1 (de) * | 1985-06-08 | 1986-12-11 | Bayer Ag, 5090 Leverkusen | Fungizide mittel auf benzaldoxim-derivat-basis |
| DE3520943A1 (de) * | 1985-06-12 | 1986-12-18 | Bayer Ag, 5090 Leverkusen | Benzaldoxim-carbamat-derivate |
| DE3608383A1 (de) * | 1986-03-13 | 1987-09-17 | Bayer Ag | Arylsulfonyl-pyridinaldoxim-derivate |
| DE3608382A1 (de) * | 1986-03-13 | 1987-09-17 | Bayer Ag | Phenylsulfonyl-pyridinaldoxime |
| DE3707687A1 (de) * | 1987-03-11 | 1988-09-22 | Bayer Ag | Benzaldoxim-carbamat-derivate |
| DE3708320A1 (de) * | 1987-03-14 | 1988-09-22 | Bayer Ag | Benzaldoxim-derivate |
| DE3712632A1 (de) * | 1987-04-14 | 1988-10-27 | Bayer Ag | (alpha)-methylsulfonyl-benzaldoxim-carbamate |
| DE3712631A1 (de) * | 1987-04-14 | 1988-10-27 | Bayer Ag | (alpha)-methylsulfonyl-benzaldoxim-derivate |
| JP3086062B2 (ja) | 1992-05-28 | 2000-09-11 | 株式会社片山化学工業研究所 | 海生付着生物の付着防止剤 |
| EP0941988A3 (de) * | 1998-03-10 | 2000-09-20 | Basf Aktiengesellschaft | Neue Benzamidoxim-Derivate, Zwischenprodukte und Verfahren zu deren Herstellung und deren Verwendung als Fungizide |
| US7781412B2 (en) * | 2006-02-24 | 2010-08-24 | Boise State University | Biphenyl inhibitors of carbonyl reductase |
| US7727967B2 (en) * | 2006-02-24 | 2010-06-01 | Boise State University | Cyanooxime inhibitors of carbonyl reductase and methods of using said inhibitors in treatments involving anthracyclines |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1996007A (en) * | 1933-07-27 | 1935-03-26 | Du Pont | Preparation of-2-chloro-6-nitro-benzaldoxime |
| US2201156A (en) * | 1939-04-22 | 1940-05-21 | Dow Chemical Co | Ethers |
| US2435274A (en) * | 1943-06-24 | 1948-02-03 | Rohm & Haas | Control of insects |
| US2486090A (en) * | 1946-09-20 | 1949-10-25 | American Cyanamid Co | Preparation of organic thiocyanates |
| US2668115A (en) * | 1952-08-05 | 1954-02-02 | Dow Chemical Co | Method of controlling stem-end decay and mold on citrus fruits |
| DE1163600B (de) * | 1958-11-28 | 1964-02-20 | Diamond Alkali Co | Fungizides und nematozides Pflanzenschutzmittel |
-
0
- IT IT643195D patent/IT643195A/it unknown
- NL NL111264D patent/NL111264C/xx active
- BE BE598730D patent/BE598730A/xx unknown
- NL NL259617D patent/NL259617A/xx unknown
-
1960
- 1960-01-01 GB GB131/60A patent/GB949371A/en not_active Expired
- 1960-12-30 DE DES71895A patent/DE1300728B/de active Pending
- 1960-12-30 FR FR848469A patent/FR1280847A/fr not_active Expired
- 1960-12-30 CH CH1459860A patent/CH423350A/de unknown
-
1961
- 1961-01-02 DK DK661AA patent/DK121023B/da unknown
- 1961-11-16 US US152923A patent/US3234255A/en not_active Expired - Lifetime
-
1964
- 1964-12-31 MY MY1964128A patent/MY6400128A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2947772A1 (de) * | 1978-11-29 | 1980-06-12 | Montedison Spa | Praeparate zur behandlung und/oder immunisierung von nutzpflanzen gegen fungusinfektionen |
Also Published As
| Publication number | Publication date |
|---|---|
| NL111264C (enExample) | |
| GB949371A (en) | 1964-02-12 |
| FR1280847A (fr) | 1962-01-08 |
| US3234255A (en) | 1966-02-08 |
| CH423350A (de) | 1966-10-31 |
| BE598730A (enExample) | |
| DK121023B (da) | 1971-08-23 |
| IT643195A (enExample) | |
| NL259617A (enExample) | |
| MY6400128A (en) | 1964-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1300728B (de) | Totales Voraulfaufherbizid | |
| DE2122636A1 (de) | Aminothiophenderivate und deren Verwendung als Pesticide | |
| DE2320550A1 (de) | Verfahren zur verbesserung der haftung von bituminoesen substanzen an gesteinsmaterialien und dafuer geeignete zusaetze | |
| DE1276402B (de) | Herbizide Mittel mit einem Gehalt an Halogenthiobenzamiden | |
| DE1039304B (de) | Unkrautbekaempfungsmittel | |
| DE935165C (de) | Mittel zur Unkrautvernichtung | |
| DE1518333A1 (de) | N,N-substituierte 4-Methylsulfonyl-2,6-dinitroaniline und Verfahren zu ihrer Herstellung | |
| DE2118317A1 (enExample) | ||
| CH622674A5 (en) | Herbicide | |
| DE1144969B (de) | Fungizide Mittel | |
| DE2259221A1 (de) | Phenylformamidine zur beeinflussung des pflanzenwachstums | |
| EP0098972A2 (de) | Neue 5-Phenoxybenzisothiazol-4'-harnstoffderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE1944525C3 (de) | Anilinoalkanohydroxamsäureverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als herbicide Mittel | |
| DE2001770A1 (de) | Amidothionophorsaeureester,Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE1027460B (de) | Bekaempfung von Pilzen und Bakterien | |
| DE1906050C3 (de) | S-Alkyi-dnethyl-hexahydro-lHazepin)-1 -carbothiolate | |
| EP0585199A1 (de) | Selektiv-herbizides Mittel | |
| DE1278701B (de) | Fungizides Mittel | |
| DE2244745C3 (de) | Thiocarbaminsäureester, ihre Herstellung und diese Ester enthaltende pestizide Mittel | |
| DE1542999A1 (de) | Polymeres Thiadiazinthion und seine Anwendung | |
| DE1445937B2 (de) | N,n'-diallyl-4,4'-bipyridyliumsalze und verwendung derselben als herbizide wirkstoffe | |
| CH570759A5 (en) | 2-Acylamino-5-halo-1,3,4-thiadiazoles as pesticides - e.g. 2-chloroacetamido-5-bromo-1,3,4-thiadiazole | |
| DE1296455B (de) | Verfahren zur Foerderung des Pflanzenwachstums | |
| DE885175C (de) | Verfahren zum Feinverteilen von festen oder fluessigen Substanzen, ins-besondere Schaedlingsbekaempfungsmitteln und in der Kosmetik oder Pharmazie verwendbaren Stoffen, auf pulverfoermigen Substraten | |
| AT267958B (de) | Herbizide Zubereitung |