DE1210764B - Verfahren zum optischen Aufhellen von organischem Fasermaterial - Google Patents
Verfahren zum optischen Aufhellen von organischem FasermaterialInfo
- Publication number
- DE1210764B DE1210764B DEM54140A DEM0054140A DE1210764B DE 1210764 B DE1210764 B DE 1210764B DE M54140 A DEM54140 A DE M54140A DE M0054140 A DEM0054140 A DE M0054140A DE 1210764 B DE1210764 B DE 1210764B
- Authority
- DE
- Germany
- Prior art keywords
- fiber material
- styryloxazole
- groups
- fabric
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002657 fibrous material Substances 0.000 title claims description 15
- 238000000034 method Methods 0.000 title claims description 15
- 230000003287 optical effect Effects 0.000 title claims description 10
- 238000005282 brightening Methods 0.000 title claims description 7
- 239000000835 fiber Substances 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 14
- -1 2-styryloxazole compound Chemical class 0.000 claims description 11
- 239000004744 fabric Substances 0.000 claims description 11
- YCPDXJAYLHNNEA-UHFFFAOYSA-N 2-(2-phenylethenyl)-1,3-oxazole Chemical class N=1C=COC=1C=CC1=CC=CC=C1 YCPDXJAYLHNNEA-UHFFFAOYSA-N 0.000 claims description 8
- 229920000728 polyester Polymers 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 239000004743 Polypropylene Substances 0.000 claims description 5
- 229920001155 polypropylene Polymers 0.000 claims description 5
- 229920002994 synthetic fiber Polymers 0.000 claims description 5
- 239000012209 synthetic fiber Substances 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 238000009987 spinning Methods 0.000 claims description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 2
- 150000005215 alkyl ethers Chemical class 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 claims description 2
- 239000000986 disperse dye Substances 0.000 claims description 2
- 238000004043 dyeing Methods 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000002971 oxazolyl group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 239000000725 suspension Substances 0.000 claims 2
- 238000007865 diluting Methods 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 239000008149 soap solution Substances 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 244000172533 Viola sororia Species 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 11
- 239000004952 Polyamide Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 235000005811 Viola adunca Nutrition 0.000 description 3
- 240000009038 Viola odorata Species 0.000 description 3
- 235000013487 Viola odorata Nutrition 0.000 description 3
- 235000002254 Viola papilionacea Nutrition 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229920002301 cellulose acetate Polymers 0.000 description 3
- 229920002239 polyacrylonitrile Polymers 0.000 description 3
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 1
- OPHSKKPSEMOQLM-UHFFFAOYSA-N 2-(2-phenylethenyl)-1h-imidazole Chemical class N=1C=CNC=1C=CC1=CC=CC=C1 OPHSKKPSEMOQLM-UHFFFAOYSA-N 0.000 description 1
- GJFNNZBYCMUAHY-ZHACJKMWSA-N 2-[(e)-2-phenylethenyl]-1,3-benzoxazole Chemical compound N=1C2=CC=CC=C2OC=1/C=C/C1=CC=CC=C1 GJFNNZBYCMUAHY-ZHACJKMWSA-N 0.000 description 1
- ZCHCHJQEWYIJDQ-UHFFFAOYSA-N 2-methyl-1,3-oxazole Chemical class CC1=NC=CO1 ZCHCHJQEWYIJDQ-UHFFFAOYSA-N 0.000 description 1
- HQPIRXQACTZROS-UHFFFAOYSA-N 4-[2-(1h-benzimidazol-2-yl)ethenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C=CC1=NC2=CC=CC=C2N1 HQPIRXQACTZROS-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- APEJMQOBVMLION-UHFFFAOYSA-N cinnamamide Chemical class NC(=O)C=CC1=CC=CC=C1 APEJMQOBVMLION-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/56—Benzoxazoles; Hydrogenated benzoxazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/60—Naphthoxazoles; Hydrogenated naphthoxazoles
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/614—Optical bleaching or brightening in aqueous solvents
- D06L4/636—Optical bleaching or brightening in aqueous solvents with disperse brighteners
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3330261 | 1961-09-12 | ||
| JP3330361 | 1961-09-20 | ||
| JP2964162 | 1962-07-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1210764B true DE1210764B (de) | 1966-02-17 |
