DE1252201B - Verfahren zur Herstellung von Benzolsulfonylharnstoffen - Google Patents
Verfahren zur Herstellung von BenzolsulfonylharnstoffenInfo
- Publication number
- DE1252201B DE1252201B DE1966F0049329 DEF0049329A DE1252201B DE 1252201 B DE1252201 B DE 1252201B DE 1966F0049329 DE1966F0049329 DE 1966F0049329 DE F0049329 A DEF0049329 A DE F0049329A DE 1252201 B DE1252201 B DE 1252201B
- Authority
- DE
- Germany
- Prior art keywords
- benzenesulfonyl
- urea
- ethyl
- methanol
- molecular weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 4
- 238000002844 melting Methods 0.000 claims description 40
- 230000008018 melting Effects 0.000 claims description 40
- -1 4- (γ- {2-methoxy-5-bromobenzamido} propyl) -benzenesulfonamide sodium Chemical compound 0.000 claims description 30
- 235000013877 carbamide Nutrition 0.000 claims description 24
- 239000004202 carbamide Substances 0.000 claims description 23
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 17
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 239000000155 melt Substances 0.000 claims description 7
- 150000003672 ureas Chemical class 0.000 claims description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 6
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims description 6
- 239000000706 filtrate Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 150000008331 benzenesulfonamides Chemical class 0.000 claims description 3
- 150000001714 carbamic acid halides Chemical class 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 239000012948 isocyanate Substances 0.000 claims description 3
- 150000002513 isocyanates Chemical class 0.000 claims description 3
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 210000002700 urine Anatomy 0.000 claims description 3
- 230000010933 acylation Effects 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 239000003610 charcoal Substances 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 2
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- VNMLVHLVBFHHSN-UHFFFAOYSA-N thiophen-2-ylcarbamic acid Chemical class OC(=O)NC1=CC=CS1 VNMLVHLVBFHHSN-UHFFFAOYSA-N 0.000 claims description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 claims 2
- 241000282619 Hylobates lar Species 0.000 claims 1
- 229940100389 Sulfonylurea Drugs 0.000 claims 1
- 239000008346 aqueous phase Substances 0.000 claims 1
- 230000004888 barrier function Effects 0.000 claims 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 claims 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 156
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- 239000008280 blood Substances 0.000 description 10
- 210000004369 blood Anatomy 0.000 description 10
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 9
- GTCAXTIRRLKXRU-UHFFFAOYSA-N carbamic acid methyl ester Natural products COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000283973 Oryctolagus cuniculus Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- PNZOMJKWVDVPIE-UHFFFAOYSA-N (4,4-dimethylcyclohexyl)urea Chemical compound CC1(C)CCC(NC(N)=O)CC1 PNZOMJKWVDVPIE-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VDTXCHSYBRHTLC-UHFFFAOYSA-N 1,1-diethyl-4-isocyanatocyclohexane Chemical compound CCC1(CC)CCC(N=C=O)CC1 VDTXCHSYBRHTLC-UHFFFAOYSA-N 0.000 description 1
- RYPVUNGPPCYIDC-UHFFFAOYSA-N 1,4-dioxane;propan-2-one Chemical compound CC(C)=O.C1COCCO1 RYPVUNGPPCYIDC-UHFFFAOYSA-N 0.000 description 1
- NYXLNMRJIFWVRN-UHFFFAOYSA-N 2-methoxy-n-[(4-sulfamoylphenyl)methyl]benzamide Chemical compound COC1=CC=CC=C1C(=O)NCC1=CC=C(S(N)(=O)=O)C=C1 NYXLNMRJIFWVRN-UHFFFAOYSA-N 0.000 description 1
- PKVFZJADFGHKEM-UHFFFAOYSA-N 3,4-dimethylcyclohexan-1-amine Chemical compound CC1CCC(N)CC1C PKVFZJADFGHKEM-UHFFFAOYSA-N 0.000 description 1
- RDEGOEYUQCUBPE-UHFFFAOYSA-N 3-ethoxythiophene Chemical compound CCOC=1C=CSC=1 RDEGOEYUQCUBPE-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 150000007945 N-acyl ureas Chemical class 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- QIOOIKAWHHBWFW-UHFFFAOYSA-N acetic acid 2,4-dimethylcyclohexan-1-amine Chemical compound C(C)(=O)O.CC1C(CCC(C1)C)N QIOOIKAWHHBWFW-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001716 carbazoles Chemical class 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000010030 glucose lowering effect Effects 0.000 description 1
- RIGBPMDIGYBTBJ-UHFFFAOYSA-N glycyclamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NC1CCCCC1 RIGBPMDIGYBTBJ-UHFFFAOYSA-N 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 229940101209 mercuric oxide Drugs 0.000 description 1
