DE1101394B - Verfahren zur Herstellung von Polyisocyanaten mit Biuret-Struktur - Google Patents
Verfahren zur Herstellung von Polyisocyanaten mit Biuret-StrukturInfo
- Publication number
- DE1101394B DE1101394B DEF25582A DEF0025582A DE1101394B DE 1101394 B DE1101394 B DE 1101394B DE F25582 A DEF25582 A DE F25582A DE F0025582 A DEF0025582 A DE F0025582A DE 1101394 B DE1101394 B DE 1101394B
- Authority
- DE
- Germany
- Prior art keywords
- diisocyanate
- water
- weight
- parts
- methylbenzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 22
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical group NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 title description 22
- 239000005056 polyisocyanate Substances 0.000 title description 19
- 229920001228 polyisocyanate Polymers 0.000 title description 19
- 238000004519 manufacturing process Methods 0.000 title description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 39
- 238000006243 chemical reaction Methods 0.000 claims description 14
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 7
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 claims description 5
- 229960004889 salicylic acid Drugs 0.000 claims description 5
- 238000002425 crystallisation Methods 0.000 claims description 3
- 230000008025 crystallization Effects 0.000 claims description 3
- 125000005442 diisocyanate group Chemical group 0.000 description 23
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 12
- JGCUIOIXGKBHJU-UHFFFAOYSA-N N=C=O.N=C=O.NC(N)=O Chemical class N=C=O.N=C=O.NC(N)=O JGCUIOIXGKBHJU-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 229920002396 Polyurea Polymers 0.000 description 6
- 239000001569 carbon dioxide Substances 0.000 description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 5
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 5
- 239000012948 isocyanate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 150000002513 isocyanates Chemical class 0.000 description 4
- 230000009257 reactivity Effects 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- -1 N-substituted carbamic acid Chemical class 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- PCHXZXKMYCGVFA-UHFFFAOYSA-N 1,3-diazetidine-2,4-dione Chemical group O=C1NC(=O)N1 PCHXZXKMYCGVFA-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- UIFVCPMLQXKEEU-UHFFFAOYSA-N 2,3-dimethylbenzaldehyde Chemical compound CC1=CC=CC(C=O)=C1C UIFVCPMLQXKEEU-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical group OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 2
- VGHSXKTVMPXHNG-UHFFFAOYSA-N 1,3-diisocyanatobenzene Chemical compound O=C=NC1=CC=CC(N=C=O)=C1 VGHSXKTVMPXHNG-UHFFFAOYSA-N 0.000 description 1
- GWEHVDNNLFDJLR-UHFFFAOYSA-N 1,3-diphenylurea Chemical compound C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 1
- ALQLPWJFHRMHIU-UHFFFAOYSA-N 1,4-diisocyanatobenzene Chemical compound O=C=NC1=CC=C(N=C=O)C=C1 ALQLPWJFHRMHIU-UHFFFAOYSA-N 0.000 description 1
- LEQNJUZEJVNIIP-UHFFFAOYSA-N 2,3-dimethylbutane-2,3-diol;hexahydrate Chemical compound O.O.O.O.O.O.CC(C)(O)C(C)(C)O LEQNJUZEJVNIIP-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- BJIYQBIFXLHQRV-UHFFFAOYSA-N 4-phenylbutylurea Chemical compound NC(=O)NCCCCC1=CC=CC=C1 BJIYQBIFXLHQRV-UHFFFAOYSA-N 0.000 description 1
- HQOMPQSYJMJMIR-UHFFFAOYSA-N C(C)C(COC(N)=O)(CC)CC Chemical compound C(C)C(COC(N)=O)(CC)CC HQOMPQSYJMJMIR-UHFFFAOYSA-N 0.000 description 1
- WMAPZFAWKYUPFD-UHFFFAOYSA-N N=C=O.N=C=O.CCOC(N)=O Chemical compound N=C=O.N=C=O.CCOC(N)=O WMAPZFAWKYUPFD-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- RNFNDJAIBTYOQL-UHFFFAOYSA-N chloral hydrate Chemical compound OC(O)C(Cl)(Cl)Cl RNFNDJAIBTYOQL-UHFFFAOYSA-N 0.000 description 1
- 229960002327 chloral hydrate Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- OIAUFEASXQPCFE-UHFFFAOYSA-N formaldehyde;1,3-xylene Chemical compound O=C.CC1=CC=CC(C)=C1 OIAUFEASXQPCFE-UHFFFAOYSA-N 0.000 description 1
- MGJURKDLIJVDEO-UHFFFAOYSA-N formaldehyde;hydrate Chemical class O.O=C MGJURKDLIJVDEO-UHFFFAOYSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- CCCMONHAUSKTEQ-UHFFFAOYSA-N octadecene Natural products CCCCCCCCCCCCCCCCC=C CCCMONHAUSKTEQ-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1854—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety
- C07C273/1863—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety from urea
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1872—Preparation of compounds comprising a -N-C(O)-N-C(O)-N- moiety
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Polyurethanes Or Polyureas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL238495D NL238495A (enExample) | 1958-04-24 | ||
| DEF25582A DE1101394B (de) | 1958-04-24 | 1958-04-24 | Verfahren zur Herstellung von Polyisocyanaten mit Biuret-Struktur |
| NL238495A NL144928B (nl) | 1958-04-24 | 1959-04-23 | Werkwijze voor de bereiding van polyisocyanaten met biureetstructuur. |
| BE578071A BE578071A (fr) | 1958-04-24 | 1959-04-24 | Polyisocyanates de biuret |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF25582A DE1101394B (de) | 1958-04-24 | 1958-04-24 | Verfahren zur Herstellung von Polyisocyanaten mit Biuret-Struktur |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1101394B true DE1101394B (de) | 1961-03-09 |
Family
ID=7091690
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF25582A Pending DE1101394B (de) | 1958-04-24 | 1958-04-24 | Verfahren zur Herstellung von Polyisocyanaten mit Biuret-Struktur |
Country Status (3)
| Country | Link |
|---|---|
| BE (1) | BE578071A (enExample) |
| DE (1) | DE1101394B (enExample) |
| NL (2) | NL144928B (enExample) |
Cited By (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1165580B (de) * | 1962-06-27 | 1964-03-19 | Bayer Ag | Verfahren zur Herstellung von Polyisocyanaten mit Biuret-Struktur |
| DE1271867B (de) | 1965-03-17 | 1968-07-04 | Bayer Ag | Verfahren zur Herstellung von Lackueberzuegen aus Lackloesungen von aliphatischen Polyisocyanaten und Hydroxylgruppen aufweisenden Polyestern in organischen Loesungsmitteln |
| DE1769817B1 (de) * | 1968-07-19 | 1971-11-18 | Bayer Ag | Verfahren zur Herstellung von Lackueberzuegen |
| DE2308015A1 (de) * | 1973-02-17 | 1974-09-12 | Bayer Ag | Verfahren zur herstellung von polyisocyanaten mit biuretstruktur |
| DE2612783A1 (de) * | 1976-03-25 | 1977-09-29 | Hoechst Ag | Blockierte polyisocyanate aus biuretgruppenhaltigem polyisocyanat und acetessigsaeurealkylester |
| US4264519A (en) | 1978-01-25 | 1981-04-28 | Bayer Aktiengesellschaft | Process for the preparation of organic polyisocyanates containing biuret groups |
| US4328282A (en) | 1980-02-11 | 1982-05-04 | Basf Aktiengesellschaft | Magnetic recording media |
| US4340712A (en) | 1978-12-30 | 1982-07-20 | Bayer Aktiengesellschaft | Process for the preparation of polyisocyanates containing biuret and/or higher polyuret groups and use thereof as synthesis component in the preparation of polyurethane plastics |
| US4373080A (en) | 1978-12-30 | 1983-02-08 | Bayer Aktiengesellschaft | Polyisocyanates, preparation and use thereof |
| US4666783A (en) * | 1984-05-18 | 1987-05-19 | Basf Aktiengesellschaft | Magnetic recording media |
| EP0778298A2 (de) | 1995-12-07 | 1997-06-11 | Bayer Ag | Festkörperreiche Bindemittelkombination |
| US6005062A (en) * | 1998-07-02 | 1999-12-21 | 3M Innovative Properties Company | Secondary aspartic acid amide esters |
| EP1101780A2 (de) | 1999-11-17 | 2001-05-23 | Bayer Ag | Neue, festkörperrreiche Bindemittelkombinationen und deren Verwendung |
| EP1216987A1 (de) * | 2000-12-22 | 2002-06-26 | Basf Aktiengesellschaft | Verfahren zur Herstellung von hochfunktionellen aromatischen Polyisocyanaten |
| US7022874B2 (en) | 1995-02-15 | 2006-04-04 | Basf Aktiengesellschaft | Preparation of biuret-containing polyisocyanates |
| WO2008157013A1 (en) | 2007-06-13 | 2008-12-24 | Hontek Corporation | Method and coating for protecting and repairing an airfoil surface using molded boots, sheet or tape |
| EP2098367A1 (en) | 2008-03-05 | 2009-09-09 | Eastman Kodak Company | Sensitizer/Initiator Combination for Negative-Working Thermal-Sensitive Compositions Usable for Lithographic Plates |
| EP2180011A1 (de) | 2008-10-22 | 2010-04-28 | Bayer MaterialScience AG | Feuchtigkeitshärtende Polyisocyanatmischungen |
| US7736745B2 (en) | 2004-05-24 | 2010-06-15 | Hontek Corporation | Abrasion resistant coatings |
| EP2202256A1 (en) | 2008-12-23 | 2010-06-30 | Bayer MaterialScience LLC | Polymer polyols comprising a natural oil base polyol, polyurethane foams comprising these polymer polyols and processes for their preparation |
| DE102009007194A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Flexible Beschichtungen |
| DE102009007228A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Beschichtungen |
| EP2287151A1 (de) | 2009-08-21 | 2011-02-23 | Bayer MaterialScience AG | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur |
| WO2011068855A1 (en) | 2009-12-04 | 2011-06-09 | Basf Coatings Gmbh | Method and composition for refinish coatings |
| US8063144B2 (en) | 2004-11-25 | 2011-11-22 | Bayer Materialscience Ag | Polyisocyanate mixtures, a process for their preparation and their use in coating compositions |
| US8091227B2 (en) | 2005-12-14 | 2012-01-10 | Hontek Corporation | Method of repairing an airfoil surface |
| DE102010031682A1 (de) | 2010-07-20 | 2012-01-26 | Bayer Materialscience Ag | Bindemittelkombinationen für konstruktive Trinkwasserrohrbeschichtungen |
| WO2012054547A1 (en) | 2010-10-20 | 2012-04-26 | Basf Coatings Gmbh | Scratch-resistant refinish clearcoat |
| EP2628530A1 (de) | 2008-03-11 | 2013-08-21 | Basf Se | Mikrokapseln mit Wänden aus Acylharnstoff |
| WO2013127850A1 (en) | 2012-02-29 | 2013-09-06 | Bayer Intellectual Property Gmbh | 2-k pultrusion formulation and process |
| WO2013137964A2 (en) | 2011-12-21 | 2013-09-19 | Hontek Corporation | Method and coating for protecting and repairing an airfoil surface |
| EP2671853A1 (en) | 2012-06-06 | 2013-12-11 | 3M Innovative Properties Company | Magnetic floor surface |
| DE202014101620U1 (de) | 2014-04-07 | 2014-04-29 | Franken Systems Gmbh | Gebinde mit 2-Komponenten Polyurea-Kunstharzen |
| DE202012013176U1 (de) | 2012-06-06 | 2015-04-01 | !Obac Limited | Magnetische Bodenfläche |
| WO2015089962A1 (zh) | 2013-12-20 | 2015-06-25 | 万华化学集团股份有限公司 | 一种制备缩二脲多异氰酸酯的方法 |
| EP2894180A1 (en) | 2014-01-08 | 2015-07-15 | Bayer MaterialScience AG | Polymer Polyols comprising a Polyether Carbonate Polyol as the Base Polyol |
| WO2017112012A2 (en) | 2015-09-17 | 2017-06-29 | Jerez Roberto Velozzi | Load-bearing composite panels, materials, products, and processes to make and use same |
| WO2018046335A1 (en) | 2016-09-08 | 2018-03-15 | Basf Coatings Gmbh | Radiation-curable hyperbranched polymers with dicarboxylic acid cores |
| WO2018046334A1 (en) | 2016-09-08 | 2018-03-15 | Basf Coatings Gmbh | Coatings with radiation-curable hyperbranched polymers |
| WO2018050509A2 (en) | 2016-09-15 | 2018-03-22 | Basf Coatings Gmbh | Coatings with wax-modified hyperbranched and flexible hyperbranched polyols |
| WO2019072553A1 (en) | 2017-10-11 | 2019-04-18 | Basf Coatings Gmbh | HYPERRAMIFIED POLYMERS FOR DISPERSIONS OF ORGANIC PIGMENTS AND WATER-SENSITIVE PIGMENTS |
| WO2019149672A2 (en) | 2018-02-02 | 2019-08-08 | Basf Se | Simultaneous optimization of fiber sizing in-line with the pultrusion process |
| WO2019211127A1 (en) | 2018-04-30 | 2019-11-07 | Evonik Degussa Gmbh | Polyurea compositions from polyaspartic esters and secondary heterocyclic amines derived aspartic esters |
| WO2021136800A1 (en) | 2019-12-30 | 2021-07-08 | Basf Coatings Gmbh | Coatings containing branched polyester polyols as plasticizers |
| WO2022043421A1 (en) | 2020-08-28 | 2022-03-03 | Basf Coatings Gmbh | Solvent-borne, two-pack, anticorrosion coating composition |
| WO2022090358A1 (en) | 2020-10-28 | 2022-05-05 | Basf Se | Production of a polyester polyol with low voc emission |
| WO2023020755A1 (en) | 2021-08-17 | 2023-02-23 | Evonik Operations Gmbh | Polyurea compositions from polyaspartic esters and 2-substituted butanedioic acid esters |
| CN115894302A (zh) * | 2022-10-20 | 2023-04-04 | 山东新和成维生素有限公司 | 缩二脲多异氰酸酯的制备方法 |
-
0
- NL NL238495D patent/NL238495A/xx unknown
-
1958
- 1958-04-24 DE DEF25582A patent/DE1101394B/de active Pending
-
1959
- 1959-04-23 NL NL238495A patent/NL144928B/xx not_active IP Right Cessation
- 1959-04-24 BE BE578071A patent/BE578071A/fr unknown
Cited By (72)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1165580B (de) * | 1962-06-27 | 1964-03-19 | Bayer Ag | Verfahren zur Herstellung von Polyisocyanaten mit Biuret-Struktur |
| DE1271867B (de) | 1965-03-17 | 1968-07-04 | Bayer Ag | Verfahren zur Herstellung von Lackueberzuegen aus Lackloesungen von aliphatischen Polyisocyanaten und Hydroxylgruppen aufweisenden Polyestern in organischen Loesungsmitteln |
| DE1769817B1 (de) * | 1968-07-19 | 1971-11-18 | Bayer Ag | Verfahren zur Herstellung von Lackueberzuegen |
| DE2308015A1 (de) * | 1973-02-17 | 1974-09-12 | Bayer Ag | Verfahren zur herstellung von polyisocyanaten mit biuretstruktur |
| DE2612783A1 (de) * | 1976-03-25 | 1977-09-29 | Hoechst Ag | Blockierte polyisocyanate aus biuretgruppenhaltigem polyisocyanat und acetessigsaeurealkylester |
| US4264519A (en) | 1978-01-25 | 1981-04-28 | Bayer Aktiengesellschaft | Process for the preparation of organic polyisocyanates containing biuret groups |
| US4292255A (en) * | 1978-01-25 | 1981-09-29 | Bayer Aktiengesellschaft | Process for the preparation of organic polyisocyanates containing urea groups |
| US4340712A (en) | 1978-12-30 | 1982-07-20 | Bayer Aktiengesellschaft | Process for the preparation of polyisocyanates containing biuret and/or higher polyuret groups and use thereof as synthesis component in the preparation of polyurethane plastics |
| US4373080A (en) | 1978-12-30 | 1983-02-08 | Bayer Aktiengesellschaft | Polyisocyanates, preparation and use thereof |
| US4328282A (en) | 1980-02-11 | 1982-05-04 | Basf Aktiengesellschaft | Magnetic recording media |
| US4666783A (en) * | 1984-05-18 | 1987-05-19 | Basf Aktiengesellschaft | Magnetic recording media |
| US7022874B2 (en) | 1995-02-15 | 2006-04-04 | Basf Aktiengesellschaft | Preparation of biuret-containing polyisocyanates |
| EP0778298A2 (de) | 1995-12-07 | 1997-06-11 | Bayer Ag | Festkörperreiche Bindemittelkombination |
| US6005062A (en) * | 1998-07-02 | 1999-12-21 | 3M Innovative Properties Company | Secondary aspartic acid amide esters |
| US6469199B1 (en) | 1998-07-02 | 2002-10-22 | 3M Innovative Properties Company | Secondary aspartic acid amide esters |
| US6573398B2 (en) | 1998-07-02 | 2003-06-03 | 3M Innovative Properties Company | Secondary aspartic acid amide esters |
| EP1101780A2 (de) | 1999-11-17 | 2001-05-23 | Bayer Ag | Neue, festkörperrreiche Bindemittelkombinationen und deren Verwendung |
| EP1216987A1 (de) * | 2000-12-22 | 2002-06-26 | Basf Aktiengesellschaft | Verfahren zur Herstellung von hochfunktionellen aromatischen Polyisocyanaten |
| US9663663B2 (en) | 2004-05-24 | 2017-05-30 | Hontek Corporation | Airfoil leading edge coatings |
| US9732232B2 (en) | 2004-05-24 | 2017-08-15 | Hontek Corporation | Abrasion resistant coatings |
| US7736745B2 (en) | 2004-05-24 | 2010-06-15 | Hontek Corporation | Abrasion resistant coatings |
| US10557038B2 (en) | 2004-05-24 | 2020-02-11 | Hontek Corporation | Erosion resistant coatings |
| US8063144B2 (en) | 2004-11-25 | 2011-11-22 | Bayer Materialscience Ag | Polyisocyanate mixtures, a process for their preparation and their use in coating compositions |
| US9770791B2 (en) | 2005-12-14 | 2017-09-26 | Hontek Corporation | Method for repairing an airfoil surface having an elastomeric protective coating |
| EP2502679A2 (en) | 2005-12-14 | 2012-09-26 | Hontek Corporation | Method and coating for protecting and repairing an airfoil surface |
| EP3305465A1 (en) | 2005-12-14 | 2018-04-11 | Hontek Corporation | Method and coating for protecting and repairing an airfoil surface |
| US8091227B2 (en) | 2005-12-14 | 2012-01-10 | Hontek Corporation | Method of repairing an airfoil surface |
| WO2008157013A1 (en) | 2007-06-13 | 2008-12-24 | Hontek Corporation | Method and coating for protecting and repairing an airfoil surface using molded boots, sheet or tape |
| EP2098367A1 (en) | 2008-03-05 | 2009-09-09 | Eastman Kodak Company | Sensitizer/Initiator Combination for Negative-Working Thermal-Sensitive Compositions Usable for Lithographic Plates |
| EP2628530A1 (de) | 2008-03-11 | 2013-08-21 | Basf Se | Mikrokapseln mit Wänden aus Acylharnstoff |
| EP2180011A1 (de) | 2008-10-22 | 2010-04-28 | Bayer MaterialScience AG | Feuchtigkeitshärtende Polyisocyanatmischungen |
| DE102008052765A1 (de) | 2008-10-22 | 2010-04-29 | Bayer Materialscience Ag | Feuchtigkeitshärtende Polyisocyanatmischungen |
| EP2202256A1 (en) | 2008-12-23 | 2010-06-30 | Bayer MaterialScience LLC | Polymer polyols comprising a natural oil base polyol, polyurethane foams comprising these polymer polyols and processes for their preparation |
| WO2010089034A1 (de) | 2009-02-03 | 2010-08-12 | Bayer Materialscience Ag | Zweikomponenten-beschichtungszusammensetzungen für flexible beschichtungen |
| WO2010089033A1 (de) | 2009-02-03 | 2010-08-12 | Bayer Materialscience Ag | Beschichtungen auf basis allophanatgruppen haltiger polyisocyanate |
| DE102009007228A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Beschichtungen |
| DE102009007194A1 (de) | 2009-02-03 | 2010-08-05 | Bayer Materialscience Ag | Flexible Beschichtungen |
| CN101993396A (zh) * | 2009-08-21 | 2011-03-30 | 拜尔材料科学股份公司 | 具有缩二脲结构聚异氰酸酯的制备方法 |
| DE102009038463A1 (de) | 2009-08-21 | 2011-02-24 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur |
| EP2287151A1 (de) | 2009-08-21 | 2011-02-23 | Bayer MaterialScience AG | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur |
| US8445623B2 (en) | 2009-08-21 | 2013-05-21 | Bayer Materialscience Ag | Process for the preparation of polyisocyanates with a biuret structure |
| CN101993396B (zh) * | 2009-08-21 | 2014-09-03 | 拜尔材料科学股份公司 | 具有缩二脲结构多异氰酸酯的制备方法 |
| WO2011068855A1 (en) | 2009-12-04 | 2011-06-09 | Basf Coatings Gmbh | Method and composition for refinish coatings |
| WO2012010528A1 (de) | 2010-07-20 | 2012-01-26 | Bayer Materialscience Ag | Bindemittelkombinationen für konstruktive trinkwasserrohrbeschichtungen |
| DE102010031682A1 (de) | 2010-07-20 | 2012-01-26 | Bayer Materialscience Ag | Bindemittelkombinationen für konstruktive Trinkwasserrohrbeschichtungen |
| WO2012054547A1 (en) | 2010-10-20 | 2012-04-26 | Basf Coatings Gmbh | Scratch-resistant refinish clearcoat |
| WO2013137964A2 (en) | 2011-12-21 | 2013-09-19 | Hontek Corporation | Method and coating for protecting and repairing an airfoil surface |
| WO2013127850A1 (en) | 2012-02-29 | 2013-09-06 | Bayer Intellectual Property Gmbh | 2-k pultrusion formulation and process |
| US12421400B2 (en) | 2012-06-06 | 2025-09-23 | IOBAC Limited | Magnetic floor surface |
| EP2671853A1 (en) | 2012-06-06 | 2013-12-11 | 3M Innovative Properties Company | Magnetic floor surface |
| DE202012013176U1 (de) | 2012-06-06 | 2015-04-01 | !Obac Limited | Magnetische Bodenfläche |
| US10720270B2 (en) | 2012-06-06 | 2020-07-21 | !Obac Limited | Magnetic floor surface |
| US10699828B2 (en) | 2012-06-06 | 2020-06-30 | !Obac Limited | Magnetic floor surface |
| WO2013182490A1 (en) | 2012-06-06 | 2013-12-12 | 3M Innovative Properties Company | Magnetic floor surface |
| US9701624B2 (en) | 2013-12-20 | 2017-07-11 | Wanhua Chemical Group Co., Ltd. | Method for preparing biuret polyisocyanate |
| WO2015089962A1 (zh) | 2013-12-20 | 2015-06-25 | 万华化学集团股份有限公司 | 一种制备缩二脲多异氰酸酯的方法 |
| EP2894180A1 (en) | 2014-01-08 | 2015-07-15 | Bayer MaterialScience AG | Polymer Polyols comprising a Polyether Carbonate Polyol as the Base Polyol |
| DE202014101620U1 (de) | 2014-04-07 | 2014-04-29 | Franken Systems Gmbh | Gebinde mit 2-Komponenten Polyurea-Kunstharzen |
| EP3766686A1 (en) | 2015-09-17 | 2021-01-20 | Roberto Velozzi Jerez | Load-bearing composite panels, materials, products, and processes to make and use same |
| WO2017112012A2 (en) | 2015-09-17 | 2017-06-29 | Jerez Roberto Velozzi | Load-bearing composite panels, materials, products, and processes to make and use same |
| WO2018046334A1 (en) | 2016-09-08 | 2018-03-15 | Basf Coatings Gmbh | Coatings with radiation-curable hyperbranched polymers |
| WO2018046335A1 (en) | 2016-09-08 | 2018-03-15 | Basf Coatings Gmbh | Radiation-curable hyperbranched polymers with dicarboxylic acid cores |
| US10689541B2 (en) | 2016-09-15 | 2020-06-23 | Basf Coatings Gmbh | Coatings with wax-modified hyperbranched and flexible hyperbranched polyols |
| WO2018050509A2 (en) | 2016-09-15 | 2018-03-22 | Basf Coatings Gmbh | Coatings with wax-modified hyperbranched and flexible hyperbranched polyols |
| WO2019072553A1 (en) | 2017-10-11 | 2019-04-18 | Basf Coatings Gmbh | HYPERRAMIFIED POLYMERS FOR DISPERSIONS OF ORGANIC PIGMENTS AND WATER-SENSITIVE PIGMENTS |
| WO2019149672A2 (en) | 2018-02-02 | 2019-08-08 | Basf Se | Simultaneous optimization of fiber sizing in-line with the pultrusion process |
| WO2019211127A1 (en) | 2018-04-30 | 2019-11-07 | Evonik Degussa Gmbh | Polyurea compositions from polyaspartic esters and secondary heterocyclic amines derived aspartic esters |
| WO2021136800A1 (en) | 2019-12-30 | 2021-07-08 | Basf Coatings Gmbh | Coatings containing branched polyester polyols as plasticizers |
| WO2022043421A1 (en) | 2020-08-28 | 2022-03-03 | Basf Coatings Gmbh | Solvent-borne, two-pack, anticorrosion coating composition |
| WO2022090358A1 (en) | 2020-10-28 | 2022-05-05 | Basf Se | Production of a polyester polyol with low voc emission |
| WO2023020755A1 (en) | 2021-08-17 | 2023-02-23 | Evonik Operations Gmbh | Polyurea compositions from polyaspartic esters and 2-substituted butanedioic acid esters |
| CN115894302A (zh) * | 2022-10-20 | 2023-04-04 | 山东新和成维生素有限公司 | 缩二脲多异氰酸酯的制备方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| NL238495A (enExample) | |
| NL144928B (nl) | 1975-02-17 |
| BE578071A (fr) | 1959-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1101394B (de) | Verfahren zur Herstellung von Polyisocyanaten mit Biuret-Struktur | |
| EP0003505B1 (de) | Verfahren zur Herstellung von Biuret- und/oder Harnstoffgruppen aufweisenden organischen Polyisocyanaten, sowie Dispersionen von Harnstoffgruppen aufweisenden Polyisocyanaten in Harnstoffgruppen-freiem Diisocyanat | |
| DE1215365B (de) | Verfahren zur Herstellung von hoehermolekularen Polyisocyanaten mit Biuret-Struktur | |
| DE2732182A1 (de) | Stabilisiertes diphenylmethan- diisocyanat-vorpolymeres und verfahren zu seiner herstellung | |
| DE1174759B (de) | Verfahren zur Herstellung von Polyisocyanaten mit Biuretstruktur | |
| DE1092007B (de) | Verfahren zur Herstellung von ein Carbodiimid-Isocyanat-Addukt enthaltenden Polyisocyanaten | |
| EP0220641B1 (de) | Substituierte p,p'-Methylen-bis-aniline | |
| DE1618394B2 (de) | Verfahren zur Herstellung von nicht-flüchtigen niedermolekularen, tertiäre Aminogruppen enthaltenden Mono- und Polyisocyanaten | |
| DD246763A5 (de) | Verfahren zur herstellung von polyisocyanaten-polyisocyanuraten | |
| DE1932832A1 (de) | Neue Isocyanatverbindung einschliesslich eines neuen Amins und deren Verwendung zur Herstellung von Polyurethanen | |
| DE1174760B (de) | Verfahren zur Herstellung von Polyisocyanaten mit Biuret-Struktur | |
| DE2403858A1 (de) | Stabile, fluessige amid- und/oder acylharnstoffgruppenhaltige isocyanurat-polyisocyanatloesungen | |
| DE2604657A1 (de) | Haerter fuer polyurethan-reaktionsgemische | |
| DE1122254B (de) | Verfahren zur Herstellung von primaere Amino- und Harnstoffgruppen aufweisenden hoehermolekularen Verbindungen | |
| DE1227003B (de) | Verfahren zur Herstellung von Polyisocyanaten mit Carbamylbiuret-Struktur | |
| DE1229067B (de) | Verfahren zur Herstellung von Polyisocyanaten | |
| DE831604C (de) | Verfahren zur Herstellung von Kunststoffen | |
| EP0105168B1 (de) | Aromatische Uretdion-di-harnstoff-diamine, Verfahren zu ihrer Herstellung und ihre Verwendung bei der Polyurethansynthese | |
| EP0062823A1 (de) | Verfahren zur Herstellung von Harnstoff- und/oder Biuretgruppen aufweisenden aromatischen Polyisocyanaten und ihre Verwendung als Isocyanatkomponente bei der Herstellung von Polyurethankunststoffen | |
| EP0113027B1 (de) | Verfahren zur Herstellung von Polyaminen | |
| DE2619548A1 (de) | Verfahren zur herstellung von biuretgruppen aufweisenden polyisocyanaten | |
| DE952940C (de) | Verfahren zur Herstellung hochmolekularer, vernetzter Kunststoffe aus linearen oder vorwiegend linearen Polyestern, Diisocyanaten und Diaminen | |
| CH422781A (de) | Verfahren zur Herstellung von Silicium enthaltenden heterocyclischen Triisocyanaten | |
| EP0191386B1 (de) | Harnstoff- sowie Ester- oder Amidgruppen aufweisende Polyhydroxyverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2830243C2 (enExample) |