Family
ID=27286670
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEM54140A Pending DE1210764B (de) | 1961-09-12 | 1962-09-05 | Verfahren zum optischen Aufhellen von organischem Fasermaterial |
Country Status (6)
| Country | Link |
|---|---|
| US (3) | US3262929A (enExample) |
| CH (1) | CH387585A (enExample) |
| DE (1) | DE1210764B (enExample) |
| FR (1) | FR1336949A (enExample) |
| GB (1) | GB967483A (enExample) |
| MY (1) | MY6600133A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1469223B1 (de) * | 1964-10-17 | 1972-08-03 | Hoechst Ag | Optische Aufhellungsmittel |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB967483A (enExample) * | 1961-09-12 | |||
| DE1419330A1 (de) * | 1962-06-09 | 1970-02-19 | Hoechst Ag | Optische Aufhellungsmittel |
| US3366630A (en) * | 1963-10-26 | 1968-01-30 | Hoechst Ag | 2-(4'-amidostyryl)-benzoxazoles and method for using the same for the optical brightening of textiles |
| US3158610A (en) * | 1964-01-03 | 1964-11-24 | American Cyanamid Co | 2-styrylbenzoxazole brighteners |
| CH902165A4 (enExample) * | 1964-05-27 | 1968-12-31 | ||
| US3274184A (en) * | 1964-07-30 | 1966-09-20 | American Cyanamid Co | Method for the preparation of 2-styrloxazole compounds |
| CH475301A (de) * | 1964-10-27 | 1969-07-15 | Ciba Geigy | Verfahren zur Herstellung von mit Oxazolverbindungen optisch aufgehellten Formkörpern |
| US3546127A (en) * | 1967-11-24 | 1970-12-08 | Magnaflux Corp | Fluorescent penetrant for and method of detecting surface discontinuities |
| US3912697A (en) * | 1973-04-27 | 1975-10-14 | Eastman Kodak Co | Light-sensitive polymers |
| DE2331444A1 (de) * | 1973-06-20 | 1975-01-23 | Hoechst Ag | Neue styryl-benzoxazole, verfahren zu deren herstellung und ihre verwendung als optische aufhellungsmittel |
| CH597335A5 (enExample) * | 1973-09-14 | 1978-03-31 | Ciba Geigy Ag | |
| DE2712686C2 (de) * | 1977-03-23 | 1986-09-04 | Bayer Ag, 5090 Leverkusen | 4-Triazinyl-4'-benzoxazolyl- bzw. 4'-phenyl-stilben-derivate |
| FR2562539B1 (fr) * | 1984-04-06 | 1987-04-17 | Chauvin Blache Lab | Nouveaux derives de l'acide vinyl-4 benzoique, leur procede de preparation et leurs applications en therapeutique et comme ligands |
| GB9312853D0 (en) * | 1993-06-22 | 1993-08-04 | Euro Celtique Sa | Chemical compounds |
| US5922751A (en) * | 1994-06-24 | 1999-07-13 | Euro-Celtique, S.A. | Aryl pyrazole compound for inhibiting phosphodiesterase IV and methods of using same |
| US5591776A (en) * | 1994-06-24 | 1997-01-07 | Euro-Celtique, S.A. | Pheynl or benzyl-substituted rolipram-based compounds for and method of inhibiting phosphodiesterase IV |
| US6372770B1 (en) | 1994-10-12 | 2002-04-16 | Euro-Celtique, S.A. | Benzoxazoles |
| US6025361A (en) * | 1994-12-13 | 2000-02-15 | Euro-Celtique, S.A. | Trisubstituted thioxanthines |
| AU4527996A (en) * | 1994-12-13 | 1996-07-03 | Euro-Celtique S.A. | Trisubstituted thioxanthines |
| DE69531506T2 (de) * | 1994-12-13 | 2004-06-24 | Euroceltique S.A. | Arylthioxanthine |
| US6166041A (en) * | 1995-10-11 | 2000-12-26 | Euro-Celtique, S.A. | 2-heteroaryl and 2-heterocyclic benzoxazoles as PDE IV inhibitors for the treatment of asthma |
| US6075016A (en) * | 1996-04-10 | 2000-06-13 | Euro-Celtique S.A. | 6,5-fused aromatic ring systems having enhanced phosphodiesterase IV inhibitory activity |
| US5864037A (en) * | 1996-06-06 | 1999-01-26 | Euro-Celtique, S.A. | Methods for the synthesis of chemical compounds having PDE-IV inhibitory activity |
| US5744473A (en) * | 1996-09-16 | 1998-04-28 | Euro-Celtique, S.A. | PDE IV inhibitors: "bis-compounds" |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1088456B (de) * | 1959-02-03 | 1960-09-08 | Glanzstoff Ag | Verfahren zur Erzielung eines dauerhaften, licht- und wasch-bestaendigen Aufhellungseffektes bei Textilien aus Polyamid, das aus Caprolactam erzeugt wurde |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA578303A (en) * | 1959-06-23 | Ackermann Franz | Process for the optical brightening of polyacrylonitrile fibers | |
| US2875089A (en) * | 1959-02-24 | Process for the optical brightening of | ||
| BE442515A (enExample) * | 1940-07-30 | |||
| GB669402A (en) * | 1949-01-28 | 1952-04-02 | George Malcolm Dyson | Improvements relating to the preparation of benziminazoles and benzoxazoles |
| US2639282A (en) * | 1949-09-29 | 1953-05-19 | Eastman Kodak Co | Resin-dyes of the cyanine type |
| US2953561A (en) * | 1957-09-24 | 1960-09-20 | Gen Aniline & Film Corp | Nitrostyryl dye bases and vinylogs thereof derived from 2-cyanomethylazoles |
| GB967483A (enExample) * | 1961-09-12 | |||
| US3158610A (en) * | 1964-01-03 | 1964-11-24 | American Cyanamid Co | 2-styrylbenzoxazole brighteners |
| US3274184A (en) * | 1964-07-30 | 1966-09-20 | American Cyanamid Co | Method for the preparation of 2-styrloxazole compounds |
-
0
- GB GB967483D patent/GB967483A/en active Active
-
1962
- 1962-08-31 US US220904A patent/US3262929A/en not_active Expired - Lifetime
- 1962-08-31 FR FR908286A patent/FR1336949A/fr not_active Expired
- 1962-09-05 DE DEM54140A patent/DE1210764B/de active Pending
- 1962-09-12 CH CH1080362A patent/CH387585A/fr unknown
-
1966
- 1966-05-18 US US550957A patent/US3400124A/en not_active Expired - Lifetime
- 1966-12-31 MY MY1966133A patent/MY6600133A/xx unknown
-
1969
- 1969-05-26 US US27031D patent/USRE27031E/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1088456B (de) * | 1959-02-03 | 1960-09-08 | Glanzstoff Ag | Verfahren zur Erzielung eines dauerhaften, licht- und wasch-bestaendigen Aufhellungseffektes bei Textilien aus Polyamid, das aus Caprolactam erzeugt wurde |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1469223B1 (de) * | 1964-10-17 | 1972-08-03 | Hoechst Ag | Optische Aufhellungsmittel |
Also Published As
| Publication number | Publication date |
|---|---|
| US3262929A (en) | 1966-07-26 |
| US3400124A (en) | 1968-09-03 |
| MY6600133A (en) | 1966-12-31 |
| FR1336949A (fr) | 1963-09-06 |
| GB967483A (enExample) | |
| CH1080362A4 (enExample) | 1964-10-31 |
| USRE27031E (en) | 1971-01-12 |
| CH387585A (fr) | 1965-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1210764B (de) | Verfahren zum optischen Aufhellen von organischem Fasermaterial | |
| DE923422C (de) | Verfahren zum Veredeln von Faserstoffen | |
| DE1139094B (de) | Verfahren zum Faerben und Bedrucken von Textilmaterial aus Polyacrylnitril, acrylnitrilhaltigen Mischpolymerisaten oder Celluloseacetat | |
| DE1076856B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE2542376C2 (de) | Organische Verbindungen | |
| DE904348C (de) | Verfahren zum Faerben von Kunststoffen | |
| AT230322B (de) | Egalisiermittel für Schwefel und Küpenfärbungen | |
| DE2041846C3 (de) | Chinophthalonfarbstoffe | |
| DE2409437A1 (de) | Verfahren zum selektiven faerben von mischfasern oder mischfasertextilien | |
| DE1955310A1 (de) | Verwendung von waessrigen Dispersionen von Mischungen aus Benzoxazol- und Phenyloxazolderivaten zum optischen Aufhellen | |
| DE1230393B (de) | Verfahren zum Faerben von Protein- oder Polyamidfasermaterialien | |
| DE1444003C (de) | Verfahren zum optischen Aufhellen von Materialien aus synthetischen Polyestern und Polyamiden | |
| AT244284B (de) | Verfahren zur Verbesserung des weißen Aussehens von Polymermaterial | |
| CH427364A (de) | Gerät zur graphischen Darstellung von Sachverhalten, insbesondere Planungsgerät, und Verwendung desselben | |
| DE1928286C3 (de) | Naphthalimidderivate und Verfahren zu ihrer Herstellung | |
| DE1644518C3 (de) | 28.12.66 Schweiz 18777-66 Wasserunlösliche Anthrachinonfarbstoffe | |
| AT209459B (de) | Verfahren zur Herstellung von neuen Farbstoffen der Porphinreihe | |
| DE1125881B (de) | Egalisieren beim Faerben mit Schwefel- oder Kuepenfarbstoffen | |
| DE2042651A1 (de) | Gelber Dispersionsfarbstoff | |
| DE1953068C3 (de) | Hilfsmittel für das Färben von Cellulosefasern, stickstoffhaltigen Fasern, synthetischen Fasern und deren Fasermischungen und dessen Verwendung | |
| AT208500B (de) | Verfahren zur Herstellung von synthetischen Fasern aus Polyacrylnitrilpolymerisaten oder Mischpolymerisaten mit überwiegendem Anteil an Acrylnitril | |
| DE1023163B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE1165789B (de) | Verfahren zur Herstellung von Styrylfarbstoffen | |
| CH432462A (de) | Nichtstaubende Farbstoffe | |
| DE1054656B (de) | Verfahren zur Herstellung von Faeden oder Fasern aus Polyacrylnitril und bzw. oder seinen Mischpolymerisaten mit guten faerberischen Eigenschaften |