DE1021859B - Verfahren zur Herstellung von spasmolytisch wirksamen N-substituierten Aminoalkylbenzhydrylaethern und -thioaethern, ihren Salzen und quartaeren Ammoniumverbindungen - Google Patents
Verfahren zur Herstellung von spasmolytisch wirksamen N-substituierten Aminoalkylbenzhydrylaethern und -thioaethern, ihren Salzen und quartaeren AmmoniumverbindungenInfo
- Publication number
- DE1021859B DE1021859B DEL15440A DEL0015440A DE1021859B DE 1021859 B DE1021859 B DE 1021859B DE L15440 A DEL15440 A DE L15440A DE L0015440 A DEL0015440 A DE L0015440A DE 1021859 B DE1021859 B DE 1021859B
- Authority
- DE
- Germany
- Prior art keywords
- chloride
- hours
- hydrochloride
- sulfide
- added
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003839 salts Chemical class 0.000 title claims description 17
- 150000002170 ethers Chemical class 0.000 title claims description 13
- 150000003568 thioethers Chemical class 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 10
- 150000003856 quaternary ammonium compounds Chemical class 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- -1 p-hexyl mercaptobenzhydryl chloride Chemical compound 0.000 claims description 127
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 93
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 58
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 55
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 37
- 239000000203 mixture Substances 0.000 claims description 30
- 239000000126 substance Substances 0.000 claims description 28
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- 239000007795 chemical reaction product Substances 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 229910052783 alkali metal Inorganic materials 0.000 claims description 13
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 13
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 13
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 13
- 239000011734 sodium Substances 0.000 claims description 12
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 11
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 11
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 238000001953 recrystallisation Methods 0.000 claims description 10
- 229920006395 saturated elastomer Polymers 0.000 claims description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 238000002844 melting Methods 0.000 claims description 9
- 230000008018 melting Effects 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 150000001805 chlorine compounds Chemical class 0.000 claims description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 7
- 230000002048 spasmolytic effect Effects 0.000 claims description 7
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 claims description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 238000009835 boiling Methods 0.000 claims description 6
- 239000000460 chlorine Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 150000002431 hydrogen Chemical group 0.000 claims description 6
- 238000010992 reflux Methods 0.000 claims description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 229940007718 zinc hydroxide Drugs 0.000 claims description 5
- 229910021511 zinc hydroxide Inorganic materials 0.000 claims description 5
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 claims description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 claims description 4
- FRWQVBHELKAGLP-UHFFFAOYSA-N [Cl-].CC[SH+]CC Chemical compound [Cl-].CC[SH+]CC FRWQVBHELKAGLP-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical group O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 229960000583 acetic acid Drugs 0.000 claims description 3
- JETFNRIIPBNRAT-UHFFFAOYSA-N butylsulfanylbenzene Chemical compound CCCCSC1=CC=CC=C1 JETFNRIIPBNRAT-UHFFFAOYSA-N 0.000 claims description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000012362 glacial acetic acid Substances 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 238000010626 work up procedure Methods 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- 238000003747 Grignard reaction Methods 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000000812 cholinergic antagonist Substances 0.000 claims description 2
- 238000004040 coloring Methods 0.000 claims description 2
- 239000007859 condensation product Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 2
- 125000001302 tertiary amino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims 3
- NWYDLOBJQIJDGH-UHFFFAOYSA-N propylsulfanylbenzene Chemical compound CCCSC1=CC=CC=C1 NWYDLOBJQIJDGH-UHFFFAOYSA-N 0.000 claims 3
- 238000010411 cooking Methods 0.000 claims 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 claims 2
- ONRREFWJTRBDRA-UHFFFAOYSA-N 2-chloroethanamine;hydron;chloride Chemical compound [Cl-].[NH3+]CCCl ONRREFWJTRBDRA-UHFFFAOYSA-N 0.000 claims 1
- BKWLRLMBMBHNJG-UHFFFAOYSA-N 4-propylsulfanylbenzoic acid Chemical compound CCCSC1=CC=C(C(O)=O)C=C1 BKWLRLMBMBHNJG-UHFFFAOYSA-N 0.000 claims 1
- AODQWLVWSLEGOD-UHFFFAOYSA-N SC(C1=CC=CC=C1)(C1=CC=CC=C1)Cl Chemical compound SC(C1=CC=CC=C1)(C1=CC=CC=C1)Cl AODQWLVWSLEGOD-UHFFFAOYSA-N 0.000 claims 1
- 229910052782 aluminium Inorganic materials 0.000 claims 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims 1
- 239000004202 carbamide Substances 0.000 claims 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- 125000003386 piperidinyl group Chemical group 0.000 claims 1
- 238000001556 precipitation Methods 0.000 claims 1
- 239000000047 product Substances 0.000 claims 1
- FZUJWWOKDIGOKH-UHFFFAOYSA-N sulfuric acid hydrochloride Chemical compound Cl.OS(O)(=O)=O FZUJWWOKDIGOKH-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 38
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 239000003921 oil Substances 0.000 description 19
- 150000001875 compounds Chemical class 0.000 description 17
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 15
- 230000001624 sedative effect Effects 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- 150000001414 amino alcohols Chemical class 0.000 description 9
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- QILSFLSDHQAZET-UHFFFAOYSA-N diphenylmethanol Chemical compound C=1C=CC=CC=1C(O)C1=CC=CC=C1 QILSFLSDHQAZET-UHFFFAOYSA-N 0.000 description 8
- 239000000932 sedative agent Substances 0.000 description 8
- ORKZATPRQQSLDT-UHFFFAOYSA-N diphenylmethanethiol Chemical compound C=1C=CC=CC=1C(S)C1=CC=CC=C1 ORKZATPRQQSLDT-UHFFFAOYSA-N 0.000 description 7
- 239000006188 syrup Substances 0.000 description 6
- 235000020357 syrup Nutrition 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 210000002460 smooth muscle Anatomy 0.000 description 4
- ICVKNHLAZQHPEH-UHFFFAOYSA-N 1-butylsulfanyl-4-[chloro(phenyl)methyl]benzene Chemical compound C(CCC)SC1=CC=C(C(C2=CC=CC=C2)Cl)C=C1 ICVKNHLAZQHPEH-UHFFFAOYSA-N 0.000 description 3
- FBEHFRAORPEGFH-UHFFFAOYSA-N Allyxycarb Chemical compound CNC(=O)OC1=CC(C)=C(N(CC=C)CC=C)C(C)=C1 FBEHFRAORPEGFH-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 208000007101 Muscle Cramp Diseases 0.000 description 3
- MGNKCLCKFJFDOU-UHFFFAOYSA-N NSO Chemical compound NSO MGNKCLCKFJFDOU-UHFFFAOYSA-N 0.000 description 3
- 208000005392 Spasm Diseases 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 3
- 150000003840 hydrochlorides Chemical class 0.000 description 3
- 231100000053 low toxicity Toxicity 0.000 description 3
- KTYVIGGEMDINJN-UHFFFAOYSA-N (4-butylsulfanylphenyl)-phenylmethanone Chemical compound C1=CC(SCCCC)=CC=C1C(=O)C1=CC=CC=C1 KTYVIGGEMDINJN-UHFFFAOYSA-N 0.000 description 2
- BLYTXSCUTGLIQN-UHFFFAOYSA-N 1-[chloro(phenyl)methyl]-4-methylsulfanylbenzene Chemical compound C1=CC(SC)=CC=C1C(Cl)C1=CC=CC=C1 BLYTXSCUTGLIQN-UHFFFAOYSA-N 0.000 description 2
- MIANDTNQOZKCFV-UHFFFAOYSA-N 1-butyl-4-(4-butylphenyl)sulfanylbenzene Chemical compound C1=CC(CCCC)=CC=C1SC1=CC=C(CCCC)C=C1 MIANDTNQOZKCFV-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 229940125717 barbiturate Drugs 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- LWSWHXZQBIFYLZ-UHFFFAOYSA-N cyclohexylsulfanylbenzene Chemical compound C1CCCCC1SC1=CC=CC=C1 LWSWHXZQBIFYLZ-UHFFFAOYSA-N 0.000 description 2
- 229960002887 deanol Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- XQYZDYMELSJDRZ-UHFFFAOYSA-N papaverine Chemical compound C1=C(OC)C(OC)=CC=C1CC1=NC=CC2=CC(OC)=C(OC)C=C12 XQYZDYMELSJDRZ-UHFFFAOYSA-N 0.000 description 2
- 229950000688 phenothiazine Drugs 0.000 description 2
- RMVRSNDYEFQCLF-UHFFFAOYSA-N phenyl mercaptan Natural products SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 2
- SPEXCGKGVJUPGG-UHFFFAOYSA-N phenyl-(2-sulfanylphenyl)methanone Chemical compound SC1=CC=CC=C1C(=O)C1=CC=CC=C1 SPEXCGKGVJUPGG-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- SITHTRCWBNFWJY-UHFFFAOYSA-N (4-butylphenyl)-(2-sulfanylphenyl)methanone Chemical compound C(CCC)C1=CC=C(C=C1)C(C1=C(C=CC=C1)S)=O SITHTRCWBNFWJY-UHFFFAOYSA-N 0.000 description 1
- SLFDDFQSIFDMLL-UHFFFAOYSA-N (4-butylsulfanylphenyl)-phenylmethanethiol Chemical compound CCCCSC1=CC=C(C=C1)C(S)C1=CC=CC=C1 SLFDDFQSIFDMLL-UHFFFAOYSA-N 0.000 description 1
- SMWLJJNTDOHOBL-UHFFFAOYSA-N (4-butylsulfonylphenyl)-phenylmethanone Chemical compound C(CCC)S(=O)(=O)C1=CC=C(C=C1)C(C1=CC=CC=C1)=O SMWLJJNTDOHOBL-UHFFFAOYSA-N 0.000 description 1
- PNWFUVVVRXJTLR-UHFFFAOYSA-N (4-methylsulfanylphenyl)-phenylmethanone Chemical compound C1=CC(SC)=CC=C1C(=O)C1=CC=CC=C1 PNWFUVVVRXJTLR-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- ZMLUHYJUTIZTOJ-UHFFFAOYSA-N 1-chloro-n,n-dimethylpropan-2-amine Chemical compound ClCC(C)N(C)C ZMLUHYJUTIZTOJ-UHFFFAOYSA-N 0.000 description 1
- MADORZDTLHDDEN-UHFFFAOYSA-N 1-piperidin-1-ylethanol Chemical compound CC(O)N1CCCCC1 MADORZDTLHDDEN-UHFFFAOYSA-N 0.000 description 1
- WHIMTUWBKCUIGO-UHFFFAOYSA-N 2-(2-aminoethylsulfanyl)ethanamine hydrochloride Chemical compound Cl.S(CCN)CCN WHIMTUWBKCUIGO-UHFFFAOYSA-N 0.000 description 1
- CSCWVQZBMXAMHJ-UHFFFAOYSA-N 2-(diethylamino)benzoyl chloride Chemical compound CCN(CC)C1=CC=CC=C1C(Cl)=O CSCWVQZBMXAMHJ-UHFFFAOYSA-N 0.000 description 1
- YBDSNEVSFQMCTL-UHFFFAOYSA-N 2-(diethylamino)ethanethiol Chemical compound CCN(CC)CCS YBDSNEVSFQMCTL-UHFFFAOYSA-N 0.000 description 1
- KKFDCBRMNNSAAW-UHFFFAOYSA-N 2-(morpholin-4-yl)ethanol Chemical compound OCCN1CCOCC1 KKFDCBRMNNSAAW-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- VKPPFDPXZWFDFA-UHFFFAOYSA-N 2-chloroethanamine Chemical compound NCCCl VKPPFDPXZWFDFA-UHFFFAOYSA-N 0.000 description 1
- BPGIOCZAQDIBPI-UHFFFAOYSA-N 2-ethoxyethanamine Chemical compound CCOCCN BPGIOCZAQDIBPI-UHFFFAOYSA-N 0.000 description 1
- PBOOZQFGWNZNQE-UHFFFAOYSA-N 3-bromobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Br)=C1 PBOOZQFGWNZNQE-UHFFFAOYSA-N 0.000 description 1
- IPDHJJQZDIOUBK-UHFFFAOYSA-N 4-butyl-2-sulfanylbenzoic acid Chemical group SC1=C(C(=O)O)C=CC(=C1)CCCC IPDHJJQZDIOUBK-UHFFFAOYSA-N 0.000 description 1
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 1
- 229930008281 A03AD01 - Papaverine Natural products 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- NZWYVYDFECNWCN-UHFFFAOYSA-N BrC1=CC=C(C=C1)CCCCSCCCCC1=CC=C(C=C1)Br Chemical compound BrC1=CC=C(C=C1)CCCCSCCCCC1=CC=C(C=C1)Br NZWYVYDFECNWCN-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000779819 Syncarpia glomulifera Species 0.000 description 1
- ZDVDCDLBOLSVGM-UHFFFAOYSA-N [chloro(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(Cl)C1=CC=CC=C1 ZDVDCDLBOLSVGM-UHFFFAOYSA-N 0.000 description 1
- PBQJVZLFFACMPW-UHFFFAOYSA-N [hydroxysulfanyl(phenyl)methyl]benzene Chemical class C=1C=CC=CC=1C(SO)C1=CC=CC=C1 PBQJVZLFFACMPW-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004266 acetylcholine chloride Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910000290 alkaline earth metals carbonate Inorganic materials 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000002921 anti-spasmodic effect Effects 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940124575 antispasmodic agent Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 description 1
- 229910001626 barium chloride Inorganic materials 0.000 description 1
- 229940045511 barium chloride Drugs 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- JECOSSASMXAXFV-UHFFFAOYSA-N chloroethane;hydrochloride Chemical compound Cl.CCCl JECOSSASMXAXFV-UHFFFAOYSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- LJSQFQKUNVCTIA-UHFFFAOYSA-N diethyl sulfide Chemical compound CCSCC LJSQFQKUNVCTIA-UHFFFAOYSA-N 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical compound OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 description 1
- ATRQTIDIOJCMHG-UHFFFAOYSA-N diphenyl(sulfanyl)methanol Chemical compound OC(S)(c1ccccc1)c1ccccc1 ATRQTIDIOJCMHG-UHFFFAOYSA-N 0.000 description 1
- SQOUBLRGZMPTLK-UHFFFAOYSA-N diphenylmethanedithiol Chemical compound C=1C=CC=CC=1C(S)(S)C1=CC=CC=C1 SQOUBLRGZMPTLK-UHFFFAOYSA-N 0.000 description 1
- OKJAXUKRQXLFNW-UHFFFAOYSA-N dipropylsulfanium chloride Chemical compound [Cl-].C(CC)[SH+]CCC OKJAXUKRQXLFNW-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- DOHLZBMKORLTKE-UHFFFAOYSA-N hexylsulfanylbenzene Chemical compound CCCCCCSC1=CC=CC=C1 DOHLZBMKORLTKE-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000003170 musculotropic effect Effects 0.000 description 1
- 230000002276 neurotropic effect Effects 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 229960001789 papaverine Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000001739 pinus spp. Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- WVULZDFWPQCPPJ-UHFFFAOYSA-N potassium;hydrochloride Chemical compound Cl.[K] WVULZDFWPQCPPJ-UHFFFAOYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- AAZYNPCMLRQUHI-UHFFFAOYSA-N propan-2-one;2-propan-2-yloxypropane Chemical compound CC(C)=O.CC(C)OC(C)C AAZYNPCMLRQUHI-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 1
- 229940103494 thiosalicylic acid Drugs 0.000 description 1
- 229940036248 turpentine Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/24—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/25—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/54—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Steroid Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK729619X | 1952-05-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1021859B true DE1021859B (de) | 1958-01-02 |
Family
ID=8152523
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEL15440A Pending DE1021859B (de) | 1952-05-08 | 1953-05-05 | Verfahren zur Herstellung von spasmolytisch wirksamen N-substituierten Aminoalkylbenzhydrylaethern und -thioaethern, ihren Salzen und quartaeren Ammoniumverbindungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2830088A (enExample) |
| BE (1) | BE519805A (enExample) |
| DE (1) | DE1021859B (enExample) |
| GB (1) | GB729619A (enExample) |
| NL (1) | NL85982C (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3121103A (en) * | 1961-10-20 | 1964-02-11 | Hoffmann La Roche | Aminobenzophenones |
| FI41392B (enExample) * | 1962-08-13 | 1969-07-31 | Merck & Co Inc | |
| US3336296A (en) * | 1962-10-26 | 1967-08-15 | American Home Prod | Preparation of 5-substituted-2h-1, 4-benzodiazepin-2-one-4-oxides |
| US3370091A (en) * | 1964-06-15 | 1968-02-20 | Hoffmann La Roche | 2 aminobenzhydrylhalides |
| US3294818A (en) * | 1964-04-06 | 1966-12-27 | Warner Lambert Pharmaceutical | Substituted dioxolanes and process for their production |
| US5231104A (en) * | 1988-07-08 | 1993-07-27 | Pfizer Inc. | 1-arylethyl-3-substituted piperidines |
| US8461389B2 (en) | 2008-04-18 | 2013-06-11 | University College Dublin, National University Of Ireland, Dublin | Psycho-pharmaceuticals |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2454092A (en) * | 1947-06-02 | 1948-11-16 | Parke Davis & Co | Benzhydryl amino ethers |
| US2455949A (en) * | 1947-06-02 | 1948-12-14 | Parke Davis & Co | Dialkylaminoalkyl benzahydryl ethers and salts thereof |
| CH269653A (fr) * | 1944-04-18 | 1950-07-15 | Parke Davis & Co | Procédé de préparation d'un nouvel aminoéther araliphatique. |
| US2567351A (en) * | 1946-01-29 | 1951-09-11 | Parke Davis & Co | Process for the manufacture of benzhydryl ethers |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2483436A (en) * | 1946-08-05 | 1949-10-04 | Parke Davis & Co | Thioethers and methods for obtaining the same |
| US2483671A (en) * | 1947-06-02 | 1949-10-04 | Parke Davis & Co | Aminoalkyl benzhydryl thioethers and their preparation |
| US2577234A (en) * | 1947-07-02 | 1951-12-04 | Searle & Co | Production of aminoalkyl ethers of diaryl carbinols |
-
0
- BE BE519805D patent/BE519805A/xx unknown
- NL NL85982D patent/NL85982C/xx active
-
1953
- 1953-05-05 DE DEL15440A patent/DE1021859B/de active Pending
- 1953-05-05 US US353234A patent/US2830088A/en not_active Expired - Lifetime
- 1953-05-08 GB GB12878/53A patent/GB729619A/en not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH269653A (fr) * | 1944-04-18 | 1950-07-15 | Parke Davis & Co | Procédé de préparation d'un nouvel aminoéther araliphatique. |
| US2567351A (en) * | 1946-01-29 | 1951-09-11 | Parke Davis & Co | Process for the manufacture of benzhydryl ethers |
| US2454092A (en) * | 1947-06-02 | 1948-11-16 | Parke Davis & Co | Benzhydryl amino ethers |
| US2455949A (en) * | 1947-06-02 | 1948-12-14 | Parke Davis & Co | Dialkylaminoalkyl benzahydryl ethers and salts thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| US2830088A (en) | 1958-04-08 |
| NL85982C (enExample) | |
| BE519805A (enExample) | |
| GB729619A (en) | 1955-05-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2024001C3 (de) | Tetrahydrofurfuryloxyphenoxypropanolamine und deren pharmakologisch vertragliche Säureadditionssalze und Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE2642511C2 (de) | Benzhydrylsulfinylverbindungen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1770956A1 (de) | Aminoester der 2-substituierten Pentionischen Saeure (Pentinoic acid) mit antispastischer und geschwuerheilender Wirkung,deren Derivate und Verfahren zu deren Herstellung | |
| DE1021859B (de) | Verfahren zur Herstellung von spasmolytisch wirksamen N-substituierten Aminoalkylbenzhydrylaethern und -thioaethern, ihren Salzen und quartaeren Ammoniumverbindungen | |
| DD202433A5 (de) | Verfahren zur herstellung von amidobenzamiden | |
| DE2426149A1 (de) | Fluor-substituierte phenthiazine | |
| DE2416016A1 (de) | Neue 1- eckige klammer auf beta-(aminocarbonylphenoxy)-aethylamino eckige klammer zu -3- (thiazol-2-oxy)-2-propanole und ihre derivate | |
| DE3128117A1 (de) | Neue phenyl-aethylaminderivate, verfahren zu ihrer herstellung | |
| DE1470194A1 (de) | 1,3,3-trisubstituierte 4-(omega-Aminoalkyl)- und 4-(omega-Morpholinoalkyl)-2-pyrrolidinone und -2-thionpyrrolidinone und Verfahren zu ihrer Herstellung | |
| DE2425767A1 (de) | 3-alkyl-9-aminoalkyl-1,2,3,4-tetrahydrocarbazole und ihre verwendung in arzneimitteln | |
| DE2406065A1 (de) | Neue isoindolinderivate, ihre herstellung und die zusammensetzungen, die sie enthalten | |
| DE1266755B (de) | Verfahren zur Herstellung von substituierten Dibenzo[a, d]-cycloheptanverbindungen sowie von Salzen dieser Verbindungen mit Saeuren | |
| DE1059460B (de) | Verfahren zur Herstellung von Phenthiazinderivaten | |
| DE2144077A1 (de) | Neue Piperazindenvate und Ver fahren zu deren Herstellung | |
| DE2166270B2 (de) | Nicotinoylaminoäthansulfonyl-2amino-thiazol | |
| AT234705B (de) | Verfahren zur Herstellung von neuen (4-Alkylpiperazino)-sulfonamiden | |
| DE2047937A1 (de) | Hydroxyphenyl 2 pipendtnylcarbi nole und ihre Verwendung in Arzneimitteln | |
| DE2530768C3 (de) | PhenoxyaUcylaminpyridyläther, Verfahren zu ihrer Herstellung sowie diese enthaltende pharmazeutische Präparate | |
| AT247344B (de) | Verfahren zur Herstellung von neuen Piperazinverbindungen | |
| DE1097995B (de) | Verfahren zur Herstellung von Phenthiazinderivaten | |
| DE2116213A1 (de) | Piperazinderivate | |
| DE2458374A1 (de) | Neuartige 1,3-benzodioxol-abkoemmlinge | |
| DE2000299A1 (de) | Meta-Toluylsaeurederivate und Verfahren zu ihrer Herstellung | |
| DE1468138C3 (de) | Verfahren zur Herstellung von 10,11- Dihydrodibenzo [a,d] -cycloheptenen | |
| DE1056611B (de) | Verfahren zur Herstellung von Phenthiazinderivaten |