DE1295558B - ª-Carboxybenzyl- und ª-Carboxythienylmethylpenicilline und Verfahren zu ihrer Herstellung - Google Patents
ª-Carboxybenzyl- und ª-Carboxythienylmethylpenicilline und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE1295558B DE1295558B DEB76480A DEB0076480A DE1295558B DE 1295558 B DE1295558 B DE 1295558B DE B76480 A DEB76480 A DE B76480A DE B0076480 A DEB0076480 A DE B0076480A DE 1295558 B DE1295558 B DE 1295558B
- Authority
- DE
- Germany
- Prior art keywords
- group
- acid
- carboxy
- ecm
- penicillin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims 2
- 229930182555 Penicillin Natural products 0.000 claims description 22
- -1 hydroxy, methoxy Chemical group 0.000 claims description 17
- 229940049954 penicillin Drugs 0.000 claims description 16
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims description 11
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 150000002960 penicillins Chemical class 0.000 claims description 7
- 229960003669 carbenicillin Drugs 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 238000010306 acid treatment Methods 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims 2
- 150000004820 halides Chemical class 0.000 claims 1
- OHKOGUYZJXTSFX-KZFFXBSXSA-N ticarcillin Chemical compound C=1([C@@H](C(O)=O)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)C=CSC=1 OHKOGUYZJXTSFX-KZFFXBSXSA-N 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 239000000243 solution Substances 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 14
- 238000004816 paper chromatography Methods 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 9
- 108700023418 Amidases Proteins 0.000 description 8
- 102000005922 amidase Human genes 0.000 description 8
- 239000008346 aqueous phase Substances 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- 229940056360 penicillin g Drugs 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 235000019371 penicillin G benzathine Nutrition 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 230000003115 biocidal effect Effects 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- WWYDYZMNFQIYPT-UHFFFAOYSA-N ru78191 Chemical compound OC(=O)C(C(O)=O)C1=CC=CC=C1 WWYDYZMNFQIYPT-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- 241000588724 Escherichia coli Species 0.000 description 3
- 241000108056 Monas Species 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- QSBAHMROFICXDC-UHFFFAOYSA-N 3-oxo-2-phenyl-3-phenylmethoxypropanoic acid Chemical compound C=1C=CC=CC=1C(C(=O)O)C(=O)OCC1=CC=CC=C1 QSBAHMROFICXDC-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- LVKCSZQWLOVUGB-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].C[CH-]C LVKCSZQWLOVUGB-UHFFFAOYSA-M 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 1
- GBHGMLJWDLOWTF-UHFFFAOYSA-N 2-(3-hydroxyphenyl)propanedioic acid Chemical compound OC=1C=C(C=CC1)C(C(=O)O)C(=O)O GBHGMLJWDLOWTF-UHFFFAOYSA-N 0.000 description 1
- NBFYQNBRQNGPJJ-UHFFFAOYSA-N 2-(3-phenylmethoxycarbonyloxyphenyl)propanedioic acid Chemical compound C(C1=CC=CC=C1)OC(=O)OC=1C=C(C=CC1)C(C(=O)O)C(=O)O NBFYQNBRQNGPJJ-UHFFFAOYSA-N 0.000 description 1
- CSEWAUGPAQPMDC-UHFFFAOYSA-N 2-(4-aminophenyl)acetic acid Chemical compound NC1=CC=C(CC(O)=O)C=C1 CSEWAUGPAQPMDC-UHFFFAOYSA-N 0.000 description 1
- HHHSHEZZJKIWLA-UHFFFAOYSA-N 2-(4-aminophenyl)propanedioic acid Chemical compound NC1=CC=C(C(C(O)=O)C(O)=O)C=C1 HHHSHEZZJKIWLA-UHFFFAOYSA-N 0.000 description 1
- HCEMITLHDQCRBV-UHFFFAOYSA-N 2-(4-chlorophenyl)propanedioic acid Chemical compound OC(=O)C(C(O)=O)C1=CC=C(Cl)C=C1 HCEMITLHDQCRBV-UHFFFAOYSA-N 0.000 description 1
- HKGWZPGNUJEGCT-UHFFFAOYSA-N 2-(4-methoxyphenyl)propanedioic acid Chemical compound COC1=CC=C(C(C(O)=O)C(O)=O)C=C1 HKGWZPGNUJEGCT-UHFFFAOYSA-N 0.000 description 1
- GCOOGCQWQFRJEK-UHFFFAOYSA-N 2-thiophen-3-ylpropanedioic acid Chemical compound OC(=O)C(C(O)=O)C=1C=CSC=1 GCOOGCQWQFRJEK-UHFFFAOYSA-N 0.000 description 1
- JGSARLDLIJGVTE-UHFFFAOYSA-N 3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-UHFFFAOYSA-N 0.000 description 1
- FVMDYYGIDFPZAX-UHFFFAOYSA-N 3-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=CC(O)=C1 FVMDYYGIDFPZAX-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- PGXNQKRQGMFNBC-UHFFFAOYSA-N O=[S-2].[Na+].[Na+] Chemical class O=[S-2].[Na+].[Na+] PGXNQKRQGMFNBC-UHFFFAOYSA-N 0.000 description 1
- NASRDENTZCCAPN-UHFFFAOYSA-N OC([Na])=O Chemical class OC([Na])=O NASRDENTZCCAPN-UHFFFAOYSA-N 0.000 description 1
- 108010087702 Penicillinase Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- 238000003916 acid precipitation Methods 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- MPCQNSCUKOECNW-UHFFFAOYSA-N butan-1-ol;ethanol Chemical compound CCO.CCCCO MPCQNSCUKOECNW-UHFFFAOYSA-N 0.000 description 1
- ZYFYTWZIMOACBS-UHFFFAOYSA-N butan-1-ol;ethanol;hydrate Chemical compound O.CCO.CCCCO ZYFYTWZIMOACBS-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- ACYBVNYNIZTUIL-UHFFFAOYSA-N n'-benzylethane-1,2-diamine Chemical compound NCCNCC1=CC=CC=C1 ACYBVNYNIZTUIL-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229950009506 penicillinase Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB15889/63A GB1004670A (en) | 1963-04-23 | 1963-04-23 | Penicillins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1295558B true DE1295558B (de) | 1969-05-22 |
Family
ID=10067366
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB76480A Pending DE1295558B (de) | 1963-04-23 | 1964-04-23 | ª-Carboxybenzyl- und ª-Carboxythienylmethylpenicilline und Verfahren zu ihrer Herstellung |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3282926A (Direct) |
| AT (1) | AT259759B (Direct) |
| BE (1) | BE646991A (Direct) |
| BR (1) | BR6458467D0 (Direct) |
| CH (1) | CH447173A (Direct) |
| CY (1) | CY428A (Direct) |
| DE (1) | DE1295558B (Direct) |
| DK (1) | DK118133B (Direct) |
| ES (1) | ES299038A1 (Direct) |
| FI (1) | FI44912C (Direct) |
| FR (1) | FR3684M (Direct) |
| GB (1) | GB1004670A (Direct) |
| NL (1) | NL142590B (Direct) |
| NO (1) | NO129633B (Direct) |
| SE (1) | SE337376B (Direct) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2334343A1 (de) * | 1972-07-12 | 1974-01-31 | Pfizer | Verfahren zur herstellung von 6-eckige klammer auf alpha-(carboxy)arylacetamido eckige klammer zu- penicillansaeureestern |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1125557A (en) * | 1966-05-13 | 1968-08-28 | Beecham Group Ltd | Penicillins |
| US3853849A (en) * | 1969-05-29 | 1974-12-10 | Beecham Group Ltd | Alpha(aryloxycarbonyl)-and alpha(alkoxy-carbonyl)-aralkyl penicillins |
| US3881013A (en) * | 1966-11-05 | 1975-04-29 | Beecham Group Ltd | Penicillin compositions and their administration |
| US3669980A (en) * | 1968-09-17 | 1972-06-13 | American Home Prod | 2-amido-6-amino penicillanic acids and related compounds |
| AT290728B (de) * | 1968-09-28 | 1971-05-15 | Takeda Chemical Industries Ltd | Verfahren zur herstellung neuer penicilline |
| GB1250970A (Direct) * | 1969-09-24 | 1971-10-27 | ||
| BE758350A (fr) * | 1969-12-30 | 1971-05-03 | Pfizer | Procede de fabrication des sels mono- et bi-metalliques alcalins de l'alpha-carboxybenzylpenicilline |
| US3697506A (en) * | 1970-08-07 | 1972-10-10 | Pfizer | Crystalline alkali metal salts of {60 -carboxybenzylpenicillin and process therefor |
| US3905960A (en) * | 1970-10-22 | 1975-09-16 | Beecham Inc | Crystalline anhydrous penicillins and preparation thereof |
| US3681342A (en) * | 1970-11-12 | 1972-08-01 | Pfizer | Esters of -carboxybenzylpenicillin |
| US3676427A (en) * | 1971-01-26 | 1972-07-11 | Pfizer | Process for the manufacture of the disodium salt of alpha-carboxybenzylpenicillin |
| DE2224121A1 (de) * | 1971-05-18 | 1973-01-18 | Vni Skij I Antibiotikow | Verfahren zur herstellung von alphaaminobenzylpenizillin |
| GB1424186A (en) * | 1971-10-08 | 1976-02-11 | Beecham Group Ltd | Penicillins |
| JPS4891218A (Direct) * | 1972-03-06 | 1973-11-28 | ||
| US4171303A (en) * | 1974-07-30 | 1979-10-16 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt. | Process for the preparation of reactive penicillanic acid and cephalosporanic acid derivatives |
| HU168914B (Direct) * | 1974-07-30 | 1976-08-28 | ||
| NZ182630A (en) * | 1975-11-21 | 1979-07-11 | Merck & Co Inc | Substituted n-methylene dervatives of thienamycin and pharmaceutical compositions |
| CH632509A5 (en) * | 1975-11-21 | 1982-10-15 | Merck & Co Inc | Process for preparing N-acyl derivatives and phosphorus-containing N-acyl derivatives of the antibiotic thienamycin |
| CH632508A5 (de) * | 1975-11-21 | 1982-10-15 | Merck & Co Inc | Verfahren zur herstellung von neuen estern des n-acylierten thienamycins. |
| US4236002A (en) | 1977-12-23 | 1980-11-25 | Yeda Research & Development Co., Ltd. | Cephalosporin derivatives |
| US4598074A (en) * | 1982-10-15 | 1986-07-01 | Beecham Group P.L.C. | β-lactam antibiotics |
| CN106117159B (zh) * | 2016-07-08 | 2018-10-16 | 上海上药新亚药业有限公司 | 一种羧苄西林钠杂质d的合成方法 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR617E (fr) * | 1901-09-16 | 1903-02-16 | Henriot Edouard | Une traverse en fer ou en acier avec cases pour rendre invariable l'écartement de la voie ferrée dans les courbes |
| GB874415A (en) * | 1959-05-25 | 1961-08-10 | Beecham Res Lab | Antibacterial agents |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2528174A (en) * | 1948-07-01 | 1950-10-31 | Lilly Co Eli | Procaine salts of biosynthetic penicillins |
| US3142673A (en) * | 1961-03-31 | 1964-07-28 | Pfizer & Co C | Derivatives of 6-aminopenicillanic acid |
-
1963
- 1963-04-23 GB GB15889/63A patent/GB1004670A/en not_active Expired
-
1964
- 1964-04-15 SE SE04665/64A patent/SE337376B/xx unknown
- 1964-04-16 BR BR158467/64A patent/BR6458467D0/pt unknown
- 1964-04-17 US US360760A patent/US3282926A/en not_active Expired - Lifetime
- 1964-04-21 NO NO00152913A patent/NO129633B/no unknown
- 1964-04-22 ES ES0299038A patent/ES299038A1/es not_active Expired
- 1964-04-22 NL NL646404384A patent/NL142590B/xx not_active IP Right Cessation
- 1964-04-22 FR FR971849A patent/FR3684M/fr active Active
- 1964-04-23 DE DEB76480A patent/DE1295558B/de active Pending
- 1964-04-23 BE BE646991A patent/BE646991A/xx unknown
- 1964-04-23 AT AT357964A patent/AT259759B/de active
- 1964-04-23 CH CH526164A patent/CH447173A/de unknown
- 1964-04-23 DK DK202964AA patent/DK118133B/da unknown
- 1964-04-23 FI FI640858A patent/FI44912C/fi active
-
1968
- 1968-01-08 CY CY42868A patent/CY428A/xx unknown
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR617E (fr) * | 1901-09-16 | 1903-02-16 | Henriot Edouard | Une traverse en fer ou en acier avec cases pour rendre invariable l'écartement de la voie ferrée dans les courbes |
| GB874415A (en) * | 1959-05-25 | 1961-08-10 | Beecham Res Lab | Antibacterial agents |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2334343A1 (de) * | 1972-07-12 | 1974-01-31 | Pfizer | Verfahren zur herstellung von 6-eckige klammer auf alpha-(carboxy)arylacetamido eckige klammer zu- penicillansaeureestern |
Also Published As
| Publication number | Publication date |
|---|---|
| NL142590B (nl) | 1974-07-15 |
| US3282926A (en) | 1966-11-01 |
| ES299038A1 (es) | 1964-08-16 |
| CH447173A (de) | 1967-11-30 |
| GB1004670A (en) | 1965-09-15 |
| BR6458467D0 (pt) | 1973-09-20 |
| FR3684M (fr) | 1965-11-15 |
| AT259759B (de) | 1968-02-12 |
| NL6404384A (Direct) | 1964-10-26 |
| SE337376B (Direct) | 1971-08-09 |
| BE646991A (Direct) | 1964-08-17 |
| DK118133B (da) | 1970-07-13 |
| FI44912C (fi) | 1972-02-10 |
| FI44912B (Direct) | 1971-11-01 |
| NO129633B (Direct) | 1974-05-06 |
| CY428A (en) | 1968-01-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1295558B (de) | ª-Carboxybenzyl- und ª-Carboxythienylmethylpenicilline und Verfahren zu ihrer Herstellung | |
| CH493528A (de) | Verfahren zur Herstellung neuer substituierter Aminopyrimidine | |
| DE68912160T2 (de) | Verfahren zur Herstellung von beta-Lactamderivaten. | |
| DE1670625A1 (de) | 7-alpha-Aminobenzyl-3-methylcephalosporinanaloge und ihre Herstellung | |
| DE1302847C2 (de) | Verfahren zur herstellung von alphaaminobenzylpenicillin | |
| DE2324272A1 (de) | 3-methylencephalosporine | |
| EP0293753A2 (de) | Verfahren zur Herstellung von E-2-Propyl-2-pentensäure und physiologisch verträglichen Salzen derselben | |
| DE1670222C3 (de) | a-(Benzyloxycarbonyl)-thienyunethylpenicilline und deren Salze, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antibakterielle Mittel | |
| DE1143817B (de) | Verfahren zur Herstellung von 6-Phenoxyacylamidopenicillansaeure-derivaten und von nicht giftigen Salzen derselben | |
| EP0722946A1 (de) | Verfahren zur Herstellung von 3-Formyl-Cephem-Derivaten | |
| DE69020240T2 (de) | Verfahren zur Herstellung von Beta-lactamase-Inhibitoren. | |
| DE2902292C2 (de) | Verfahren zur Herstellung von 2,4-Diaminobuttersäure oder 4-Amino-2-hydroxybuttersäure | |
| DE1289053B (de) | ª‡-Hydroxy-2-thienylmethyl-penicilline und Verfahren zur ihrer Herstellung | |
| DE1156078C2 (de) | Verfahren zur Herstellung von D(-)-ª‡-Aminobenzylpenicillin und von L(+)-ª‡-Aminobenzylpenicillin | |
| DE1445685A1 (de) | Antibiotisch wirksame Cephalospransaeurederivate und Verfahren zu ihrer Herstellung | |
| DE2251290C3 (de) | α-Sulfo-p-aminobenzylpenicillin | |
| DE1770855B2 (de) | Verfahren zur Herstellung von N-Trialkylsilyl-6-aminopenicillansäuretrialkylsilylestern. Ausscheidung aus: 1420981 | |
| DE2550151A1 (de) | Neue cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| AT226364B (de) | Verfahren zur Herstellung von neuen Penicillinderivaten | |
| CH407126A (de) | Verfahren zur Herstellung von epimeren a-Amino-benzylpenicillinen | |
| DE1294383B (de) | Penicilline und deren Salze sowie Verfahren zu ihrer Herstellung | |
| CH393330A (de) | Verfahren zur Herstellung von a-Aminobenzylpenicillinen | |
| DE1545838C3 (de) | 7-(2-Azidooctanamido)-cephalosporansäure, deren Salze und Verfahren zur Herstellung dieser Verbindungen | |
| DE1445419C (de) | Verfahren zur Herstellung von 6 (alpha Aminoacylamino) pemcillansauren | |
| DE2058110A1 (de) | Neue,antibakteriell wirksame Ester von alpha-Carboxybenzylpenicillin |