DE1163675B - Zweikomponenten-Diazotypielichtpausmaterial - Google Patents
Zweikomponenten-DiazotypielichtpausmaterialInfo
- Publication number
- DE1163675B DE1163675B DEK45186A DEK0045186A DE1163675B DE 1163675 B DE1163675 B DE 1163675B DE K45186 A DEK45186 A DE K45186A DE K0045186 A DEK0045186 A DE K0045186A DE 1163675 B DE1163675 B DE 1163675B
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- formula
- dioxy
- acid
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 15
- 150000008049 diazo compounds Chemical class 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- -1 p-aminobenzene diazo compound Chemical class 0.000 description 9
- 238000000034 method Methods 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 7
- 239000011592 zinc chloride Substances 0.000 description 7
- 235000005074 zinc chloride Nutrition 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 239000000975 dye Substances 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000001235 sensitizing effect Effects 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- GLDQAMYCGOIJDV-UHFFFAOYSA-N 2,3-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(O)=C1O GLDQAMYCGOIJDV-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 241000790917 Dioxys <bee> Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000005521 carbonamide group Chemical group 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical class ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- GZZZSOOGQLOEOB-UHFFFAOYSA-N 2,2-dichloro-n-(4-hydroxyphenyl)-n-methylacetamide Chemical compound ClC(Cl)C(=O)N(C)C1=CC=C(O)C=C1 GZZZSOOGQLOEOB-UHFFFAOYSA-N 0.000 description 1
- CLRCAIQMELSJCK-UHFFFAOYSA-N 2,5-diethoxy-1-n,1-n-dimethylbenzene-1,4-diamine Chemical compound CCOC1=CC(N(C)C)=C(OCC)C=C1N CLRCAIQMELSJCK-UHFFFAOYSA-N 0.000 description 1
- YNAKESQZGPZDDZ-UHFFFAOYSA-N 2-n,2-n-diethylbenzene-1,2-diamine Chemical compound CCN(CC)C1=CC=CC=C1N YNAKESQZGPZDDZ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- DENKGPBHLYFNGK-UHFFFAOYSA-N 4-bromobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Br)C=C1 DENKGPBHLYFNGK-UHFFFAOYSA-N 0.000 description 1
- NDNJKFIXDTUIQY-UHFFFAOYSA-N 4-morpholin-4-yl-2,5-dipropoxyaniline Chemical compound O1CCN(CC1)C1=CC(=C(N)C=C1OCCC)OCCC NDNJKFIXDTUIQY-UHFFFAOYSA-N 0.000 description 1
- HJALBXPSRTVJLL-UHFFFAOYSA-N C(C1=CC=CC=C1)N(C)C1=C(C=C(C(=C1)OCC)N)OCC Chemical compound C(C1=CC=CC=C1)N(C)C1=C(C=C(C(=C1)OCC)N)OCC HJALBXPSRTVJLL-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- UIAFKZKHHVMJGS-UHFFFAOYSA-N beta-resorcylic acid Natural products OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000010421 pencil drawing Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/58—Coupling substances therefor
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Paper (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL284911D NL284911A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1961-11-11 | ||
| BE624581D BE624581A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1961-11-11 | ||
| DEK45186A DE1163675B (de) | 1961-11-11 | 1961-11-11 | Zweikomponenten-Diazotypielichtpausmaterial |
| GB41794/62A GB1014660A (en) | 1961-11-11 | 1962-11-05 | Two-component diazotype photoprinting material |
| FR914532A FR1349967A (fr) | 1961-11-11 | 1962-11-06 | Matériaux photosensibles à deux composants pour la diazotypie |
| US236191A US3186845A (en) | 1961-11-11 | 1962-11-08 | Two-component diazotype material |
| CH1312662A CH423469A (de) | 1961-11-11 | 1962-11-09 | Zweikomponenten-Diazotypielichtpausmaterial |
| SE12064/62A SE316077B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1961-11-11 | 1962-11-09 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK45186A DE1163675B (de) | 1961-11-11 | 1961-11-11 | Zweikomponenten-Diazotypielichtpausmaterial |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1163675B true DE1163675B (de) | 1964-02-20 |
Family
ID=7223756
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK45186A Pending DE1163675B (de) | 1961-11-11 | 1961-11-11 | Zweikomponenten-Diazotypielichtpausmaterial |
Country Status (7)
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1053941A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1963-06-18 | |||
| NL128965C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1963-09-06 | |||
| US3480437A (en) * | 1965-11-30 | 1969-11-25 | Gaf Corp | Two component diazo sensitizing compositions containing a xanthine compound |
| US3424585A (en) * | 1966-02-10 | 1969-01-28 | Fairmont Chem Co Inc | Photosensitive diazotype materials |
| US3497355A (en) * | 1968-01-11 | 1970-02-24 | Gaf Corp | Diazotype reproduction material comprising a diazonium compound and method of use |
| US3976491A (en) * | 1974-11-26 | 1976-08-24 | Scott Paper Company | Diazo compositions and diazotype materials prepared from same |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2467358A (en) * | 1946-06-15 | 1949-04-12 | Gen Aniline & Film Corp | Preparation of diazo prints utilizing resorcinol carbonamides as coupling components |
| US2650925A (en) * | 1948-05-03 | 1953-09-01 | Laaketehdas Orion Oy | N, n'-piperazine dicarbamate of 2, 4-di-hydroxyphenylthiol |
| US2819305A (en) * | 1956-09-28 | 1958-01-07 | Olin Mathieson | Aminoalkylamides of butoxybenzoic acid |
| DE1068555B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-02-04 | 1959-11-05 | ||
| NL225064A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-02-19 | |||
| US3072573A (en) * | 1959-05-13 | 1963-01-08 | Goodyear Tire & Rubber | Stabilization of organic compositions with metal deactivators |
| NL259349A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1959-12-23 |
-
0
- BE BE624581D patent/BE624581A/xx unknown
- NL NL284911D patent/NL284911A/xx unknown
-
1961
- 1961-11-11 DE DEK45186A patent/DE1163675B/de active Pending
-
1962
- 1962-11-05 GB GB41794/62A patent/GB1014660A/en not_active Expired
- 1962-11-08 US US236191A patent/US3186845A/en not_active Expired - Lifetime
- 1962-11-09 SE SE12064/62A patent/SE316077B/xx unknown
- 1962-11-09 CH CH1312662A patent/CH423469A/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH423469A (de) | 1966-10-31 |
| US3186845A (en) | 1965-06-01 |
| SE316077B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1969-10-13 |
| GB1014660A (en) | 1965-12-31 |
| NL284911A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| BE624581A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1163675B (de) | Zweikomponenten-Diazotypielichtpausmaterial | |
| DE1226879B (de) | Lichtempfindliches Kopiermaterial mit einseitig diazotiertem p-Phenylendiamin-Derivat als licht-empfindliche Substanz | |
| DE1047621B (de) | Verfahren zur Herstellung von Purpurfarbbildern in einer Halogensilberemulsion mit Hilfe von Acylaminopyrazolonfarbkupplern nach dem Farbentwicklungsverfahren | |
| DE2010280A1 (de) | FarbbIe ichkatalysatoren | |
| DE1182063B (de) | Lichtpausmaterial | |
| DE885197C (de) | Verfahren zur Herstellung von purpurfarbigen photographischen Bildern in Halogen-Gelatine-Emulsionsschichten durch farbbildende Entwicklung | |
| DE1240738B (de) | Lichtempfindliche Schicht fuer die Trockenentwicklung | |
| DE946833C (de) | Verfahren zur Herstellung von Polymethinfarbstoffen | |
| DE1226878B (de) | Lichtempfindliche Diazoschicht | |
| DE857737C (de) | Photographische Halogensilberemulsion fuer die Farbenphotographie | |
| AT233378B (de) | Zweikomponenten-Diazotypielichtpausmaterial | |
| DE2144298C2 (de) | Verwendung von Chinoxalinen als Farbbleichkatalysatoren im photographischen Silberfarbbleichverfahren | |
| DE763721C (de) | Lichtempfindliche Schichten | |
| DE1793150C3 (de) | Zweikomponenten-Diazotypiematerial | |
| DE964290C (de) | Lichtempfindliches Material fuer die Diazotypie | |
| AT228634B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE1224611B (de) | Lichtempfindliches Kopiermaterial fuer die Diazotypie mit 2, 5-Dialkoxy-4-tert.-aminobenzol-diazoniumsalzen | |
| DE1246401B (de) | Diazotypieverfahren, bei dem als Azokomponente ein 2-Hydroxy-3-naphthoesaeureamid verwendet wird | |
| DE963297C (de) | Verfahren zur Herstellung farbiger photographischer Bilder durch chromogene Entwicklung | |
| DE1134588B (de) | Diazotypiematerial, insbesondere fuer die Trockenentwicklung | |
| DE1522422A1 (de) | Verbessertes farbphotographisches Material | |
| DE1229844B (de) | Verfahren zur Herstellung von Lichtpausen | |
| AT219411B (de) | Photographisches Ein- oder Mehrschichtenmaterial | |
| DE730590C (de) | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen | |
| DE881754C (de) | Lichtempfindliche Schichten |