DE1082404B - Warmverformbare Masse auf Grundlage von hochmolekularen, endstaendig veresterten oder veraetherten Polyoxymethylenen - Google Patents
Warmverformbare Masse auf Grundlage von hochmolekularen, endstaendig veresterten oder veraetherten PolyoxymethylenenInfo
- Publication number
- DE1082404B DE1082404B DEP18985A DEP0018985A DE1082404B DE 1082404 B DE1082404 B DE 1082404B DE P18985 A DEP18985 A DE P18985A DE P0018985 A DEP0018985 A DE P0018985A DE 1082404 B DE1082404 B DE 1082404B
- Authority
- DE
- Germany
- Prior art keywords
- polyoxymethylene
- polymer
- molecular weight
- high molecular
- etherified
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 polyoxymethylene Polymers 0.000 title claims description 35
- 229920006324 polyoxymethylene Polymers 0.000 title claims description 31
- 229930040373 Paraformaldehyde Natural products 0.000 title description 19
- 150000002989 phenols Chemical class 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 9
- 239000004952 Polyamide Substances 0.000 claims description 5
- 229920002647 polyamide Polymers 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- XOUQAVYLRNOXDO-UHFFFAOYSA-N 2-tert-butyl-5-methylphenol Chemical compound CC1=CC=C(C(C)(C)C)C(O)=C1 XOUQAVYLRNOXDO-UHFFFAOYSA-N 0.000 claims 2
- 230000000087 stabilizing effect Effects 0.000 claims 2
- YQQAAUCBTNZUQQ-UHFFFAOYSA-N 2-[1-(2-hydroxy-3,5-dimethylphenyl)butyl]-4,6-dimethylphenol Chemical compound C=1C(C)=CC(C)=C(O)C=1C(CCC)C1=CC(C)=CC(C)=C1O YQQAAUCBTNZUQQ-UHFFFAOYSA-N 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Chemical group CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 27
- 239000003963 antioxidant agent Substances 0.000 description 20
- 235000006708 antioxidants Nutrition 0.000 description 20
- 230000003078 antioxidant effect Effects 0.000 description 11
- 239000007789 gas Substances 0.000 description 9
- WJQOZHYUIDYNHM-UHFFFAOYSA-N 2-tert-Butylphenol Chemical compound CC(C)(C)C1=CC=CC=C1O WJQOZHYUIDYNHM-UHFFFAOYSA-N 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- 238000005979 thermal decomposition reaction Methods 0.000 description 6
- 238000000227 grinding Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000002845 discoloration Methods 0.000 description 4
- 125000001033 ether group Chemical group 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- FQUNFJULCYSSOP-UHFFFAOYSA-N bisoctrizole Chemical compound N1=C2C=CC=CC2=NN1C1=CC(C(C)(C)CC(C)(C)C)=CC(CC=2C(=C(C=C(C=2)C(C)(C)CC(C)(C)C)N2N=C3C=CC=CC3=N2)O)=C1O FQUNFJULCYSSOP-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 150000002148 esters Chemical group 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical group CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000004519 grease Substances 0.000 description 2
- 239000012760 heat stabilizer Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000002530 phenolic antioxidant Substances 0.000 description 2
- GRWFGVWFFZKLTI-IUCAKERBSA-N (-)-α-pinene Chemical compound CC1=CC[C@@H]2C(C)(C)[C@H]1C2 GRWFGVWFFZKLTI-IUCAKERBSA-N 0.000 description 1
- MXAOILAHPVJWBS-UHFFFAOYSA-N 10-(azepan-1-yl)-10-oxodecanamide Chemical compound NC(=O)CCCCCCCCC(=O)N1CCCCCC1 MXAOILAHPVJWBS-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- PFANXOISJYKQRP-UHFFFAOYSA-N 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(CCC)C1=CC(C(C)(C)C)=C(O)C=C1C PFANXOISJYKQRP-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000003064 anti-oxidating effect Effects 0.000 description 1
