DE1122321B - Fungizides Mittel - Google Patents
Fungizides MittelInfo
- Publication number
- DE1122321B DE1122321B DEN17982A DEN0017982A DE1122321B DE 1122321 B DE1122321 B DE 1122321B DE N17982 A DEN17982 A DE N17982A DE N0017982 A DEN0017982 A DE N0017982A DE 1122321 B DE1122321 B DE 1122321B
- Authority
- DE
- Germany
- Prior art keywords
- triphenyltin
- preparations
- bis
- oxide
- phytotoxicity
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000417 fungicide Substances 0.000 title claims description 5
- MUHFQLVFMFDJOK-UHFFFAOYSA-N triphenyl(triphenylstannyloxy)stannane Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(C=1C=CC=CC=1)O[Sn](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 MUHFQLVFMFDJOK-UHFFFAOYSA-N 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 description 12
- 231100000674 Phytotoxicity Toxicity 0.000 description 8
- 239000013543 active substance Substances 0.000 description 8
- 230000000855 fungicidal effect Effects 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241000233866 Fungi Species 0.000 description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 4
- WDQNIWFZKXZFAY-UHFFFAOYSA-M fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 4
- 229910052718 tin Inorganic materials 0.000 description 4
- 150000003606 tin compounds Chemical class 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000220225 Malus Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- -1 fatty alcohol sulfates Chemical class 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- 235000012015 potatoes Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000233622 Phytophthora infestans Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 239000012874 anionic emulsifier Substances 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000001905 inorganic group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 239000012875 nonionic emulsifier Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/22—Tin compounds
- C07F7/2224—Compounds having one or more tin-oxygen linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL236826 | 1959-03-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1122321B true DE1122321B (de) | 1962-01-18 |
Family
ID=19751608
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN17982A Pending DE1122321B (de) | 1959-03-05 | 1960-03-03 | Fungizides Mittel |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3248283A (Direct) |
| BE (1) | BE588252A (Direct) |
| CH (1) | CH395628A (Direct) |
| DE (1) | DE1122321B (Direct) |
| ES (1) | ES256194A1 (Direct) |
| GB (1) | GB945041A (Direct) |
| NL (2) | NL236826A (Direct) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3876795A (en) * | 1972-08-25 | 1975-04-08 | Procter & Gamble | Method of killing acarids using bis(tri-n-hexyltin)oxide |
| US3923998A (en) * | 1972-12-04 | 1975-12-02 | M & T Chemicals Inc | Certain triorganotin compounds used to combat plant fungi |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2868820A (en) * | 1954-05-08 | 1959-01-13 | Wacker Chemie Gmbh | Preparation of hexaorganodistannoxane and triorganotin hydroxide |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB772663A (en) * | 1953-03-14 | 1957-04-17 | Wacker Chemie Gmbh | Process for stabilising halogen-containing polymers |
| US2867563A (en) * | 1954-07-27 | 1959-01-06 | Refined Products Corp | Phenyl mercury compounds |
| US2912448A (en) * | 1955-10-19 | 1959-11-10 | Metal & Thermit Corp | Hydrocarbontin isodithiocarbamates and process of preparation |
| US2880129A (en) * | 1956-01-19 | 1959-03-31 | Johnson & Johnson | Imparting anti-microbial properties to formed articles |
| US2915428A (en) * | 1956-02-10 | 1959-12-01 | Metal & Thermit Corp | Process for controlling slime in paper making systems and products therefrom |
| US3037037A (en) * | 1960-04-05 | 1962-05-29 | Ethyl Corp | Organophosphorus, arsenic, antimony derivatives of manganese carbonyl compounds |
| NL126846C (Direct) * | 1960-05-27 |
-
0
- NL NL103466D patent/NL103466C/xx active
- BE BE588252D patent/BE588252A/xx unknown
- NL NL236826D patent/NL236826A/xx unknown
-
1960
- 1960-03-01 US US11978A patent/US3248283A/en not_active Expired - Lifetime
- 1960-03-02 ES ES0256194A patent/ES256194A1/es not_active Expired
- 1960-03-02 GB GB7396/60A patent/GB945041A/en not_active Expired
- 1960-03-02 CH CH235760A patent/CH395628A/de unknown
- 1960-03-03 DE DEN17982A patent/DE1122321B/de active Pending
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2868820A (en) * | 1954-05-08 | 1959-01-13 | Wacker Chemie Gmbh | Preparation of hexaorganodistannoxane and triorganotin hydroxide |
Also Published As
| Publication number | Publication date |
|---|---|
| GB945041A (en) | 1963-12-18 |
| CH395628A (de) | 1965-07-15 |
| NL103466C (Direct) | 1900-01-01 |
| ES256194A1 (es) | 1960-10-01 |
| US3248283A (en) | 1966-04-26 |
| NL236826A (Direct) | 1900-01-01 |
| BE588252A (Direct) | 1900-01-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1155630B (de) | Fungicides Pflanzenschutzmittel | |
| DE2122058A1 (de) | Carbamylierte und thiocarbamylierte Guanidine aus Wachstumsregulationsmittel | |
| DE2815287A1 (de) | Herbizide mittel | |
| DE1122321B (de) | Fungizides Mittel | |
| EP0047972A2 (de) | Erhöhung der Kohlehydrat-Einlagerung in Pflanzen mittels substituierten Phenoxyalkansäure- und Cyclohexandionderivaten | |
| AT238999B (de) | Fungizidpräparat | |
| DE2427270A1 (de) | Herbizide mittel | |
| DE1143668B (de) | Fungizide Mittel | |
| EP0075249B1 (de) | Herbizide Mittel | |
| DE961668C (de) | Fungizide Mittel | |
| DE2223936A1 (de) | Fungizide mittel | |
| DE3643246A1 (de) | Mittel zur abszission von pflanzenteilen | |
| DD254877A5 (de) | Zusammensetzung und verfahren zur regulierung des pflanzenwachstums | |
| DE1210620B (de) | Fungitoxische Mittel | |
| DE1768296C3 (de) | Äthyl-N-cyclohexyl-N-propargylthiolcarbamat | |
| DE3033358C2 (de) | Isovaleriansäure-Derivate, Verfahren zu deren Herstellung und diese enthaltende insektizide und acarizide Mittel | |
| DE1174103B (de) | Mittel zur Bekaempfung von Schimmelpilzen auf lebenden Pflanzen | |
| DE1217693B (de) | Insektizides und akarizides Mittel | |
| DE861167C (de) | Schaedlingsbekaempfungsmittel | |
| AT264192B (de) | Insektizide Mischungen | |
| DE3908460C2 (de) | Neue fungizide Formulierungen | |
| DE1266563B (de) | Selektives Herbizid | |
| DE2332429A1 (de) | Regulatoren fuer das pflanzenwachstum | |
| DE1695759B1 (de) | 5-Methyl-7-nitro-8-hydroxychinolin-derivate und ein Verfahren zu ihrer Herstellung | |
| AT240100B (de) | Fungizide Mittel |