DE1183498B - Verfahren zur Herstellung von N-(4-acylierten-Benzol-sulfonyl)-N'-cyclooctyl-harnstoffen - Google Patents
Verfahren zur Herstellung von N-(4-acylierten-Benzol-sulfonyl)-N'-cyclooctyl-harnstoffenInfo
- Publication number
- DE1183498B DE1183498B DEF37279A DEF0037279A DE1183498B DE 1183498 B DE1183498 B DE 1183498B DE F37279 A DEF37279 A DE F37279A DE F0037279 A DEF0037279 A DE F0037279A DE 1183498 B DE1183498 B DE 1183498B
- Authority
- DE
- Germany
- Prior art keywords
- benzenesulfonyl
- cyclooctyl
- substituted
- acid
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 4
- -1 alkyl radical Chemical group 0.000 claims description 68
- 238000006243 chemical reaction Methods 0.000 claims description 16
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 12
- 235000013877 carbamide Nutrition 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 7
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 7
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 7
- DQNHNVJSWPPXFY-UHFFFAOYSA-N N-cyclooctylurea Chemical compound NC(=O)NC1CCCCCCC1 DQNHNVJSWPPXFY-UHFFFAOYSA-N 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 150000008331 benzenesulfonamides Chemical class 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 150000003672 ureas Chemical class 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical class OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 claims 1
- NRFQODPXLSMCNG-UHFFFAOYSA-N cyclooctylcarbamic acid Chemical compound OC(=O)NC1CCCCCCC1 NRFQODPXLSMCNG-UHFFFAOYSA-N 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910021529 ammonia Inorganic materials 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000008280 blood Substances 0.000 description 8
- 210000004369 blood Anatomy 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000000155 melt Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- QYKPRMWZTPVYJC-UHFFFAOYSA-N isocyanatocyclooctane Chemical compound O=C=NC1CCCCCCC1 QYKPRMWZTPVYJC-UHFFFAOYSA-N 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 241000283973 Oryctolagus cuniculus Species 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical class NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000007522 mineralic acids Chemical group 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- PDMKFVQFAZDGDO-UHFFFAOYSA-N (4-acetylphenyl)sulfonylurea Chemical compound C(C)(=O)C1=CC=C(C=C1)S(=O)(=O)NC(=O)N PDMKFVQFAZDGDO-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- CSATVXJBGFVJES-UHFFFAOYSA-N 4-acetylbenzenesulfonamide Chemical compound CC(=O)C1=CC=C(S(N)(=O)=O)C=C1 CSATVXJBGFVJES-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical class NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- AYBJSQMXTYQYSU-UHFFFAOYSA-N ethyl N-(4-acetylphenyl)sulfonyl-N-methylcarbamate Chemical compound CN(C(=O)OCC)S(=O)(=O)C1=CC=C(C=C1)C(C)=O AYBJSQMXTYQYSU-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000002218 hypoglycaemic effect Effects 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- XWEVZIDRVIZKRV-UHFFFAOYSA-N 1,3-di(cyclooctyl)urea Chemical compound C1CCCCCCC1NC(=O)NC1CCCCCCC1 XWEVZIDRVIZKRV-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JLJCVDMTHCOFME-UHFFFAOYSA-N 1-(4-acetylphenyl)sulfonyl-3-cycloheptylurea Chemical compound C(C)(=O)C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCCC1 JLJCVDMTHCOFME-UHFFFAOYSA-N 0.000 description 1
- GPRYKVSEZCQIHD-UHFFFAOYSA-N 1-(4-aminophenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C=C1 GPRYKVSEZCQIHD-UHFFFAOYSA-N 0.000 description 1
- BRSRNTJGTDYRFT-UHFFFAOYSA-N 2-(benzenesulfonyl)guanidine Chemical class NC(N)=NS(=O)(=O)C1=CC=CC=C1 BRSRNTJGTDYRFT-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- LZSFYFURKZAZOU-UHFFFAOYSA-N 2-acetylbenzenesulfonyl chloride Chemical compound CC(=O)C1=CC=CC=C1S(Cl)(=O)=O LZSFYFURKZAZOU-UHFFFAOYSA-N 0.000 description 1
- FXVDNCRTKXMSEZ-UHFFFAOYSA-N 4-acetylbenzenesulfonyl chloride Chemical compound CC(=O)C1=CC=C(S(Cl)(=O)=O)C=C1 FXVDNCRTKXMSEZ-UHFFFAOYSA-N 0.000 description 1
- UGEHJRDRKZUJJS-UHFFFAOYSA-N 4-propanoylbenzenesulfonamide Chemical compound CCC(=O)C1=CC=C(S(N)(=O)=O)C=C1 UGEHJRDRKZUJJS-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 244000265913 Crataegus laevigata Species 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical class ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000609 carbazolyl group Chemical class C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- VDTNNGKXZGSZIP-UHFFFAOYSA-N carbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VDTNNGKXZGSZIP-UHFFFAOYSA-N 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 229910003439 heavy metal oxide Inorganic materials 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002542 isoureas Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VHJIYQBTRVEPQR-UHFFFAOYSA-N methyl n-cyclooctylcarbamate Chemical compound COC(=O)NC1CCCCCCC1 VHJIYQBTRVEPQR-UHFFFAOYSA-N 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- XCFPVEPFJPBYAS-UHFFFAOYSA-N n-cyclooctylformamide Chemical compound O=CNC1CCCCCCC1 XCFPVEPFJPBYAS-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229940127017 oral antidiabetic Drugs 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- DOQQTKLDEQSKIE-UHFFFAOYSA-N silver;isocyanate Chemical compound [Ag+].[N-]=C=O DOQQTKLDEQSKIE-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF37279A DE1183498B (de) | 1962-07-10 | 1962-07-10 | Verfahren zur Herstellung von N-(4-acylierten-Benzol-sulfonyl)-N'-cyclooctyl-harnstoffen |
| FI1336/63A FI41154B (cs) | 1962-07-10 | 1963-07-04 | |
| AT543163A AT248451B (de) | 1962-07-10 | 1963-07-08 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| AT901064A AT249687B (de) | 1962-07-10 | 1963-07-08 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| AT901164A AT252935B (de) | 1962-07-10 | 1963-07-08 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| GB26979/63A GB1041981A (en) | 1962-07-10 | 1963-07-08 | Benzenesulphonyl ureas and their manufacture and use |
| SE1726/65A SE311650B (cs) | 1962-07-10 | 1963-07-09 | |
| SE1727/65A SE306529B (cs) | 1962-07-10 | 1963-07-09 | |
| FR950024A FR2956M (fr) | 1962-07-10 | 1963-10-09 | Médicament hypoglycémiant a base de sulfonyl-urée. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF37279A DE1183498B (de) | 1962-07-10 | 1962-07-10 | Verfahren zur Herstellung von N-(4-acylierten-Benzol-sulfonyl)-N'-cyclooctyl-harnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1183498B true DE1183498B (de) | 1964-12-17 |
Family
ID=7096814
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF37279A Pending DE1183498B (de) | 1962-07-10 | 1962-07-10 | Verfahren zur Herstellung von N-(4-acylierten-Benzol-sulfonyl)-N'-cyclooctyl-harnstoffen |
Country Status (6)
| Country | Link |
|---|---|
| AT (3) | AT252935B (cs) |
| DE (1) | DE1183498B (cs) |
| FI (1) | FI41154B (cs) |
| FR (1) | FR2956M (cs) |
| GB (1) | GB1041981A (cs) |
| SE (2) | SE311650B (cs) |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT196413B (de) * | 1955-08-08 | 1958-03-25 | Hoechst Ag | Verfahren zur Herstellung von neuen Sulfonylharnstoffen |
-
1962
- 1962-07-10 DE DEF37279A patent/DE1183498B/de active Pending
-
1963
- 1963-07-04 FI FI1336/63A patent/FI41154B/fi active
- 1963-07-08 AT AT901164A patent/AT252935B/de active
- 1963-07-08 GB GB26979/63A patent/GB1041981A/en not_active Expired
- 1963-07-08 AT AT543163A patent/AT248451B/de active
- 1963-07-08 AT AT901064A patent/AT249687B/de active
- 1963-07-09 SE SE1726/65A patent/SE311650B/xx unknown
- 1963-07-09 SE SE1727/65A patent/SE306529B/xx unknown
- 1963-10-09 FR FR950024A patent/FR2956M/fr active Active
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT196413B (de) * | 1955-08-08 | 1958-03-25 | Hoechst Ag | Verfahren zur Herstellung von neuen Sulfonylharnstoffen |
Also Published As
| Publication number | Publication date |
|---|---|
| AT248451B (de) | 1966-07-25 |
| SE311650B (cs) | 1969-06-23 |
| AT252935B (de) | 1967-03-10 |
| SE306529B (cs) | 1968-12-02 |
| GB1041981A (en) | 1966-09-07 |
| FI41154B (cs) | 1969-06-02 |
| AT249687B (de) | 1966-10-25 |
| FR2956M (fr) | 1964-11-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1185180B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE2951135A1 (de) | Sulfonylharnstoffe, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung | |
| DE1543564C3 (de) | Benzolsulfonylharnstoffe, Verfahren zur ihrer Herstellung und diese enthaltende phyrmazeutische Präparate | |
| DE1198354B (de) | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen | |
| DE1181208B (de) | Verfahren zur Herstellung von N-Benzolsulfonyl-N'-cyclohexyl-harnstoffen | |
| DE1201337B (de) | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen | |
| DE1568626C3 (de) | Benzolsulfonyl-harnstoffe, ihre Salze, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1183498B (de) | Verfahren zur Herstellung von N-(4-acylierten-Benzol-sulfonyl)-N'-cyclooctyl-harnstoffen | |
| EP0031088A1 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen sowie ihre Verwendung | |
| AT228798B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| AT216521B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1135891B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE2132028A1 (de) | Biologisch aktive substituierte Amidine | |
| DE1518846C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1153357B (de) | Verfahren zur Herstellung von Azidobenzolsulfonylharnstoffen | |
| DE1034618B (de) | Verfahren zur Herstellung von Sulfonylharnstoffen | |
| AT228797B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1793111C3 (de) | Acylaminoäthylbenzolsulfonyl-delta hoch 2-cyclohexenyl-harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| AT236402B (de) | Verfahren zur Herstellung von neuen Benzolsulfonyl-semicarbaziden | |
| DE1443890C (de) | Benzolsulfonyl Harnstoffe und Verfahren zu ihrer Herstellung | |
| DE1443878C (de) | Verfahren zur Herstellung von Benzol= sulfonylharnstoffen | |
| AT238216B (de) | Verfahren zur Herstellung von neuen Benzolsulfonyl-semicarbaziden | |
| AT236404B (de) | Verfahren zur Herstellung von neuen Benzolsulfonyl-alkylen-semicarbaziden | |
| DE1188078B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1301812B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |