DE1209679B - Verfahren zur Herstellung von basischen Farbstoffen - Google Patents
Verfahren zur Herstellung von basischen FarbstoffenInfo
- Publication number
- DE1209679B DE1209679B DEF33519A DEF0033519A DE1209679B DE 1209679 B DE1209679 B DE 1209679B DE F33519 A DEF33519 A DE F33519A DE F0033519 A DEF0033519 A DE F0033519A DE 1209679 B DE1209679 B DE 1209679B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- aldehyde
- dye
- dihydroindole
- methoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 8
- 239000000981 basic dye Substances 0.000 title claims description 3
- 239000000975 dye Substances 0.000 claims description 88
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 31
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 29
- 150000007857 hydrazones Chemical class 0.000 claims description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 21
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 14
- -1 aromatic radical Chemical class 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 13
- 239000004744 fabric Substances 0.000 claims description 12
- 239000011780 sodium chloride Substances 0.000 claims description 10
- ISOCABSXIKQOOV-UHFFFAOYSA-N acridine-9-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C(C=CC=C3)C3=NC2=C1 ISOCABSXIKQOOV-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- JPJCJVLMPPNLQB-UHFFFAOYSA-N 5-methoxy-2,3,3-trimethyl-1,2-dihydroindole Chemical compound COC1=CC=C2NC(C)C(C)(C)C2=C1 JPJCJVLMPPNLQB-UHFFFAOYSA-N 0.000 claims 1
- OKJSATHJBAUCPQ-UHFFFAOYSA-N 5-methoxy-2,3,3-trimethyl-2h-indol-1-amine Chemical compound COC1=CC=C2N(N)C(C)C(C)(C)C2=C1 OKJSATHJBAUCPQ-UHFFFAOYSA-N 0.000 claims 1
- UOGHZHPESMATDD-UHFFFAOYSA-N 5-methoxy-2,3,3-trimethylindole Chemical compound COC1=CC=C2N=C(C)C(C)(C)C2=C1 UOGHZHPESMATDD-UHFFFAOYSA-N 0.000 claims 1
- 238000004040 coloring Methods 0.000 claims 1
- 150000007524 organic acids Chemical class 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 32
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 239000000463 material Substances 0.000 description 25
- 238000009835 boiling Methods 0.000 description 23
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 235000002639 sodium chloride Nutrition 0.000 description 19
- WPYJKGWLDJECQD-UHFFFAOYSA-N quinoline-2-carbaldehyde Chemical compound C1=CC=CC2=NC(C=O)=CC=C21 WPYJKGWLDJECQD-UHFFFAOYSA-N 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 13
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 12
- MGCGJBXTNWUHQE-UHFFFAOYSA-N quinoline-4-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CC=NC2=C1 MGCGJBXTNWUHQE-UHFFFAOYSA-N 0.000 description 12
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 10
- 239000003086 colorant Substances 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 8
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- USXDEPBQTLFSFB-UHFFFAOYSA-N 1,2,3,4,4a,4b,5,9a-octahydrocarbazol-9-amine Chemical compound NN1C2=CC=CCC2C2CCCCC12 USXDEPBQTLFSFB-UHFFFAOYSA-N 0.000 description 6
- YELHZVMLYJGTFN-UHFFFAOYSA-N 2-methyl-2,3-dihydroindol-1-amine Chemical compound C1=CC=C2N(N)C(C)CC2=C1 YELHZVMLYJGTFN-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- BGUWFUQJCDRPTL-UHFFFAOYSA-N pyridine-4-carbaldehyde Chemical compound O=CC1=CC=NC=C1 BGUWFUQJCDRPTL-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 244000172533 Viola sororia Species 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- DRKSMCFPUOMHMK-UHFFFAOYSA-N 2,3,4,5,6,9-hexahydro-1h-carbazole Chemical compound C1=CCCC2=C1NC1=C2CCCC1 DRKSMCFPUOMHMK-UHFFFAOYSA-N 0.000 description 2
- QRWRJDVVXAXGBT-UHFFFAOYSA-N 2-Methylindoline Chemical compound C1=CC=C2NC(C)CC2=C1 QRWRJDVVXAXGBT-UHFFFAOYSA-N 0.000 description 2
- LOKLRNCSSZZXFP-UHFFFAOYSA-N 5-methoxy-2-methyl-2,3-dihydroindol-1-amine Chemical compound NN1C(CC2=CC(=CC=C12)OC)C LOKLRNCSSZZXFP-UHFFFAOYSA-N 0.000 description 2
- XJYXBOSMRSJTEE-UHFFFAOYSA-N 8-nitroquinoline-4-carbaldehyde Chemical compound C1=CN=C2C([N+](=O)[O-])=CC=CC2=C1C=O XJYXBOSMRSJTEE-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- CGTWOOPTAAXMLM-UHFFFAOYSA-N carbazol-9-amine Chemical compound C1=CC=C2N(N)C3=CC=CC=C3C2=C1 CGTWOOPTAAXMLM-UHFFFAOYSA-N 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 1
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VLWNWEVWNIXNKE-UHFFFAOYSA-N 1-amino-N,N,2-trimethyl-2,3-dihydroindole-5-sulfonamide Chemical compound CN(S(=O)(=O)C=1C=C2CC(N(C2=CC1)N)C)C VLWNWEVWNIXNKE-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- WEXZHVIBOVOVKI-UHFFFAOYSA-N 2,3,3-trimethyl-2h-indol-1-amine Chemical compound C1=CC=C2C(C)(C)C(C)N(N)C2=C1 WEXZHVIBOVOVKI-UHFFFAOYSA-N 0.000 description 1
- RSAIIBFKUJGUQI-UHFFFAOYSA-N 2-methylpyridine Chemical compound [CH2]C1=CC=CC=N1 RSAIIBFKUJGUQI-UHFFFAOYSA-N 0.000 description 1
- LWEUOWQIECZGAW-UHFFFAOYSA-N 3,4,4a,5-tetrahydro-1h-isoquinolin-2-amine Chemical compound C1C=CC=C2CN(N)CCC21 LWEUOWQIECZGAW-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- VSWGLJOQFUMFOQ-UHFFFAOYSA-N 5-methoxy-2-methyl-1h-indole Chemical compound COC1=CC=C2NC(C)=CC2=C1 VSWGLJOQFUMFOQ-UHFFFAOYSA-N 0.000 description 1
- MKZAAOOSZBRZEP-UHFFFAOYSA-N 5-methoxy-2-methyl-2,3-dihydro-1h-indole Chemical compound COC1=CC=C2NC(C)CC2=C1 MKZAAOOSZBRZEP-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- BRJNDKQMVSNGFZ-UHFFFAOYSA-N n,n,2-trimethyl-2,3-dihydro-1h-indole-5-sulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=C2NC(C)CC2=C1 BRJNDKQMVSNGFZ-UHFFFAOYSA-N 0.000 description 1
- LGDPTPLJZGPOJL-UHFFFAOYSA-N n,n-dimethyl-2-nitrosoaniline Chemical compound CN(C)C1=CC=CC=C1N=O LGDPTPLJZGPOJL-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical compound NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B23/00—Methine or polymethine dyes, e.g. cyanine dyes
- C09B23/16—Methine or polymethine dyes, e.g. cyanine dyes the polymethine chain containing hetero atoms
- C09B23/162—Methine or polymethine dyes, e.g. cyanine dyes the polymethine chain containing hetero atoms only nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B26/00—Hydrazone dyes; Triazene dyes
- C09B26/02—Hydrazone dyes
- C09B26/04—Hydrazone dyes cationic
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Indole Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB964452D GB964452A (en:Method) | 1961-03-27 | ||
| BE615562D BE615562A (en:Method) | 1961-03-27 | ||
| DEF33519A DE1209679B (de) | 1961-03-27 | 1961-03-27 | Verfahren zur Herstellung von basischen Farbstoffen |
| CH280862A CH413173A (de) | 1961-03-27 | 1962-03-08 | Verfahren zur Herstellung von Farbstoffen |
| US179244A US3238198A (en) | 1961-03-27 | 1962-03-12 | Methine dyestuffs |
| FR892095A FR1321671A (fr) | 1961-03-27 | 1962-03-23 | Nouveaux colorants et procédé pour les préparer |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF33519A DE1209679B (de) | 1961-03-27 | 1961-03-27 | Verfahren zur Herstellung von basischen Farbstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1209679B true DE1209679B (de) | 1966-01-27 |
Family
ID=7095127
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF33519A Pending DE1209679B (de) | 1961-03-27 | 1961-03-27 | Verfahren zur Herstellung von basischen Farbstoffen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3238198A (en:Method) |
| BE (1) | BE615562A (en:Method) |
| CH (1) | CH413173A (en:Method) |
| DE (1) | DE1209679B (en:Method) |
| GB (1) | GB964452A (en:Method) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7374581B2 (en) * | 2005-04-29 | 2008-05-20 | L'oreal, S.A. | Dye composition containing a particular cationic hydrazone direct dye, dyeing process, use and multi-compartment devices |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1038522B (de) * | 1956-08-14 | 1958-09-11 | Basf Ag | Verfahren zum Faerben von Gebilden aus acrylnitrilhaltigen Polymerisaten |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2767174A (en) * | 1954-12-29 | 1956-10-16 | Schenley Ind Inc | N-benzylidene and n-quinolylmethylene-substituted 2-aminobenzisothiazolones and processes for their preparation |
| BE551825A (en:Method) * | 1955-10-25 | |||
| US2932646A (en) * | 1957-08-30 | 1960-04-12 | Lakeside Lab Inc | Nu-amino-nitrogen containing heterocyclic compounds |
| US3051707A (en) * | 1961-03-21 | 1962-08-28 | Lakeside Lab Inc | Unsymmetrical mono-(aminoalkylene)-hydrazines |
-
0
- GB GB964452D patent/GB964452A/en active Active
- BE BE615562D patent/BE615562A/xx unknown
-
1961
- 1961-03-27 DE DEF33519A patent/DE1209679B/de active Pending
-
1962
- 1962-03-08 CH CH280862A patent/CH413173A/de unknown
- 1962-03-12 US US179244A patent/US3238198A/en not_active Expired - Lifetime
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1038522B (de) * | 1956-08-14 | 1958-09-11 | Basf Ag | Verfahren zum Faerben von Gebilden aus acrylnitrilhaltigen Polymerisaten |
Also Published As
| Publication number | Publication date |
|---|---|
| US3238198A (en) | 1966-03-01 |
| GB964452A (en:Method) | |
| BE615562A (en:Method) | |
| CH413173A (de) | 1966-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1083000B (de) | Verfahren zur Herstellung basischer Farbstoffe | |
| DE2340571C3 (de) | Verfahren zur Herstellung von heterocyclischen Verbindungen | |
| DE1569748C3 (de) | Sulfonsäure- und carbonsäuregruppenfreie Aminodiphenyl-indolyl-methanfarbstoffe, deren Herstellung und Verwendung | |
| DE1285647B (de) | Verfahren zur Herstellung von Dispersionsfarbstoffen | |
| CH413173A (de) | Verfahren zur Herstellung von Farbstoffen | |
| DE1218094B (de) | Verfahren zur Herstellung basischer Farbstoffe | |
| DE2031202A1 (de) | Hydrazonfarbstoffe | |
| DE1133054B (de) | Verfahren zur Herstellung basischer Farbstoffe | |
| DE1225326B (de) | Verfahren zur Herstellung von Farbstoffen | |
| AT223302B (de) | Verfahren zur Herstellung neuer basischer Hydrazonfarbstoffe | |
| DE2341289A1 (de) | Basische farbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2222042A1 (de) | Basische azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| AT223301B (de) | Verfahren zur Herstellung basischer Hydrazonfarbstoffe | |
| DE2360986A1 (de) | Polycyclische farbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2062678A1 (de) | Neue Naphthahmidverbindungen, ihre Herstellung und Verwendung | |
| DE1248192B (de) | Verfahren zur Herstellung von Methinfarbstoffen | |
| AT206549B (de) | Verfahren zur Herstellung neuer basischer Farbstoffe | |
| CH624980A5 (en:Method) | ||
| DE1569721C (de) | Verfahren zur Herstellung von basischen Farbstoffen | |
| DE1150475B (de) | Verfahren zur Herstellung basischer Farbstoffe | |
| DE1569606A1 (de) | Basische Farbstoffe | |
| DE1133053B (de) | Verfahren zur Herstellung basischer Farbstoffe | |
| AT226855B (de) | Verfahren zur Herstellung neuer basischer Hydrazonfarbstoffe | |
| DE1619484C (de) | Verfahren zum Farben und Bedruk *ken von Formkorpern aus Polymerisaten oder Mischpolymerisaten des Acrylmtrils bzw as Dicyanathylens | |
| CH523955A (de) | Verfahren zur Herstellung sulfonsäuregruppenfreier Azoverbindungen |