DE1297614B - Verfahren zur Herstellung von aromatischen Bis-arylamino-dicarbonsaeuren - Google Patents
Verfahren zur Herstellung von aromatischen Bis-arylamino-dicarbonsaeurenInfo
- Publication number
- DE1297614B DE1297614B DEP25603A DEP0025603A DE1297614B DE 1297614 B DE1297614 B DE 1297614B DE P25603 A DEP25603 A DE P25603A DE P0025603 A DEP0025603 A DE P0025603A DE 1297614 B DE1297614 B DE 1297614B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- aromatic
- dimethyl ester
- mol
- copper
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 24
- 125000003118 aryl group Chemical group 0.000 title claims description 21
- 238000002360 preparation method Methods 0.000 title claims description 3
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 21
- 150000002148 esters Chemical class 0.000 claims description 12
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 11
- -1 aromatic radicals Chemical class 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 239000010949 copper Substances 0.000 claims description 9
- 229910052802 copper Inorganic materials 0.000 claims description 9
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 9
- ZJQZWNLKRBUEKX-UHFFFAOYSA-N 2,5-dianilinoterephthalic acid Chemical compound OC(=O)C=1C=C(NC=2C=CC=CC=2)C(C(=O)O)=CC=1NC1=CC=CC=C1 ZJQZWNLKRBUEKX-UHFFFAOYSA-N 0.000 claims description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 8
- 238000009833 condensation Methods 0.000 claims description 8
- 230000005494 condensation Effects 0.000 claims description 8
- DYDNPESBYVVLBO-UHFFFAOYSA-N formanilide Chemical compound O=CNC1=CC=CC=C1 DYDNPESBYVVLBO-UHFFFAOYSA-N 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 claims description 4
- RDDWGNUSHLFXED-UHFFFAOYSA-N dimethyl 2,5-dichlorobenzene-1,4-dicarboxylate Chemical compound COC(=O)C1=CC(Cl)=C(C(=O)OC)C=C1Cl RDDWGNUSHLFXED-UHFFFAOYSA-N 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 230000020477 pH reduction Effects 0.000 claims description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 4
- 125000004185 ester group Chemical group 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 claims 1
- KFSVVYLLDJYPHA-UHFFFAOYSA-N dimethyl 2,5-dianilinobenzene-1,4-dicarboxylate Chemical compound COC(=O)C=1C=C(NC=2C=CC=CC=2)C(C(=O)OC)=CC=1NC1=CC=CC=C1 KFSVVYLLDJYPHA-UHFFFAOYSA-N 0.000 claims 1
- WCBGDOGUDDAXLJ-UHFFFAOYSA-N dimethyl 3,6-dichlorobenzene-1,2-dicarboxylate Chemical compound ClC1=C(C(C(=O)OC)=C(C=C1)Cl)C(=O)OC WCBGDOGUDDAXLJ-UHFFFAOYSA-N 0.000 claims 1
- QWQUWKXPOOVIPR-UHFFFAOYSA-N dimethyl 4,6-dichlorobenzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC(C(=O)OC)=C(Cl)C=C1Cl QWQUWKXPOOVIPR-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000001914 filtration Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 3
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Natural products O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- LMOSYFZLPBHEOW-UHFFFAOYSA-N 2,5-dichloroterephthalic acid Chemical compound OC(=O)C1=CC(Cl)=C(C(O)=O)C=C1Cl LMOSYFZLPBHEOW-UHFFFAOYSA-N 0.000 description 2
- RXWOHFUULDINMC-UHFFFAOYSA-N 2-(3-nitrothiophen-2-yl)acetic acid Chemical compound OC(=O)CC=1SC=CC=1[N+]([O-])=O RXWOHFUULDINMC-UHFFFAOYSA-N 0.000 description 2
- NGZJULVKWHXKMF-UHFFFAOYSA-N 2-anilinoterephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(NC=2C=CC=CC=2)=C1 NGZJULVKWHXKMF-UHFFFAOYSA-N 0.000 description 2
- DROXPSAQYJVHFQ-UHFFFAOYSA-N 4,6-dianilinobenzene-1,3-dicarboxylic acid Chemical compound N(C1=CC=CC=C1)C1=C(C=C(C(=O)O)C(=C1)NC1=CC=CC=C1)C(=O)O DROXPSAQYJVHFQ-UHFFFAOYSA-N 0.000 description 2
- LJASDYRQBLUXEZ-UHFFFAOYSA-N 4,6-dichlorobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(Cl)C=C1Cl LJASDYRQBLUXEZ-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 2
- FIHZPTWOTZIPHS-UHFFFAOYSA-N n-(2-fluorophenyl)formamide Chemical compound FC1=CC=CC=C1NC=O FIHZPTWOTZIPHS-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 1
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical class NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 description 1
- APXJCBXRWUSIMM-UHFFFAOYSA-N 2,5-bis(3-methylanilino)terephthalic acid Chemical compound CC1=CC=CC(NC=2C(=CC(NC=3C=C(C)C=CC=3)=C(C(O)=O)C=2)C(O)=O)=C1 APXJCBXRWUSIMM-UHFFFAOYSA-N 0.000 description 1
- VUTICWRXMKBOSF-UHFFFAOYSA-N 2,5-dibromoterephthalic acid Chemical compound OC(=O)C1=CC(Br)=C(C(O)=O)C=C1Br VUTICWRXMKBOSF-UHFFFAOYSA-N 0.000 description 1
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 1
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 1
- RQKFYFNZSHWXAW-UHFFFAOYSA-N 3-chloro-p-toluidine Chemical compound CC1=CC=C(N)C=C1Cl RQKFYFNZSHWXAW-UHFFFAOYSA-N 0.000 description 1
- UDCSURCKPULYEL-UHFFFAOYSA-N 4,6-dibromobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(Br)C=C1Br UDCSURCKPULYEL-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WATVKUKXTKWHRP-UHFFFAOYSA-N [K].[Br] Chemical compound [K].[Br] WATVKUKXTKWHRP-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- XVOMHXSMRIJNDW-UHFFFAOYSA-N copper(1+);nitrate Chemical compound [Cu+].[O-][N+]([O-])=O XVOMHXSMRIJNDW-UHFFFAOYSA-N 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- NWFNSTOSIVLCJA-UHFFFAOYSA-L copper;diacetate;hydrate Chemical compound O.[Cu+2].CC([O-])=O.CC([O-])=O NWFNSTOSIVLCJA-UHFFFAOYSA-L 0.000 description 1
- CZZBXGOYISFHRY-UHFFFAOYSA-N copper;hydroiodide Chemical compound [Cu].I CZZBXGOYISFHRY-UHFFFAOYSA-N 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- ZJXBEXRSXKGGHS-UHFFFAOYSA-N diethyl 2,5-dianilinocyclohexa-1,4-diene-1,4-dicarboxylate Chemical compound C1C(C(=O)OCC)=C(NC=2C=CC=CC=2)CC(C(=O)OCC)=C1NC1=CC=CC=C1 ZJXBEXRSXKGGHS-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- VUMPFOPENBVFOF-UHFFFAOYSA-N dimethyl 2-bromobenzene-1,4-dicarboxylate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C(Br)=C1 VUMPFOPENBVFOF-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical class II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 description 1
- LMLFHXMNNHGRRO-UHFFFAOYSA-N n-(4-chlorophenyl)formamide Chemical compound ClC1=CC=C(NC=O)C=C1 LMLFHXMNNHGRRO-UHFFFAOYSA-N 0.000 description 1
- OSKSYESYIGCEOW-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)formamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC=O OSKSYESYIGCEOW-UHFFFAOYSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical group CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- ZLMJMSJWJFRBEC-OUBTZVSYSA-N potassium-40 Chemical group [40K] ZLMJMSJWJFRBEC-OUBTZVSYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/14—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof
- C07C227/18—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof by reactions involving amino or carboxyl groups, e.g. hydrolysis of esters or amides, by formation of halides, salts or esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/52—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C229/54—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton with amino and carboxyl groups bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C229/56—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton with amino and carboxyl groups bound to carbon atoms of the same non-condensed six-membered aromatic ring with amino and carboxyl groups bound in ortho-position
- C07C229/58—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton with amino and carboxyl groups bound to carbon atoms of the same non-condensed six-membered aromatic ring with amino and carboxyl groups bound in ortho-position having the nitrogen atom of at least one of the amino groups further bound to a carbon atom of a six-membered aromatic ring, e.g. N-phenyl-anthranilic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/06—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members
- C07C2603/10—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings
- C07C2603/12—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings only one five-membered ring
- C07C2603/18—Fluorenes; Hydrogenated fluorenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US840489A US3153667A (en) | 1959-09-02 | 1959-09-02 | Process for producing diarylamino aromatic dicarboxylic acids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1297614B true DE1297614B (de) | 1969-06-19 |
Family
ID=25282513
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP25603A Pending DE1297614B (de) | 1959-09-02 | 1960-08-30 | Verfahren zur Herstellung von aromatischen Bis-arylamino-dicarbonsaeuren |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3153667A (en, 2012) |
| CH (1) | CH390271A (en, 2012) |
| DE (1) | DE1297614B (en, 2012) |
| FR (1) | FR1264157A (en, 2012) |
| GB (1) | GB961305A (en, 2012) |
| NL (1) | NL255441A (en, 2012) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4339994A1 (de) * | 1993-11-24 | 1995-06-01 | Chemie Linz Deutschland | Chinacridonsynthese und Verfahren zur Herstellung von Zwischenprodukten |
| US5491255A (en) * | 1993-10-19 | 1996-02-13 | Chemie Linz Gmbh | Process for the transesterification of dimethyl succinylsuccinate |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10141266A1 (de) * | 2001-08-21 | 2003-03-06 | Syntec Ges Fuer Chemie Und Tec | Elektrolumineszierende Derivate der 2,5-Diamino-terephthalsäure und deren Verwendung in organischen Leuchtdioden |
| AU2003221303A1 (en) * | 2002-02-27 | 2003-09-22 | Hirose Engineering Co., Ltd. | Yellow-emitting compounds, process for the production thereof, yellow-emitting devices and white-emitting devices |
| EP3184509A1 (en) * | 2015-12-24 | 2017-06-28 | Centre National De La Recherche Scientifique (Cnrs) | Compounds for the detection, capture and/or separation of polluting gases |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE148179C (en, 2012) * | ||||
| CH172073A (de) * | 1932-11-17 | 1934-09-30 | Ig Farbenindustrie Ag | Verfahren zur Darstellung eines Nitroarylaminoarylamins. |
| US2830990A (en) * | 1956-01-13 | 1958-04-15 | Du Pont | Organic pigment |
| US2924620A (en) * | 1959-03-30 | 1960-02-09 | Du Pont | Process for the preparation of diphenylamines |
-
0
- NL NL255441D patent/NL255441A/xx unknown
-
1959
- 1959-09-02 US US840489A patent/US3153667A/en not_active Expired - Lifetime
-
1960
- 1960-06-28 FR FR831328A patent/FR1264157A/fr not_active Expired
- 1960-08-12 CH CH921260A patent/CH390271A/de unknown
- 1960-08-22 GB GB28994/60A patent/GB961305A/en not_active Expired
- 1960-08-30 DE DEP25603A patent/DE1297614B/de active Pending
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5491255A (en) * | 1993-10-19 | 1996-02-13 | Chemie Linz Gmbh | Process for the transesterification of dimethyl succinylsuccinate |
| US5659076A (en) * | 1993-10-19 | 1997-08-19 | Dsm Chemie Linz Gmbh | Process for the production of 2,5-dianilino-terephthalic acids |
| DE4339994A1 (de) * | 1993-11-24 | 1995-06-01 | Chemie Linz Deutschland | Chinacridonsynthese und Verfahren zur Herstellung von Zwischenprodukten |
Also Published As
| Publication number | Publication date |
|---|---|
| US3153667A (en) | 1964-10-20 |
| FR1264157A (fr) | 1961-06-19 |
| NL255441A (en, 2012) | |
| GB961305A (en) | 1964-06-17 |
| CH390271A (de) | 1965-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2148866C3 (de) | Chinacridonpigmentgemische und Verfahren zu ihrer Herstellung | |
| DE1297614B (de) | Verfahren zur Herstellung von aromatischen Bis-arylamino-dicarbonsaeuren | |
| DE929805C (de) | Verfahren zur Herstellung von Nickel- oder Kobalttetra-aza-porphinen bzw. ihren alkyl- und cycloalkylsubstituierten Derivaten | |
| DE1569603C3 (de) | Verfahren zur Herstellung von Oxazinfarbstoffen | |
| CH627733A5 (de) | Verfahren zur herstellung reiner substituierter 2,5-diarylaminoterephthalsaeureester. | |
| DE2247971C3 (de) | Verfahren zur Herstellung von 3'-Hydroxychinophthalonen | |
| CH629743A5 (de) | Verfahren zur herstellung von optisch aktiven anthracyclinonen. | |
| DE908288C (de) | Verfahren zur Herstellung von Tetra-aza-porphinfarbstoffen | |
| DE1098652B (de) | Verfahren zur Herstellung von Farbstoffen der Triphenylrosanilinreihe | |
| DE2407003A1 (de) | Neue naphthalin-tetracarbonsaeurederivate und verfahren zu ihrer herstellung | |
| US2128684A (en) | Chrysene carboxylic acids and a process of preparing them | |
| DE924764C (de) | Verfahren zur Herstellung von Metallphthalocyaninen | |
| EP0367067A2 (de) | Verfahren zur Herstellung von Küpenfarbstoffen und Pigmenten der Perinon-Reihe | |
| DE906935C (de) | Verfahren zur Herstellung von Isolierung von Zwischenprodukten der Phthalocyaninsynthese | |
| DE2337023A1 (de) | Neue aromatische aldehyde | |
| DE634968C (de) | Verfahren zur Herstellung von ª‰-Azabenzanthronen | |
| DE1956511A1 (de) | 3,3-Bis-(nitroaryloxyaryl)-phthalide und -phthalimidine und ein Verfahren zu ihrer Herstellung | |
| DE2353580C2 (de) | Verfahren zur Herstellung von o-Acylamino-diarylverbindungen | |
| DE2255117A1 (de) | Herstellung von phthalocyaninverbindungen | |
| DE911647C (de) | Verfahren zur Herstellung metallhaltiger Phthalocyanine | |
| DE1960896B2 (de) | Lineare trans-Chinacridon-Pigmente, Verfahren zu ihrer Herstellung und mit ihnen gefärbte Lacke, Druckfarben und Kunststoffe | |
| DE2215048A1 (de) | Verfahren zur herstellung von 2eckige klammer auf bis-(4', 4"-dialkylamino)benzhydryl eckige klammer zu -5-aminobenzoesaeuren | |
| DE2256663A1 (de) | Verfahren zur herstellung von chloranthrachinon-2,3-dicarbonsaeureanhydriden | |
| DE2415748A1 (de) | Verfahren zur herstellung von polyhalogenierten nicotinsaeuren | |
| DE1238596B (de) | Verfahren zur Herstellung von Chinacridonen |