DD143607A5 - Verfahren zur herstellung neuer carbazolyl-(4)-oxy-propanolamin-derivate - Google Patents
Verfahren zur herstellung neuer carbazolyl-(4)-oxy-propanolamin-derivate Download PDFInfo
- Publication number
- DD143607A5 DD143607A5 DD79212096A DD21209679A DD143607A5 DD 143607 A5 DD143607 A5 DD 143607A5 DD 79212096 A DD79212096 A DD 79212096A DD 21209679 A DD21209679 A DD 21209679A DD 143607 A5 DD143607 A5 DD 143607A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- group
- formula
- carbazolyl
- oxy
- compound
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 15
- -1 bicyclic aryl radical Chemical class 0.000 claims description 56
- 150000001875 compounds Chemical class 0.000 claims description 39
- 101000588924 Anthopleura elegantissima Delta-actitoxin-Ael1a Proteins 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 125000003435 aroyl group Chemical group 0.000 claims description 2
- 125000002950 monocyclic group Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 abstract description 19
- 238000002360 preparation method Methods 0.000 abstract description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 23
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 23
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- SVWKIGRDISDRLO-UHFFFAOYSA-N 4-(oxiran-2-ylmethoxy)-9h-carbazole Chemical compound C=1C=CC=2NC3=CC=CC=C3C=2C=1OCC1CO1 SVWKIGRDISDRLO-UHFFFAOYSA-N 0.000 description 19
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 15
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 14
- 239000013078 crystal Substances 0.000 description 13
- 239000000126 substance Substances 0.000 description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000012230 colorless oil Substances 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- 230000000304 vasodilatating effect Effects 0.000 description 6
- 238000004061 bleaching Methods 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 5
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 4
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 4
- 238000007327 hydrogenolysis reaction Methods 0.000 description 4
- 229960001317 isoprenaline Drugs 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- VLNNJWRDIPGHBE-UHFFFAOYSA-N 1-(oxiran-2-ylmethoxy)-9h-carbazole Chemical compound C=1C=CC(C2=CC=CC=C2N2)=C2C=1OCC1CO1 VLNNJWRDIPGHBE-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 3
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- GBBBWTDKOLEAOC-UHFFFAOYSA-N 1-(2-methoxyphenoxy)propan-2-one Chemical compound COC1=CC=CC=C1OCC(C)=O GBBBWTDKOLEAOC-UHFFFAOYSA-N 0.000 description 2
- QWBBPBRQALCEIZ-UHFFFAOYSA-N 2,3-dimethylphenol Chemical compound CC1=CC=CC(O)=C1C QWBBPBRQALCEIZ-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- LUSZGTFNYDARNI-UHFFFAOYSA-N Sesamol Chemical compound OC1=CC=C2OCOC2=C1 LUSZGTFNYDARNI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 150000001716 carbazoles Chemical class 0.000 description 2
- 150000001728 carbonyl compounds Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 208000019622 heart disease Diseases 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- PEHSSTUGJUBZBI-UHFFFAOYSA-N indan-5-ol Chemical compound OC1=CC=C2CCCC2=C1 PEHSSTUGJUBZBI-UHFFFAOYSA-N 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000011514 reflex Effects 0.000 description 2
- 238000005245 sintering Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- 230000001960 triggered effect Effects 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SQQJANREFMJAEP-UHFFFAOYSA-N 1-(2-chloroethylsulfanyl)-2-methoxybenzene Chemical compound COC1=CC=CC=C1SCCCl SQQJANREFMJAEP-UHFFFAOYSA-N 0.000 description 1
- SQKVVYGOXLSEKL-UHFFFAOYSA-N 1-(2-methoxyphenoxy)propan-2-amine Chemical compound COC1=CC=CC=C1OCC(C)N SQKVVYGOXLSEKL-UHFFFAOYSA-N 0.000 description 1
- UWQNZSIIICIMKJ-UHFFFAOYSA-N 1-(oxiran-2-ylmethyl)-9h-carbazole Chemical compound C=1C=CC=2C3=CC=CC=C3NC=2C=1CC1CO1 UWQNZSIIICIMKJ-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- QOEUHSPBSQPZEB-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yloxy)acetonitrile Chemical compound N#CCOC1=CC=C2OCOC2=C1 QOEUHSPBSQPZEB-UHFFFAOYSA-N 0.000 description 1
- PRINMFLUFYNHGD-UHFFFAOYSA-N 2-(2,3-dimethylphenoxy)acetonitrile Chemical compound CC1=CC=CC(OCC#N)=C1C PRINMFLUFYNHGD-UHFFFAOYSA-N 0.000 description 1
- QDAOLZRIBDCHRR-UHFFFAOYSA-N 2-(2,6-dimethoxyphenoxy)acetonitrile Chemical compound COC1=CC=CC(OC)=C1OCC#N QDAOLZRIBDCHRR-UHFFFAOYSA-N 0.000 description 1
- NAPNYPMMDVRKGM-UHFFFAOYSA-N 2-(2-chlorophenoxy)ethanamine Chemical compound NCCOC1=CC=CC=C1Cl NAPNYPMMDVRKGM-UHFFFAOYSA-N 0.000 description 1
- GCBARCBKJKKWDS-UHFFFAOYSA-N 2-(2-methylsulfanylphenoxy)acetonitrile Chemical compound CSC1=CC=CC=C1OCC#N GCBARCBKJKKWDS-UHFFFAOYSA-N 0.000 description 1
- RTRHUTMJBNRFOL-UHFFFAOYSA-N 2-(2-methylsulfinylphenoxy)ethanamine Chemical compound CS(=O)C1=CC=CC=C1OCCN RTRHUTMJBNRFOL-UHFFFAOYSA-N 0.000 description 1
- IYVSABAGVFWSNU-UHFFFAOYSA-N 2-(2-phenylmethoxyphenoxy)ethanamine Chemical compound NCCOC1=CC=CC=C1OCC1=CC=CC=C1 IYVSABAGVFWSNU-UHFFFAOYSA-N 0.000 description 1
- HTMIRIIZZGJJBK-UHFFFAOYSA-N 2-(4-fluorophenoxy)ethanamine Chemical compound NCCOC1=CC=C(F)C=C1 HTMIRIIZZGJJBK-UHFFFAOYSA-N 0.000 description 1
- SOOARYARZPXNAL-UHFFFAOYSA-N 2-(Methylthio)phenol Chemical compound CSC1=CC=CC=C1O SOOARYARZPXNAL-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- IMLAIXAZMVDRGA-UHFFFAOYSA-N 2-phenoxyethanamine Chemical compound NCCOC1=CC=CC=C1 IMLAIXAZMVDRGA-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- SKDUIZXONBSZOH-UHFFFAOYSA-N 3-(3-phenylpropylamino)propan-1-ol Chemical compound OCCCNCCCC1=CC=CC=C1 SKDUIZXONBSZOH-UHFFFAOYSA-N 0.000 description 1
- WXRASJNZZKLKBC-UHFFFAOYSA-N 3-(oxiran-2-ylmethoxy)-9h-carbazole Chemical compound C=1C=C2NC3=CC=CC=C3C2=CC=1OCC1CO1 WXRASJNZZKLKBC-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- LYUQWQRTDLVQGA-UHFFFAOYSA-N 3-phenylpropylamine Chemical compound NCCCC1=CC=CC=C1 LYUQWQRTDLVQGA-UHFFFAOYSA-N 0.000 description 1
- BOQUSVDDEJXKKS-UHFFFAOYSA-N 4-(ethylaminooxy)benzamide Chemical compound CCNOC1=CC=C(C(N)=O)C=C1 BOQUSVDDEJXKKS-UHFFFAOYSA-N 0.000 description 1
- HIWHLFQMDDWLRB-UHFFFAOYSA-N 5-chloro-2-methoxyphenol Chemical compound COC1=CC=C(Cl)C=C1O HIWHLFQMDDWLRB-UHFFFAOYSA-N 0.000 description 1
- GZSUIHUAFPHZSU-UHFFFAOYSA-N 9-ethyl-2,3-dihydro-1h-carbazol-4-one Chemical compound C12=CC=CC=C2N(CC)C2=C1C(=O)CCC2 GZSUIHUAFPHZSU-UHFFFAOYSA-N 0.000 description 1
- XSSMMYSUVMYMFI-UHFFFAOYSA-N 9H-carbazole oxalic acid Chemical compound C(C(=O)O)(=O)O.C1=CC=CC=2C3=CC=CC=C3NC12 XSSMMYSUVMYMFI-UHFFFAOYSA-N 0.000 description 1
- APSDTEHUYIJMPZ-UHFFFAOYSA-N 9h-carbazole;hydrochloride Chemical compound Cl.C1=CC=C2C3=CC=CC=C3NC2=C1 APSDTEHUYIJMPZ-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101100399480 Caenorhabditis elegans lmn-1 gene Proteins 0.000 description 1
- LSPHULWDVZXLIL-UHFFFAOYSA-N Camphoric acid Natural products CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- DUGOZIWVEXMGBE-UHFFFAOYSA-N Methylphenidate Chemical compound C=1C=CC=CC=1C(C(=O)OC)C1CCCCN1 DUGOZIWVEXMGBE-UHFFFAOYSA-N 0.000 description 1
- UOAOBXLVAJBFJT-UHFFFAOYSA-N N-(4-tert-butylphenoxy)ethanamine Chemical compound C(C)(C)(C)C1=CC=C(ONCC)C=C1 UOAOBXLVAJBFJT-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 101150046432 Tril gene Proteins 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- ZXVOCOLRQJZVBW-UHFFFAOYSA-N azane;ethanol Chemical compound N.CCO ZXVOCOLRQJZVBW-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 238000006480 benzoylation reaction Methods 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- LSPHULWDVZXLIL-QUBYGPBYSA-N camphoric acid Chemical compound CC1(C)[C@H](C(O)=O)CC[C@]1(C)C(O)=O LSPHULWDVZXLIL-QUBYGPBYSA-N 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OTIDWUALRXXVIM-UHFFFAOYSA-N n-ethylpyridin-4-amine Chemical compound CCNC1=CC=NC=C1 OTIDWUALRXXVIM-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- FZJCXIDLUFPGPP-UHFFFAOYSA-N propan-2-ol;toluene Chemical compound CC(C)O.CC1=CC=CC=C1 FZJCXIDLUFPGPP-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical class OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000002889 sympathetic effect Effects 0.000 description 1
- 210000002820 sympathetic nervous system Anatomy 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000003396 thiol group Chemical class [H]S* 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/82—Carbazoles; Hydrogenated carbazoles
- C07D209/88—Carbazoles; Hydrogenated carbazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the ring system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/02—Drugs for disorders of the nervous system for peripheral neuropathies
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/64—Oxygen atoms
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782815926 DE2815926A1 (de) | 1978-04-13 | 1978-04-13 | Neue carbazolyl-(4)-oxy-propanolamin-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD143607A5 true DD143607A5 (de) | 1980-09-03 |
Family
ID=6036838
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD79212096A DD143607A5 (de) | 1978-04-13 | 1979-04-09 | Verfahren zur herstellung neuer carbazolyl-(4)-oxy-propanolamin-derivate |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4503067A (enExample) |
| EP (1) | EP0004920B1 (enExample) |
| JP (2) | JPS54157558A (enExample) |
| AT (1) | AT375639B (enExample) |
| AU (1) | AU522975B2 (enExample) |
| BG (1) | BG61419B2 (enExample) |
| CA (1) | CA1129416A (enExample) |
| CS (2) | CS227007B2 (enExample) |
| DD (1) | DD143607A5 (enExample) |
| DE (2) | DE2815926A1 (enExample) |
| DK (1) | DK154555C (enExample) |
| ES (1) | ES479396A1 (enExample) |
| FI (1) | FI70406C (enExample) |
| HK (1) | HK2385A (enExample) |
| HU (1) | HU179433B (enExample) |
| IL (1) | IL57020A (enExample) |
| LT (1) | LT2628B (enExample) |
| LU (1) | LU88320I2 (enExample) |
| MX (1) | MX9203380A (enExample) |
| NL (1) | NL930110I2 (enExample) |
| SG (1) | SG52284G (enExample) |
| SU (1) | SU810079A3 (enExample) |
| ZA (1) | ZA791732B (enExample) |
Families Citing this family (118)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3131146A1 (de) * | 1981-08-06 | 1983-02-24 | Boehringer Mannheim Gmbh, 6800 Mannheim | Neue heteroaryloxypropanolamine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DE3300933A1 (de) * | 1983-01-13 | 1984-07-19 | Boehringer Mannheim Gmbh, 6800 Mannheim | Verwendung von d,l- und d-carazolol als antiglaukommittel sowie arzneimittel, die diese stoffe enthalten |
| DE3319027A1 (de) | 1983-05-26 | 1984-11-29 | Boehringer Mannheim Gmbh, 6800 Mannheim | Verfahren zur herstellung von optisch aktiven carbazol-derivaten, neue r- und s-carbazol-derivate, sowie arzneimittel, die diese verbindungen enthalten |
| GB9113802D0 (en) * | 1991-06-26 | 1991-08-14 | Smithkline Beecham Plc | Medicaments |
| US20030036980A1 (en) * | 2001-08-14 | 2003-02-20 | Wren Stephen C. | System for marketing goods and services utilizing computerized central and remote facilities |
| US5405863A (en) * | 1992-12-01 | 1995-04-11 | Smithkline Beecham Corporation | Antioxidant cardioprotective use of, and method of treatment using, hydroxycarbazole compounds |
| ZA938897B (en) * | 1992-12-01 | 1994-08-01 | Smithkline Beecham Corp | Antioxidant neuroprotective use of and method of treatment using hydroxycarbazole compounds |
| US5308862A (en) * | 1993-03-05 | 1994-05-03 | Boehringer Mannheim Pharmaceuticals Corporation - Smithkline Beecham Corp., Ltd. Partnership No. 1 | Use of, and method of treatment using, carbazolyl-(4)-oxypropanolamine compounds for inhibition of smooth muscle cell proliferation |
| WO1994020096A1 (en) * | 1993-03-05 | 1994-09-15 | Boehringer Mannheim Pharmaceuticals Corporation - Smithkline Beckman Corporation Limited | Method of employing carbazolyl-(4)-oxypropanolamine compounds for inhibition of smooth muscle cell proliferation |
| US5393772A (en) * | 1993-11-24 | 1995-02-28 | Boehringer Mannheim Pharmaceuticals Corporation | Use of, and method of treatment using, hydroxycarbazole compounds for inhibition of smooth muscle migration and proliferation |
| US5760069A (en) | 1995-02-08 | 1998-06-02 | Boehringer Mannheim Pharmaceuticals Corporation-Smithkline Beecham Corporation Limited Partnership #1 | Method of treatment for decreasing mortality resulting from congestive heart failure |
| ZA967892B (en) * | 1995-09-21 | 1998-03-18 | Lilly Co Eli | Selective β3 adrenergic agonists. |
| US6177430B1 (en) | 1997-03-27 | 2001-01-23 | Pfizer Inc | Use of α1-adrenoreceptor antagonists in the prevention and treatment of benign prostatic hyperplasia |
| DE19628335A1 (de) * | 1996-07-13 | 1998-01-15 | Boehringer Mannheim Gmbh | Verwendung von Carbazolyl-(4)-oxy-propanolamin-Derivaten zur topischen Behandlung von peripheren Durchblutungsstörungen |
| NZ334307A (en) * | 1996-08-23 | 2000-11-24 | Boehringer Mannheim Pharm Corp | Compounds for treating diseases wherein inhibition of Fas-mediated apoptosis is indicated |
| ATE215369T1 (de) * | 1996-09-05 | 2002-04-15 | Lilly Co Eli | Carbazolanaloge als selektive beta3-adrenergische agonisten |
| US5808080A (en) * | 1996-09-05 | 1998-09-15 | Eli Lilly And Company | Selective β3 adrenergic agonists |
| TR199900762T2 (xx) * | 1996-10-09 | 1999-07-21 | Boehringer Mannheim Pharmaceuticals Cor.Smithkline Beecham | Stresle aktifle�tirilen protein kinazlar�n�n engellenme y�ntemi. |
| US6730326B2 (en) | 1997-07-22 | 2004-05-04 | Roche Diagnostics Gmbh | Thermodynamically stable modification of 1-(4-carbazolyl-oxy-3[2-(2-methoxyphenoxy)-ethylamino]-2-propanol process for its preparation and pharmaceutical compositions containing it |
| EP0893440A1 (en) * | 1997-07-22 | 1999-01-27 | Roche Diagnostics GmbH | Thermodynamically stable modification of 1-(4-carbazolyloxy)-3-[2-(2-methoxyphenoxy)ethylamino]-2-propanole, process for its preparation and pharmaceutical compositions containing it |
| ZA989365B (en) * | 1997-10-15 | 1999-04-15 | Boehringer Mannheim Pharm Corp | Preparation for treating alzheimer's disease |
| TR200001362T2 (tr) * | 1997-11-12 | 2000-09-21 | Boehringer Mannheim Pharm Corp.-Smithkline Beckman | Yeni karvedilol oral dozaj formu |
| HU9702209D0 (en) * | 1997-11-24 | 1998-01-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing pharmaceutical product |
| HU227441B1 (en) * | 1997-11-24 | 2011-06-28 | Egis Gyogyszergyar Nyilvanosan Muekoedoe Reszvenytarsasag | Process for producing carvedilol, enantiomers and salts thereof |
| CO5011072A1 (es) * | 1997-12-05 | 2001-02-28 | Lilly Co Eli | Etanolaminas pirazinil substituidas como agfonistas de los receptores |
| KR100520589B1 (ko) * | 1998-04-09 | 2005-10-10 | 로쉐 디아그노스틱스 게엠베하 | 카베딜롤-갈레누스 제제 |
| EP0968714A1 (de) * | 1998-07-02 | 2000-01-05 | Roche Diagnostics GmbH | Verfahren zur Herstellung schnellauflösender pharmazeutischer Zubereitungen von schwerlöslichen Wirkstoffen |
| DE19833119A1 (de) * | 1998-07-23 | 2000-01-27 | Roche Diagnostics Gmbh | Spritzfertige Injektionslösungen enthaltend Carvedilol |
| US6664284B2 (en) | 1998-07-23 | 2003-12-16 | Roche Diagnostics Gmbh | Stabilized carvedilol injection solution |
| AU5251999A (en) | 1998-08-04 | 2000-02-28 | Wisconsin Alumni Research Foundation | Method of reducing retinal ganglion cell degeneration |
| PE20001302A1 (es) | 1998-11-27 | 2000-11-30 | Hoffmann La Roche | Preparaciones de una combinacion farmaceutica que contiene carvedilol e hidroclorotiazida |
| MY125942A (en) | 1999-09-07 | 2006-09-29 | Upjohn Co | Aminoalkoxy carbazoles for the treatment of cns diseases |
| CA2392085A1 (en) | 1999-11-15 | 2001-05-25 | Smithkline Beecham Corporation | Carvedilol methanesulfonate |
| US20010036959A1 (en) * | 2000-04-03 | 2001-11-01 | Gabel Rolf Dieter | Carvedilol-hydrophilic solutions |
| WO2001074356A1 (en) * | 2000-04-03 | 2001-10-11 | F. Hoffmann-La Roche Ag | Concentrated solutions of carvedilol |
| DK174645B1 (da) * | 2000-05-18 | 2003-08-04 | Gea Farmaceutisk Fabrik As | Fremgangsmåde og mellemprodukter til fremstillingen af 1-(9H-carbazol-4-yloxy)-3-[2-(2-methoxy-phenoxy)-ethylamino]-propan-2-ol, carvedilol og syreadditionssalte deraf |
| MXPA02012795A (es) | 2000-06-28 | 2004-07-30 | Teva Pharma | Carvedilol. |
| EP1655285A1 (en) * | 2000-06-28 | 2006-05-10 | Teva Pharmaceutical Industries Ltd. | Method for preparation of a crystalline form of carvedilol (form II) |
| GB0106953D0 (en) * | 2001-03-20 | 2001-05-09 | Univ Aberdeen | Neufofibrillary labels |
| US20050009897A1 (en) * | 2001-04-02 | 2005-01-13 | Karen Anderson | Method of treatment |
| IN191028B (enExample) * | 2001-05-17 | 2003-09-13 | Sun Pharmaceutical Ind Ltd | |
| WO2003005970A2 (en) * | 2001-07-13 | 2003-01-23 | Smithkline Beecham Corporation | Carvedilol polymorph |
| EP1429739A1 (en) * | 2001-09-21 | 2004-06-23 | Egalet A/S | Polymer release system |
| US20040253310A1 (en) * | 2001-09-21 | 2004-12-16 | Gina Fischer | Morphine polymer release system |
| KR100752549B1 (ko) * | 2001-09-28 | 2007-08-30 | 에프. 호프만-라 로슈 아게 | 카르베딜올의 유사다형태 |
| WO2003028718A1 (en) * | 2001-10-01 | 2003-04-10 | Smithkline Beecham Corporation | Novel formulations of carvedilol |
| US8101209B2 (en) * | 2001-10-09 | 2012-01-24 | Flamel Technologies | Microparticulate oral galenical form for the delayed and controlled release of pharmaceutical active principles |
| AU2003205146A1 (en) * | 2002-01-15 | 2003-07-30 | Teva Pharmaceutical Industries Ltd. | Crystalline solids of carvedilol and processes for their preparation |
| EP2316469A1 (en) | 2002-02-22 | 2011-05-04 | Shire LLC | Delivery system and methods for protecting and administering dextroamphetamine |
| EP1499310A4 (en) * | 2002-04-30 | 2005-12-07 | Sb Pharmco Inc | MONOCITRATE MONOHYDRATE OF CARVEDILOL |
| US20050261335A1 (en) * | 2002-05-03 | 2005-11-24 | Wei Chen | Carvedilol formulations |
| US20060094771A1 (en) * | 2002-05-03 | 2006-05-04 | Wei Chen | Carvedilol pharmasolve solvate |
| EP1539140A4 (en) | 2002-06-27 | 2005-12-07 | Sb Pharmco Inc | CARVEDILOLHYDOBROMID |
| CN103254114A (zh) * | 2002-06-27 | 2013-08-21 | 史密斯克莱.比奇曼(科克)有限公司 | 卡维地洛磷酸盐和/或其溶剂合物相应的组合物和/或治疗方法 |
| US20040152756A1 (en) * | 2002-07-15 | 2004-08-05 | Wei Chen | Carvedilol polymorph |
| EP1542728A4 (en) * | 2002-07-22 | 2005-09-21 | Nanohybrid Co Ltd | HYBRID OF ITRACONAZOLE, CYCLOSPORINE OR CARVEDILOL WITH A LAYERED SILICATE AND PROCESS FOR PREPARING THE SAME |
| JP3835763B2 (ja) | 2002-08-19 | 2006-10-18 | ファイザー・プロダクツ・インク | 増殖亢進疾患のための組み合わせ治療 |
| US6632832B1 (en) | 2002-09-10 | 2003-10-14 | Dabur Research Foundation | Anti-cancer activity of carvedilol and its isomers |
| SK285547B6 (sk) * | 2002-11-08 | 2007-03-01 | Zentiva, A. S. | Spôsob prípravy Carvedilolu |
| EP1562552A1 (en) * | 2002-11-08 | 2005-08-17 | Egalet A/S | Controlled release carvedilol compositions |
| US7468442B2 (en) * | 2003-04-21 | 2008-12-23 | Matrix Laboratories Ltd. | Process for the preparation of carvedilol form-II |
| SG141430A1 (en) * | 2003-05-30 | 2008-04-28 | Ranbaxy Lab Ltd | Substituted pyrrole derivatives and their use as hmg-co inhibitors |
| US7482471B2 (en) * | 2003-06-20 | 2009-01-27 | Sun Pharmaceutical Industries Limited | Process for preparation of 1-[9H-carbazol-4-yloxy]-3-[{2-(2-(-methoxy)phenoxy)-ethyl}-amino]-propan-2-ol |
| US20050037063A1 (en) * | 2003-07-21 | 2005-02-17 | Bolton Anthony E. | Combined therapies |
| JP2007512350A (ja) * | 2003-11-25 | 2007-05-17 | エスビー・ファルムコ・プエルト・リコ・インコーポレイテッド | カルベジロール組成物の治療および送達方法 |
| US7750036B2 (en) * | 2003-11-25 | 2010-07-06 | Sb Pharmco Puerto Rico Inc. | Carvedilol salts, corresponding compositions, methods of delivery and/or treatment |
| US20050175695A1 (en) * | 2003-11-25 | 2005-08-11 | Catherine Castan | Carvedilol free base, salts, anhydrous forms or solvates thereof, corresponding pharmaceutical compositions, controlled release formulations, and treatment or delivery methods |
| WO2005115981A2 (en) * | 2004-04-22 | 2005-12-08 | Usv Limited | A process for the preparation of 1-(9h-carbazol-4-yloxy)-3-2-(-methoxyphenoxy)-ethyl amino-propan-2-ol |
| GB0411273D0 (en) * | 2004-05-20 | 2004-06-23 | Cipla Ltd | Process and product |
| WO2006060122A2 (en) * | 2004-11-30 | 2006-06-08 | Artesian Therapeutics, Inc. | Cardiotonic compounds with inhibitory activity against beta-adrenergic receptors and phosphodiesterase |
| SI1838670T1 (sl) * | 2004-12-09 | 2010-04-30 | Zach System Spa | Postopek za pripravo karvedilola in njegovih entantiomer |
| US20070027202A1 (en) * | 2005-06-07 | 2007-02-01 | Ashok Kumar | Process for the preparation of carvedilol and its salts |
| US20070043099A1 (en) * | 2005-06-09 | 2007-02-22 | Igor Lifshitz | Crystalline forms of carvedilol and processes for their preparation |
| GT200600381A (es) | 2005-08-25 | 2007-03-28 | Compuestos organicos | |
| WO2007042912A2 (en) * | 2005-10-13 | 2007-04-19 | Orchid Research Laboratories Limited | Heterocyclic compounds as pstat3/il-6 inhibitors |
| US7741317B2 (en) | 2005-10-21 | 2010-06-22 | Bristol-Myers Squibb Company | LXR modulators |
| BRPI0618379A2 (pt) * | 2005-11-08 | 2011-08-30 | Ranbaxy Lab Ltd | processo para preparação do hemi-sal de cálcio do ácido (3r,5r) -7-[2-(4-fluorofenil)-5-isopropil-3-fenil-4-[(4-hidroxime tilfenilamino) carbonil]-pirrol-1-il] -3, 5-diidroxi heptanóico |
| US7888376B2 (en) | 2005-11-23 | 2011-02-15 | Bristol-Myers Squibb Company | Heterocyclic CETP inhibitors |
| US8367112B2 (en) * | 2006-02-28 | 2013-02-05 | Alkermes Pharma Ireland Limited | Nanoparticulate carverdilol formulations |
| US20070238716A1 (en) * | 2006-03-14 | 2007-10-11 | Murthy Ayanampudi S R | Statin stabilizing dosage formulations |
| US8703804B2 (en) | 2006-03-26 | 2014-04-22 | Uti Limited Partnership | Ryanodine receptor inhibitors and methods relating thereto |
| WO2008002683A2 (en) * | 2006-06-28 | 2008-01-03 | Teva Pharmaceutical Industries Ltd. | Polymorphous forms of carvedilol phosphate |
| TW200811101A (en) * | 2006-07-14 | 2008-03-01 | Ranbaxy Lab Ltd | Polymorphic forms of an HMG-CoA reductase inhibitor and uses thereof |
| WO2008038301A1 (en) * | 2006-09-26 | 2008-04-03 | Morepen Laboratories Limited | A process for the preparation of carvedilol |
| US20090028935A1 (en) * | 2006-12-01 | 2009-01-29 | Kristin Arnold | Carvedilol forms, compositions, and methods of preparation thereof |
| US20080292695A1 (en) * | 2006-12-01 | 2008-11-27 | Kristin Arnold | Carvedilol forms, compositions, and methods of preparation thereof |
| CN101663262B (zh) | 2006-12-01 | 2014-03-26 | 百时美施贵宝公司 | 用于治疗动脉粥样硬化和心血管疾病的作为cetp抑制剂的n-(3-苄基)-2,2-(二苯基)-丙-1胺衍生物 |
| WO2008084494A1 (en) * | 2007-01-08 | 2008-07-17 | Matrix Laboratories Limited | Novel polymorphic forms of carvedilol dihydrogen phosphate and process for preparing the same |
| AU2008207200B2 (en) * | 2007-01-16 | 2011-02-17 | Egalet Ltd | Use of i) a polyglycol and ii) an active drug substance for the preparation of a pharmaceutical composition for i) mitigating the risk of alcohol induced dose dumping and/or ii) reducing the risk of drug abuse |
| CZ302357B6 (cs) * | 2007-01-26 | 2011-03-30 | Zentiva, A. S. | Zpusob cištení Carvedilolu |
| US20080207726A1 (en) * | 2007-02-26 | 2008-08-28 | Santiago Ini | Process for the purification of carvedilol or its salts thereof |
| US20080249317A1 (en) * | 2007-04-04 | 2008-10-09 | Apotex Inc. | Novel amorphous form of carvedilol phosphate and processes for the preparation thereof |
| WO2008142703A1 (en) * | 2007-05-17 | 2008-11-27 | Wanbury Limited | A novel cost effective process for production of carvedilol phosphate |
| WO2008148798A2 (en) | 2007-06-04 | 2008-12-11 | Egalet A/S | Controlled release pharmaceutical compositions for prolonged effect |
| EP2195292B1 (en) * | 2007-08-21 | 2013-10-02 | Lupin Ltd. | Stable amorphous form of carvedilol dihydrogen phosphate with stabilizer |
| WO2009035535A2 (en) * | 2007-09-07 | 2009-03-19 | Scinopharm Taiwan Ltd. | Method of crystallizing carvedilol phosphate and the product thereof |
| US20090076116A1 (en) * | 2007-09-13 | 2009-03-19 | Protia, Llc | Deuterium-enriched carvediolo |
| US20090111998A1 (en) * | 2007-10-25 | 2009-04-30 | Srinivas Reddy Gade | Process for the preparation of carvedilol dihydrogen phosphate hemihydrate and pharmaceutical compositions thereof |
| US8889728B2 (en) * | 2008-03-04 | 2014-11-18 | Lupin Limited | Stable pharmaceutical compositions of carvedilol |
| WO2009115902A1 (en) * | 2008-03-19 | 2009-09-24 | Cadila Pharmaceuticals Ltd. | Process for the preparation of carvedilol via silyl protection of substituted amine |
| WO2009115906A2 (en) * | 2008-03-19 | 2009-09-24 | Cadila Pharmaceuticals Ltd. | An improved process for preparation of carvedilol involving halohydrin derivative |
| WO2009122425A1 (en) * | 2008-04-04 | 2009-10-08 | Shodhana Laboratories Limited | Novel crystalline form of carvedilol dihydrogen phosphate and related processes |
| US7763645B2 (en) * | 2008-05-23 | 2010-07-27 | Wanbury Limited | Carvedilol dihydrogen phosphate monohydrate |
| WO2010092589A2 (en) * | 2008-05-26 | 2010-08-19 | Alkem Laboratories Ltd. | Process for preparation of amorphous carvedilol phosphate |
| AU2010211220B2 (en) | 2009-02-06 | 2013-08-01 | Egalet Ltd. | Immediate release composition resistant to abuse by intake of alcohol |
| WO2010149169A2 (en) | 2009-06-24 | 2010-12-29 | Egalet A/S | Controlled release formulations |
| TWI415604B (zh) | 2009-09-29 | 2013-11-21 | Tsh Biopharm Corp Ltd | 調控釋放卡菲蒂羅劑型 |
| US20110229564A1 (en) * | 2010-03-22 | 2011-09-22 | Amneal Pharmaceuticals, L.L.C. | Pharmaceutical Compositions Of Carvedilol Salts And Process For Preparation Thereof |
| KR101995824B1 (ko) | 2011-12-16 | 2019-07-03 | 쓰리엠 이노베이티브 프로퍼티즈 컴파니 | 옥시란-함유 비스안하이드로헥시톨 유도체 및 이의 용도 |
| US9549899B2 (en) | 2012-07-06 | 2017-01-24 | Egalet Ltd. | Abuse deterrent pharmaceutical compositions for controlled release |
| US8492426B1 (en) * | 2012-07-12 | 2013-07-23 | Anis Ahmad | Use of carvedilol for treatment of diabetes mellitus |
| WO2014170786A1 (en) | 2013-04-17 | 2014-10-23 | Pfizer Inc. | N-piperidin-3-ylbenzamide derivatives for treating cardiovascular diseases |
| WO2016055901A1 (en) | 2014-10-08 | 2016-04-14 | Pfizer Inc. | Substituted amide compounds |
| US10357476B1 (en) | 2018-10-30 | 2019-07-23 | Anis Ahmad | Method for treating coronary artery disease |
| AU2020209215B2 (en) | 2019-01-18 | 2023-02-02 | Astrazeneca Ab | PCSK9 inhibitors and methods of use thereof |
| CN111170997A (zh) * | 2019-12-31 | 2020-05-19 | 广州医科大学 | 咔唑类化合物及其制备方法和应用 |
| CN113372260A (zh) * | 2021-07-05 | 2021-09-10 | 大连蒙迪科技有限公司 | 一种卡维地洛杂质的合成方法 |
| CN115960032A (zh) * | 2021-10-08 | 2023-04-14 | 复旦大学 | 具有β-arrestin偏向性激动活性的芳氧丙醇胺类β-肾上腺素受体配基及其用途 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1834015A (en) * | 1929-06-29 | 1931-12-01 | Gen Aniline Works Inc | Manufacture of hydroxy carbazoles |
| DE1152107B (de) * | 1956-06-27 | 1963-08-01 | Chem Fab Promonta G M B H | Verfahren zur Herstellung von basisch substituierten Carbazolderivaten und deren Salzen |
| US3932424A (en) * | 1970-06-15 | 1976-01-13 | Richardson-Merrell Inc. | Bis-basic ethers of carbazole |
| BE789072A (fr) * | 1971-09-23 | 1973-03-21 | Astra Laekemedel Ab | Composes abaissant le taux de lipides du serum et leur obtention |
| AT336176B (de) * | 1971-12-10 | 1977-04-25 | Sandoz Ag | Verfahren zur herstellung eines pharmazeutischen praparates |
| US3975398A (en) * | 1973-08-01 | 1976-08-17 | Boehringer Mannheim G.M.B.H. | 9-Substituted 3-aminocarbazole compounds |
| DE2339396C2 (de) * | 1973-08-03 | 1984-06-28 | Boehringer Mannheim Gmbh, 6800 Mannheim | N-substituierte 1-Amino-3-phenoxypropan-2-ole, deren Salze, Verfahren zu deren Herstellung sowie Arzneimittel, die diese Verbindungen enthalten |
| DE2424523A1 (de) * | 1974-05-21 | 1975-12-11 | Boehringer Mannheim Gmbh | Neue 1,2,3,4-tetrahydrocarbazol-derivate und verfahren zu deren herstellung |
| US4152446A (en) * | 1974-11-16 | 1979-05-01 | Boehringer Mannheim Gmbh | Aminopropanol compounds and compositions for the treatment of cardiac and circulatory diseases |
| US4076829A (en) * | 1974-11-16 | 1978-02-28 | Boehringer Mannheim Gmbh | Aminopropanol compounds and compositions for the treatment of cardiac and circulatory diseases |
| DE2454406A1 (de) * | 1974-11-16 | 1976-05-20 | Boehringer Mannheim Gmbh | Neue aminopropanol-derivate, verfahren zu ihrer herstellung und diese enthaltende arzneimittel |
| GB1508208A (en) * | 1975-12-05 | 1978-04-19 | Ici Ltd | Amide derivatives |
| US4115409A (en) * | 1975-12-05 | 1978-09-19 | Imperial Chemical Industries Limited | Alkanolamine derivatives |
-
1978
- 1978-04-13 DE DE19782815926 patent/DE2815926A1/de not_active Withdrawn
-
1979
- 1979-04-02 CA CA324,667A patent/CA1129416A/en not_active Expired
- 1979-04-06 AU AU45820/79A patent/AU522975B2/en not_active Expired
- 1979-04-06 ES ES479396A patent/ES479396A1/es not_active Expired
- 1979-04-06 FI FI791142A patent/FI70406C/fi not_active IP Right Cessation
- 1979-04-06 DK DK141979A patent/DK154555C/da not_active IP Right Cessation
- 1979-04-06 SU SU792745301A patent/SU810079A3/ru active
- 1979-04-07 EP EP79101063A patent/EP0004920B1/de not_active Expired
- 1979-04-07 DE DE7979101063T patent/DE2960553D1/de not_active Expired
- 1979-04-08 IL IL57020A patent/IL57020A/xx unknown
- 1979-04-09 DD DD79212096A patent/DD143607A5/de not_active IP Right Cessation
- 1979-04-10 CS CS792434A patent/CS227007B2/cs unknown
- 1979-04-11 JP JP4311979A patent/JPS54157558A/ja active Granted
- 1979-04-11 ZA ZA791732A patent/ZA791732B/xx unknown
- 1979-04-12 HU HU79BO1774A patent/HU179433B/hu unknown
- 1979-04-12 AT AT0276279A patent/AT375639B/de not_active IP Right Cessation
-
1983
- 1983-04-04 US US06/479,921 patent/US4503067A/en not_active Expired - Lifetime
-
1984
- 1984-07-20 SG SG52284A patent/SG52284G/en unknown
-
1985
- 1985-01-10 HK HK23/85A patent/HK2385A/xx not_active IP Right Cessation
-
1987
- 1987-03-31 JP JP62076548A patent/JPS63258416A/ja active Pending
-
1991
- 1991-12-31 CS CS914200A patent/CS420091A3/cs unknown
-
1992
- 1992-06-25 MX MX9203380A patent/MX9203380A/es unknown
-
1993
- 1993-06-22 LU LU88320C patent/LU88320I2/de unknown
- 1993-06-29 NL NL930110C patent/NL930110I2/nl unknown
- 1993-09-27 LT LTRP1124A patent/LT2628B/xx unknown
-
1994
- 1994-02-28 BG BG098612A patent/BG61419B2/bg unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI70406B (fi) | 1986-03-27 |
| SG52284G (en) | 1985-03-29 |
| MX9203380A (es) | 1992-09-01 |
| JPH0123462B2 (enExample) | 1989-05-02 |
| HK2385A (en) | 1985-01-18 |
| IL57020A0 (en) | 1979-07-25 |
| DK154555C (da) | 1989-06-19 |
| DE2960553D1 (en) | 1981-11-05 |
| LT2628B (lt) | 1994-04-25 |
| EP0004920B1 (de) | 1981-08-05 |
| BG61419B2 (bg) | 1997-07-31 |
| IL57020A (en) | 1982-07-30 |
| EP0004920A1 (de) | 1979-10-31 |
| NL930110I1 (nl) | 1993-10-18 |
| CS227007B2 (en) | 1984-04-16 |
| FI791142A7 (fi) | 1979-10-14 |
| AT375639B (de) | 1984-08-27 |
| DE2815926A1 (de) | 1979-10-18 |
| DK141979A (da) | 1979-10-14 |
| ES479396A1 (es) | 1980-04-16 |
| NL930110I2 (nl) | 1994-12-01 |
| AU4582079A (en) | 1979-10-18 |
| US4503067A (en) | 1985-03-05 |
| ZA791732B (en) | 1980-05-28 |
| SU810079A3 (ru) | 1981-02-28 |
| ATA276279A (de) | 1984-01-15 |
| HU179433B (en) | 1982-10-28 |
| DK154555B (da) | 1988-11-28 |
| CA1129416A (en) | 1982-08-10 |
| AU522975B2 (en) | 1982-07-08 |
| CS420091A3 (en) | 1992-04-15 |
| LU88320I2 (de) | 1994-05-04 |
| FI70406C (fi) | 1986-09-19 |
| JPS63258416A (ja) | 1988-10-25 |
| JPS54157558A (en) | 1979-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD143607A5 (de) | Verfahren zur herstellung neuer carbazolyl-(4)-oxy-propanolamin-derivate | |
| DE69305276T2 (de) | Arylglycinamidderivate, Verfahren zur deren Herstellung und deren Verwendung zur Therapie der Dysurie | |
| DE1643262A1 (de) | Neue 1-Phenoxy-2-hydroxy-3-alkylaminopropane und Verfahren zu ihrer Herstellung | |
| DE3114239C2 (de) | N↑4↑-Carbamoylpiperazinpropanolderivate, Verfahren zu ihrer Herstellung und pharmazeutisches Mittel | |
| DE69510192T2 (de) | Substituierte cyclopentylaminderivate und deren verwendung als calcium-kanal antagonisten | |
| EP0775135B1 (de) | N-substituierte 3-azabicyclo(3.2.0)heptan-derivate als neuroleptika | |
| DE3411993A1 (de) | Substituierte benzopyrane, verfahren zu ihrer herstellung sowie ihre verwendung in arzneimittel | |
| DE3223463A1 (de) | Substituierte 3-azabicyclo(3.1.0)hexane und verfahren zur behandlung von depressionen unter verwendung von substituierten 3-azabicyclo(3.1.0)hexanen | |
| WO1995015312A1 (de) | N-substituierte azabicycloheptan-derivate wie z.b. neuroleptika | |
| EP0646110B1 (de) | N-substituierte 3-azabicyclo[3.2.0]heptan-derivate als neuroleptika | |
| DE3687035T2 (de) | 3-aminopropyloxyphenylabkoemmlinge, herstellung und arzneitmittel die sie enthalten. | |
| EP0775113B1 (de) | N-substituierte azabicycloheptan-derivate als neuroleptika usw. | |
| EP0065295A1 (de) | Substituierte Tryptaminderivate von Thienyloxypropanolaminen, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen sowie ihre Verwendung | |
| DE2332707A1 (de) | Tricyclische tetrahydronaphthalinderivate, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3424586A1 (de) | 3-aminocarbonylmethoxy-5-phenyl-pyrazol-verbindungen sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3807813A1 (de) | Neue benzocycloheptenderivate, diese verbindungen enthaltende arzneimittel und verfahren zu deren herstellung | |
| DE2748466A1 (de) | 4a-aryloctahydro-1h-2-pyrindine | |
| DE1470055A1 (de) | Verfahren zur Herstellung von Piperidinderivaten | |
| US20120322796A1 (en) | Benzocycloheptane and benzoxepine derivatives | |
| DD154487A5 (de) | Verfahren zur herstellung von 1-benzoxepin-5(2h)-on-derivaten | |
| DE60312511T2 (de) | Oxophenylcyclohexylpropanolaminderivate, deren herstellung und verwendung in therapeutika | |
| DD210266A5 (de) | Verfahren zur herstellung von 3-(ureidocyclohexylamino)-propan-1,2-diolderivaten | |
| DD157796A5 (de) | Verfahren zur herstellung neuer derivate des 2-amino-aethanols | |
| EP0029992A1 (de) | Neue Aminopropanolderivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| US5137908A (en) | 4-azahexacyclododecane compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |