DE1183896B - Verfahren zur Reinigung von gasfoermigem Formaldehyd - Google Patents
Verfahren zur Reinigung von gasfoermigem FormaldehydInfo
- Publication number
- DE1183896B DE1183896B DE1963F0039306 DEF0039306A DE1183896B DE 1183896 B DE1183896 B DE 1183896B DE 1963F0039306 DE1963F0039306 DE 1963F0039306 DE F0039306 A DEF0039306 A DE F0039306A DE 1183896 B DE1183896 B DE 1183896B
- Authority
- DE
- Germany
- Prior art keywords
- formaldehyde
- treatment
- molecular weight
- carried out
- glycol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 title claims description 128
- 238000000034 method Methods 0.000 title claims description 21
- 238000000746 purification Methods 0.000 title claims description 7
- 239000007788 liquid Substances 0.000 claims description 18
- 239000007789 gas Substances 0.000 claims description 16
- 229920000570 polyether Polymers 0.000 claims description 13
- -1 alkylene glycol Chemical compound 0.000 claims description 12
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 10
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 9
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 7
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 125000004036 acetal group Chemical group 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 238000005406 washing Methods 0.000 description 22
- 238000006116 polymerization reaction Methods 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 12
- 229920001451 polypropylene glycol Polymers 0.000 description 9
- 230000008929 regeneration Effects 0.000 description 9
- 238000011069 regeneration method Methods 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 229930040373 Paraformaldehyde Natural products 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 229920006324 polyoxymethylene Polymers 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 125000005474 octanoate group Chemical group 0.000 description 5
- 238000005201 scrubbing Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 238000000197 pyrolysis Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 125000003916 ethylene diamine group Chemical group 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical compound [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 description 3
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- 239000002574 poison Substances 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 2
- 229950006389 thiodiglycol Drugs 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000012645 aldehyde polymerization Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- 230000009920 chelation Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- NKDDWNXOKDWJAK-UHFFFAOYSA-N dimethoxymethane Chemical compound COCOC NKDDWNXOKDWJAK-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- ZGFPIGGZMWGPPW-UHFFFAOYSA-N formaldehyde;formic acid Chemical compound O=C.OC=O ZGFPIGGZMWGPPW-UHFFFAOYSA-N 0.000 description 1
- KRWIARONJRLNJW-UHFFFAOYSA-N formaldehyde;hexane Chemical compound O=C.CCCCCC KRWIARONJRLNJW-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002373 hemiacetals Chemical class 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000003345 natural gas Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000005704 oxymethylene group Chemical group [H]C([H])([*:2])O[*:1] 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 238000003918 potentiometric titration Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- CZMAXQOXGAWNDO-UHFFFAOYSA-N propane-1,1,2-triol Chemical compound CC(O)C(O)O CZMAXQOXGAWNDO-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Substances CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical compound OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/78—Separation; Purification; Stabilisation; Use of additives
- C07C45/783—Separation; Purification; Stabilisation; Use of additives by gas-liquid treatment, e.g. by gas-liquid absorption
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Polyoxymethylene Polymers And Polymers With Carbon-To-Carbon Bonds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1963F0039306 DE1183896B (de) | 1963-03-22 | 1963-03-22 | Verfahren zur Reinigung von gasfoermigem Formaldehyd |
| AT178564A AT244320B (de) | 1963-03-22 | 1964-03-02 | Verfahren zur Reinigung von gasförmigem Formaldehyd |
| NL6402331A NL6402331A (en:Method) | 1963-03-22 | 1964-03-06 | |
| GB1074364A GB997561A (en) | 1963-03-22 | 1964-03-13 | Process for purifying gaseous formaldehyde |
| BE645348D BE645348A (en:Method) | 1963-03-22 | 1964-03-18 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1963F0039306 DE1183896B (de) | 1963-03-22 | 1963-03-22 | Verfahren zur Reinigung von gasfoermigem Formaldehyd |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1183896B true DE1183896B (de) | 1964-12-23 |
Family
ID=7097712
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1963F0039306 Pending DE1183896B (de) | 1963-03-22 | 1963-03-22 | Verfahren zur Reinigung von gasfoermigem Formaldehyd |
Country Status (5)
| Country | Link |
|---|---|
| AT (1) | AT244320B (en:Method) |
| BE (1) | BE645348A (en:Method) |
| DE (1) | DE1183896B (en:Method) |
| GB (1) | GB997561A (en:Method) |
| NL (1) | NL6402331A (en:Method) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT516530B1 (de) * | 2014-11-20 | 2018-02-15 | Johnson Matthey Plc | Verfahren und Vorrichtung zur Herstellung einer wässrigen Lösung von Formaldehyd |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE623900A (en:Method) * | 1961-10-30 | |||
| US2780652A (en) * | 1954-05-13 | 1957-02-05 | Du Pont | Preparation of high purity formaldehyde |
| DE1090191B (de) * | 1957-04-04 | 1960-10-06 | Du Pont | Verfahren zur Reinigung von gasformigem Formaldehyd |
| DE1106749B (de) * | 1959-04-21 | 1961-05-18 | Basf Ag | Verfahren zur Herstellung von reinem Formaldehyd |
| DE1138752B (de) * | 1958-12-19 | 1962-10-31 | Hoechst Ag | Verfahren zur Herstellung von reinem Formaldehyd |
| DE1140921B (de) * | 1960-06-02 | 1962-12-13 | Farbenfabriken Bayer Aktiengesellschaft, Leverkusen | Verfahren zur Herstellung von hochgereinigtem Formaldehyd. |
-
1963
- 1963-03-22 DE DE1963F0039306 patent/DE1183896B/de active Pending
-
1964
- 1964-03-02 AT AT178564A patent/AT244320B/de active
- 1964-03-06 NL NL6402331A patent/NL6402331A/xx unknown
- 1964-03-13 GB GB1074364A patent/GB997561A/en not_active Expired
- 1964-03-18 BE BE645348D patent/BE645348A/xx unknown
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2780652A (en) * | 1954-05-13 | 1957-02-05 | Du Pont | Preparation of high purity formaldehyde |
| DE1090191B (de) * | 1957-04-04 | 1960-10-06 | Du Pont | Verfahren zur Reinigung von gasformigem Formaldehyd |
| DE1138752B (de) * | 1958-12-19 | 1962-10-31 | Hoechst Ag | Verfahren zur Herstellung von reinem Formaldehyd |
| DE1106749B (de) * | 1959-04-21 | 1961-05-18 | Basf Ag | Verfahren zur Herstellung von reinem Formaldehyd |
| DE1140921B (de) * | 1960-06-02 | 1962-12-13 | Farbenfabriken Bayer Aktiengesellschaft, Leverkusen | Verfahren zur Herstellung von hochgereinigtem Formaldehyd. |
| BE623900A (en:Method) * | 1961-10-30 |
Also Published As
| Publication number | Publication date |
|---|---|
| AT244320B (de) | 1965-12-27 |
| NL6402331A (en:Method) | 1964-09-23 |
| GB997561A (en) | 1965-07-07 |
| BE645348A (en:Method) | 1964-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0003112B1 (de) | Verfahren zur Herstellung von Polybutylenglykolcarbonsäurediester durch Polymerisation von chemisch vorbehandeltem Tetrahydrofuran | |
| DE1795570A1 (de) | Gegen Abbau instabiler Kettenenden stabilisierte,feste Oxymethylencopolymere | |
| DE19530388A1 (de) | Geruchsarme, höhermolekulare Polyetherpolyole, ein Verfahren zu deren Herstellung sowie deren Verwendung für die Herstellung von auf Polyetherpolyolen aufbauenden Polymeren, Kosmetika und pharmazeutischen Produkten | |
| EP0673955B1 (de) | Verfahren zur Aufarbeitung von rohem Polyoxymethylen | |
| DE1137215B (de) | Verfahren zur Herstellung von Polyoxymethylenen | |
| DE2156075A1 (de) | Verfahren zum Reinigen polymerisierbarer organischer Verbindungen | |
| DE4421788C2 (de) | Verfahren zur Herstellung eines Polyalkylenethers mit Ester-Endkappen | |
| DE69520072T2 (de) | Verfahren zur entfernung von fortbildenden stoffen aus 1,4-butandiol und dessen verwendung zur herstellung von ptmeg | |
| DE1183896B (de) | Verfahren zur Reinigung von gasfoermigem Formaldehyd | |
| DE1495729B2 (de) | Verfahren zur herstellung von polyaethern durch polymerisation von alkylenoxyden | |
| DE2703935C2 (de) | Verfahren zur Gewinnung einer wässrigen Acrylamidlösung | |
| DE2914342A1 (de) | Verfahren zur rueckgewinnung nicht umgesetzter olefinischer monomerverbindungen | |
| DE3231797A1 (de) | Verfahren zur wiederverwendung von trioxan | |
| DE1198558B (de) | Verfahren zur Herstellung von hochmolekularen Polyoxymethylenen | |
| DE1543815B2 (de) | Verfahren zur Herstellung von reinen Trioxan | |
| DE1906846A1 (de) | Verfahren zur Reinigung von Acetalen | |
| DE2160419B2 (de) | Verfahren zur Herstellung von Poly phenylenoxiden | |
| AT284442B (de) | Verfahren zum Verbessern der thermischen Stabilität von Copolymerisaten des Trioxans | |
| DE1199991B (de) | Verfahren zur Herstellung von Copolymerisaten durch Polymerisieren von monomerem Formaldehyd oder dessen linearen Polymeren oder Trioxan mit Kohlenmonoxyd | |
| DE3217564A1 (de) | Verfahren zur entfernung des katalysators aus polyphenylenethern | |
| DE1231897B (de) | Verfahren zur Herstellung von Polyoxymethylenglykolen | |
| DE1246245B (de) | Verfahren zur Herstellung von Copolymerisaten des Trioxans | |
| DE1570383C3 (de) | Verfahren zum thermischen Stabilisieren von Oxymethylencopolymerisaten | |
| DE1720509B1 (de) | Verfahren zum thermischen stabilisieren von oxymethylencopolymemerisaten | |
| DE1232565B (de) | Verfahren zur Herstellung von sehr reinem monomerem Formaldehyd |