- 229920005601 base polymer Polymers 0.000 description 1
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000012668 chain scission Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000006864 oxidative decomposition reaction Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 235000021286 stilbenes Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- DJZKNOVUNYPPEE-UHFFFAOYSA-N tetradecane-1,4,11,14-tetracarboxamide Chemical compound NC(=O)CCCC(C(N)=O)CCCCCCC(C(N)=O)CCCC(N)=O DJZKNOVUNYPPEE-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/13—Phenols; Phenolates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US600159A US2966476A (en) | 1956-07-26 | 1956-07-26 | Antioxidant composition for polyoxymethylenes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1082404B true DE1082404B (de) | 1960-05-25 |
Family
ID=24402533
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP18985A Pending DE1082404B (de) | 1956-07-26 | 1957-07-23 | Warmverformbare Masse auf Grundlage von hochmolekularen, endstaendig veresterten oder veraetherten Polyoxymethylenen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2966476A (enExample) |
| CH (1) | CH361129A (enExample) |
| DE (1) | DE1082404B (enExample) |
| FR (1) | FR1179858A (enExample) |
| GB (1) | GB860411A (enExample) |
| NL (2) | NL219323A (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1156229B (de) * | 1961-04-13 | 1963-10-24 | Hoechst Ag | Verwendung von substituierten Phenolen zum Stabilisieren von Trioxan-Mischpolymerisaten |
| DE1190183B (de) * | 1961-06-28 | 1965-04-01 | Kurashiki Rayon Co | Stabilisatorgemisch fuer hochmolekulare Polyoxymethylene |
| DE1208884B (de) * | 1962-09-27 | 1966-01-13 | Hoechst Ag | Stabilisierung von Polyacetalen |
| DE1210557B (de) * | 1961-08-08 | 1966-02-10 | Celanese Corp | Phenole als Stabilisatoren fuer Oxymethylenpolymere |
| DE1214397B (de) * | 1963-08-20 | 1966-04-14 | Hoechst Ag | Verwendung einer Stabilisatorkombination zum Stabilisieren von Polyalkylenoxyden |
| DE1242363B (de) * | 1962-09-20 | 1967-06-15 | Tenneco Chem | Aus 3 Komponenten bestehendes Stabilisatorgemisch fuer Polyoxymethylene |
| EP0273864A3 (de) * | 1986-12-22 | 1989-04-19 | Ciba-Geigy Ag | Diphenylmethane |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL244788A (enExample) * | 1958-11-03 | |||
| US3103499A (en) * | 1959-04-02 | 1963-09-10 | Thermal stabilization of oxymethylene | |
| BE591578A (enExample) * | 1959-06-04 | |||
| US3144431A (en) * | 1959-08-05 | 1964-08-11 | Celanese Corp | Oxymethylene polymers stabilized with carbamates |
| US3116267A (en) * | 1959-08-17 | 1963-12-31 | Celanese Corp | Oxymethylene polymers containing amide stabilizers |
| NL281592A (enExample) * | 1959-08-29 | 1900-01-01 | ||
| GB890761A (en) * | 1959-12-31 | 1962-03-07 | Ici Ltd | Copper articles coated with polypropylene compositions |
| US3133896A (en) * | 1960-01-11 | 1964-05-19 | Celanese Corp | Oxymethylene polymers stabilized with cycloaliphatic amines and salts thereof |
| US3156669A (en) * | 1960-01-27 | 1964-11-10 | Celanese Corp | Thermal stabilization of oxymethylene polymers by the use of maleurate esters |
| NL274992A (enExample) * | 1961-02-23 | |||
| DE1143637B (de) * | 1961-03-11 | 1963-02-14 | Hoechst Ag | Schiffsche Basen zum Stabilisieren von Polyacetalen |
| NL277628A (enExample) * | 1961-05-12 | |||
| US3210318A (en) * | 1961-10-23 | 1965-10-05 | Celanese Corp | Oxymethylene polymers stabilized with epoxides |
| NL130430C (enExample) * | 1961-11-11 | |||
| NL122899C (enExample) * | 1961-11-24 | |||
| NL286452A (enExample) * | 1961-12-14 | |||
| US3262910A (en) * | 1962-10-18 | 1966-07-26 | Monsanto Co | Stabilized polypropionaldehyde containing triphenylphosphine and dilauryl thiodipropionate as stabilizers |
| US3274149A (en) * | 1963-02-13 | 1966-09-20 | Celanese Corp | Oxymethylene polymers stabilized with amino substituted amides |
| US3219727A (en) * | 1963-03-04 | 1965-11-23 | Celanese Corp | Thermally stabilized oxymethylene polymers |
| US3406223A (en) * | 1964-02-13 | 1968-10-15 | Du Pont | Stabilized polyoxymethylenes |
| US3235531A (en) * | 1964-12-22 | 1966-02-15 | Celanese Corp | Oxymethylene copolymer stabilization |
| IT1006136B (it) * | 1973-12-28 | 1976-09-30 | Sir Soc Italiana Resine Spa | Stabilizzazione di polimeri acetalici |
| IT1027886B (it) * | 1974-12-20 | 1978-12-20 | Sir Soc Italiana Resine Spa | Procedimento per la preparazione di polimeri acetalici eterificati |
| US4355153A (en) * | 1980-11-19 | 1982-10-19 | Societa' Italiana Resine S.I.R. S.P.A. | Process for the polymerization of formaldehyde |
| EP1408075A1 (en) * | 2002-10-10 | 2004-04-14 | Titecs Japan Corporation | Vibration damping material composition |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB748856A (en) * | 1952-12-23 | 1956-05-09 | Du Pont | Improvements in or relating to formaldehyde polymers and methods of preparing the same |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2538355A (en) * | 1949-07-25 | 1951-01-16 | American Cyanamid Co | 2, 2'-alkylene bis-4, 6-dialkyl phenols as rubber stabilizers |
| US2706189A (en) * | 1952-06-05 | 1955-04-12 | Dow Chemical Co | Solid polymers of propylene oxide |
| US2731442A (en) * | 1952-09-20 | 1956-01-17 | Firestone Fire & Rubber Compan | Sulfur vulcanizable rubber stabilized with a mixture of an alkyl substituted phenol and an alkyl substituted di(hydroxyphenyl) alkane |
| GB753299A (en) * | 1954-11-25 | 1956-07-18 | Du Pont | Improvements in or relating to formaldehyde polymers |
| US2871220A (en) * | 1956-11-21 | 1959-01-27 | Du Pont | Stabilization of polyoxymethylenes with phenols |
-
0
- NL NL113826D patent/NL113826C/xx active
- NL NL219323D patent/NL219323A/xx unknown
-
1956
- 1956-07-26 US US600159A patent/US2966476A/en not_active Expired - Lifetime
-
1957
- 1957-07-12 GB GB22234/57A patent/GB860411A/en not_active Expired
- 1957-07-23 DE DEP18985A patent/DE1082404B/de active Pending
- 1957-07-25 CH CH361129D patent/CH361129A/de unknown
- 1957-07-25 FR FR1179858D patent/FR1179858A/fr not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB748856A (en) * | 1952-12-23 | 1956-05-09 | Du Pont | Improvements in or relating to formaldehyde polymers and methods of preparing the same |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1156229B (de) * | 1961-04-13 | 1963-10-24 | Hoechst Ag | Verwendung von substituierten Phenolen zum Stabilisieren von Trioxan-Mischpolymerisaten |
| DE1190183B (de) * | 1961-06-28 | 1965-04-01 | Kurashiki Rayon Co | Stabilisatorgemisch fuer hochmolekulare Polyoxymethylene |
| DE1210557B (de) * | 1961-08-08 | 1966-02-10 | Celanese Corp | Phenole als Stabilisatoren fuer Oxymethylenpolymere |
| DE1242363B (de) * | 1962-09-20 | 1967-06-15 | Tenneco Chem | Aus 3 Komponenten bestehendes Stabilisatorgemisch fuer Polyoxymethylene |
| DE1208884B (de) * | 1962-09-27 | 1966-01-13 | Hoechst Ag | Stabilisierung von Polyacetalen |
| DE1214397B (de) * | 1963-08-20 | 1966-04-14 | Hoechst Ag | Verwendung einer Stabilisatorkombination zum Stabilisieren von Polyalkylenoxyden |
| EP0273864A3 (de) * | 1986-12-22 | 1989-04-19 | Ciba-Geigy Ag | Diphenylmethane |
Also Published As
| Publication number | Publication date |
|---|---|
| CH361129A (de) | 1962-03-31 |
| FR1179858A (fr) | 1959-05-28 |
| NL113826C (enExample) | |
| GB860411A (en) | 1961-02-01 |
| NL219323A (enExample) | |
| US2966476A (en) | 1960-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1082404B (de) | Warmverformbare Masse auf Grundlage von hochmolekularen, endstaendig veresterten oder veraetherten Polyoxymethylenen | |
| DE1495656A1 (de) | Verfahren zur Herstellung von Copolymerisaten | |
| DE1495365A1 (de) | Verfahren zur Stabilisierung von unter Normalbedingungen festen Polymeren | |
| DE1251020B (de) | Stabilisieren von Polyvinylchlorid, Mischpolymerisaten des Vinylidenchlorid und Vinylchlorids und Halogenaethylenpolymerisaten | |
| DE1209292B (de) | Stabilisieren von Polymerisaten des Formaldehyds mit Stabilisatorkombinationen | |
| DE1242363B (de) | Aus 3 Komponenten bestehendes Stabilisatorgemisch fuer Polyoxymethylene | |
| DE1495149B2 (de) | Verfahren zur Herstellung von PoIylaurinlactam | |
| DE1102388B (de) | Verfahren zur Verbesserung der Zugfestigkeit sowie gegebenenfalls der elektrischen Widerstandsfaehigkeit von siliciumdioxydgefuelltem Polyaethylen durch Vernetzen mit Di-ª-cumylperoxyd | |
| DE1694354A1 (de) | Stabilisierte Polyphenylaether | |
| DE1089968B (de) | Thermoplastische Formmasse auf Grundlage von Polyoxymethylen mit endstaendigen AEther- oder Estergruppen | |
| DE1570857A1 (de) | Verfahren zur Herstellung von Pfropfkopolymerisaten von Polyoxymethylen | |
| DE1066739B (de) | Thermoplastische Formmasse auf Grundlage von Polyoxymerhylen | |
| AT213058B (de) | Stabilisiertes Polyoxymethylendicarboxylat oder -diäther | |
| DE2805892A1 (de) | Konditionierungsfreie polyamide | |
| DE1211391B (de) | Verfahren zur Verbesserung der Lichtbestaendigkeit von Polyamiden | |
| DE1911790C3 (de) | Stabilisierte Polyoxymethylenmasse und Verfahren zu ihrer Herstellung | |
| DE1198064B (de) | Verfahren zur Verbesserung der Verarbeitbarkeit makromolekularer Formaldehydpolymerisate | |
| DE1694092A1 (de) | Verfahren zur Stabilisierung von Polyoxymethylenen | |
| DE1283520B (de) | Verfahren zur Verbesserung der Eigenschaften von vernetzten AEthylenpolymerisaten | |
| DE2150705C3 (de) | Verbesserte Oxymethylen-homo-undcopolymere | |
| AT211552B (de) | Kunststoffmasse und aus ihr bestehender Formkörper | |
| AT232280B (de) | Verfahren zur Herstellung eines Oxymethylenpolymeren mit hoher Wärmestabilität | |
| DE2056263A1 (de) | Stabilisierte Polyoxymethylenform massen und ihre Verwendung zur Herstellung von Formkorpern | |
| DE2461574A1 (de) | Stabilisierung von azetalpolymeren | |
| DE1143637B (de) | Schiffsche Basen zum Stabilisieren von Polyacetalen |