- RMAHPRNLQIRHIJ-UHFFFAOYSA-N methyl carbamimidate Chemical compound COC(N)=N RMAHPRNLQIRHIJ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- NJKWLYKNUCLIRG-UHFFFAOYSA-N n,n-dimethylformamide;methanol;hydrate Chemical compound O.OC.CN(C)C=O NJKWLYKNUCLIRG-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- ZFLIKDUSUDBGCD-UHFFFAOYSA-N parabanic acid Chemical compound O=C1NC(=O)C(=O)N1 ZFLIKDUSUDBGCD-UHFFFAOYSA-N 0.000 description 1
- 238000009304 pastoral farming Methods 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- QXKXDIKCIPXUPL-UHFFFAOYSA-N sulfanylidenemercury Chemical compound [Hg]=S QXKXDIKCIPXUPL-UHFFFAOYSA-N 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003560 thiocarbamic acids Chemical class 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/57—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings
- C07C311/59—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings having nitrogen atoms of the sulfonylurea groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D333/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D333/70—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/18—Systems containing only non-condensed rings with a ring being at least seven-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/50—Spiro compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/56—Ring systems containing bridged rings
- C07C2603/58—Ring systems containing bridged rings containing three rings
- C07C2603/60—Ring systems containing bridged rings containing three rings containing at least one ring with less than six members
- C07C2603/66—Ring systems containing bridged rings containing three rings containing at least one ring with less than six members containing five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (42)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1966F0049329 DE1252201B (de) | 1966-05-28 | 1966-05-28 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| DE1967F0052152 DE1618402B2 (de) | 1966-05-28 | 1967-04-18 | Benzolsulfonylharnstoffe, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate |
| DK266367AA DK129414B (da) | 1966-05-28 | 1967-05-22 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller fysiologisk uskadelige salte deraf med baser. |
| FI671459A FI46155C (fi) | 1966-05-28 | 1967-05-23 | Menetelmä veren sokeripitoisuutta alentavien bentseenisulfonyylivirtsa -aineiden valmistamiseksi. |
| IS1648A IS734B6 (is) | 1966-05-28 | 1967-05-24 | Aðferð til að framleiða sulfonylurinefni eða söltaf þeim. |
| IL28034A IL28034A (en) | 1966-05-28 | 1967-05-24 | Benzenesulfonyl ureas and process for their preparation |
| LU53740D LU53740A1 (online.php) | 1966-05-28 | 1967-05-24 | |
| ES340953A ES340953A1 (es) | 1966-05-28 | 1967-05-24 | Procedimiento para la obtencion de bencenosulfonilureas. |
| AU22291/67A AU429080B2 (en) | 1966-05-28 | 1967-05-25 | Benzenesulfonyl ureas and process for their manufacture |
| CH1948569A CH533090A (de) | 1966-05-28 | 1967-05-25 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH1948669A CH502318A (de) | 1966-05-28 | 1967-05-25 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH979571A CH533091A (de) | 1966-05-28 | 1967-05-25 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH1948869A CH502320A (de) | 1966-05-28 | 1967-05-25 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH739467A CH503709A (de) | 1966-05-28 | 1967-05-25 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH1948769A CH502319A (de) | 1966-05-28 | 1967-05-25 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH1948469A CH502998A (de) | 1966-05-28 | 1967-05-25 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| AT493767A AT324349B (de) | 1966-05-28 | 1967-05-26 | Verfahren zur herstellung von neuen benzolsulfonylharnstoffen und deren salzen |
| NL6707340.A NL157592B (nl) | 1966-05-28 | 1967-05-26 | Werkwijze voor het bereiden van geneesmiddelen met bloedsuikerspiegel verlagende activiteit, aldus verkregen, gevormde geneesmiddelen, alsmede werkwijze voor het bereiden van daarvoor geschikte, actieve verbindingen. |
| MC694A MC654A1 (fr) | 1966-05-28 | 1967-05-26 | Benzène sulfonyl urées et leur préparation |
| SE07405/67A SE336331B (online.php) | 1966-05-28 | 1967-05-26 | |
| AT375674A AT326682B (de) | 1966-05-28 | 1967-05-26 | Verfahren zur herstellung von neuen acylaminoalkylbenzolsulfonylharnstoffen und deren salzen |
| OA52951A OA03625A (fr) | 1966-05-28 | 1967-05-27 | Procédé de préparation de benzène-sulfonyl-urées. |
| PL1967120799A PL69770B1 (online.php) | 1966-05-28 | 1967-05-27 | |
| NO168334A NO122921B (online.php) | 1966-05-28 | 1967-05-27 | |
| SU1443576A SU407445A3 (online.php) | 1966-05-28 | 1967-05-27 | |
| SU1443581A SU440828A3 (online.php) | 1966-05-28 | 1967-05-27 | |
| SU1443578A SU465783A3 (ru) | 1966-05-28 | 1967-05-27 | Способ получени бензолсульфонилмочевины |
