DE1237105B - Verfahren zur Herstellung von Thiocarbonsaeureamiden - Google Patents
Verfahren zur Herstellung von ThiocarbonsaeureamidenInfo
- Publication number
- DE1237105B DE1237105B DE1965R0040954 DER0040954A DE1237105B DE 1237105 B DE1237105 B DE 1237105B DE 1965R0040954 DE1965R0040954 DE 1965R0040954 DE R0040954 A DER0040954 A DE R0040954A DE 1237105 B DE1237105 B DE 1237105B
- Authority
- DE
- Germany
- Prior art keywords
- thiocarbamoyl
- cyanoacetic
- salt
- ethyl ester
- acid ethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 8
- 150000003566 thiocarboxylic acids Chemical class 0.000 title 1
- 150000003839 salts Chemical class 0.000 claims description 29
- -1 (4-hydroxyphenyl) thiocarbamoyl ethyl Chemical group 0.000 claims description 26
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 12
- 125000004494 ethyl ester group Chemical group 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 150000003863 ammonium salts Chemical class 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- CYEBJEDOHLIWNP-UHFFFAOYSA-N methanethioamide Chemical compound NC=S CYEBJEDOHLIWNP-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229960003540 oxyquinoline Drugs 0.000 description 3
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 3
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 3
- 241000219198 Brassica Species 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 2
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- 150000001879 copper Chemical class 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 125000002587 enol group Chemical group 0.000 description 2
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000002540 isothiocyanates Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- FJNCXZZQNBKEJT-UHFFFAOYSA-N 8beta-hydroxymarrubiin Natural products O1C(=O)C2(C)CCCC3(C)C2C1CC(C)(O)C3(O)CCC=1C=COC=1 FJNCXZZQNBKEJT-UHFFFAOYSA-N 0.000 description 1
- 235000008753 Papaver somniferum Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical compound CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D341/00—Heterocyclic compounds containing rings having three or more sulfur atoms as the only ring hetero atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1965R0040954 DE1237105B (de) | 1965-06-26 | 1965-06-26 | Verfahren zur Herstellung von Thiocarbonsaeureamiden |
| NL6608409A NL6608409A (enExample) | 1965-06-26 | 1966-06-16 | |
| GB2844666A GB1112210A (en) | 1965-06-26 | 1966-06-24 | Process for the production of thiocarboxylic acid amides |
| FR66850A FR1484505A (fr) | 1965-06-26 | 1966-06-24 | Procédé de préparation de thio-amides |
| CH916666A CH463480A (de) | 1965-06-26 | 1966-06-24 | Verfahren zur Herstellung von Thiocarbonsäureamiden |
| BE683103D BE683103A (enExample) | 1965-06-26 | 1966-06-24 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1965R0040954 DE1237105B (de) | 1965-06-26 | 1965-06-26 | Verfahren zur Herstellung von Thiocarbonsaeureamiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1237105B true DE1237105B (de) | 1967-03-23 |
Family
ID=7406213
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1965R0040954 Pending DE1237105B (de) | 1965-06-26 | 1965-06-26 | Verfahren zur Herstellung von Thiocarbonsaeureamiden |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE683103A (enExample) |
| CH (1) | CH463480A (enExample) |
| DE (1) | DE1237105B (enExample) |
| GB (1) | GB1112210A (enExample) |
| NL (1) | NL6608409A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4888357A (en) * | 1988-01-26 | 1989-12-19 | Bristol-Myers Company | Antiarthritic β-cycloalkyl-β-oxopropionitriles |
| US4975462A (en) * | 1988-07-29 | 1990-12-04 | Bristol-Myers Company | Antiarthritic α-arylcarbamoyl cyanoacetic acid derivatives |
-
1965
- 1965-06-26 DE DE1965R0040954 patent/DE1237105B/de active Pending
-
1966
- 1966-06-16 NL NL6608409A patent/NL6608409A/xx unknown
- 1966-06-24 CH CH916666A patent/CH463480A/de unknown
- 1966-06-24 GB GB2844666A patent/GB1112210A/en not_active Expired
- 1966-06-24 BE BE683103D patent/BE683103A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH463480A (de) | 1968-10-15 |
| NL6608409A (enExample) | 1966-12-27 |
| BE683103A (enExample) | 1966-12-01 |
| GB1112210A (en) | 1968-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0008102B1 (de) | Verfahren zur Herstellung von Azaspirodecanen | |
| DE1237105B (de) | Verfahren zur Herstellung von Thiocarbonsaeureamiden | |
| DE1795344B2 (de) | Verfahren zur herstellung von 3-aminoisothiazolen | |
| CH508637A (de) | Verfahren zur Herstellung neuer, halogensubstituierter Tetrahydrochinazoline | |
| DE1793693B2 (enExample) | ||
| DE1912941B2 (de) | 1 -PhenyM-amino-e-methoxypridaziniumsalze | |
| DE2503699A1 (de) | Verfahren zur herstellung von 1,2- benzisothiazolen | |
| CH495363A (de) | Verfahren zur Herstellung von neuen antidiabetisch wirksamen Sulfonamiden | |
| DE2426977A1 (de) | N,n'-disubstituierte amidine und verfahren zu ihrer herstellung | |
| DE2033611C3 (de) | Verfahren zur Herstellung von 1-(2-Thiazolyl)-2-oxotetrahydroimidazol | |
| DE1695695C3 (de) | Verfahren zur Herstellung von 2-Aminofuro eckige Klammer auf 2,3-d eckige Klammer zu thiazolen | |
| DE1670907C3 (de) | N-disubstituierte 3-Am!no-1,2benzisothiazole und Verfahren zu ihrer Herstellung | |
| DE1003221B (de) | Verfahren zur Herstellung neuer anaesthetisch wirkender Aminocarbonsaeureamide | |
| DE2331969C3 (de) | beta-(3,4,5-Trimethoxyphenyl)-propionltril und Verfahren zu seiner Herstellung | |
| DE1259871B (de) | Verfahren zur Herstellung von N-Chlorformylcarbamidsaeureestern | |
| AT233573B (de) | Verfahren zur Herstellung von 4-Azaphenthiazinderivaten | |
| DE947370C (de) | Verfahren zur Herstellung von 4-Thionylamino-2-oxy-benzoylchlorid | |
| AT226731B (de) | Verfahren zur Herstellung von neuen Guanidinverbindungen | |
| DE1252194B (de) | Verfahren zur Herstellung neuartiger Chinonaldehyde | |
| DE1162380B (de) | Verfahren zur Herstellung von antimikrobiell wirksamen Derivaten des Glycinamids | |
| DE1210892B (de) | Verfahren zur Herstellung von 5[3-(1, 2-Dithiacylopentyl)]-pentan-saeureamiden | |
| DE1156403B (de) | Verfahren zur Herstellung von Sulfonsaeureamid-N-sulfensaeurechloriden | |
| DE1085524B (de) | Verfahren zur Herstellung von Phosphorsaeure-alkylalkinylestermonoamiden | |
| DE1260468B (de) | Verfahren zur Herstellung von Aminonitrophenolen | |
| DE1620395A1 (de) | Verfahren zur Herstellung von Cycloheptimidazoliniumhalogeniden |