DE1249263B - Verfah ren zur Herstellung vor substituierten 1,3 Dioxocyclopentanderivaten - Google Patents
Verfah ren zur Herstellung vor substituierten 1,3 DioxocyclopentanderivatenInfo
- Publication number
- DE1249263B DE1249263B DENDAT1249263D DE1249263DA DE1249263B DE 1249263 B DE1249263 B DE 1249263B DE NDAT1249263 D DENDAT1249263 D DE NDAT1249263D DE 1249263D A DE1249263D A DE 1249263DA DE 1249263 B DE1249263 B DE 1249263B
- Authority
- DE
- Germany
- Prior art keywords
- substituted
- levulinic acid
- molecular weight
- derivatives
- low molecular
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 6
- LOGSONSNCYTHPS-UHFFFAOYSA-N cyclopentane-1,3-dione Chemical class O=C1CCC(=O)C1 LOGSONSNCYTHPS-UHFFFAOYSA-N 0.000 title claims description 3
- 238000002360 preparation method Methods 0.000 title claims description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 27
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 10
- JOOXCMJARBKPKM-UHFFFAOYSA-N laevulinic acid Natural products CC(=O)CCC(O)=O JOOXCMJARBKPKM-UHFFFAOYSA-N 0.000 claims description 9
- 229940040102 levulinic acid Drugs 0.000 claims description 8
- -1 benzene hydrocarbon Chemical class 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 7
- 238000007363 ring formation reaction Methods 0.000 claims description 6
- 239000008096 xylene Substances 0.000 claims description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 5
- 125000005907 alkyl ester group Chemical group 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 229910052700 potassium Chemical group 0.000 claims description 2
- 239000011591 potassium Chemical group 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 2
- 150000001340 alkali metals Chemical class 0.000 claims 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical group [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- HXZILEQYFQYQCE-UHFFFAOYSA-N 2-methylcyclopentane-1,3-dione Chemical compound CC1C(=O)CCC1=O HXZILEQYFQYQCE-UHFFFAOYSA-N 0.000 description 2
- WTEVTPRVVNSLTM-UHFFFAOYSA-N 2-propan-2-ylcyclopentane-1,3-dione Chemical compound CC(C)C1C(=O)CCC1=O WTEVTPRVVNSLTM-UHFFFAOYSA-N 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IEPRKVQEAMIZSS-UHFFFAOYSA-N Di-Et ester-Fumaric acid Natural products CCOC(=O)C=CC(=O)OCC IEPRKVQEAMIZSS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IEPRKVQEAMIZSS-WAYWQWQTSA-N Diethyl maleate Chemical compound CCOC(=O)\C=C/C(=O)OCC IEPRKVQEAMIZSS-WAYWQWQTSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000006114 decarboxylation reaction Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229960004719 nandrolone Drugs 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- FSCAEMWIILOKLC-UHFFFAOYSA-N 2-propylcyclopentane-1,3-dione Chemical compound CCCC1C(=O)CCC1=O FSCAEMWIILOKLC-UHFFFAOYSA-N 0.000 description 1
- PAMDLYIJZGDGCE-UHFFFAOYSA-N 3-ethoxycarbonyl-4-oxoheptanoic acid Chemical compound CCCC(=O)C(CC(O)=O)C(=O)OCC PAMDLYIJZGDGCE-UHFFFAOYSA-N 0.000 description 1
- GFPHLUCWXDCZDL-UHFFFAOYSA-N 3-ethoxycarbonyl-4-oxohexanoic acid Chemical compound CCC(C(CC(O)=O)C(OCC)=O)=O GFPHLUCWXDCZDL-UHFFFAOYSA-N 0.000 description 1
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical group C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 1
- DKMROQRQHGEIOW-UHFFFAOYSA-N Diethyl succinate Chemical compound CCOC(=O)CCC(=O)OCC DKMROQRQHGEIOW-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- UAGJVSRUFNSIHR-UHFFFAOYSA-N Methyl levulinate Chemical compound COC(=O)CCC(C)=O UAGJVSRUFNSIHR-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 150000001940 cyclopentanes Chemical class 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000005837 enolization reaction Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- JHCRLEWHFPBZTE-UHFFFAOYSA-N iodoethane;zinc Chemical compound [Zn].CCI JHCRLEWHFPBZTE-UHFFFAOYSA-N 0.000 description 1
- 229940058352 levulinate Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- NPAGDVCDWIYMMC-IZPLOLCNSA-N nandrolone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 NPAGDVCDWIYMMC-IZPLOLCNSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical group [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/455—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation with carboxylic acids or their derivatives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR932866A FR1363281A (fr) | 1963-04-26 | 1963-04-26 | Nouveau procédé de préparation du 1,3-dioxo 2-méthyl cyclopentane |
| FR964020A FR1493409A (fr) | 1963-04-26 | 1964-02-17 | Procédé de préparation de dérivés substitués du 1, 3-dioxo cyclopentane |
| BE647081A BE647081A (enExample) | 1963-04-26 | 1964-04-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1249263B true DE1249263B (de) | 1967-09-07 |