| SU1444380A SU468403A3 (ru) | 1966-05-28 | 1967-05-28 | Способ получени бензолсульфонилмочевины |
| JP42034115A JPS5133903B1 (online.php) | 1966-05-28 | 1967-05-29 | |
| BE699134D BE699134A (online.php) | 1966-05-28 | 1967-05-29 | |
| FR108207A FR1524754A (fr) | 1966-05-28 | 1967-05-29 | Benzène-sulfonyl-urées et leur préparation |
| GB24852/67A GB1182694A (en) | 1966-05-28 | 1967-05-30 | Benzenesulfonyl Ureas and process for their manufacture |
| FR119022A FR6497M (online.php) | 1966-05-28 | 1967-08-25 | |
| ES353814A ES353814A1 (es) | 1966-05-28 | 1968-05-11 | Un procedimiento para la obtencion de preparados farmaceu- ticos de accion depresora del nivel de azucar en sangre. |
| AR228019A AR192396A1 (es) | 1966-05-28 | 1970-04-10 | Procedimiento para la obtencion de bencenosulfonilureas |
| US05/041,160 US3932503A (en) | 1966-05-28 | 1970-05-25 | Benzenesulfonyl ureas |
| US00041161A US3812185A (en) | 1966-05-28 | 1970-05-25 | Benzenesulfonyl ureas |
| CY56770A CY567A (en) | 1966-05-28 | 1970-11-26 | Benzenesulfonyl ureas and process for their manufacture |
| MY59/71A MY7100059A (en) | 1966-05-28 | 1971-12-30 | Benzenesulfonyl ureas and process for their manufacture |
| AR245895A AR193007A1 (es) | 1966-05-28 | 1972-12-28 | Procedimiento para la obtencion de bencenosulfonilureas |
| AR245611A AR192829A1 (es) | 1966-05-28 | 1972-12-31 | Procedimiento para la obtencion de bencenosulfonilureas |
| NL7801563A NL7801563A (nl) | 1966-05-28 | 1978-02-10 | Werkwijze voor het bereiden van geneesmiddelen met bloedsuikerspiegel verlagende activiteit, aldus verkregen, gevormde geneesmiddelen, als- mede werkwijze voor het bereiden van daarvoor geschikte, actieve verbindingen. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1966F0049329 DE1252201B (de) | 1966-05-28 | 1966-05-28 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1252201B true DE1252201B (de) | 1967-10-19 |
| DE1252201C2 DE1252201C2 (online.php) | 1968-05-22 |
Family
ID=7102926
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1966F0049329 Granted DE1252201B (de) | 1966-05-28 | 1966-05-28 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
Country Status (2)
| Country | Link |
|---|---|
| DE (1) | DE1252201B (online.php) |
| PL (1) | PL69770B1 (online.php) |
-
1966
- 1966-05-28 DE DE1966F0049329 patent/DE1252201B/de active Granted
-
1967
- 1967-05-27 PL PL1967120799A patent/PL69770B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1252201C2 (online.php) | 1968-05-22 |
| PL69770B1 (online.php) | 1973-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1518877C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1543564C3 (de) | Benzolsulfonylharnstoffe, Verfahren zur ihrer Herstellung und diese enthaltende phyrmazeutische Präparate | |
| DE1244174C2 (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1443911C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1568626C3 (de) | Benzolsulfonyl-harnstoffe, ihre Salze, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1518816C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1443905C3 (de) | benzolsulfonyl] -N'-cyclohexylharnstoff, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE1252201B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1201337B (de) | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen | |
| DE1198354B (de) | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen | |
| DE1179200B (de) | Verfahren zur Herstellung von N-Benzolsulfonyl-N'-methyl-cyclohexylharnstoffen | |
| DE1568648C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1518846C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1443878C (de) | Verfahren zur Herstellung von Benzol= sulfonylharnstoffen | |
| DE1518895C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE1443908C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Mittel | |
| DE1301812B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1443890C (de) | Benzolsulfonyl Harnstoffe und Verfahren zu ihrer Herstellung | |
| DE1670700A1 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE1443878B2 (de) | Verfahren zur herstellung von benzol- sulfonylharnstoffen | |
| DE1443894C (de) | Benzolsulfonylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1568606B2 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1793111C3 (de) | Acylaminoäthylbenzolsulfonyl-delta hoch 2-cyclohexenyl-harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1493670C (de) | Benzolsulfonylharnstoffe und deren pharmakologisch nicht giftige Salze so wie Verfahren zu deren Herstellung und diese enthaltende blutzucker senkende Mittel | |
| DE1793072C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen |