DE1019280B - Verfahren zur Herstellung von Wasserstoffperoxyd - Google Patents
Verfahren zur Herstellung von WasserstoffperoxydInfo
- Publication number
- DE1019280B DE1019280B DEB23344A DEB0023344A DE1019280B DE 1019280 B DE1019280 B DE 1019280B DE B23344 A DEB23344 A DE B23344A DE B0023344 A DEB0023344 A DE B0023344A DE 1019280 B DE1019280 B DE 1019280B
- Authority
- DE
- Germany
- Prior art keywords
- solution
- hydrogen peroxide
- quinone
- naphthalene
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims description 58
- 238000000034 method Methods 0.000 title claims description 18
- 238000004519 manufacturing process Methods 0.000 title claims description 11
- 230000008569 process Effects 0.000 title claims description 8
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims description 38
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 31
- 239000002904 solvent Substances 0.000 claims description 28
- -1 naphthalene hydrocarbon Chemical class 0.000 claims description 15
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 14
- 229930195733 hydrocarbon Natural products 0.000 claims description 14
- 239000012046 mixed solvent Substances 0.000 claims description 13
- 150000004056 anthraquinones Chemical class 0.000 claims description 10
- 150000002430 hydrocarbons Chemical class 0.000 claims description 8
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 claims description 7
- 239000004215 Carbon black (E152) Substances 0.000 claims description 7
- QPUYECUOLPXSFR-UHFFFAOYSA-N alpha-methyl-naphthalene Natural products C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 claims description 7
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 claims description 5
- 238000006701 autoxidation reaction Methods 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 230000009467 reduction Effects 0.000 claims description 4
- YEVQZPWSVWZAOB-UHFFFAOYSA-N 2-(bromomethyl)-1-iodo-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(I)C(CBr)=C1 YEVQZPWSVWZAOB-UHFFFAOYSA-N 0.000 claims description 3
- 150000003014 phosphoric acid esters Chemical class 0.000 claims description 3
- XMNDMAQKWSQVOV-UHFFFAOYSA-N (2-methylphenyl) diphenyl phosphate Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C=CC=CC=1)OC1=CC=CC=C1 XMNDMAQKWSQVOV-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000004615 ingredient Substances 0.000 claims 1
- 230000003381 solubilizing effect Effects 0.000 claims 1
- 239000000243 solution Substances 0.000 description 36
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 16
- 230000003647 oxidation Effects 0.000 description 15
- 238000007254 oxidation reaction Methods 0.000 description 15
- 239000001257 hydrogen Substances 0.000 description 13
- 229910052739 hydrogen Inorganic materials 0.000 description 13
- 239000012224 working solution Substances 0.000 description 13
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 12
- 239000001301 oxygen Substances 0.000 description 12
- 229910052760 oxygen Inorganic materials 0.000 description 12
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- SJEBAWHUJDUKQK-UHFFFAOYSA-N 2-ethylanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(CC)=CC=C3C(=O)C2=C1 SJEBAWHUJDUKQK-UHFFFAOYSA-N 0.000 description 10
- 238000005984 hydrogenation reaction Methods 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 238000000605 extraction Methods 0.000 description 7
- 230000005484 gravity Effects 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 6
- 150000002978 peroxides Chemical class 0.000 description 6
- OTBHDFWQZHPNPU-UHFFFAOYSA-N 1,2,3,4-tetrahydroanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1CCCC2 OTBHDFWQZHPNPU-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- FDHDUXOBMHHFFJ-UHFFFAOYSA-N 1-pentylnaphthalene Chemical compound C1=CC=C2C(CCCCC)=CC=CC2=C1 FDHDUXOBMHHFFJ-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 150000004053 quinones Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- WWGUMAYGTYQSGA-UHFFFAOYSA-N 2,3-dimethylnaphthalene Chemical class C1=CC=C2C=C(C)C(C)=CC2=C1 WWGUMAYGTYQSGA-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- APQSQLNWAIULLK-UHFFFAOYSA-N 1,4-dimethylnaphthalene Chemical compound C1=CC=C2C(C)=CC=C(C)C2=C1 APQSQLNWAIULLK-UHFFFAOYSA-N 0.000 description 2
- NJWGQARXZDRHCD-UHFFFAOYSA-N 2-methylanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(C)=CC=C3C(=O)C2=C1 NJWGQARXZDRHCD-UHFFFAOYSA-N 0.000 description 2
- QIMMUPPBPVKWKM-UHFFFAOYSA-N 2-methylnaphthalene Chemical compound C1=CC=CC2=CC(C)=CC=C21 QIMMUPPBPVKWKM-UHFFFAOYSA-N 0.000 description 2
- BQUNPXRABCSKJZ-UHFFFAOYSA-N 2-propan-2-ylanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(C(C)C)=CC=C3C(=O)C2=C1 BQUNPXRABCSKJZ-UHFFFAOYSA-N 0.000 description 2
- YTPSFXZMJKMUJE-UHFFFAOYSA-N 2-tert-butylanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(C(C)(C)C)=CC=C3C(=O)C2=C1 YTPSFXZMJKMUJE-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000036284 oxygen consumption Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 238000009423 ventilation Methods 0.000 description 2
- HSWCAHQGZOOTEY-UHFFFAOYSA-N 1,2-dimethylnaphthalene 1-methylnaphthalene Chemical compound CC1=C(C2=CC=CC=C2C=C1)C.CC1=CC=CC2=CC=CC=C12 HSWCAHQGZOOTEY-UHFFFAOYSA-N 0.000 description 1
- UYYPOPWOFQHNHH-UHFFFAOYSA-N 1,2-dipentylnaphthalene Chemical compound C1=CC=CC2=C(CCCCC)C(CCCCC)=CC=C21 UYYPOPWOFQHNHH-UHFFFAOYSA-N 0.000 description 1
- 239000005967 1,4-Dimethylnaphthalene Substances 0.000 description 1
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-naphthoquinone Chemical compound C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 1
- KTHUKEZOIFYPEH-UHFFFAOYSA-N 1-benzylnaphthalene Chemical compound C=1C=CC2=CC=CC=C2C=1CC1=CC=CC=C1 KTHUKEZOIFYPEH-UHFFFAOYSA-N 0.000 description 1
- IYDMICQAKLQHLA-UHFFFAOYSA-N 1-phenylnaphthalene Chemical compound C1=CC=CC=C1C1=CC=CC2=CC=CC=C12 IYDMICQAKLQHLA-UHFFFAOYSA-N 0.000 description 1
- JORLUGVBYJSSAW-UHFFFAOYSA-N 2-ethyl-1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1CC(CC)CC2 JORLUGVBYJSSAW-UHFFFAOYSA-N 0.000 description 1
- WJCQJHNUBJYFBW-UHFFFAOYSA-N 2-methyl-1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1CC(C)CC2 WJCQJHNUBJYFBW-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- SRFPPSVMECXTOB-UHFFFAOYSA-N C[Ni]C Chemical compound C[Ni]C SRFPPSVMECXTOB-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000010227 cup method (microbiological evaluation) Methods 0.000 description 1
- DCZFGQYXRKMVFG-UHFFFAOYSA-N cyclohexane-1,4-dione Chemical compound O=C1CCC(=O)CC1 DCZFGQYXRKMVFG-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000013585 weight reducing agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/022—Preparation from organic compounds
- C01B15/023—Preparation from organic compounds by the alkyl-anthraquinone process
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US261762A US2768065A (en) | 1951-12-14 | 1951-12-14 | Auto-oxidation of alkylated anthraquinones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1019280B true DE1019280B (de) | 1957-11-14 |
Family
ID=22994748
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB23344A Pending DE1019280B (de) | 1951-12-14 | 1952-12-12 | Verfahren zur Herstellung von Wasserstoffperoxyd |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2768065A (show.php) |
| BE (1) | BE516198A (show.php) |
| CH (1) | CH307965A (show.php) |
| DE (1) | DE1019280B (show.php) |
| FR (1) | FR1078403A (show.php) |
| IT (1) | IT496667A (show.php) |
| NL (1) | NL78559C (show.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2935381A (en) * | 1957-04-19 | 1960-05-03 | Fmc Corp | Manufacture of hydrogen peroxide |
| DE1261838B (de) * | 1963-09-03 | 1968-02-29 | Degussa | Verfahren zur Herstellung von Wasserstoffperoxyd |
| US4394369A (en) * | 1982-05-24 | 1983-07-19 | Fmc Corporation | Hydrogen peroxide process |
| DE3633672C2 (de) * | 1986-10-03 | 1993-09-30 | Degussa | Verfahren zur Herstellung von Wasserstoffperoxid |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2059569A (en) * | 1933-04-13 | 1936-11-03 | William S Pritchard | Manufacture of hydrogen peroxide |
| US2158525A (en) * | 1935-10-10 | 1939-05-16 | Ig Farbenindustrie Ag | Production of hydrogen peroxide |
| IT360853A (show.php) * | 1937-04-07 | |||
| US2144341A (en) * | 1937-07-22 | 1939-01-17 | Mathieson Alkali Works Inc | Manufacture of hydrogen peroxide |
| US2178640A (en) * | 1938-12-29 | 1939-11-07 | Mathieson Alkali Works Inc | Manufacture of hydrogen peroxide |
| US2455238A (en) * | 1946-10-15 | 1948-11-30 | Buffalo Electro Chem Co | Manufacture of hydrogen peroxide |
| US2668753A (en) * | 1949-11-05 | 1954-02-09 | Du Pont | Production of hydrogen peroxide |
| US2537655A (en) * | 1950-03-09 | 1951-01-09 | Buffalo Electro Chem Co | Auto-oxidation of alkylated anthraquinones |
| US2537516A (en) * | 1950-03-09 | 1951-01-09 | Buffalo Electro Chem Co | Process of producing hydrogen peroxide by the alternate reduction and oxidation of alkylated anthraquinones |
-
0
- IT IT496667D patent/IT496667A/it unknown
- BE BE516198D patent/BE516198A/xx unknown
- NL NL78559D patent/NL78559C/xx active
-
1951
- 1951-12-14 US US261762A patent/US2768065A/en not_active Expired - Lifetime
-
1952
- 1952-12-12 DE DEB23344A patent/DE1019280B/de active Pending
- 1952-12-12 FR FR1078403D patent/FR1078403A/fr not_active Expired
- 1952-12-12 CH CH307965D patent/CH307965A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH307965A (fr) | 1955-06-30 |
| US2768065A (en) | 1956-10-23 |
| FR1078403A (fr) | 1954-11-18 |
| NL78559C (show.php) | |
| BE516198A (show.php) | |
| IT496667A (show.php) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1073607B1 (de) | Verfahren zur herstellung von wasserstoffperoxid und reaktionsträger zu seiner durchführung | |
| DE69314445T2 (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE1019280B (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE1290530B (de) | Kreislaufverfahren zur Herstellung von Wasserstoffsuperoxyd | |
| DE2018686C3 (de) | Verfahren zur Herstellung von Was serstoffperoxid | |
| DE953790C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE2111196A1 (de) | Verfahren zur Gewinnung von Adipinsaeure | |
| DE935124C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| AT151946B (de) | Verfahren zur Herstellung von Wasserstoffperoxyd. | |
| DE888840C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE814739C (de) | Verfahren zur Reinigung synthetischer Aldehydprodukte | |
| DE870853C (de) | Verfahren zur Herstellung von Diisopropylbenzolhydroperoxyden | |
| DE958917C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd durch Hydrierung und Oxydierung von Anthrachinonen | |
| DE1112051B (de) | Kreislaufverfahren zur Herstellung von Wasserstoffperoxyd | |
| DE382326C (de) | Verfahren zur Darstellung sulfoaromatischer Fettsaeuren | |
| DE1195279B (de) | Verfahren zur Herstellung von Wasserstoff-peroxyd im Kreislauf | |
| DE942807C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd durch abwechselndes Hydrieren und Oxydieren von Alkylanthrachinonen | |
| DE963150C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE833953C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| AT202973B (de) | Verfahren zur Herstellung von Wasserstoffperoxyd mit Hilfe von Alkylanthrachinonen | |
| AT164508B (de) | Verfahren zur Herstellung von Hexachlorcyclohexanen | |
| DE683953C (de) | Verfahren zur Herstellung von Wasserstoffsuperoxyd durch Oxydation von Hydrazoverbindungen | |
| AT202108B (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE501305C (de) | Herstellung von fuer die Technik verwendbaren basenaustauschenden Stoffen | |
| DE701462C (de) | Verfahren zur Reinigung von schwefeldioxydhaltigen Gasen zur Herstellung von Schwefelsaeure |