Family
ID=27158963
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1249263D Pending DE1249263B (de) | 1963-04-26 | Verfah ren zur Herstellung vor substituierten 1,3 Dioxocyclopentanderivaten |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3349130A (enExample) |
| BE (1) | BE647081A (enExample) |
| CH (1) | CH425753A (enExample) |
| DE (1) | DE1249263B (enExample) |
| FR (2) | FR1363281A (enExample) |
| GB (1) | GB1038346A (enExample) |
| NL (2) | NL6404468A (enExample) |
| SE (1) | SE321215B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1288086B (enExample) * | 1963-12-26 | 1969-01-30 | ||
| US3671589A (en) * | 1969-05-23 | 1972-06-20 | American Home Prod | Process for preparation of 2-substituted-1,3-cyclopentanediones |
| US3931322A (en) * | 1974-01-25 | 1976-01-06 | Hoffmann-La Roche Inc. | Synthesis of 2-alkyl-cyclopentan-1,3-diones |
| US4371711A (en) * | 1979-05-30 | 1983-02-01 | Sumitomo Chemical Company, Limited | Process for producing 4-hydroxycyclopentenones |
| CH653665A5 (de) * | 1981-05-27 | 1986-01-15 | Lonza Ag | Verfahren zur herstellung von dimedon. |
| US5407910A (en) * | 1993-10-12 | 1995-04-18 | Union Camp Corporation | Cyclopent-1-en-3,5-dione compounds and compositions |
-
0
- NL NL122308D patent/NL122308C/xx active
- DE DENDAT1249263D patent/DE1249263B/de active Pending
-
1963
- 1963-04-26 FR FR932866A patent/FR1363281A/fr not_active Expired
-
1964
- 1964-02-17 FR FR964020A patent/FR1493409A/fr not_active Expired
- 1964-04-17 CH CH496564A patent/CH425753A/fr unknown
- 1964-04-17 SE SE4804/46A patent/SE321215B/xx unknown
- 1964-04-22 US US361887A patent/US3349130A/en not_active Expired - Lifetime
- 1964-04-23 NL NL6404468A patent/NL6404468A/xx unknown
- 1964-04-24 BE BE647081A patent/BE647081A/xx unknown
- 1964-04-24 GB GB17087/64A patent/GB1038346A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1493409A (fr) | 1967-09-01 |
| SE321215B (enExample) | 1970-03-02 |
| US3349130A (en) | 1967-10-24 |
| GB1038346A (en) | 1966-08-10 |
| NL6404468A (enExample) | 1964-10-27 |
| FR1363281A (fr) | 1964-06-12 |
| CH425753A (fr) | 1966-12-15 |
| NL122308C (enExample) | |
| BE647081A (enExample) | 1964-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1793559C3 (de) | Verfahren zur Herstellung von Furan 3 carbonsaureestern Ausscheidung aus 1543804 | |
| CH555352A (de) | Verfahren zur herstellung von (((omega)-1)-oxoalkyl)-dimethylxanthinen. | |
| DE1249263B (de) | Verfah ren zur Herstellung vor substituierten 1,3 Dioxocyclopentanderivaten | |
| DE1468890B1 (de) | Verfahren zur Herstellung von Tetrahydroindan-Zwischenprodukten fuer Steroidderivate | |
| DE1055007B (de) | Verfahren zur Herstellung von 3-Aminothiophen-2-carbonsaeureestern und den entsprechenden freien Carbonsaeuren | |
| DE953077C (de) | Verfahren zur Herstellung von 5-Pregnen-17ª, 21-diol-3, 11, 20-trion-3, 20-dialkylen-ketalen | |
| DE1232577B (de) | Verfahren zur Herstellung von delta 4,9-3-Oxo-11beta-hydroperoxy-19-nor-steroiden | |
| DE870857C (de) | Verfahren zur Herstellung monohalogenierter 1, 3-Dioxane | |
| DE1593315B1 (de) | 9-Isopropyliden-9,10-dihydroanthracen-10-carbonsaeure-ss-diaethylamino-aethylester,deren Salze und Verfahren zu deren Herstellung | |
| DE2221123C2 (de) | Reserpsäurederivate, Verfahren zu deren Herstellung und Arzneimittel | |
| DE1618310C3 (enExample) | ||
| DE809806C (de) | Verfahren zur Herstellung von ungesaettigten Dicarbonylverbindungen | |
| DE911371C (de) | Verfahren zur Herstellung von Estern der Bis-[4-oxycumarinyl-(3)]-essigsaeure | |
| DE955947C (de) | Verfahren zur Herstellung von Diglycidestern | |
| DE961535C (de) | Verfahren zur Herstellung von 20-Keto-21, 21-dihalogen-21-acylsteroiden | |
| DE1543522C3 (de) | Acylaminophenolalkanole, Verfahren zu ihrer Herstellung und diese Acylaminophenolalkanole enthaltende pharmazeutische Mittel | |
| DE1593303C (de) | Verfahren zur Herstellung von Östr-5(10>en-3,17-dion | |
| DE974201C (de) | Verfahren zur Reduktion von Verbindungen der Cyclopentanopolyhydrophenanthren-Reihe | |
| DE896804C (de) | Verfahren zur Darstellung von Enolaethern von ª‡,ª‰-ungesaettigten Steroidketonen | |
| DE961536C (de) | Verfahren zur Herstellung von 20-Keto-21-formylsteroiden der Pregnanreihe | |
| DE1168918B (de) | Verfahren zur Herstellung von Acylanthranilsaeureaniliden | |
| DE1147584B (de) | Verfahren zur Herstellung von substituierten 2-Mercaptothiazol-5-aldehyden | |
| DE1235320B (de) | Verfahren zur Herstellung von 1-(Oxoalkyl)-3, 7-dimethylxanthinen | |
| DE2740041A1 (de) | Dioxanderivate und verfahren zu deren herstellung | |
| DE1148546B (de) | Verfahren zur Herstellung von 21-Hydroxy-3, 11, 20-triketo- und 11, 21-Dihydroxy-3, 2-diketo-?pregnen-21-acylaten |