CZ293135B6 - Použití alfa-substituované pyrimidin-thioalkylové nebo alkyletherové sloučeniny pro léčení HIV pozitivních jednotlivců - Google Patents
Použití alfa-substituované pyrimidin-thioalkylové nebo alkyletherové sloučeniny pro léčení HIV pozitivních jednotlivců Download PDFInfo
- Publication number
- CZ293135B6 CZ293135B6 CZ19973491A CZ349197A CZ293135B6 CZ 293135 B6 CZ293135 B6 CZ 293135B6 CZ 19973491 A CZ19973491 A CZ 19973491A CZ 349197 A CZ349197 A CZ 349197A CZ 293135 B6 CZ293135 B6 CZ 293135B6
- Authority
- CZ
- Czechia
- Prior art keywords
- dihydro
- pyridinyl
- amino
- chloro
- compound
- Prior art date
Links
- -1 alkylether compound Chemical class 0.000 title claims abstract description 322
- 150000001875 compounds Chemical class 0.000 claims abstract description 456
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 32
- 239000001257 hydrogen Substances 0.000 claims abstract description 24
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 23
- 150000002367 halogens Chemical class 0.000 claims abstract description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 13
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 11
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 148
- 125000004076 pyridyl group Chemical group 0.000 claims description 118
- 229910052757 nitrogen Inorganic materials 0.000 claims description 77
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 71
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 54
- HBCQSNAFLVXVAY-UHFFFAOYSA-N pyrimidine-2-thiol Chemical compound SC1=NC=CC=N1 HBCQSNAFLVXVAY-UHFFFAOYSA-N 0.000 claims description 43
- 229920006395 saturated elastomer Polymers 0.000 claims description 21
- 208000030507 AIDS Diseases 0.000 claims description 20
- 241000725303 Human immunodeficiency virus Species 0.000 claims description 18
- 229910052799 carbon Inorganic materials 0.000 claims description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 16
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 14
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 11
- 239000012453 solvate Substances 0.000 claims description 8
- 125000001544 thienyl group Chemical group 0.000 claims description 8
- DLUPKDAJXDJCTN-UHFFFAOYSA-N 6-chloro-2-(1-isoquinolin-3-ylethylsulfanyl)pyrimidin-4-amine Chemical compound C=1C2=CC=CC=C2C=NC=1C(C)SC1=NC(N)=CC(Cl)=N1 DLUPKDAJXDJCTN-UHFFFAOYSA-N 0.000 claims description 7
- 150000001204 N-oxides Chemical class 0.000 claims description 7
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 7
- 239000003814 drug Substances 0.000 claims description 7
- 150000004677 hydrates Chemical class 0.000 claims description 6
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 5
- 125000003386 piperidinyl group Chemical group 0.000 claims description 5
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 5
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 4
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 claims description 4
- 241000700605 Viruses Species 0.000 claims description 4
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000004193 piperazinyl group Chemical group 0.000 claims description 4
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 claims description 3
- 239000000427 antigen Substances 0.000 claims description 3
- 102000036639 antigens Human genes 0.000 claims description 3
- 108091007433 antigens Proteins 0.000 claims description 3
- 125000001475 halogen functional group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 2
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims description 2
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 2
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- XQCMDWFUTKIKOW-UHFFFAOYSA-N 3-methylfuro[2,3-c]pyridine Chemical compound N1=CC=C2C(C)=COC2=C1 XQCMDWFUTKIKOW-UHFFFAOYSA-N 0.000 claims description 2
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 claims description 2
- ATCRIOJPQXDFNY-ZETCQYMHSA-N 6-chloro-2-(1-furo[2,3-c]pyridin-5-yl-ethylsulfanyl)-pyrimidin-4-ylamine Chemical compound S([C@@H](C)C=1N=CC=2OC=CC=2C=1)C1=NC(N)=CC(Cl)=N1 ATCRIOJPQXDFNY-ZETCQYMHSA-N 0.000 claims description 2
- 206010061598 Immunodeficiency Diseases 0.000 claims description 2
- 208000029462 Immunodeficiency disease Diseases 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 2
- 125000004534 benzothien-2-yl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 230000007813 immunodeficiency Effects 0.000 claims description 2
- 125000005956 isoquinolyl group Chemical group 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 2
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 claims description 2
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 claims description 2
- 125000004262 quinoxalin-2-yl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N=C1* 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 claims 2
- 125000006727 (C1-C6) alkenyl group Chemical group 0.000 claims 1
- 125000006728 (C1-C6) alkynyl group Chemical group 0.000 claims 1
- BNOPCFBJOCQCMD-QMMMGPOBSA-N 2-[(1s)-1-(3-methylfuro[2,3-c]pyridin-5-yl)ethyl]sulfanyl-6-(trifluoromethyl)pyrimidin-4-amine Chemical compound S([C@@H](C)C=1N=CC=2OC=C(C)C=2C=1)C1=NC(N)=CC(C(F)(F)F)=N1 BNOPCFBJOCQCMD-QMMMGPOBSA-N 0.000 claims 1
- UYWWLYCGNNCLKE-UHFFFAOYSA-N 2-pyridin-4-yl-1h-benzimidazole Chemical compound N=1C2=CC=CC=C2NC=1C1=CC=NC=C1 UYWWLYCGNNCLKE-UHFFFAOYSA-N 0.000 claims 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000004600 benzothiopyranyl group Chemical group S1C(C=CC2=C1C=CC=C2)* 0.000 claims 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 claims 1
- YNDHIHDWUDBWMC-UHFFFAOYSA-N methanesulfonic acid;pyrimidine Chemical compound CS(O)(=O)=O.C1=CN=CN=C1 YNDHIHDWUDBWMC-UHFFFAOYSA-N 0.000 claims 1
- 238000011282 treatment Methods 0.000 abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 7
- 239000000460 chlorine Substances 0.000 abstract description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract description 2
- 229910052801 chlorine Inorganic materials 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 536
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 507
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 444
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 270
- 239000000243 solution Substances 0.000 description 255
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 234
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 198
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 189
- 239000011541 reaction mixture Substances 0.000 description 188
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 173
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 166
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 164
- 239000000741 silica gel Substances 0.000 description 161
- 229910002027 silica gel Inorganic materials 0.000 description 161
- 238000005160 1H NMR spectroscopy Methods 0.000 description 110
- 239000000203 mixture Substances 0.000 description 103
- 229910000027 potassium carbonate Inorganic materials 0.000 description 99
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 91
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 84
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 83
- 239000003921 oil Substances 0.000 description 82
- 239000007787 solid Substances 0.000 description 81
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 77
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 77
- 238000004809 thin layer chromatography Methods 0.000 description 77
- 238000001819 mass spectrum Methods 0.000 description 74
- 238000002360 preparation method Methods 0.000 description 70
- 239000013058 crude material Substances 0.000 description 63
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 57
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 57
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 54
- 239000010410 layer Substances 0.000 description 53
- 239000002480 mineral oil Substances 0.000 description 52
- 235000010446 mineral oil Nutrition 0.000 description 52
- 238000004458 analytical method Methods 0.000 description 49
- 229910000104 sodium hydride Inorganic materials 0.000 description 48
- 238000006243 chemical reaction Methods 0.000 description 43
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 42
- 238000000034 method Methods 0.000 description 42
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 39
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 38
- 238000010992 reflux Methods 0.000 description 38
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 36
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 36
- 239000012312 sodium hydride Substances 0.000 description 35
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 34
- 239000000706 filtrate Substances 0.000 description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 31
- 239000000284 extract Substances 0.000 description 30
- 125000001424 substituent group Chemical group 0.000 description 30
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 28
- 238000002844 melting Methods 0.000 description 28
- 230000008018 melting Effects 0.000 description 28
- OITKEKZIJXHOMS-UHFFFAOYSA-N 4-amino-6-chloro-1h-pyrimidine-2-thione;methanesulfonic acid Chemical compound CS(O)(=O)=O.NC1=CC(Cl)=NC(S)=N1 OITKEKZIJXHOMS-UHFFFAOYSA-N 0.000 description 25
- FXUDMQXADIQKFJ-UHFFFAOYSA-N 4-amino-6-chloro-1h-pyrimidine-2-thione Chemical compound NC1=CC(Cl)=NC(S)=N1 FXUDMQXADIQKFJ-UHFFFAOYSA-N 0.000 description 22
- 238000003756 stirring Methods 0.000 description 21
- 238000004587 chromatography analysis Methods 0.000 description 20
- 239000012065 filter cake Substances 0.000 description 20
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 20
- 235000019341 magnesium sulphate Nutrition 0.000 description 20
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 20
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 19
- 239000000725 suspension Substances 0.000 description 17
- 239000012267 brine Substances 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 238000005804 alkylation reaction Methods 0.000 description 15
- 238000002425 crystallisation Methods 0.000 description 15
- 230000008025 crystallization Effects 0.000 description 15
- 239000003039 volatile agent Substances 0.000 description 15
- 102000004190 Enzymes Human genes 0.000 description 14
- 108090000790 Enzymes Proteins 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 230000029936 alkylation Effects 0.000 description 14
- 229940088598 enzyme Drugs 0.000 description 14
- 239000006260 foam Substances 0.000 description 14
- 229910052938 sodium sulfate Inorganic materials 0.000 description 14
- 235000011152 sodium sulphate Nutrition 0.000 description 14
- 238000001816 cooling Methods 0.000 description 13
- 239000004533 oil dispersion Substances 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 150000001721 carbon Chemical group 0.000 description 12
- 239000012141 concentrate Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 11
- 238000005481 NMR spectroscopy Methods 0.000 description 11
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 11
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 10
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 10
- 239000000908 ammonium hydroxide Substances 0.000 description 10
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 10
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 10
- 239000012044 organic layer Substances 0.000 description 10
- 238000010791 quenching Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 9
- 235000017557 sodium bicarbonate Nutrition 0.000 description 9
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 8
- 102100034343 Integrase Human genes 0.000 description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- 108010092799 RNA-directed DNA polymerase Proteins 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 8
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 7
- 229910052794 bromium Inorganic materials 0.000 description 7
- 239000012230 colorless oil Substances 0.000 description 7
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 7
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 7
- 230000003612 virological effect Effects 0.000 description 7
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 6
- JYYNAJVZFGKDEQ-UHFFFAOYSA-N 2,4-Dimethylpyridine Chemical compound CC1=CC=NC(C)=C1 JYYNAJVZFGKDEQ-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 125000004122 cyclic group Chemical group 0.000 description 6
- FDSGHYHRLSWSLQ-UHFFFAOYSA-N dichloromethane;propan-2-one Chemical compound ClCCl.CC(C)=O FDSGHYHRLSWSLQ-UHFFFAOYSA-N 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- HBOMLICNUCNMMY-XLPZGREQSA-N zidovudine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](N=[N+]=[N-])C1 HBOMLICNUCNMMY-XLPZGREQSA-N 0.000 description 6
- 229960002555 zidovudine Drugs 0.000 description 6
- INZYSWIUDSCSEN-UHFFFAOYSA-N 1-(7-chlorofuro[2,3-c]pyridin-5-yl)ethanol Chemical compound ClC1=NC(C(O)C)=CC2=C1OC=C2 INZYSWIUDSCSEN-UHFFFAOYSA-N 0.000 description 5
- MKTLVFRYWOEUPJ-UHFFFAOYSA-N 2-formylpyridine-4-carbonitrile Chemical compound O=CC1=CC(C#N)=CC=N1 MKTLVFRYWOEUPJ-UHFFFAOYSA-N 0.000 description 5
- XHHACLYUUYLTNG-UHFFFAOYSA-N 4-amino-6-(trifluoromethyl)-1h-pyrimidine-2-thione;methanesulfonic acid Chemical compound CS(O)(=O)=O.NC=1C=C(C(F)(F)F)NC(=S)N=1 XHHACLYUUYLTNG-UHFFFAOYSA-N 0.000 description 5
- UAKMHSRHDUBNJR-UHFFFAOYSA-N 4-methylpyridine-2-carbaldehyde Chemical compound CC1=CC=NC(C=O)=C1 UAKMHSRHDUBNJR-UHFFFAOYSA-N 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- 150000005215 alkyl ethers Chemical class 0.000 description 5
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 239000011877 solvent mixture Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- QKPRMHFCRFIAPV-UHFFFAOYSA-N 1-(3-methylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound C1=NC(C(O)C)=CC2=C1OC=C2C QKPRMHFCRFIAPV-UHFFFAOYSA-N 0.000 description 4
- NBCAZGPKVFAFQA-UHFFFAOYSA-N 1-(6-chloro-4-iodo-5-prop-2-enylpyridin-2-yl)ethanol Chemical compound CC(O)C1=CC(I)=C(CC=C)C(Cl)=N1 NBCAZGPKVFAFQA-UHFFFAOYSA-N 0.000 description 4
- IZFJZDCDTSRECN-UHFFFAOYSA-N 1-furo[2,3-c]pyridin-5-ylethanol Chemical compound C1=NC(C(O)C)=CC2=C1OC=C2 IZFJZDCDTSRECN-UHFFFAOYSA-N 0.000 description 4
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 4
- 125000006018 1-methyl-ethenyl group Chemical group 0.000 description 4
- SZSMYQPIAAUBBY-UHFFFAOYSA-N 5,6,7,8-tetrahydroisoquinolin-3-ylmethanol Chemical compound C1CCCC2=C1C=C(CO)N=C2 SZSMYQPIAAUBBY-UHFFFAOYSA-N 0.000 description 4
- LKYJULOGVDGSLA-UHFFFAOYSA-N CC(C1(NC(I)=CC=C1O)Cl)O Chemical compound CC(C1(NC(I)=CC=C1O)Cl)O LKYJULOGVDGSLA-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 229910004298 SiO 2 Inorganic materials 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000004280 Sodium formate Substances 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 239000010779 crude oil Substances 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 238000010265 fast atom bombardment Methods 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229940098779 methanesulfonic acid Drugs 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 4
- 235000019254 sodium formate Nutrition 0.000 description 4
- 241001430294 unidentified retrovirus Species 0.000 description 4
- 230000029812 viral genome replication Effects 0.000 description 4
- QKPRMHFCRFIAPV-SSDOTTSWSA-N (1r)-1-(3-methylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound C1=NC([C@H](O)C)=CC2=C1OC=C2C QKPRMHFCRFIAPV-SSDOTTSWSA-N 0.000 description 3
- OTSGTSFKNBLRJL-UHFFFAOYSA-N 1-(1-chloroethyl)-5,6,7,8-tetrahydroisoquinoline Chemical compound C1CCCC2=C1C=CN=C2C(Cl)C OTSGTSFKNBLRJL-UHFFFAOYSA-N 0.000 description 3
- RFBHBTDIKWLGQZ-UHFFFAOYSA-N 1-(3-chlorofuro[2,3-c]pyridin-5-yl)ethanol Chemical compound C1=NC(C(O)C)=CC2=C1OC=C2Cl RFBHBTDIKWLGQZ-UHFFFAOYSA-N 0.000 description 3
- SYLKYMHRWOVBHM-UHFFFAOYSA-N 1-(7-chloro-2-methylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound ClC1=NC(C(O)C)=CC2=C1OC(C)=C2 SYLKYMHRWOVBHM-UHFFFAOYSA-N 0.000 description 3
- DICMOCZHXNYFNE-UHFFFAOYSA-N 1-(7-chloro-2-trimethylsilylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound ClC1=NC(C(O)C)=CC2=C1OC([Si](C)(C)C)=C2 DICMOCZHXNYFNE-UHFFFAOYSA-N 0.000 description 3
- KZKKFDHYNSLGFQ-UHFFFAOYSA-N 1-(7-chloro-3,3-dimethyl-2h-furo[2,3-c]pyridin-5-yl)ethanol Chemical compound ClC1=NC(C(O)C)=CC2=C1OCC2(C)C KZKKFDHYNSLGFQ-UHFFFAOYSA-N 0.000 description 3
- COSQXUHXIBZFHQ-UHFFFAOYSA-N 1-(7-chloro-3-ethylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound N1=C(C(C)O)C=C2C(CC)=COC2=C1Cl COSQXUHXIBZFHQ-UHFFFAOYSA-N 0.000 description 3
- JDKZQUWMXKRHGH-UHFFFAOYSA-N 1-(7-chloro-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)ethanol Chemical compound ClC1=NC(C(O)C)=CC2=C1OCC2C JDKZQUWMXKRHGH-UHFFFAOYSA-N 0.000 description 3
- JUPZWOCGJQVLQM-UHFFFAOYSA-N 1-(7-chloro-3-methylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound ClC1=NC(C(O)C)=CC2=C1OC=C2C JUPZWOCGJQVLQM-UHFFFAOYSA-N 0.000 description 3
- KUWAMVQGYIKZEF-UHFFFAOYSA-N 1-(7-chlorofuro[2,3-c]pyridin-5-yl)ethyl acetate Chemical compound ClC1=NC(C(OC(C)=O)C)=CC2=C1OC=C2 KUWAMVQGYIKZEF-UHFFFAOYSA-N 0.000 description 3
- HFGJNKGNQBJMIL-UHFFFAOYSA-N 1-furo[2,3-c]pyridin-5-ylethyl acetate Chemical compound C1=NC(C(OC(C)=O)C)=CC2=C1OC=C2 HFGJNKGNQBJMIL-UHFFFAOYSA-N 0.000 description 3
- YHTIGIWCSZNCTK-UHFFFAOYSA-N 2-[(3-bromophenyl)methylsulfanyl]-6-chloropyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(Br)C=CC=2)=N1 YHTIGIWCSZNCTK-UHFFFAOYSA-N 0.000 description 3
- UVGFRUBIRIRNOU-UHFFFAOYSA-N 2-chloro-6-(1-hydroxyethyl)-4-iodopyridin-3-ol Chemical compound CC(O)C1=CC(I)=C(O)C(Cl)=N1 UVGFRUBIRIRNOU-UHFFFAOYSA-N 0.000 description 3
- JLAUIFHDUVBHBT-UHFFFAOYSA-N 3-[(4-amino-6-chloropyrimidin-2-yl)sulfanylmethyl]phenol Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(O)C=CC=2)=N1 JLAUIFHDUVBHBT-UHFFFAOYSA-N 0.000 description 3
- CMFQXPIZAKBRCG-UHFFFAOYSA-N 4-tert-butyl-1-oxidopyridin-1-ium Chemical compound CC(C)(C)C1=CC=[N+]([O-])C=C1 CMFQXPIZAKBRCG-UHFFFAOYSA-N 0.000 description 3
- CIXKTUZKFSOTCT-UHFFFAOYSA-N 5,6,7,8-tetrahydroisoquinolin-1-ylmethanol Chemical compound C1CCCC2=C1C=CN=C2CO CIXKTUZKFSOTCT-UHFFFAOYSA-N 0.000 description 3
- AVPYNWUNEQDEIG-UHFFFAOYSA-N 5-(1-chloroethyl)-2-methylfuro[2,3-c]pyridine Chemical compound C1=NC(C(Cl)C)=CC2=C1OC(C)=C2 AVPYNWUNEQDEIG-UHFFFAOYSA-N 0.000 description 3
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 3
- QXVXXKPOVQCXED-UHFFFAOYSA-N 6-chloro-2-(1-pyridin-2-ylethylsulfanyl)pyrimidin-4-amine Chemical compound C=1C=CC=NC=1C(C)SC1=NC(N)=CC(Cl)=N1 QXVXXKPOVQCXED-UHFFFAOYSA-N 0.000 description 3
- MVZILPRZJGSLFX-UHFFFAOYSA-N 6-chloro-2-(naphthalen-2-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C3C=CC=CC3=CC=2)=N1 MVZILPRZJGSLFX-UHFFFAOYSA-N 0.000 description 3
- CGRXFBWZMUVYLS-UHFFFAOYSA-N 7-chloro-5-(1-chloroethyl)-2-methylfuro[2,3-c]pyridine Chemical compound ClC1=NC(C(Cl)C)=CC2=C1OC(C)=C2 CGRXFBWZMUVYLS-UHFFFAOYSA-N 0.000 description 3
- PKWYAUSUAUDBKJ-UHFFFAOYSA-N 7-chloro-5-(1-chloroethyl)-3,3-dimethyl-2h-furo[2,3-c]pyridine Chemical compound ClC1=NC(C(Cl)C)=CC2=C1OCC2(C)C PKWYAUSUAUDBKJ-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 3
- 238000003747 Grignard reaction Methods 0.000 description 3
- 241000713772 Human immunodeficiency virus 1 Species 0.000 description 3
- 102000019280 Pancreatic lipases Human genes 0.000 description 3
- 108050006759 Pancreatic lipases Proteins 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- 206010035664 Pneumonia Diseases 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- KMVYDQPRPWDODV-SNVBAGLBSA-N [(1r)-1-(3-methylfuro[2,3-c]pyridin-5-yl)ethyl] butanoate Chemical compound C1=NC([C@@H](C)OC(=O)CCC)=CC2=C1OC=C2C KMVYDQPRPWDODV-SNVBAGLBSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- ZYXBIOIYWUIXSM-UHFFFAOYSA-N furo[2,3-c]pyridine Chemical compound C1=NC=C2OC=CC2=C1 ZYXBIOIYWUIXSM-UHFFFAOYSA-N 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 238000003328 mesylation reaction Methods 0.000 description 3
- 229940116369 pancreatic lipase Drugs 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003230 pyrimidines Chemical class 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical class [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- TVBWXHIHUAWUDO-UHFFFAOYSA-N (4-ethylpyridin-2-yl)methanol Chemical compound CCC1=CC=NC(CO)=C1 TVBWXHIHUAWUDO-UHFFFAOYSA-N 0.000 description 2
- AIOQNFLGOFMATK-UHFFFAOYSA-N (4-tert-butylpyridin-2-yl)methanol Chemical compound CC(C)(C)C1=CC=NC(CO)=C1 AIOQNFLGOFMATK-UHFFFAOYSA-N 0.000 description 2
- AKNWJEDHHXQXIC-AATRIKPKSA-N (e)-4-chloro-n,n-diethylbut-2-enamide Chemical compound CCN(CC)C(=O)\C=C\CCl AKNWJEDHHXQXIC-AATRIKPKSA-N 0.000 description 2
- ZZPGFFRMBXEUQF-VOTSOKGWSA-N (e)-4-chloro-n,n-diethylpent-2-enamide Chemical compound CCN(CC)C(=O)\C=C\C(C)Cl ZZPGFFRMBXEUQF-VOTSOKGWSA-N 0.000 description 2
- ZUSAESZFJKLVPG-AATRIKPKSA-N (e)-4-chloro-n,n-dipropylbut-2-enamide Chemical compound CCCN(CCC)C(=O)\C=C\CCl ZUSAESZFJKLVPG-AATRIKPKSA-N 0.000 description 2
- AYUXFENPDFURJQ-VOTSOKGWSA-N (e)-n,n-diethyl-4-hydroxypent-2-enamide Chemical compound CCN(CC)C(=O)\C=C\C(C)O AYUXFENPDFURJQ-VOTSOKGWSA-N 0.000 description 2
- MWFWHHCCKXEVOT-VOTSOKGWSA-N (e)-n,n-diethyl-4-oxopent-2-enamide Chemical compound CCN(CC)C(=O)\C=C\C(C)=O MWFWHHCCKXEVOT-VOTSOKGWSA-N 0.000 description 2
- WLIADPFXSACYLS-RQOWECAXSA-N (z)-1,3-dichlorobut-2-ene Chemical compound C\C(Cl)=C\CCl WLIADPFXSACYLS-RQOWECAXSA-N 0.000 description 2
- 125000004605 1,2,3,4-tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 2
- RXNGXTVHIOVJKZ-UHFFFAOYSA-N 1-(1-chloroethyl)isoquinoline Chemical compound C1=CC=C2C(C(Cl)C)=NC=CC2=C1 RXNGXTVHIOVJKZ-UHFFFAOYSA-N 0.000 description 2
- JYFNMHJIINIGCN-UHFFFAOYSA-N 1-(2,3,7-trichloro-2,3-dihydrofuro[2,3-c]pyridin-5-yl)ethyl acetate Chemical compound ClC1=NC(C(OC(C)=O)C)=CC2=C1OC(Cl)C2Cl JYFNMHJIINIGCN-UHFFFAOYSA-N 0.000 description 2
- JNWISYUYZMKVEL-UHFFFAOYSA-N 1-(2,3-dibromo-2,3-dihydrofuro[2,3-c]pyridin-5-yl)ethyl acetate Chemical compound C1=NC(C(OC(C)=O)C)=CC2=C1OC(Br)C2Br JNWISYUYZMKVEL-UHFFFAOYSA-N 0.000 description 2
- BLCUVTDONSZMHI-UHFFFAOYSA-N 1-(2,3-dibromo-7-chloro-2,3-dihydrofuro[2,3-c]pyridin-5-yl)ethyl acetate Chemical compound ClC1=NC(C(OC(C)=O)C)=CC2=C1OC(Br)C2Br BLCUVTDONSZMHI-UHFFFAOYSA-N 0.000 description 2
- QPGDVGNKTLBNMR-UHFFFAOYSA-N 1-(2,3-dichloro-2,3-dihydrofuro[2,3-c]pyridin-5-yl)ethyl acetate Chemical compound C1=NC(C(OC(C)=O)C)=CC2=C1OC(Cl)C2Cl QPGDVGNKTLBNMR-UHFFFAOYSA-N 0.000 description 2
- ACXFKUJZBGVEGD-UHFFFAOYSA-N 1-(2-methylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound C1=NC(C(O)C)=CC2=C1OC(C)=C2 ACXFKUJZBGVEGD-UHFFFAOYSA-N 0.000 description 2
- AVENZYFJZDNGHH-UHFFFAOYSA-N 1-(3,3-dimethyl-2h-furo[2,3-c]pyridin-5-yl)ethanol Chemical compound C1=NC(C(O)C)=CC2=C1OCC2(C)C AVENZYFJZDNGHH-UHFFFAOYSA-N 0.000 description 2
- SSORKEJABLDCCK-UHFFFAOYSA-N 1-(3-bromo-7-chlorofuro[2,3-c]pyridin-5-yl)ethanol Chemical compound ClC1=NC(C(O)C)=CC2=C1OC=C2Br SSORKEJABLDCCK-UHFFFAOYSA-N 0.000 description 2
- BUJYTWPCSMEMGD-UHFFFAOYSA-N 1-(3-bromofuro[2,3-c]pyridin-5-yl)ethanol Chemical compound C1=NC(C(O)C)=CC2=C1OC=C2Br BUJYTWPCSMEMGD-UHFFFAOYSA-N 0.000 description 2
- TVHNDTLOOVITLK-UHFFFAOYSA-N 1-(3-ethylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound N1=C(C(C)O)C=C2C(CC)=COC2=C1 TVHNDTLOOVITLK-UHFFFAOYSA-N 0.000 description 2
- XUEBKWAOGVQQKN-UHFFFAOYSA-N 1-(3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)ethanol Chemical compound OC(C)C=1C=C2C(=CN=1)OCC2C XUEBKWAOGVQQKN-UHFFFAOYSA-N 0.000 description 2
- OQBLERKVYUOWSD-UHFFFAOYSA-N 1-(3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)ethyl acetate Chemical compound C1=NC(C(OC(C)=O)C)=CC2=C1OCC2C OQBLERKVYUOWSD-UHFFFAOYSA-N 0.000 description 2
- ILZXVZWSUYKYJU-UHFFFAOYSA-N 1-(3-propan-2-ylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound N1=C(C(C)O)C=C2C(C(C)C)=COC2=C1 ILZXVZWSUYKYJU-UHFFFAOYSA-N 0.000 description 2
- GIDIDSQDLDZIFB-UHFFFAOYSA-N 1-(4-ethyl-5-methoxypyridin-2-yl)ethanol Chemical compound CCC1=CC(C(C)O)=NC=C1OC GIDIDSQDLDZIFB-UHFFFAOYSA-N 0.000 description 2
- LUCMPRMHMZTCRR-UHFFFAOYSA-N 1-(4-tert-butylpyridin-2-yl)ethanol Chemical compound CC(O)C1=CC(C(C)(C)C)=CC=N1 LUCMPRMHMZTCRR-UHFFFAOYSA-N 0.000 description 2
- RWWOXIKUOBCQFQ-UHFFFAOYSA-N 1-(7-chloro-3-propan-2-ylfuro[2,3-c]pyridin-5-yl)ethanol Chemical compound N1=C(C(C)O)C=C2C(C(C)C)=COC2=C1Cl RWWOXIKUOBCQFQ-UHFFFAOYSA-N 0.000 description 2
- CGJRAHKCLLVTBS-UHFFFAOYSA-N 1-[4-(morpholin-4-ylmethyl)pyridin-2-yl]ethanol Chemical compound C1=NC(C(O)C)=CC(CN2CCOCC2)=C1 CGJRAHKCLLVTBS-UHFFFAOYSA-N 0.000 description 2
- JZSJHUHRTMTBPZ-UHFFFAOYSA-N 1-[6-chloro-4-iodo-5-(3-methylbut-2-enoxy)pyridin-2-yl]ethanol Chemical compound CC(O)C1=CC(I)=C(OCC=C(C)C)C(Cl)=N1 JZSJHUHRTMTBPZ-UHFFFAOYSA-N 0.000 description 2
- KVPWEPKQZVFAMW-UHFFFAOYSA-N 1-isoquinolin-1-ylethanol Chemical compound C1=CC=C2C(C(O)C)=NC=CC2=C1 KVPWEPKQZVFAMW-UHFFFAOYSA-N 0.000 description 2
- UBOQZJCKVLWPLH-UHFFFAOYSA-N 1-isoquinolin-1-ylethanone Chemical compound C1=CC=C2C(C(=O)C)=NC=CC2=C1 UBOQZJCKVLWPLH-UHFFFAOYSA-N 0.000 description 2
- NLMXNLJJYMMQIF-UHFFFAOYSA-N 1-isoquinolin-3-ylethanone Chemical compound C1=CC=C2C=NC(C(=O)C)=CC2=C1 NLMXNLJJYMMQIF-UHFFFAOYSA-N 0.000 description 2
- YEGKUCIVMMCZAS-UHFFFAOYSA-N 2-(1-chloroethyl)-4-ethyl-5-methoxypyridine Chemical compound CCC1=CC(C(C)Cl)=NC=C1OC YEGKUCIVMMCZAS-UHFFFAOYSA-N 0.000 description 2
- MMVBJOBTOMJNHE-UHFFFAOYSA-N 2-(hydroxymethyl)pyridine-4-carbonitrile Chemical compound OCC1=CC(C#N)=CC=N1 MMVBJOBTOMJNHE-UHFFFAOYSA-N 0.000 description 2
- RUCKWAMAIMEYLX-UHFFFAOYSA-N 2-(pyridin-3-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC=NC(SCC=2C=NC=CC=2)=N1 RUCKWAMAIMEYLX-UHFFFAOYSA-N 0.000 description 2
- CNCRMWAVZITOLY-UHFFFAOYSA-N 2-[(4-methoxyphenyl)methylsulfanyl]-6-(trifluoromethyl)-1h-pyrimidin-4-one Chemical compound C1=CC(OC)=CC=C1CSC1=NC(O)=CC(C(F)(F)F)=N1 CNCRMWAVZITOLY-UHFFFAOYSA-N 0.000 description 2
- OSSXOGKDVQWILL-UHFFFAOYSA-N 2-benzylsulfanyl-4,6-dichloropyrimidine Chemical compound ClC1=CC(Cl)=NC(SCC=2C=CC=CC=2)=N1 OSSXOGKDVQWILL-UHFFFAOYSA-N 0.000 description 2
- LGTXUPUULSWTNA-UHFFFAOYSA-N 2-benzylsulfanyl-6-chloropyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=CC=CC=2)=N1 LGTXUPUULSWTNA-UHFFFAOYSA-N 0.000 description 2
- LWKNLYDHINKVBS-UHFFFAOYSA-N 2-chloro-6-(1-chloroethyl)-4-ethenyl-3-methoxypyridine Chemical compound COC1=C(Cl)N=C(C(C)Cl)C=C1C=C LWKNLYDHINKVBS-UHFFFAOYSA-N 0.000 description 2
- VEMWJAFUPDTDJL-UHFFFAOYSA-N 2-chloro-6-(1-hydroxyethyl)-4-(2-trimethylsilylethynyl)pyridin-3-ol Chemical compound CC(O)C1=CC(C#C[Si](C)(C)C)=C(O)C(Cl)=N1 VEMWJAFUPDTDJL-UHFFFAOYSA-N 0.000 description 2
- RGFQXAVFTNUGGD-UHFFFAOYSA-N 2-chloro-6-(1-hydroxyethyl)pyridin-3-ol Chemical compound CC(O)C1=CC=C(O)C(Cl)=N1 RGFQXAVFTNUGGD-UHFFFAOYSA-N 0.000 description 2
- WQSIHSWWVYQVPV-UHFFFAOYSA-N 2-chloro-6-iodopyridin-3-ol Chemical compound OC1=CC=C(I)N=C1Cl WQSIHSWWVYQVPV-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- YZAOETRYQWFEOY-UHFFFAOYSA-N 2-sulfanylidene-6-(trifluoromethyl)-1h-pyrimidin-4-one Chemical compound FC(F)(F)C1=CC(=O)NC(=S)N1 YZAOETRYQWFEOY-UHFFFAOYSA-N 0.000 description 2
- OFGJGBASTVSCNO-UHFFFAOYSA-N 3-(1-chloroethyl)-5,6,7,8-tetrahydroisoquinoline Chemical compound C1CCCC2=C1C=C(C(Cl)C)N=C2 OFGJGBASTVSCNO-UHFFFAOYSA-N 0.000 description 2
- IYEVRLKBLZVKJX-UHFFFAOYSA-N 3-(1-chloroethyl)isoquinoline Chemical compound C1=CC=C2C=NC(C(Cl)C)=CC2=C1 IYEVRLKBLZVKJX-UHFFFAOYSA-N 0.000 description 2
- GQMJDZAIJJSISV-UHFFFAOYSA-N 3-bromo-5-(1-chloroethyl)furo[2,3-c]pyridine Chemical compound C1=NC(C(Cl)C)=CC2=C1OC=C2Br GQMJDZAIJJSISV-UHFFFAOYSA-N 0.000 description 2
- VUWSYWHLJSIRTB-UHFFFAOYSA-N 3-bromo-7-chloro-5-(1-chloroethyl)furo[2,3-c]pyridine Chemical compound ClC1=NC(C(Cl)C)=CC2=C1OC=C2Br VUWSYWHLJSIRTB-UHFFFAOYSA-N 0.000 description 2
- VKTBMSSSKZXRIJ-UHFFFAOYSA-N 3-chloro-5-(1-chloroethyl)furo[2,3-c]pyridine Chemical compound C1=NC(C(Cl)C)=CC2=C1OC=C2Cl VKTBMSSSKZXRIJ-UHFFFAOYSA-N 0.000 description 2
- DUFGYCAXVIUXIP-UHFFFAOYSA-N 4,6-dihydroxypyrimidine Chemical compound OC1=CC(O)=NC=N1 DUFGYCAXVIUXIP-UHFFFAOYSA-N 0.000 description 2
- ZDHKVKPZQKYREU-UHFFFAOYSA-N 4-(chloromethyl)pyridine;hydron;chloride Chemical compound Cl.ClCC1=CC=NC=C1 ZDHKVKPZQKYREU-UHFFFAOYSA-N 0.000 description 2
- GGBODKGBWZAAJD-UHFFFAOYSA-N 4-(diethylaminomethyl)pyridine-2-carbaldehyde Chemical compound CCN(CC)CC1=CC=NC(C=O)=C1 GGBODKGBWZAAJD-UHFFFAOYSA-N 0.000 description 2
- VFJRXOXKSUBBMR-UHFFFAOYSA-N 4-ethyl-1-oxidopyridin-1-ium Chemical compound CCC1=CC=[N+]([O-])C=C1 VFJRXOXKSUBBMR-UHFFFAOYSA-N 0.000 description 2
- PJTWJHFVBSRCMW-UHFFFAOYSA-N 4-ethylpyridine-2-carbaldehyde Chemical compound CCC1=CC=NC(C=O)=C1 PJTWJHFVBSRCMW-UHFFFAOYSA-N 0.000 description 2
- CBTYVTCBHBPVDW-UHFFFAOYSA-N 4-tert-butyl-2-(1-chloroethyl)pyridine Chemical compound CC(Cl)C1=CC(C(C)(C)C)=CC=N1 CBTYVTCBHBPVDW-UHFFFAOYSA-N 0.000 description 2
- CKNDWLWHZWBDGR-UHFFFAOYSA-N 4-tert-butylpyridine-2-carbaldehyde Chemical compound CC(C)(C)C1=CC=NC(C=O)=C1 CKNDWLWHZWBDGR-UHFFFAOYSA-N 0.000 description 2
- KWQXWPWIKUNAEO-UHFFFAOYSA-N 5,6,7,8-tetrahydroisoquinoline-3-carbaldehyde Chemical compound C1CCCC2=C1C=C(C=O)N=C2 KWQXWPWIKUNAEO-UHFFFAOYSA-N 0.000 description 2
- GAJDOBBUQHQBNJ-UHFFFAOYSA-N 5-(1-chloroethyl)-3,3-dimethyl-2h-furo[2,3-c]pyridine Chemical compound C1=NC(C(Cl)C)=CC2=C1OCC2(C)C GAJDOBBUQHQBNJ-UHFFFAOYSA-N 0.000 description 2
- MJJGTWVDTSWSGR-UHFFFAOYSA-N 5-(1-chloroethyl)-3-ethylfuro[2,3-c]pyridine Chemical compound N1=C(C(C)Cl)C=C2C(CC)=COC2=C1 MJJGTWVDTSWSGR-UHFFFAOYSA-N 0.000 description 2
- YWTYFERRQQIZDV-UHFFFAOYSA-N 5-(1-chloroethyl)-3-methylfuro[2,3-c]pyridine Chemical compound C1=NC(C(Cl)C)=CC2=C1OC=C2C YWTYFERRQQIZDV-UHFFFAOYSA-N 0.000 description 2
- XKOFGGUABLRRHW-UHFFFAOYSA-N 5-(1-chloroethyl)-3-propan-2-ylfuro[2,3-c]pyridine Chemical compound N1=C(C(C)Cl)C=C2C(C(C)C)=COC2=C1 XKOFGGUABLRRHW-UHFFFAOYSA-N 0.000 description 2
- HZHNVJWKHVMSBO-UHFFFAOYSA-N 5-(1-chloroethyl)furo[2,3-c]pyridine Chemical compound C1=NC(C(Cl)C)=CC2=C1OC=C2 HZHNVJWKHVMSBO-UHFFFAOYSA-N 0.000 description 2
- MJDXSLDHQYJHAT-UHFFFAOYSA-N 5-bromo-6-chloro-2-(1-isoquinolin-3-ylethylsulfanyl)pyrimidin-4-amine Chemical compound C=1C2=CC=CC=C2C=NC=1C(C)SC1=NC(N)=C(Br)C(Cl)=N1 MJDXSLDHQYJHAT-UHFFFAOYSA-N 0.000 description 2
- VGCYENIYHSOEES-UHFFFAOYSA-N 6-(hydroxyiminomethyl)-2-(naphthalen-2-ylmethylsulfanyl)-1h-pyrimidin-4-one Chemical compound ON=CC1=CC(O)=NC(SCC=2C=C3C=CC=CC3=CC=2)=N1 VGCYENIYHSOEES-UHFFFAOYSA-N 0.000 description 2
- RUTKPPAOFNYVDQ-UHFFFAOYSA-N 6-amino-2-[(2,6-difluorophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound NC1=CC(O)=NC(SCC=2C(=CC=CC=2F)F)=N1 RUTKPPAOFNYVDQ-UHFFFAOYSA-N 0.000 description 2
- HGMKPTMIKYAQRC-UHFFFAOYSA-N 6-chloro-2-(1-isoquinolin-1-ylethylsulfanyl)pyrimidin-4-amine Chemical compound N=1C=CC2=CC=CC=C2C=1C(C)SC1=NC(N)=CC(Cl)=N1 HGMKPTMIKYAQRC-UHFFFAOYSA-N 0.000 description 2
- HWDNYXIBKBXQSU-UHFFFAOYSA-N 6-chloro-2-(naphthalen-2-ylmethylsulfanyl)pyrimidine-4-carbonitrile Chemical compound ClC1=CC(C#N)=NC(SCC=2C=C3C=CC=CC3=CC=2)=N1 HWDNYXIBKBXQSU-UHFFFAOYSA-N 0.000 description 2
- NFSGGFQVZXEAQJ-UHFFFAOYSA-N 6-chloro-2-(pyridin-2-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2N=CC=CC=2)=N1 NFSGGFQVZXEAQJ-UHFFFAOYSA-N 0.000 description 2
- STUQITWXBMZUGY-UHFFFAOYSA-N 6-hydroxy-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound OC1=CC(O)=NC(S)=N1 STUQITWXBMZUGY-UHFFFAOYSA-N 0.000 description 2
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 2
- JHKXIGXXLUTUHY-UHFFFAOYSA-N 7-chloro-5-(1-chloroethyl)-3-ethylfuro[2,3-c]pyridine Chemical compound N1=C(C(C)Cl)C=C2C(CC)=COC2=C1Cl JHKXIGXXLUTUHY-UHFFFAOYSA-N 0.000 description 2
- RFNVORXDYVYXHO-UHFFFAOYSA-N 7-chloro-5-(1-chloroethyl)furo[2,3-c]pyridine Chemical compound ClC1=NC(C(Cl)C)=CC2=C1OC=C2 RFNVORXDYVYXHO-UHFFFAOYSA-N 0.000 description 2
- 206010001513 AIDS related complex Diseases 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- FXWYMYQHIUAEJF-UHFFFAOYSA-N CC(C(C=CN1O)=NC1Cl)O Chemical compound CC(C(C=CN1O)=NC1Cl)O FXWYMYQHIUAEJF-UHFFFAOYSA-N 0.000 description 2
- CVYQFVCOFIYBBS-GFCCVEGCSA-N CC1=COC2=CN=C(C=C12)[C@@H](C)OC(=O)C3=CC=CC=C3 Chemical compound CC1=COC2=CN=C(C=C12)[C@@H](C)OC(=O)C3=CC=CC=C3 CVYQFVCOFIYBBS-GFCCVEGCSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical group CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000004367 Lipase Substances 0.000 description 2
- 102000004882 Lipase Human genes 0.000 description 2
- 108090001060 Lipase Proteins 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical group CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XPXJFOGTIOMTAC-UHFFFAOYSA-N [4-(morpholin-4-ylmethyl)pyridin-2-yl]methanol Chemical compound C1=NC(CO)=CC(CN2CCOCC2)=C1 XPXJFOGTIOMTAC-UHFFFAOYSA-N 0.000 description 2
- 230000021736 acetylation Effects 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- UVJHQYIOXKWHFD-UHFFFAOYSA-N cyclohexa-1,4-diene Chemical compound C1C=CCC=C1 UVJHQYIOXKWHFD-UHFFFAOYSA-N 0.000 description 2
- JLBRRXOYUGIARO-UHFFFAOYSA-N cyclopropyl-(4-methylpyridin-2-yl)methanol Chemical compound CC1=CC=NC(C(O)C2CC2)=C1 JLBRRXOYUGIARO-UHFFFAOYSA-N 0.000 description 2
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 2
- LBOZPYNUPOEJDO-UHFFFAOYSA-N dichloromethane;hexane;propan-2-one Chemical compound ClCCl.CC(C)=O.CCCCCC LBOZPYNUPOEJDO-UHFFFAOYSA-N 0.000 description 2
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 2
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 230000007071 enzymatic hydrolysis Effects 0.000 description 2
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 229940040461 lipase Drugs 0.000 description 2
- 235000019421 lipase Nutrition 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 210000004698 lymphocyte Anatomy 0.000 description 2
- RWIKCBHOVNDESJ-NSCUHMNNSA-N methyl (e)-4-bromobut-2-enoate Chemical compound COC(=O)\C=C\CBr RWIKCBHOVNDESJ-NSCUHMNNSA-N 0.000 description 2
- GTSWGSZEDFAGCU-HWKANZROSA-N methyl (e)-4-hydroxy-3-methylbut-2-enoate Chemical compound COC(=O)\C=C(/C)CO GTSWGSZEDFAGCU-HWKANZROSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- WJIPIQALFYTIQL-UHFFFAOYSA-N n-ethyl-n-(pyridin-4-ylmethyl)ethanamine Chemical compound CCN(CC)CC1=CC=NC=C1 WJIPIQALFYTIQL-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 210000005259 peripheral blood Anatomy 0.000 description 2
- 239000011886 peripheral blood Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 2
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 2
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- SXCNHZRVUZDPDR-UHFFFAOYSA-N tert-butyl-[6-[tert-butyl(dimethyl)silyl]oxy-2-(1-pyridin-2-ylethylsulfanyl)pyrimidin-4-yl]oxy-dimethylsilane Chemical compound C=1C=CC=NC=1C(C)SC1=NC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=N1 SXCNHZRVUZDPDR-UHFFFAOYSA-N 0.000 description 2
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Natural products C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- PBLNHHSDYFYZNC-UHFFFAOYSA-N (1-naphthyl)methanol Chemical compound C1=CC=C2C(CO)=CC=CC2=C1 PBLNHHSDYFYZNC-UHFFFAOYSA-N 0.000 description 1
- PTACZYKVFNDEHZ-UHFFFAOYSA-N (2-benzylsulfanyl-6-chloropyrimidin-4-yl)hydrazine Chemical compound NNC1=CC(Cl)=NC(SCC=2C=CC=CC=2)=N1 PTACZYKVFNDEHZ-UHFFFAOYSA-N 0.000 description 1
- DOMQFIFVDIAOOT-ROUUACIJSA-N (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NN=C1C=1C=NC=C(C=1)C)NS(=O)(=O)[C@@H](C)[C@H](C)C1=NC=C(C=N1)C DOMQFIFVDIAOOT-ROUUACIJSA-N 0.000 description 1
- XLVOWGDFXAVSFE-UHFFFAOYSA-N (4-amino-2-methylsulfanylpyrimidin-5-yl)methanol Chemical class CSC1=NC=C(CO)C(N)=N1 XLVOWGDFXAVSFE-UHFFFAOYSA-N 0.000 description 1
- YWLXFZREPGYZAH-UHFFFAOYSA-N (4-methyl-3h-pyridin-4-yl)methanol Chemical compound OCC1(C)CC=NC=C1 YWLXFZREPGYZAH-UHFFFAOYSA-N 0.000 description 1
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 description 1
- VUOXNQPUPDHCQF-NSCUHMNNSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-1-(4-methylpiperazin-1-yl)but-2-en-1-one Chemical compound C1CN(C)CCN1C(=O)\C=C\CSC1=NC(N)=CC(Cl)=N1 VUOXNQPUPDHCQF-NSCUHMNNSA-N 0.000 description 1
- RGXUICXYKYYAAM-OWOJBTEDSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-1-morpholin-4-ylbut-2-en-1-one Chemical compound NC1=CC(Cl)=NC(SC\C=C\C(=O)N2CCOCC2)=N1 RGXUICXYKYYAAM-OWOJBTEDSA-N 0.000 description 1
- MYLWROYTHQFZIO-SNAWJCMRSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-1-piperidin-1-ylbut-2-en-1-one Chemical compound NC1=CC(Cl)=NC(SC\C=C\C(=O)N2CCCCC2)=N1 MYLWROYTHQFZIO-SNAWJCMRSA-N 0.000 description 1
- NRTBNQSBXMHVGW-ONEGZZNKSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylbut-2-en-1-one Chemical compound NC1=CC(Cl)=NC(SC\C=C\C(=O)N2CCCC2)=N1 NRTBNQSBXMHVGW-ONEGZZNKSA-N 0.000 description 1
- PUIUVVGYMSCPOK-VOTSOKGWSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-n,n-diethylpent-2-enamide Chemical compound CCN(CC)C(=O)\C=C\C(C)SC1=NC(N)=CC(Cl)=N1 PUIUVVGYMSCPOK-VOTSOKGWSA-N 0.000 description 1
- ATRVJRPEWVFALJ-ONEGZZNKSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-n,n-dimethylbut-2-enamide Chemical compound CN(C)C(=O)\C=C\CSC1=NC(N)=CC(Cl)=N1 ATRVJRPEWVFALJ-ONEGZZNKSA-N 0.000 description 1
- PHGVNFROCBOAKH-AATRIKPKSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-n,n-dipropylbut-2-enamide Chemical compound CCCN(CCC)C(=O)\C=C\CSC1=NC(N)=CC(Cl)=N1 PHGVNFROCBOAKH-AATRIKPKSA-N 0.000 description 1
- SMEXPIBTHBJCLQ-SNAWJCMRSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-n-ethyl-n-methylbut-2-enamide Chemical compound CCN(C)C(=O)\C=C\CSC1=NC(N)=CC(Cl)=N1 SMEXPIBTHBJCLQ-SNAWJCMRSA-N 0.000 description 1
- OXAMUOPONHOTQY-ONEGZZNKSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-n-ethylbut-2-enamide Chemical compound CCNC(=O)\C=C\CSC1=NC(N)=CC(Cl)=N1 OXAMUOPONHOTQY-ONEGZZNKSA-N 0.000 description 1
- NFFRAWAVUUTJPZ-VMPITWQZSA-N (e)-4-(4-amino-6-chloropyrimidin-2-yl)sulfanyl-n-methyl-n-phenylbut-2-enamide Chemical compound C=1C=CC=CC=1N(C)C(=O)\C=C\CSC1=NC(N)=CC(Cl)=N1 NFFRAWAVUUTJPZ-VMPITWQZSA-N 0.000 description 1
- DOTGZROJTAUYFQ-OWOJBTEDSA-N (e)-4-bromobut-2-enoic acid Chemical compound OC(=O)\C=C\CBr DOTGZROJTAUYFQ-OWOJBTEDSA-N 0.000 description 1
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 1
- GOKUKIRFOQPVFI-NSCUHMNNSA-N (e)-4-oxopent-2-enoyl chloride Chemical compound CC(=O)\C=C\C(Cl)=O GOKUKIRFOQPVFI-NSCUHMNNSA-N 0.000 description 1
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 1
- JTFKFVCGQRTWGL-UHFFFAOYSA-N 1,2-dimethyl-2h-pyridine Chemical compound CC1C=CC=CN1C JTFKFVCGQRTWGL-UHFFFAOYSA-N 0.000 description 1
- YXDDMLUWLYLLJB-UHFFFAOYSA-N 1-(3,7-dichloro-2,3-dihydrofuro[2,3-c]pyridin-5-yl)ethyl acetate Chemical compound ClC1=NC(C(OC(C)=O)C)=CC2=C1OCC2Cl YXDDMLUWLYLLJB-UHFFFAOYSA-N 0.000 description 1
- OORDFIRMNJHEOO-UHFFFAOYSA-N 1-(5,6,7,8-tetrahydroisoquinolin-1-yl)ethanol Chemical compound C1CCCC2=C1C=CN=C2C(O)C OORDFIRMNJHEOO-UHFFFAOYSA-N 0.000 description 1
- QAEFILGGGDHXLU-UHFFFAOYSA-N 1-(5-but-2-enoxy-6-chloro-4-iodopyridin-2-yl)ethanol Chemical compound CC=CCOC1=C(Cl)N=C(C(C)O)C=C1I QAEFILGGGDHXLU-UHFFFAOYSA-N 0.000 description 1
- BHHKZTXFFAEPHB-UHFFFAOYSA-N 1-(6-chloro-4-ethenyl-5-methoxypyridin-2-yl)ethanol Chemical compound COC1=C(Cl)N=C(C(C)O)C=C1C=C BHHKZTXFFAEPHB-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical group CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- HBOMLICNUCNMMY-UHFFFAOYSA-N 1-[4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione Chemical compound O=C1NC(=O)C(C)=CN1C1OC(CO)C(N=[N+]=[N-])C1 HBOMLICNUCNMMY-UHFFFAOYSA-N 0.000 description 1
- JKXQKGNGJVZKFA-UHFFFAOYSA-N 1-chloro-3-methylbut-2-ene Chemical compound CC(C)=CCCl JKXQKGNGJVZKFA-UHFFFAOYSA-N 0.000 description 1
- PLYRGGHWPHUPEM-UHFFFAOYSA-N 1-ethyl-5,6,7,8-tetrahydroisoquinoline Chemical compound C1(=NC=CC=2CCCCC1=2)CC PLYRGGHWPHUPEM-UHFFFAOYSA-N 0.000 description 1
- AHFNTGSCVZVNPP-UHFFFAOYSA-N 1-isoquinolin-3-ylethanol Chemical compound C1=CC=C2C=NC(C(O)C)=CC2=C1 AHFNTGSCVZVNPP-UHFFFAOYSA-N 0.000 description 1
- AXRKCRWZRKETCK-UHFFFAOYSA-N 1-naphthalen-2-ylethanol Chemical compound C1=CC=CC2=CC(C(O)C)=CC=C21 AXRKCRWZRKETCK-UHFFFAOYSA-N 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- DEXWRCYOMLUJRF-UHFFFAOYSA-N 2,2,2-trifluoroethyl butanoate Chemical compound CCCC(=O)OCC(F)(F)F DEXWRCYOMLUJRF-UHFFFAOYSA-N 0.000 description 1
- UPVBKNZVOJNQKE-UHFFFAOYSA-N 2,6-dichloropyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(Cl)=N1 UPVBKNZVOJNQKE-UHFFFAOYSA-N 0.000 description 1
- WFTXDZRSIFDCTL-UHFFFAOYSA-N 2-(1-benzofuran-2-ylmethylsulfanyl)-6-chloropyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2OC3=CC=CC=C3C=2)=N1 WFTXDZRSIFDCTL-UHFFFAOYSA-N 0.000 description 1
- ZHBVIIQZRLPHGH-UHFFFAOYSA-N 2-(1-chloroethyl)pyridine Chemical compound CC(Cl)C1=CC=CC=N1 ZHBVIIQZRLPHGH-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- XDWDZVRFZPKLAK-UHFFFAOYSA-N 2-(aziridin-1-yl)pyrimidine Chemical class C1CN1C1=NC=CC=N1 XDWDZVRFZPKLAK-UHFFFAOYSA-N 0.000 description 1
- LSXJPJGBWSZHTM-UHFFFAOYSA-N 2-(bromomethyl)-1,3-difluorobenzene Chemical compound FC1=CC=CC(F)=C1CBr LSXJPJGBWSZHTM-UHFFFAOYSA-N 0.000 description 1
- RUHJZSZTSCSTCC-UHFFFAOYSA-N 2-(bromomethyl)naphthalene Chemical compound C1=CC=CC2=CC(CBr)=CC=C21 RUHJZSZTSCSTCC-UHFFFAOYSA-N 0.000 description 1
- BZKATHXEDHDATI-UHFFFAOYSA-N 2-(naphthalen-2-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC=NC(SCC=2C=C3C=CC=CC3=CC=2)=N1 BZKATHXEDHDATI-UHFFFAOYSA-N 0.000 description 1
- BLCSQUZTWKPKSR-UHFFFAOYSA-N 2-(propan-2-ylamino)phenol Chemical compound CC(C)NC1=CC=CC=C1O BLCSQUZTWKPKSR-UHFFFAOYSA-N 0.000 description 1
- FARVROKMPNUOAB-UHFFFAOYSA-N 2-(pyridin-2-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC=NC(SCC=2N=CC=CC=2)=N1 FARVROKMPNUOAB-UHFFFAOYSA-N 0.000 description 1
- VXZQVFNSIKLGOX-UHFFFAOYSA-N 2-[(3-bromophenyl)methoxy]-6-chloropyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(OCC=2C=C(Br)C=CC=2)=N1 VXZQVFNSIKLGOX-UHFFFAOYSA-N 0.000 description 1
- LENRSFSADDLPRJ-UHFFFAOYSA-N 2-[(3-bromophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC=NC(SCC=2C=C(Br)C=CC=2)=N1 LENRSFSADDLPRJ-UHFFFAOYSA-N 0.000 description 1
- VERBVDKGZLOZQD-UHFFFAOYSA-N 2-[(3-bromophenyl)methylsulfinyl]-6-chloropyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(S(=O)CC=2C=C(Br)C=CC=2)=N1 VERBVDKGZLOZQD-UHFFFAOYSA-N 0.000 description 1
- UDKQCNPSQXVKKZ-UHFFFAOYSA-N 2-[(3-bromophenyl)methylsulfonyl]-6-chloropyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(S(=O)(=O)CC=2C=C(Br)C=CC=2)=N1 UDKQCNPSQXVKKZ-UHFFFAOYSA-N 0.000 description 1
- YDFRADMMKNLUDF-UHFFFAOYSA-N 2-[(4-chlorophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC=NC(SCC=2C=CC(Cl)=CC=2)=N1 YDFRADMMKNLUDF-UHFFFAOYSA-N 0.000 description 1
- QMJAZRGQAFDFIW-UHFFFAOYSA-N 2-[(4-tert-butylphenyl)methylsulfanyl]-6-chloropyrimidin-4-amine Chemical compound C1=CC(C(C)(C)C)=CC=C1CSC1=NC(N)=CC(Cl)=N1 QMJAZRGQAFDFIW-UHFFFAOYSA-N 0.000 description 1
- YLYZJPBURSJFQK-UHFFFAOYSA-N 2-[1-(3-bromo-7-chlorofuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-chloropyrimidin-4-amine Chemical compound C=1C=2C(Br)=COC=2C(Cl)=NC=1C(C)SC1=NC(N)=CC(Cl)=N1 YLYZJPBURSJFQK-UHFFFAOYSA-N 0.000 description 1
- CQYPVOKJYXDJRT-UHFFFAOYSA-N 2-[1-(3-bromofuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-chloropyrimidin-4-amine Chemical compound C=1C=2C(Br)=COC=2C=NC=1C(C)SC1=NC(N)=CC(Cl)=N1 CQYPVOKJYXDJRT-UHFFFAOYSA-N 0.000 description 1
- KAQJFCYQAIWDLQ-UHFFFAOYSA-N 2-[chloro(cyclopropyl)methyl]-4-methylpyridine Chemical compound CC1=CC=NC(C(Cl)C2CC2)=C1 KAQJFCYQAIWDLQ-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- GWVZTHHWOCCVOY-UHFFFAOYSA-N 2-benzylsulfanyl-6-chloro-5-cyclohexylpyrimidin-4-amine Chemical compound N=1C(Cl)=C(C2CCCCC2)C(N)=NC=1SCC1=CC=CC=C1 GWVZTHHWOCCVOY-UHFFFAOYSA-N 0.000 description 1
- RDNJGNNLUKOCFD-UHFFFAOYSA-N 2-benzylsulfanyl-6-chloro-5-propan-2-ylpyrimidin-4-amine Chemical compound N1=C(Cl)C(C(C)C)=C(N)N=C1SCC1=CC=CC=C1 RDNJGNNLUKOCFD-UHFFFAOYSA-N 0.000 description 1
- RBONDWMXFXJLNK-UHFFFAOYSA-N 2-benzylsulfanyl-6-chloro-n-propylpyrimidin-4-amine Chemical compound CCCNC1=CC(Cl)=NC(SCC=2C=CC=CC=2)=N1 RBONDWMXFXJLNK-UHFFFAOYSA-N 0.000 description 1
- JLCHIORNNYBWFD-UHFFFAOYSA-N 2-benzylsulfanylpyrimidin-4-amine Chemical compound NC1=CC=NC(SCC=2C=CC=CC=2)=N1 JLCHIORNNYBWFD-UHFFFAOYSA-N 0.000 description 1
- AYNTXICLWNGOHZ-UHFFFAOYSA-N 2-benzylsulfanylpyrimidine Chemical class C=1C=CC=CC=1CSC1=NC=CC=N1 AYNTXICLWNGOHZ-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- RSOPTYAZDFSMTN-UHFFFAOYSA-N 2-chloropyridin-3-ol Chemical compound OC1=CC=CN=C1Cl RSOPTYAZDFSMTN-UHFFFAOYSA-N 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- OCWVONVWBVXUPE-UHFFFAOYSA-N 2-isoquinolin-3-ylethanol Chemical compound C1=CC=C2C=NC(CCO)=CC2=C1 OCWVONVWBVXUPE-UHFFFAOYSA-N 0.000 description 1
- CNBASZQNOKRYDU-UHFFFAOYSA-N 2-methylfuro[2,3-c]pyridine Chemical compound C1=NC=C2OC(C)=CC2=C1 CNBASZQNOKRYDU-UHFFFAOYSA-N 0.000 description 1
- AQEYJNQCMXIBFF-UHFFFAOYSA-N 2-oxido-5,6,7,8-tetrahydroisoquinolin-2-ium Chemical compound C1CCCC2=C[N+]([O-])=CC=C21 AQEYJNQCMXIBFF-UHFFFAOYSA-N 0.000 description 1
- WYTQEBFRBDRPOE-UHFFFAOYSA-N 2-oxooxolane-3-carbonitrile Chemical compound O=C1OCCC1C#N WYTQEBFRBDRPOE-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- RVBUGGBMJDPOST-UHFFFAOYSA-N 2-thiobarbituric acid Chemical compound O=C1CC(=O)NC(=S)N1 RVBUGGBMJDPOST-UHFFFAOYSA-N 0.000 description 1
- WWPCFIMXKVMWRA-UHFFFAOYSA-N 3,7-dichloro-5-(1-chloroethyl)furo[2,3-c]pyridine Chemical compound ClC1=NC(C(Cl)C)=CC2=C1OC=C2Cl WWPCFIMXKVMWRA-UHFFFAOYSA-N 0.000 description 1
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 1
- USEGQJLHQSTGHW-UHFFFAOYSA-N 3-bromo-2-methylprop-1-ene Chemical compound CC(=C)CBr USEGQJLHQSTGHW-UHFFFAOYSA-N 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical class C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- LIQBKSIZAXKCPA-UHFFFAOYSA-N 4,4,4-trifluoro-3-oxobutanoic acid Chemical compound OC(=O)CC(=O)C(F)(F)F LIQBKSIZAXKCPA-UHFFFAOYSA-N 0.000 description 1
- XUKABXYVEUMVRY-UHFFFAOYSA-N 4,4-diethoxy-3-oxobutanoic acid Chemical compound CCOC(OCC)C(=O)CC(O)=O XUKABXYVEUMVRY-UHFFFAOYSA-N 0.000 description 1
- XJPZKYIHCLDXST-UHFFFAOYSA-N 4,6-dichloropyrimidine Chemical compound ClC1=CC(Cl)=NC=N1 XJPZKYIHCLDXST-UHFFFAOYSA-N 0.000 description 1
- ZYFMSVSPGODTCZ-UHFFFAOYSA-N 4-(4-methylpyridin-2-yl)morpholine Chemical compound CC1=CC=NC(N2CCOCC2)=C1 ZYFMSVSPGODTCZ-UHFFFAOYSA-N 0.000 description 1
- LOONFRKFJPYULD-UHFFFAOYSA-N 4-(dimethylamino)-3-methylbenzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1C LOONFRKFJPYULD-UHFFFAOYSA-N 0.000 description 1
- XEVBJIMAQAPHBB-UHFFFAOYSA-N 4-(pyridin-4-ylmethyl)morpholine Chemical compound C=1C=NC=CC=1CN1CCOCC1 XEVBJIMAQAPHBB-UHFFFAOYSA-N 0.000 description 1
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 1
- CCXFGZMBHYAPST-UHFFFAOYSA-N 4-[2-(1-chloroethyl)-3-methylpyridin-4-yl]morpholine Chemical compound ClC(C)C1=NC=CC(=C1C)N1CCOCC1 CCXFGZMBHYAPST-UHFFFAOYSA-N 0.000 description 1
- XYWIPYBIIRTJMM-IBGZPJMESA-N 4-[[(2S)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide Chemical compound CC[C@H](N1C=C(OC)C(=CC1=O)C1=C(C=CC(Cl)=C1)N1C=C(N=N1)C(F)(F)F)C(=O)NC1=CC(F)=C(C=C1)C(N)=O XYWIPYBIIRTJMM-IBGZPJMESA-N 0.000 description 1
- QFJODJRRUFIQDU-UHFFFAOYSA-N 4-amino-6-(trifluoromethyl)-1h-pyrimidine-2-thione Chemical compound NC1=CC(C(F)(F)F)=NC(S)=N1 QFJODJRRUFIQDU-UHFFFAOYSA-N 0.000 description 1
- 150000003928 4-aminopyridines Chemical class 0.000 description 1
- LMYLEZYGXCVCEY-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)pyridine Chemical compound ClCC1=CC(Cl)=CC=N1 LMYLEZYGXCVCEY-UHFFFAOYSA-N 0.000 description 1
- VGCGSEDTQNWNGB-UHFFFAOYSA-N 4-chloro-2-(naphthalen-2-ylmethylsulfanyl)pyrimidine Chemical compound ClC1=CC=NC(SCC=2C=C3C=CC=CC3=CC=2)=N1 VGCGSEDTQNWNGB-UHFFFAOYSA-N 0.000 description 1
- DAOZBJCTEPJGES-UHFFFAOYSA-N 4-chloro-2-methylpyridine Chemical compound CC1=CC(Cl)=CC=N1 DAOZBJCTEPJGES-UHFFFAOYSA-N 0.000 description 1
- OASSVVXWWNCBTP-UHFFFAOYSA-N 4-hydroxy-2-(1-pyridin-2-ylethylsulfanyl)-1h-pyrimidin-6-one;hydrochloride Chemical compound Cl.C=1C=CC=NC=1C(C)SC1=NC(O)=CC(O)=N1 OASSVVXWWNCBTP-UHFFFAOYSA-N 0.000 description 1
- RTLUPHDWSUGAOS-UHFFFAOYSA-N 4-iodopyridine Chemical compound IC1=CC=NC=C1 RTLUPHDWSUGAOS-UHFFFAOYSA-N 0.000 description 1
- IWYYIZOHWPCALJ-UHFFFAOYSA-N 4-methyl-1-oxidopyridin-1-ium Chemical compound CC1=CC=[N+]([O-])C=C1 IWYYIZOHWPCALJ-UHFFFAOYSA-N 0.000 description 1
- FILVPVLQGMBYPS-UHFFFAOYSA-N 4-methyl-2-pentylpyridine Chemical compound CCCCCC1=CC(C)=CC=N1 FILVPVLQGMBYPS-UHFFFAOYSA-N 0.000 description 1
- YSHMQTRICHYLGF-UHFFFAOYSA-N 4-tert-butylpyridine Chemical compound CC(C)(C)C1=CC=NC=C1 YSHMQTRICHYLGF-UHFFFAOYSA-N 0.000 description 1
- RFOUJHDITIMDEU-UHFFFAOYSA-N 5,6,7,8-tetrahydroisoquinoline-1-carbaldehyde Chemical compound C1CCCC2=C1C=CN=C2C=O RFOUJHDITIMDEU-UHFFFAOYSA-N 0.000 description 1
- YPXFJZNHGBGQDN-UHFFFAOYSA-N 5-bromo-6-chloro-2-(naphthalen-2-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound ClC1=C(Br)C(N)=NC(SCC=2C=C3C=CC=CC3=CC=2)=N1 YPXFJZNHGBGQDN-UHFFFAOYSA-N 0.000 description 1
- ATYKKJLCXVTUOQ-UHFFFAOYSA-N 5-bromo-6-chloro-2-(pyridin-2-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound ClC1=C(Br)C(N)=NC(SCC=2N=CC=CC=2)=N1 ATYKKJLCXVTUOQ-UHFFFAOYSA-N 0.000 description 1
- DCPSTSVLRXOYGS-UHFFFAOYSA-N 6-amino-1h-pyrimidine-2-thione Chemical compound NC1=CC=NC(S)=N1 DCPSTSVLRXOYGS-UHFFFAOYSA-N 0.000 description 1
- JYOQBUHQQIXBSZ-UHFFFAOYSA-N 6-amino-2-(naphthalen-1-ylmethylsulfanyl)-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=CC2=CC=CC=C12 JYOQBUHQQIXBSZ-UHFFFAOYSA-N 0.000 description 1
- NNEYLRCRBRXTEG-UHFFFAOYSA-N 6-amino-2-(naphthalen-2-ylmethylsulfanyl)-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=C(C=CC=C2)C2=C1 NNEYLRCRBRXTEG-UHFFFAOYSA-N 0.000 description 1
- JRJPTRXIDHZLCN-UHFFFAOYSA-N 6-amino-2-(pyridin-2-ylmethylsulfanyl)-1h-pyrimidin-4-one Chemical compound NC1=CC(O)=NC(SCC=2N=CC=CC=2)=N1 JRJPTRXIDHZLCN-UHFFFAOYSA-N 0.000 description 1
- TZUFMZVYFIMKSU-UHFFFAOYSA-N 6-amino-2-(pyridin-3-ylmethylsulfanyl)-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=CN=C1 TZUFMZVYFIMKSU-UHFFFAOYSA-N 0.000 description 1
- YPPZLUOULDDGLT-UHFFFAOYSA-N 6-amino-2-(quinolin-2-ylmethylsulfanyl)-1h-pyrimidin-4-one Chemical compound NC1=CC(O)=NC(SCC=2N=C3C=CC=CC3=CC=2)=N1 YPPZLUOULDDGLT-UHFFFAOYSA-N 0.000 description 1
- AEOOHSADGKNJGL-UHFFFAOYSA-N 6-amino-2-[(2,4-dichlorophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=C(Cl)C=C1Cl AEOOHSADGKNJGL-UHFFFAOYSA-N 0.000 description 1
- JCGSUAADGPAKEI-UHFFFAOYSA-N 6-amino-2-[(2-methylphenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound CC1=CC=CC=C1CSC1=NC(=O)C=C(N)N1 JCGSUAADGPAKEI-UHFFFAOYSA-N 0.000 description 1
- FOQZOSIYDZLRDP-UHFFFAOYSA-N 6-amino-2-[(3,4-dichlorophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=C(Cl)C(Cl)=C1 FOQZOSIYDZLRDP-UHFFFAOYSA-N 0.000 description 1
- NFTGKXRLSVQCJZ-UHFFFAOYSA-N 6-amino-2-[(3,4-difluorophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound NC1=CC(O)=NC(SCC=2C=C(F)C(F)=CC=2)=N1 NFTGKXRLSVQCJZ-UHFFFAOYSA-N 0.000 description 1
- JDMGQEJHOQIOFF-UHFFFAOYSA-N 6-amino-2-[(3,5-dichlorophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound NC1=CC(O)=NC(SCC=2C=C(Cl)C=C(Cl)C=2)=N1 JDMGQEJHOQIOFF-UHFFFAOYSA-N 0.000 description 1
- GJPRMOUJVPHXDS-UHFFFAOYSA-N 6-amino-2-[(3-bromophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=CC(Br)=C1 GJPRMOUJVPHXDS-UHFFFAOYSA-N 0.000 description 1
- ATGRTSBOPIQKIQ-UHFFFAOYSA-N 6-amino-2-[(3-chlorophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=CC(Cl)=C1 ATGRTSBOPIQKIQ-UHFFFAOYSA-N 0.000 description 1
- SDDAMIXOOQOSSV-UHFFFAOYSA-N 6-amino-2-[(3-fluorophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound NC1=CC(O)=NC(SCC=2C=C(F)C=CC=2)=N1 SDDAMIXOOQOSSV-UHFFFAOYSA-N 0.000 description 1
- ZDYZFFCQCPNZOQ-UHFFFAOYSA-N 6-amino-2-[(3-iodophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound NC1=CC(O)=NC(SCC=2C=C(I)C=CC=2)=N1 ZDYZFFCQCPNZOQ-UHFFFAOYSA-N 0.000 description 1
- UYHWBKGKIYCBDL-UHFFFAOYSA-N 6-amino-2-[(3-methoxyphenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound COC1=CC=CC(CSC=2NC(N)=CC(=O)N=2)=C1 UYHWBKGKIYCBDL-UHFFFAOYSA-N 0.000 description 1
- UHECSNHORITUGX-UHFFFAOYSA-N 6-amino-2-[(3-methylphenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound CC1=CC=CC(CSC=2NC(N)=CC(=O)N=2)=C1 UHECSNHORITUGX-UHFFFAOYSA-N 0.000 description 1
- LQTLRIOLQJCKMY-UHFFFAOYSA-N 6-amino-2-[(3-nitrophenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=CC([N+]([O-])=O)=C1 LQTLRIOLQJCKMY-UHFFFAOYSA-N 0.000 description 1
- LNIDSBAQPOYYHJ-UHFFFAOYSA-N 6-amino-2-[(4-methoxyphenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound C1=CC(OC)=CC=C1CSC1=NC(=O)C=C(N)N1 LNIDSBAQPOYYHJ-UHFFFAOYSA-N 0.000 description 1
- OQQZKAPKMXBJSE-UHFFFAOYSA-N 6-amino-2-[(4-methylphenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound C1=CC(C)=CC=C1CSC1=NC(=O)C=C(N)N1 OQQZKAPKMXBJSE-UHFFFAOYSA-N 0.000 description 1
- ASEDNWCJVUADNB-UHFFFAOYSA-N 6-amino-2-[(4-tert-butylphenyl)methylsulfanyl]-1h-pyrimidin-4-one Chemical compound C1=CC(C(C)(C)C)=CC=C1CSC1=NC(=O)C=C(N)N1 ASEDNWCJVUADNB-UHFFFAOYSA-N 0.000 description 1
- WFYVTFACCADNKN-QPJJXVBHSA-N 6-amino-2-[(e)-3-phenylprop-2-enyl]sulfanyl-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SC\C=C\C1=CC=CC=C1 WFYVTFACCADNKN-QPJJXVBHSA-N 0.000 description 1
- NXQRZFRTOJLVKG-UHFFFAOYSA-N 6-amino-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=CC(C(F)(F)F)=C1 NXQRZFRTOJLVKG-UHFFFAOYSA-N 0.000 description 1
- USCKGDQJCBTIGK-UHFFFAOYSA-N 6-amino-2-benzylsulfanyl-1h-pyrimidin-4-one Chemical compound N1C(N)=CC(=O)N=C1SCC1=CC=CC=C1 USCKGDQJCBTIGK-UHFFFAOYSA-N 0.000 description 1
- UKXQMTBWSNRWHW-UHFFFAOYSA-N 6-amino-2-benzylsulfanyl-5-cyclohexyl-1h-pyrimidin-4-one Chemical compound N=1C(O)=C(C2CCCCC2)C(N)=NC=1SCC1=CC=CC=C1 UKXQMTBWSNRWHW-UHFFFAOYSA-N 0.000 description 1
- FZWKRWSDTLCGIL-UHFFFAOYSA-N 6-amino-2-benzylsulfanyl-5-propan-2-yl-1h-pyrimidin-4-one Chemical compound N1=C(O)C(C(C)C)=C(N)N=C1SCC1=CC=CC=C1 FZWKRWSDTLCGIL-UHFFFAOYSA-N 0.000 description 1
- CYRHUKQVXWTRFJ-UHFFFAOYSA-N 6-amino-2-prop-2-ynylsulfanyl-1h-pyrimidin-4-one Chemical compound NC1=CC(=O)N=C(SCC#C)N1 CYRHUKQVXWTRFJ-UHFFFAOYSA-N 0.000 description 1
- BWYGMIYEADAIGW-UHFFFAOYSA-N 6-amino-2-sulfanylidene-1h-pyrimidin-4-one;hydrate Chemical compound O.NC1=CC(=O)NC(=S)N1 BWYGMIYEADAIGW-UHFFFAOYSA-N 0.000 description 1
- LVPUYQNGJWIYIM-UHFFFAOYSA-N 6-chloro-2-(2-pyridin-2-ylpropan-2-ylsulfanyl)pyrimidin-4-amine Chemical compound C=1C=CC=NC=1C(C)(C)SC1=NC(N)=CC(Cl)=N1 LVPUYQNGJWIYIM-UHFFFAOYSA-N 0.000 description 1
- SOEZDSNYOSVNHO-UHFFFAOYSA-N 6-chloro-2-(3,4-dihydronaphthalen-1-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C3=CC=CC=C3CCC=2)=N1 SOEZDSNYOSVNHO-UHFFFAOYSA-N 0.000 description 1
- RIGHIDQIRPHWLF-UHFFFAOYSA-N 6-chloro-2-(isoquinolin-3-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2N=CC3=CC=CC=C3C=2)=N1 RIGHIDQIRPHWLF-UHFFFAOYSA-N 0.000 description 1
- ZZZZVQYIUQRCGN-UHFFFAOYSA-N 6-chloro-2-(naphthalen-1-ylmethoxy)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(OCC=2C3=CC=CC=C3C=CC=2)=N1 ZZZZVQYIUQRCGN-UHFFFAOYSA-N 0.000 description 1
- LAVQIPXXNQAWAT-UHFFFAOYSA-N 6-chloro-2-(naphthalen-1-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C3=CC=CC=C3C=CC=2)=N1 LAVQIPXXNQAWAT-UHFFFAOYSA-N 0.000 description 1
- UGRQTQUIODULAJ-UHFFFAOYSA-N 6-chloro-2-(naphthalen-2-ylmethoxy)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(OCC=2C=C3C=CC=CC3=CC=2)=N1 UGRQTQUIODULAJ-UHFFFAOYSA-N 0.000 description 1
- XVEKUXWUWKCKCI-UHFFFAOYSA-N 6-chloro-2-(naphthalen-2-ylmethylsulfinyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(S(=O)CC=2C=C3C=CC=CC3=CC=2)=N1 XVEKUXWUWKCKCI-UHFFFAOYSA-N 0.000 description 1
- HKXSMXCJWKLILG-UHFFFAOYSA-N 6-chloro-2-(pyridin-3-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=NC=CC=2)=N1 HKXSMXCJWKLILG-UHFFFAOYSA-N 0.000 description 1
- AZBFKPDKOVGBQU-UHFFFAOYSA-N 6-chloro-2-(quinolin-2-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2N=C3C=CC=CC3=CC=2)=N1 AZBFKPDKOVGBQU-UHFFFAOYSA-N 0.000 description 1
- STCQBHMIHLQXFY-UHFFFAOYSA-N 6-chloro-2-(quinolin-4-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C3=CC=CC=C3N=CC=2)=N1 STCQBHMIHLQXFY-UHFFFAOYSA-N 0.000 description 1
- FWQIBIQIJZYAQV-UHFFFAOYSA-N 6-chloro-2-(quinolin-5-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C3=CC=CN=C3C=CC=2)=N1 FWQIBIQIJZYAQV-UHFFFAOYSA-N 0.000 description 1
- OCIGFFURHFDQSI-UHFFFAOYSA-N 6-chloro-2-(quinolin-6-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C3C=CC=NC3=CC=2)=N1 OCIGFFURHFDQSI-UHFFFAOYSA-N 0.000 description 1
- IZOXUXCFHJSPMN-UHFFFAOYSA-N 6-chloro-2-(quinolin-8-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C3=NC=CC=C3C=CC=2)=N1 IZOXUXCFHJSPMN-UHFFFAOYSA-N 0.000 description 1
- CFVZTPVNXIJZTE-UHFFFAOYSA-N 6-chloro-2-(quinoxalin-2-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2N=C3C=CC=CC3=NC=2)=N1 CFVZTPVNXIJZTE-UHFFFAOYSA-N 0.000 description 1
- DACCRIAOWPHTII-FJXQXJEOSA-N 6-chloro-2-[(1S)-1-furo[2,3-c]pyridin-5-ylethyl]sulfanylpyrimidin-4-amine methanesulfonic acid Chemical compound CS(O)(=O)=O.C[C@H](Sc1nc(N)cc(Cl)n1)c1cc2ccoc2cn1 DACCRIAOWPHTII-FJXQXJEOSA-N 0.000 description 1
- YWDXFEGBJPHBCP-UHFFFAOYSA-N 6-chloro-2-[(2,4-dichlorophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C(=CC(Cl)=CC=2)Cl)=N1 YWDXFEGBJPHBCP-UHFFFAOYSA-N 0.000 description 1
- AMAYOJMYNREBMU-UHFFFAOYSA-N 6-chloro-2-[(2-cyclohexylpyridin-3-yl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C(=NC=CC=2)C2CCCCC2)=N1 AMAYOJMYNREBMU-UHFFFAOYSA-N 0.000 description 1
- XWSGTKOTXQBHFS-UHFFFAOYSA-N 6-chloro-2-[(2-methylphenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound CC1=CC=CC=C1CSC1=NC(N)=CC(Cl)=N1 XWSGTKOTXQBHFS-UHFFFAOYSA-N 0.000 description 1
- AQYOTWSRQYZHTF-UHFFFAOYSA-N 6-chloro-2-[(2-thiophen-3-ylpyridin-3-yl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C(=NC=CC=2)C2=CSC=C2)=N1 AQYOTWSRQYZHTF-UHFFFAOYSA-N 0.000 description 1
- NSVFGNUFNKUOQL-UHFFFAOYSA-N 6-chloro-2-[(3,4-dichlorophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(Cl)C(Cl)=CC=2)=N1 NSVFGNUFNKUOQL-UHFFFAOYSA-N 0.000 description 1
- VZGUZRMROMVEIV-UHFFFAOYSA-N 6-chloro-2-[(3,4-difluorophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(F)C(F)=CC=2)=N1 VZGUZRMROMVEIV-UHFFFAOYSA-N 0.000 description 1
- YTXLOXIBLDHOBZ-UHFFFAOYSA-N 6-chloro-2-[(3,5-dichlorophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(Cl)C=C(Cl)C=2)=N1 YTXLOXIBLDHOBZ-UHFFFAOYSA-N 0.000 description 1
- XLZPAEFOPLTJNT-UHFFFAOYSA-N 6-chloro-2-[(3-chlorophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(Cl)C=CC=2)=N1 XLZPAEFOPLTJNT-UHFFFAOYSA-N 0.000 description 1
- WIKDEYYWRPXJDM-UHFFFAOYSA-N 6-chloro-2-[(3-fluorophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(F)C=CC=2)=N1 WIKDEYYWRPXJDM-UHFFFAOYSA-N 0.000 description 1
- VBECYBPCLCAMRD-UHFFFAOYSA-N 6-chloro-2-[(3-iodophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(I)C=CC=2)=N1 VBECYBPCLCAMRD-UHFFFAOYSA-N 0.000 description 1
- UNDHAVDDZLESST-UHFFFAOYSA-N 6-chloro-2-[(3-methoxyphenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound COC1=CC=CC(CSC=2N=C(Cl)C=C(N)N=2)=C1 UNDHAVDDZLESST-UHFFFAOYSA-N 0.000 description 1
- UYKAJHPFUAEHPN-UHFFFAOYSA-N 6-chloro-2-[(3-methylphenyl)methoxy]pyrimidin-4-amine Chemical compound CC1=CC=CC(COC=2N=C(Cl)C=C(N)N=2)=C1 UYKAJHPFUAEHPN-UHFFFAOYSA-N 0.000 description 1
- MCZLKCYGCXKUNC-UHFFFAOYSA-N 6-chloro-2-[(3-methylphenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound CC1=CC=CC(CSC=2N=C(Cl)C=C(N)N=2)=C1 MCZLKCYGCXKUNC-UHFFFAOYSA-N 0.000 description 1
- RFMXDHBNGHEXFU-UHFFFAOYSA-N 6-chloro-2-[(3-methylpyrazin-2-yl)methylsulfanyl]pyrimidin-4-amine Chemical compound CC1=NC=CN=C1CSC1=NC(N)=CC(Cl)=N1 RFMXDHBNGHEXFU-UHFFFAOYSA-N 0.000 description 1
- ASXYCNFLYLWXDB-UHFFFAOYSA-N 6-chloro-2-[(3-nitrophenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(C=CC=2)[N+]([O-])=O)=N1 ASXYCNFLYLWXDB-UHFFFAOYSA-N 0.000 description 1
- IZFGJVDJKRJUGL-UHFFFAOYSA-N 6-chloro-2-[(3-propan-2-yloxyphenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound CC(C)OC1=CC=CC(CSC=2N=C(Cl)C=C(N)N=2)=C1 IZFGJVDJKRJUGL-UHFFFAOYSA-N 0.000 description 1
- ZWEYIYJISZVPTC-UHFFFAOYSA-N 6-chloro-2-[(4,6-dimethylpyridin-2-yl)methylsulfanyl]pyrimidin-4-amine Chemical compound CC1=CC(C)=NC(CSC=2N=C(Cl)C=C(N)N=2)=C1 ZWEYIYJISZVPTC-UHFFFAOYSA-N 0.000 description 1
- KUTRVVSIHNRWAF-UHFFFAOYSA-N 6-chloro-2-[(4-methoxy-6-methylpyridin-2-yl)methylsulfanyl]pyrimidin-4-amine Chemical compound COC1=CC(C)=NC(CSC=2N=C(Cl)C=C(N)N=2)=C1 KUTRVVSIHNRWAF-UHFFFAOYSA-N 0.000 description 1
- NFKIZZKKEXHBNB-UHFFFAOYSA-N 6-chloro-2-[(4-methoxyphenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound C1=CC(OC)=CC=C1CSC1=NC(N)=CC(Cl)=N1 NFKIZZKKEXHBNB-UHFFFAOYSA-N 0.000 description 1
- NNWHGVXNYVGMIR-UHFFFAOYSA-N 6-chloro-2-[(4-methylphenyl)methylsulfanyl]pyrimidin-4-amine Chemical compound C1=CC(C)=CC=C1CSC1=NC(N)=CC(Cl)=N1 NNWHGVXNYVGMIR-UHFFFAOYSA-N 0.000 description 1
- ABKGSNIVIKLRCZ-UHFFFAOYSA-N 6-chloro-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyrimidin-4-amine Chemical compound O1C(C)=CC(CSC=2N=C(Cl)C=C(N)N=2)=N1 ABKGSNIVIKLRCZ-UHFFFAOYSA-N 0.000 description 1
- AKQIZEXWEGEPQR-UHFFFAOYSA-N 6-chloro-2-[(6,7-difluoronaphthalen-2-yl)methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C3C=C(F)C(F)=CC3=CC=2)=N1 AKQIZEXWEGEPQR-UHFFFAOYSA-N 0.000 description 1
- RSQHKWMPESVBLV-UHFFFAOYSA-N 6-chloro-2-[(6-methylpyrazin-2-yl)methylsulfanyl]pyrimidin-4-amine Chemical compound CC1=CN=CC(CSC=2N=C(Cl)C=C(N)N=2)=N1 RSQHKWMPESVBLV-UHFFFAOYSA-N 0.000 description 1
- YGSYQZYLTRZBAS-QPJJXVBHSA-N 6-chloro-2-[(e)-3-phenylprop-2-enyl]sulfanylpyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SC\C=C\C=2C=CC=CC=2)=N1 YGSYQZYLTRZBAS-QPJJXVBHSA-N 0.000 description 1
- RXOHQVPYXXNPED-SREVYHEPSA-N 6-chloro-2-[(z)-2-phenylethenyl]sulfanylpyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(S\C=C/C=2C=CC=CC=2)=N1 RXOHQVPYXXNPED-SREVYHEPSA-N 0.000 description 1
- YMHQKOULGDCVBJ-UHFFFAOYSA-N 6-chloro-2-[1-(3,7-dichlorofuro[2,3-c]pyridin-5-yl)ethylsulfanyl]pyrimidin-4-amine Chemical compound C=1C=2C(Cl)=COC=2C(Cl)=NC=1C(C)SC1=NC(N)=CC(Cl)=N1 YMHQKOULGDCVBJ-UHFFFAOYSA-N 0.000 description 1
- ZGUHYIFXFNYIIN-UHFFFAOYSA-N 6-chloro-2-[1-(3-ethylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]pyrimidin-4-amine Chemical compound C1=C2C(CC)=COC2=CN=C1C(C)SC1=NC(N)=CC(Cl)=N1 ZGUHYIFXFNYIIN-UHFFFAOYSA-N 0.000 description 1
- KDGPDSWJVBHQAB-UHFFFAOYSA-N 6-chloro-2-[1-(3-propan-2-ylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]pyrimidin-4-amine Chemical compound C1=C2C(C(C)C)=COC2=CN=C1C(C)SC1=NC(N)=CC(Cl)=N1 KDGPDSWJVBHQAB-UHFFFAOYSA-N 0.000 description 1
- KTKFXWAQSYBERP-UHFFFAOYSA-N 6-chloro-2-[1-(4-methylpyridin-2-yl)ethylsulfanyl]pyrimidin-4-amine Chemical compound C=1C(C)=CC=NC=1C(C)SC1=NC(N)=CC(Cl)=N1 KTKFXWAQSYBERP-UHFFFAOYSA-N 0.000 description 1
- WXFBXJOTFOGSTO-UHFFFAOYSA-N 6-chloro-2-[1-(7-chloro-3-ethylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]pyrimidin-4-amine Chemical compound C1=C2C(CC)=COC2=C(Cl)N=C1C(C)SC1=NC(N)=CC(Cl)=N1 WXFBXJOTFOGSTO-UHFFFAOYSA-N 0.000 description 1
- HGEYIUSIVVAMOH-UHFFFAOYSA-N 6-chloro-2-[1-(7-chloro-3-methylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]pyrimidin-4-amine Chemical compound C=1C=2C(C)=COC=2C(Cl)=NC=1C(C)SC1=NC(N)=CC(Cl)=N1 HGEYIUSIVVAMOH-UHFFFAOYSA-N 0.000 description 1
- WCQVMSVJEKQETD-UHFFFAOYSA-N 6-chloro-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]pyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC=2C=C(C=CC=2)C(F)(F)F)=N1 WCQVMSVJEKQETD-UHFFFAOYSA-N 0.000 description 1
- BUISFZQPCMDWPP-UHFFFAOYSA-N 6-chloro-2-phenylmethoxypyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(OCC=2C=CC=CC=2)=N1 BUISFZQPCMDWPP-UHFFFAOYSA-N 0.000 description 1
- NUJOMCSGSFAGPF-UHFFFAOYSA-N 6-chloro-2-prop-2-ynylsulfanylpyrimidin-4-amine Chemical compound NC1=CC(Cl)=NC(SCC#C)=N1 NUJOMCSGSFAGPF-UHFFFAOYSA-N 0.000 description 1
- MJBHXDFKCLORPP-UHFFFAOYSA-N 6-chloro-5-fluoro-2-(pyridin-2-ylmethylsulfanyl)pyrimidin-4-amine Chemical compound ClC1=C(F)C(N)=NC(SCC=2N=CC=CC=2)=N1 MJBHXDFKCLORPP-UHFFFAOYSA-N 0.000 description 1
- LNCHIATVMLHEHC-UHFFFAOYSA-N 7-chloro-5-(1-chloroethyl)-3-methylfuro[2,3-c]pyridine Chemical compound ClC1=NC(C(Cl)C)=CC2=C1OC=C2C LNCHIATVMLHEHC-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- ZGXJTSGNIOSYLO-UHFFFAOYSA-N 88755TAZ87 Chemical compound NCC(=O)CCC(O)=O ZGXJTSGNIOSYLO-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 1
- 108700032845 Ala(2)- enkephalinamide-Met Proteins 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 102220534042 Angiopoietin-related protein 3_K65N_mutation Human genes 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- MCLUWFMEWAFGPN-UHFFFAOYSA-N C(C1=CC=CC=C1)SC1=NC(=CC(=C1)N)O Chemical compound C(C1=CC=CC=C1)SC1=NC(=CC(=C1)N)O MCLUWFMEWAFGPN-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 206010007134 Candida infections Diseases 0.000 description 1
- NNOHEQDLDOEXRK-UHFFFAOYSA-N ClC1(NC(=CC=C1CC(=C)C)I)C(C)O Chemical compound ClC1(NC(=CC=C1CC(=C)C)I)C(C)O NNOHEQDLDOEXRK-UHFFFAOYSA-N 0.000 description 1
- YZQOCOLBOFDPCU-UHFFFAOYSA-N ClC1(NC=CC(=C1O)I)C(C)O Chemical compound ClC1(NC=CC(=C1O)I)C(C)O YZQOCOLBOFDPCU-UHFFFAOYSA-N 0.000 description 1
- MEVAADBIYFPAPJ-UHFFFAOYSA-N ClC1=NC(=NC(=C1)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 Chemical compound ClC1=NC(=NC(=C1)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 MEVAADBIYFPAPJ-UHFFFAOYSA-N 0.000 description 1
- ODPAKIHZNHMBBU-UHFFFAOYSA-N ClC1=NC(=NC(=C1C)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 Chemical compound ClC1=NC(=NC(=C1C)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 ODPAKIHZNHMBBU-UHFFFAOYSA-N 0.000 description 1
- WJCOSLZHDMOBCX-UHFFFAOYSA-N ClC1=NC=NC=C1SCC1=CC=CC=C1 Chemical compound ClC1=NC=NC=C1SCC1=CC=CC=C1 WJCOSLZHDMOBCX-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 108020001019 DNA Primers Proteins 0.000 description 1
- 239000003155 DNA primer Substances 0.000 description 1
- 108010033174 Deoxycytidine kinase Proteins 0.000 description 1
- 102100029588 Deoxycytidine kinase Human genes 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 201000002563 Histoplasmosis Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 206010023076 Isosporiasis Diseases 0.000 description 1
- 208000007766 Kaposi sarcoma Diseases 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-L L-tartrate(2-) Chemical compound [O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O FEWJPZIEWOKRBE-JCYAYHJZSA-L 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- BVIAOQMSVZHOJM-UHFFFAOYSA-N N(6),N(6)-dimethyladenine Chemical class CN(C)C1=NC=NC2=C1N=CN2 BVIAOQMSVZHOJM-UHFFFAOYSA-N 0.000 description 1
- FEYNFHSRETUBEM-UHFFFAOYSA-N N-[3-(1,1-difluoroethyl)phenyl]-1-(4-methoxyphenyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide Chemical compound COc1ccc(cc1)N1N=C(C)C(C(=O)Nc2cccc(c2)C(C)(F)F)C1=O FEYNFHSRETUBEM-UHFFFAOYSA-N 0.000 description 1
- 102220570933 N-acetylgalactosamine-6-sulfatase_M41L_mutation Human genes 0.000 description 1
- HEMUUBNINAHGPX-UHFFFAOYSA-N N1(CCOCC1)C1=CC(=NC=C1)C.C(#N)C1=CC(=NC=C1)CO Chemical compound N1(CCOCC1)C1=CC(=NC=C1)C.C(#N)C1=CC(=NC=C1)CO HEMUUBNINAHGPX-UHFFFAOYSA-N 0.000 description 1
- IWQHWPCDYYXONY-UHFFFAOYSA-N NC1=NC(=NC(=C1)Cl)SCC1=C=CCCC1 Chemical compound NC1=NC(=NC(=C1)Cl)SCC1=C=CCCC1 IWQHWPCDYYXONY-UHFFFAOYSA-N 0.000 description 1
- GZQVEOZCQSPEGK-UHFFFAOYSA-N NC1=NC(=NC(=C1)Cl)SCC=1C(=NC=CC1)C1=C(C=CC=C1Cl)Cl Chemical compound NC1=NC(=NC(=C1)Cl)SCC=1C(=NC=CC1)C1=C(C=CC=C1Cl)Cl GZQVEOZCQSPEGK-UHFFFAOYSA-N 0.000 description 1
- DKZVASPIHFMMIH-UHFFFAOYSA-N NC1=NC(=NC(=C1C)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 Chemical compound NC1=NC(=NC(=C1C)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 DKZVASPIHFMMIH-UHFFFAOYSA-N 0.000 description 1
- UAICYOOZVGHWGC-UHFFFAOYSA-N NC1=NC(=NC(=C1F)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 Chemical compound NC1=NC(=NC(=C1F)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 UAICYOOZVGHWGC-UHFFFAOYSA-N 0.000 description 1
- DWYOMVSUEBAOSS-UHFFFAOYSA-N NC1=NC(=NC(=C1OC)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 Chemical compound NC1=NC(=NC(=C1OC)Cl)SC(C1=CC=CC=C1)C1=CC2=CC=CC=C2C=C1 DWYOMVSUEBAOSS-UHFFFAOYSA-N 0.000 description 1
- VYXISWUHKDJLMQ-UHFFFAOYSA-N NC1=NC(=NC=C1)SCC1=CC=C(C=C1)C Chemical compound NC1=NC(=NC=C1)SCC1=CC=C(C=C1)C VYXISWUHKDJLMQ-UHFFFAOYSA-N 0.000 description 1
- MPTQDVPEGQNPST-UHFFFAOYSA-N NC1=NC=NC(=C1SCC1=CC(=CC(=C1)Br)Br)Cl Chemical compound NC1=NC=NC(=C1SCC1=CC(=CC(=C1)Br)Br)Cl MPTQDVPEGQNPST-UHFFFAOYSA-N 0.000 description 1
- FHYJUEIRZBADRV-UHFFFAOYSA-N NC1=NC=NC(=C1SCC1=CC(=CC(=C1)Br)Br)O Chemical compound NC1=NC=NC(=C1SCC1=CC(=CC(=C1)Br)Br)O FHYJUEIRZBADRV-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 102220506560 Sphingosine-1-phosphate phosphatase 1_K67L_mutation Human genes 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- DAAZCYSTVWBRPH-UHFFFAOYSA-N [4-(diethylaminomethyl)pyridin-2-yl]methanol Chemical compound CCN(CC)CC1=CC=NC(CO)=C1 DAAZCYSTVWBRPH-UHFFFAOYSA-N 0.000 description 1
- QTSXDKLFNSWKJW-UHFFFAOYSA-N [4-[(dimethylamino)methyl]pyridin-2-yl]methanol Chemical compound CN(C)CC1=CC=NC(CO)=C1 QTSXDKLFNSWKJW-UHFFFAOYSA-N 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000002259 anti human immunodeficiency virus agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000001626 borono group Chemical group [H]OB([*])O[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 201000003984 candidiasis Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- DGLFSNZWRYADFC-UHFFFAOYSA-N chembl2334586 Chemical compound C1CCC2=CN=C(N)N=C2C2=C1NC1=CC=C(C#CC(C)(O)C)C=C12 DGLFSNZWRYADFC-UHFFFAOYSA-N 0.000 description 1
- 238000000451 chemical ionisation Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- YTKRILODNOEEPX-NSCUHMNNSA-N crotyl chloride Chemical compound C\C=C\CCl YTKRILODNOEEPX-NSCUHMNNSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 201000008167 cystoisosporiasis Diseases 0.000 description 1
- LHUZAYREVYDAGJ-UHFFFAOYSA-N dichloromethane;ethyl acetate;methanol Chemical compound OC.ClCCl.CCOC(C)=O LHUZAYREVYDAGJ-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- LTOHTVPCWUZTJY-UHFFFAOYSA-N ethoxyethane;ethyl acetate;hexane Chemical compound CCOCC.CCCCCC.CCOC(C)=O LTOHTVPCWUZTJY-UHFFFAOYSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical group CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000003574 free electron Substances 0.000 description 1
- 230000001408 fungistatic effect Effects 0.000 description 1
- 239000002044 hexane fraction Substances 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- TVZISJTYELEYPI-UHFFFAOYSA-N hypodiphosphoric acid Chemical compound OP(O)(=O)P(O)(O)=O TVZISJTYELEYPI-UHFFFAOYSA-N 0.000 description 1
- 208000033065 inborn errors of immunity Diseases 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- HJHXYSBRTVFEDD-UHFFFAOYSA-N isoquinoline-1-carbonitrile Chemical compound C1=CC=C2C(C#N)=NC=CC2=C1 HJHXYSBRTVFEDD-UHFFFAOYSA-N 0.000 description 1
- GXXBVBVNGMCFIU-UHFFFAOYSA-N isoquinoline-3-carbonitrile Chemical compound C1=CC=C2C=NC(C#N)=CC2=C1 GXXBVBVNGMCFIU-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- VFZXMEQGIIWBFJ-UHFFFAOYSA-M magnesium;cyclopropane;bromide Chemical compound [Mg+2].[Br-].C1C[CH-]1 VFZXMEQGIIWBFJ-UHFFFAOYSA-M 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-L malate(2-) Chemical compound [O-]C(=O)C(O)CC([O-])=O BJEPYKJPYRNKOW-UHFFFAOYSA-L 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 229960002523 mercuric chloride Drugs 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- KAHBYMZNRWVCAQ-SNAWJCMRSA-N methyl (e)-4-chloro-3-methylpent-2-enoate Chemical compound COC(=O)\C=C(/C)C(C)Cl KAHBYMZNRWVCAQ-SNAWJCMRSA-N 0.000 description 1
- HVZYNAMDXGRPBS-NSCUHMNNSA-N methyl (e)-4-chlorobut-2-enoate Chemical compound COC(=O)\C=C\CCl HVZYNAMDXGRPBS-NSCUHMNNSA-N 0.000 description 1
- PCNYRJWGVAAVRB-UHFFFAOYSA-N methyl 3-[(6-amino-4-oxo-1h-pyrimidin-2-yl)sulfanylmethyl]benzoate Chemical compound COC(=O)C1=CC=CC(CSC=2N=C(O)C=C(N)N=2)=C1 PCNYRJWGVAAVRB-UHFFFAOYSA-N 0.000 description 1
- LSEFCHWGJNHZNT-UHFFFAOYSA-M methyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 LSEFCHWGJNHZNT-UHFFFAOYSA-M 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 1
- QYZFTMMPKCOTAN-UHFFFAOYSA-N n-[2-(2-hydroxyethylamino)ethyl]-2-[[1-[2-(2-hydroxyethylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide Chemical compound OCCNCCNC(=O)C(C)(C)N=NC(C)(C)C(=O)NCCNCCO QYZFTMMPKCOTAN-UHFFFAOYSA-N 0.000 description 1
- NNKPHNTWNILINE-UHFFFAOYSA-N n-cyclopropyl-3-fluoro-4-methyl-5-[3-[[1-[2-[2-(methylamino)ethoxy]phenyl]cyclopropyl]amino]-2-oxopyrazin-1-yl]benzamide Chemical compound CNCCOC1=CC=CC=C1C1(NC=2C(N(C=3C(=C(F)C=C(C=3)C(=O)NC3CC3)C)C=CN=2)=O)CC1 NNKPHNTWNILINE-UHFFFAOYSA-N 0.000 description 1
- IOXXVNYDGIXMIP-UHFFFAOYSA-N n-methylprop-2-en-1-amine Chemical group CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 1
- ZTHRQJQJODGZHV-UHFFFAOYSA-N n-phenylpropanamide Chemical compound CCC(=O)NC1=CC=CC=C1 ZTHRQJQJODGZHV-UHFFFAOYSA-N 0.000 description 1
- 239000002777 nucleoside Substances 0.000 description 1
- 150000003833 nucleoside derivatives Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- LZMJNVRJMFMYQS-UHFFFAOYSA-N poseltinib Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NC(OC=2C=C(NC(=O)C=C)C=CC=2)=C(OC=C2)C2=N1 LZMJNVRJMFMYQS-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 208000028529 primary immunodeficiency disease Diseases 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- GPHQHTOMRSGBNZ-UHFFFAOYSA-N pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC=C1 GPHQHTOMRSGBNZ-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000006513 pyridinyl methyl group Chemical group 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical class OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- 230000001177 retroviral effect Effects 0.000 description 1
- 239000003419 rna directed dna polymerase inhibitor Substances 0.000 description 1
- 102200009479 rs141772938 Human genes 0.000 description 1
- 102200131341 rs267607614 Human genes 0.000 description 1
- 102200069353 rs8103142 Human genes 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- MZIYQMVHASXABC-UHFFFAOYSA-N tetrakis(ethenyl)stannane Chemical compound C=C[Sn](C=C)(C=C)C=C MZIYQMVHASXABC-UHFFFAOYSA-N 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 1
- ULYLMHUHFUQKOE-UHFFFAOYSA-N trimethyl(prop-2-ynyl)silane Chemical compound C[Si](C)(C)CC#C ULYLMHUHFUQKOE-UHFFFAOYSA-N 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/519—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim ortho- or peri-condensed with heterocyclic rings
- A61K31/525—Isoalloxazines, e.g. riboflavins, vitamin B2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/14—Antivirals for RNA viruses
- A61P31/18—Antivirals for RNA viruses for HIV
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/38—One sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/56—One oxygen atom and one sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/60—Three or more oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Virology (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Oncology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Communicable Diseases (AREA)
- AIDS & HIV (AREA)
- Tropical Medicine & Parasitology (AREA)
- Molecular Biology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US43670895A | 1995-05-08 | 1995-05-08 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CZ349197A3 CZ349197A3 (cs) | 1998-04-15 |
| CZ293135B6 true CZ293135B6 (cs) | 2004-02-18 |
Family
ID=23733510
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CZ19973491A CZ293135B6 (cs) | 1995-05-08 | 1996-05-03 | Použití alfa-substituované pyrimidin-thioalkylové nebo alkyletherové sloučeniny pro léčení HIV pozitivních jednotlivců |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US6043248A (enExample) |
| EP (2) | EP1449835A3 (enExample) |
| JP (1) | JPH11507017A (enExample) |
| KR (1) | KR100445498B1 (enExample) |
| CN (2) | CN1535958A (enExample) |
| AT (1) | ATE275550T1 (enExample) |
| AU (1) | AU712404B2 (enExample) |
| BR (1) | BR9608265A (enExample) |
| CA (1) | CA2216099C (enExample) |
| CZ (1) | CZ293135B6 (enExample) |
| DE (1) | DE69633332T2 (enExample) |
| ES (1) | ES2227586T3 (enExample) |
| GE (1) | GEP20002297B (enExample) |
| HU (1) | HUP9801995A3 (enExample) |
| IL (1) | IL118075A0 (enExample) |
| MX (1) | MX9708582A (enExample) |
| NO (1) | NO310287B1 (enExample) |
| NZ (1) | NZ307089A (enExample) |
| PL (1) | PL323240A1 (enExample) |
| PT (1) | PT824524E (enExample) |
| RU (1) | RU2167155C2 (enExample) |
| SK (1) | SK150297A3 (enExample) |
| TW (1) | TW450962B (enExample) |
| UA (1) | UA56992C2 (enExample) |
| WO (1) | WO1996035678A1 (enExample) |
| ZA (1) | ZA963281B (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2301800A1 (en) * | 1997-09-25 | 1999-04-22 | Pharmacia & Upjohn Company | Thioalkyl alpha substituted pyrimidine compounds |
| US6111111A (en) | 1997-10-23 | 2000-08-29 | Kuraray Co., Ltd. | Intermediates for producing pyridine derivatives |
| US7358254B2 (en) | 2001-07-13 | 2008-04-15 | Bristol-Myers Squibb Company | Method for treating atherosclerosis employing an aP2 inhibitor and combination |
| KR20010079842A (ko) | 1998-09-17 | 2001-08-22 | 스티븐 비. 데이비스 | aP2 억제제 또는 조합을 사용한 아테롬성동맥경화증의치료 방법 |
| ATE253915T1 (de) | 1999-06-30 | 2003-11-15 | Merck & Co Inc | Src-kinase hemmende verbindungen |
| JP2003503351A (ja) | 1999-06-30 | 2003-01-28 | メルク エンド カムパニー インコーポレーテッド | Srcキナーゼ阻害化合物 |
| US6316444B1 (en) | 1999-06-30 | 2001-11-13 | Merck & Co., Inc. | SRC kinase inhibitor compounds |
| US7138404B2 (en) * | 2001-05-23 | 2006-11-21 | Hoffmann-La Roche Inc. | 4-aminopyrimidine derivatives |
| US8852632B2 (en) * | 2004-12-03 | 2014-10-07 | Merck Sharp & Dohme Corp. | Pharmaceutical formulation containing a release rate controlling composition |
| HRP20100504T1 (hr) * | 2005-03-04 | 2010-10-31 | Tibotec Pharmaceuticals | 2-(4-cijanofenil)-6-hidroksilaminopirimidini koji inhibiraju hiv |
| US7923056B2 (en) | 2007-06-01 | 2011-04-12 | Illinois Tool Works Inc. | Method and apparatus for dispensing material on a substrate |
| EP2432776B1 (en) | 2009-05-21 | 2019-09-11 | Universite Laval | Methyl sulfanyl pyrimidines useful as antiinflammatories, analgesics, and antiepileptics |
| CN101638391B (zh) * | 2009-08-21 | 2011-04-27 | 山东大学 | 2-[(取代苯氨基)羰基甲硫基]-6-(2,6-二氯苄基)-3h-嘧啶-4-酮类衍生物及其制备方法与应用 |
| US9226970B2 (en) | 2010-02-22 | 2016-01-05 | Nektar Therapeutics | Oligomer modified diaromatic substituted compounds |
| EP2550362B1 (en) | 2010-03-25 | 2017-01-04 | Oregon Health&Science University | Cmv glycoproteins and recombinant vectors |
| PH12013500011A1 (en) * | 2010-07-02 | 2013-02-18 | Gilead Sciences Inc | Napht-2-ylacetic acid derivatives to treat aids |
| RS57397B8 (sr) | 2011-06-10 | 2020-01-31 | Univ Oregon Health & Science | Cmv glikoproteini i rekombinantni vektori |
| AU2012216792A1 (en) | 2011-09-12 | 2013-03-28 | International Aids Vaccine Initiative | Immunoselection of recombinant vesicular stomatitis virus expressing HIV-1 proteins by broadly neutralizing antibodies |
| EP2586461A1 (en) | 2011-10-27 | 2013-05-01 | Christopher L. Parks | Viral particles derived from an enveloped virus |
| ES2631608T3 (es) | 2012-06-27 | 2017-09-01 | International Aids Vaccine Initiative | Variante de la glicoproteína Env del VIH-1 |
| KR101360587B1 (ko) * | 2012-11-01 | 2014-03-10 | 현대자동차주식회사 | 스마트 도어 언록 시스템 |
| EP2848937A1 (en) | 2013-09-05 | 2015-03-18 | International Aids Vaccine Initiative | Methods of identifying novel HIV-1 immunogens |
| EP2873423B1 (en) | 2013-10-07 | 2017-05-31 | International Aids Vaccine Initiative | Soluble hiv-1 envelope glycoprotein trimers |
| US10174292B2 (en) | 2015-03-20 | 2019-01-08 | International Aids Vaccine Initiative | Soluble HIV-1 envelope glycoprotein trimers |
| EP3072901A1 (en) | 2015-03-23 | 2016-09-28 | International Aids Vaccine Initiative | Soluble hiv-1 envelope glycoprotein trimers |
| NZ739226A (en) | 2015-07-22 | 2022-11-25 | Enanta Pharm Inc | Benzodiazepine derivatives as rsv inhibitors |
| GB201807898D0 (en) * | 2018-05-15 | 2018-06-27 | Kancera Ab | New processes and products with increased chiral purity |
| EP4037688A4 (en) * | 2019-10-04 | 2023-09-06 | Enanta Pharmaceuticals, Inc. | ANTIVIRAL HETEROCYCLIC COMPOUNDS |
| CA3167672A1 (en) * | 2020-01-20 | 2021-07-29 | Agrematch Ltd. | Compositions for crop protection |
| CN114057707A (zh) * | 2021-11-24 | 2022-02-18 | 上海应用技术大学 | 一种n-4-吲哚基-2-呋喃甲酰胺化合物的制备方法 |
| EP4463441A1 (en) * | 2022-01-12 | 2024-11-20 | IFM Due, Inc. | Compounds and compositions for treating conditions associated with sting activity |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2295560A (en) * | 1941-06-18 | 1942-09-15 | Gen Electric | Pyrimidine derivatives |
| GB744867A (en) * | 1952-10-29 | 1956-02-15 | American Cyanamid Co | Improvements relating to 2-substituted-mercapto-4-amino-6-disubstituted-aminopyrimidines and acid addition salts thereof |
| US3940394A (en) * | 1972-03-31 | 1976-02-24 | Santilli Arthur A | 2-pyrimidinylthio)alkanoic acids, esters, amides and hydrazides |
| US3940240A (en) * | 1974-07-11 | 1976-02-24 | Ina Seito Co., Ltd. | Baking method and kiln for tile |
| EP0124630B1 (de) * | 1983-05-05 | 1987-01-28 | LUDWIG HEUMANN & CO GMBH | Pyrimidin-Thioalkylpyridin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindung enthaltende Arzneimittel |
| US4724232A (en) * | 1985-03-16 | 1988-02-09 | Burroughs Wellcome Co. | Treatment of human viral infections |
| JPS62209062A (ja) * | 1986-03-10 | 1987-09-14 | Yamanouchi Pharmaceut Co Ltd | 2−ピリジルメチルチオ−または2−ピリジルメチルスルフイニル−置換縮合環化合物 |
| JPH07107056B2 (ja) * | 1987-01-30 | 1995-11-15 | 日清製粉株式会社 | 4(3h)−キナゾリノン誘導体、その製造方法およびそれを有効成分とする抗潰瘍剤 |
| AU3752589A (en) * | 1988-05-16 | 1989-12-12 | Georgia State University Research Foundation, Inc. | Nucleic acid interacting unfused heteropolycyclic compounds |
| HU203736B (en) * | 1989-04-06 | 1991-09-30 | Gyogyszerkutato Intezet | Process for producing new thiouracil-derivatives and pharmaceutical compositions containing them |
| CA2071529C (en) * | 1989-12-28 | 2001-03-20 | Donna Lee Romero | Diaromatic substituted anti-aids compounds |
| US5668136A (en) * | 1990-09-25 | 1997-09-16 | Eisai Co., Ltd. | Trisubstituted benzene derivatives, composition and methods of treatment |
| AU653855B2 (en) * | 1991-07-03 | 1994-10-13 | Pharmacia & Upjohn Company | Indolyl carbonyl pyridinyl-poperazine/piperidine derivatives |
| GB2266716A (en) * | 1992-05-05 | 1993-11-10 | Merck & Co Inc | Inhibitors of HIV reverse transcriptase |
| JP3077046B2 (ja) * | 1992-08-31 | 2000-08-14 | 久光製薬株式会社 | 新規なキナゾリン誘導体 |
| JPH09502713A (ja) * | 1993-09-17 | 1997-03-18 | ジ・アップジョン・カンパニー | Hivおよび他のレトロウイルス病を治療するのに有用な置換テトロン酸 |
| NZ276286A (en) * | 1993-11-12 | 2001-06-29 | Upjohn Co | Substituted pyrimidine thio- or oxy-alkyl derivatives and medicaments |
| AU2395095A (en) * | 1994-04-29 | 1995-11-29 | G.D. Searle & Co. | Method of using (h+/k+) atpase inhibitors as antiviral agents |
| EP0772593B1 (de) * | 1994-07-20 | 2003-05-02 | ALTANA Pharma AG | Pyridylthioverbindungen zur bekämpfung von helicobacter-bakterien |
-
1996
- 1996-03-05 UA UA97125800A patent/UA56992C2/uk unknown
- 1996-04-24 ZA ZA9603281A patent/ZA963281B/xx unknown
- 1996-04-29 IL IL11807596A patent/IL118075A0/xx unknown
- 1996-05-03 SK SK1502-97A patent/SK150297A3/sk unknown
- 1996-05-03 NZ NZ307089A patent/NZ307089A/xx unknown
- 1996-05-03 MX MX9708582A patent/MX9708582A/es not_active IP Right Cessation
- 1996-05-03 BR BR9608265A patent/BR9608265A/pt not_active Application Discontinuation
- 1996-05-03 CN CNA200410032589XA patent/CN1535958A/zh active Pending
- 1996-05-03 PT PT96913306T patent/PT824524E/pt unknown
- 1996-05-03 EP EP04010159A patent/EP1449835A3/en not_active Withdrawn
- 1996-05-03 ES ES96913306T patent/ES2227586T3/es not_active Expired - Lifetime
- 1996-05-03 US US08/945,153 patent/US6043248A/en not_active Expired - Fee Related
- 1996-05-03 AT AT96913306T patent/ATE275550T1/de not_active IP Right Cessation
- 1996-05-03 RU RU97120116/04A patent/RU2167155C2/ru not_active IP Right Cessation
- 1996-05-03 CA CA002216099A patent/CA2216099C/en not_active Expired - Fee Related
- 1996-05-03 KR KR1019970707927A patent/KR100445498B1/ko not_active Expired - Fee Related
- 1996-05-03 JP JP8534120A patent/JPH11507017A/ja not_active Withdrawn
- 1996-05-03 PL PL96323240A patent/PL323240A1/xx unknown
- 1996-05-03 DE DE69633332T patent/DE69633332T2/de not_active Expired - Fee Related
- 1996-05-03 EP EP96913306A patent/EP0824524B1/en not_active Expired - Lifetime
- 1996-05-03 AU AU56353/96A patent/AU712404B2/en not_active Ceased
- 1996-05-03 WO PCT/US1996/006119 patent/WO1996035678A1/en not_active Ceased
- 1996-05-03 HU HU9801995A patent/HUP9801995A3/hu unknown
- 1996-05-03 CN CNB961937912A patent/CN1152022C/zh not_active Expired - Fee Related
- 1996-05-03 CZ CZ19973491A patent/CZ293135B6/cs not_active IP Right Cessation
- 1996-05-03 GE GEAP19964013A patent/GEP20002297B/en unknown
- 1996-05-07 TW TW085105432A patent/TW450962B/zh not_active IP Right Cessation
-
1997
- 1997-11-07 NO NO19975129A patent/NO310287B1/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CZ293135B6 (cs) | Použití alfa-substituované pyrimidin-thioalkylové nebo alkyletherové sloučeniny pro léčení HIV pozitivních jednotlivců | |
| JP3398152B2 (ja) | 1n−アルキル−n−アリールピリミジンアミンおよびその誘導体 | |
| JP6445574B2 (ja) | ブロモドメイン阻害剤 | |
| CZ20023199A3 (cs) | Modulátory receptoru adenosinu | |
| US5981537A (en) | Pyrimidine-thioalkyl and alkylether compounds | |
| AU2015202675A1 (en) | Heteroaryl compounds and uses thereof | |
| JP2018505207A (ja) | 置換モノおよびポリアザナフタレン誘導体およびその使用 | |
| CZ101496A3 (en) | N-alkyl-n-aryl-pyrimidinamines and derivatives thereof | |
| TW200410945A (en) | Vanilloid receptor ligands and their use in treatments" | |
| EP2091941B1 (en) | Mapk/erk kinase inhibitors | |
| TW202216707A (zh) | 胺基嘧啶酮衍生物 | |
| CA2969839A1 (en) | Heterocyclic compounds as biogenic amine transport modulators | |
| US6124306A (en) | Thioalkyl alpha substituted pyrimidine compounds | |
| WO2017108203A1 (en) | Novel substituted indoline compounds as phosphodiesterase inhibitors | |
| TW200305567A (en) | Compounds and use thereof for decreasing activity of hormonesensitive lipase |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PD00 | Pending as of 2000-06-30 in czech republic | ||
| MM4A | Patent lapsed due to non-payment of fee |
Effective date: 20050503 |