CS259532B2 - Agent for pollen formation inhibition and method of efficient substances production - Google Patents
Agent for pollen formation inhibition and method of efficient substances production Download PDFInfo
- Publication number
- CS259532B2 CS259532B2 CS856783A CS678385A CS259532B2 CS 259532 B2 CS259532 B2 CS 259532B2 CS 856783 A CS856783 A CS 856783A CS 678385 A CS678385 A CS 678385A CS 259532 B2 CS259532 B2 CS 259532B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- compound
- pyrazolecarboxamide
- active ingredient
- carboxy
- mixture
- Prior art date
Links
- 230000015572 biosynthetic process Effects 0.000 title claims abstract description 19
- 238000000034 method Methods 0.000 title claims description 24
- 238000004519 manufacturing process Methods 0.000 title abstract description 13
- 239000000126 substance Substances 0.000 title description 8
- 230000005764 inhibitory process Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 112
- 239000000203 mixture Substances 0.000 claims description 101
- 239000004480 active ingredient Substances 0.000 claims description 45
- 229910052739 hydrogen Inorganic materials 0.000 claims description 39
- 150000003839 salts Chemical class 0.000 claims description 23
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 230000002401 inhibitory effect Effects 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 238000011282 treatment Methods 0.000 claims description 10
- RGGCHHCVNLUMKH-UHFFFAOYSA-N 5-carbamoyl-1-(3-chlorophenyl)pyrazole-4-carboxylic acid Chemical group NC(=O)C1=C(C(O)=O)C=NN1C1=CC=CC(Cl)=C1 RGGCHHCVNLUMKH-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 5
- GMJFALMFZHXWSI-UHFFFAOYSA-N 5-carbamoyl-1-(3-methylphenyl)pyrazole-4-carboxylic acid Chemical group CC1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 GMJFALMFZHXWSI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 238000005886 esterification reaction Methods 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000005336 allyloxy group Chemical group 0.000 claims description 2
- 230000032050 esterification Effects 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 239000004464 cereal grain Substances 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 81
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 74
- 241000196324 Embryophyta Species 0.000 description 68
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 60
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- 239000000725 suspension Substances 0.000 description 37
- 238000012360 testing method Methods 0.000 description 37
- 230000033228 biological regulation Effects 0.000 description 33
- 239000000047 product Substances 0.000 description 33
- 229910052757 nitrogen Inorganic materials 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- 238000010992 reflux Methods 0.000 description 26
- 238000004458 analytical method Methods 0.000 description 24
- 229910052799 carbon Inorganic materials 0.000 description 23
- 239000000243 solution Substances 0.000 description 23
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 21
- 239000008187 granular material Substances 0.000 description 21
- -1 methoxy, ethoxy Chemical group 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 21
- 241000209140 Triticum Species 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 235000021307 Triticum Nutrition 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- 229960000892 attapulgite Drugs 0.000 description 16
- 229910052625 palygorskite Inorganic materials 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 238000000921 elemental analysis Methods 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- 235000010489 acacia gum Nutrition 0.000 description 12
- 238000009472 formulation Methods 0.000 description 12
- 239000004615 ingredient Substances 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 239000006185 dispersion Substances 0.000 description 11
- 229920001296 polysiloxane Polymers 0.000 description 11
- 239000004575 stone Substances 0.000 description 11
- 239000002689 soil Substances 0.000 description 10
- 239000011343 solid material Substances 0.000 description 10
- 238000009331 sowing Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- 244000215068 Acacia senegal Species 0.000 description 9
- 229920000084 Gum arabic Polymers 0.000 description 9
- 239000000205 acacia gum Substances 0.000 description 9
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 9
- 239000005457 ice water Substances 0.000 description 9
- 239000002245 particle Substances 0.000 description 9
- 239000004157 Nitrosyl chloride Substances 0.000 description 8
- 230000035558 fertility Effects 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 8
- 235000019392 nitrosyl chloride Nutrition 0.000 description 8
- 230000003254 anti-foaming effect Effects 0.000 description 7
- 239000002518 antifoaming agent Substances 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 241000894007 species Species 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 240000005979 Hordeum vulgare Species 0.000 description 6
- 235000007340 Hordeum vulgare Nutrition 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 240000008042 Zea mays Species 0.000 description 6
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 6
- 239000013543 active substance Substances 0.000 description 6
- 239000000654 additive Substances 0.000 description 6
- 230000000996 additive effect Effects 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 229940075894 denatured ethanol Drugs 0.000 description 6
- 230000008775 paternal effect Effects 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 5
- 235000013339 cereals Nutrition 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- PLFJWWUZKJKIPZ-UHFFFAOYSA-N 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol Chemical compound CC(C)CC(C)CC(CC(C)C)OCCOCCOCCO PLFJWWUZKJKIPZ-UHFFFAOYSA-N 0.000 description 4
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 4
- 150000003857 carboxamides Chemical class 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000005187 foaming Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 229920005610 lignin Polymers 0.000 description 4
- 235000009973 maize Nutrition 0.000 description 4
- 230000008774 maternal effect Effects 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- PWGFXIMOCMRSIM-UHFFFAOYSA-N 5-carbamoyl-1h-pyrazole-4-carboxylic acid Chemical compound NC(=O)C=1NN=CC=1C(O)=O PWGFXIMOCMRSIM-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000001785 acacia senegal l. willd gum Substances 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 238000009396 hybridization Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- GOTYRUGSSMKFNF-UHFFFAOYSA-N lenalidomide Chemical compound C1C=2C(N)=CC=CC=2C(=O)N1C1CCC(=O)NC1=O GOTYRUGSSMKFNF-UHFFFAOYSA-N 0.000 description 3
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000004576 sand Substances 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000004563 wettable powder Substances 0.000 description 3
- KPEHRPKBJVEDMJ-UHFFFAOYSA-N 5-carbamoyl-1-(3-methoxyphenyl)pyrazole-4-carboxylic acid Chemical compound COC1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 KPEHRPKBJVEDMJ-UHFFFAOYSA-N 0.000 description 2
- VQPNTPPRCQFSJM-UHFFFAOYSA-N 5-cyano-1h-pyrazole-4-carboxylic acid Chemical compound OC(=O)C=1C=NNC=1C#N VQPNTPPRCQFSJM-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 240000001140 Mimosa pudica Species 0.000 description 2
- 235000016462 Mimosa pudica Nutrition 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- 241000209056 Secale Species 0.000 description 2
- 235000007238 Secale cereale Nutrition 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000003905 agrochemical Substances 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical group C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229950005228 bromoform Drugs 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 239000011928 denatured alcohol Substances 0.000 description 2
- PJABQHODPAEOFU-UHFFFAOYSA-N diethyl(dipropyl)azanium Chemical group CCC[N+](CC)(CC)CCC PJABQHODPAEOFU-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- KTMGNAIGXYODKQ-VOTSOKGWSA-N ethyl (e)-2-cyano-3-ethoxyprop-2-enoate Chemical compound CCO\C=C(/C#N)C(=O)OCC KTMGNAIGXYODKQ-VOTSOKGWSA-N 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 238000010899 nucleation Methods 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 229940068977 polysorbate 20 Drugs 0.000 description 2
- BHZRJJOHZFYXTO-UHFFFAOYSA-L potassium sulfite Chemical compound [K+].[K+].[O-]S([O-])=O BHZRJJOHZFYXTO-UHFFFAOYSA-L 0.000 description 2
- 235000019252 potassium sulphite Nutrition 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- 150000003217 pyrazoles Chemical class 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 2
- 239000012414 tert-butyl nitrite Substances 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- CRRIAWUJYMLJOE-UHFFFAOYSA-N (3-chlorophenyl)hydrazine;hydron;chloride Chemical compound Cl.NNC1=CC=CC(Cl)=C1 CRRIAWUJYMLJOE-UHFFFAOYSA-N 0.000 description 1
- XHJNKGFUXFLNAG-UHFFFAOYSA-N (3-ethylphenyl)hydrazine Chemical compound CCC1=CC=CC(NN)=C1 XHJNKGFUXFLNAG-UHFFFAOYSA-N 0.000 description 1
- JWJSWCNKBBQJMP-UHFFFAOYSA-N (3-ethylphenyl)hydrazine;hydrochloride Chemical compound Cl.CCC1=CC=CC(NN)=C1 JWJSWCNKBBQJMP-UHFFFAOYSA-N 0.000 description 1
- GPTOGZLZMLJZCV-UHFFFAOYSA-N (3-methylphenyl)hydrazine Chemical group CC1=CC=CC(NN)=C1 GPTOGZLZMLJZCV-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical compound OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 description 1
- RAQVJKHQNDKMDM-UHFFFAOYSA-N 1-(2-bromo-4-methylphenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound BrC1=CC(C)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 RAQVJKHQNDKMDM-UHFFFAOYSA-N 0.000 description 1
- KTLGPIVKELDXAU-UHFFFAOYSA-N 1-(3-bromo-2-chlorophenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=CC(Br)=C1Cl KTLGPIVKELDXAU-UHFFFAOYSA-N 0.000 description 1
- JNJMDUVNKABIHZ-UHFFFAOYSA-N 1-(3-bromo-4-methylphenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound C1=C(Br)C(C)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 JNJMDUVNKABIHZ-UHFFFAOYSA-N 0.000 description 1
- YCXSKLLCJDDKSH-UHFFFAOYSA-N 1-(3-bromophenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=CC(Br)=C1 YCXSKLLCJDDKSH-UHFFFAOYSA-N 0.000 description 1
- WESWPLRCACGWFX-UHFFFAOYSA-N 1-(3-butan-2-ylphenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound CCC(C)C1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 WESWPLRCACGWFX-UHFFFAOYSA-N 0.000 description 1
- BMRRLHHPLUQWMN-UHFFFAOYSA-N 1-(3-fluorophenyl)pyrazole-4-carboxylic acid Chemical compound C1=C(C(=O)O)C=NN1C1=CC=CC(F)=C1 BMRRLHHPLUQWMN-UHFFFAOYSA-N 0.000 description 1
- IDHQIBDXIVLLFT-UHFFFAOYSA-N 1-(4-bromo-3-propylphenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound C1=C(Br)C(CCC)=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 IDHQIBDXIVLLFT-UHFFFAOYSA-N 0.000 description 1
- LIRDCTZQZVJFJO-UHFFFAOYSA-N 1-(4-bromophenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(Br)C=C1 LIRDCTZQZVJFJO-UHFFFAOYSA-N 0.000 description 1
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 1
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical class NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NTSMOUACTOCHOU-UHFFFAOYSA-N 3-cyano-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1C=C(C#N)NN=1 NTSMOUACTOCHOU-UHFFFAOYSA-N 0.000 description 1
- AMKPQMFZCBTTAT-UHFFFAOYSA-N 3-ethylaniline Chemical compound CCC1=CC=CC(N)=C1 AMKPQMFZCBTTAT-UHFFFAOYSA-N 0.000 description 1
- ZRXHLJNBNWVNIM-UHFFFAOYSA-N 3-methyl-1-benzofuran Chemical compound C1=CC=C2C(C)=COC2=C1 ZRXHLJNBNWVNIM-UHFFFAOYSA-N 0.000 description 1
- BFMGSMOYBHOHGI-UHFFFAOYSA-N 5-amino-1-phenylpyrazole-4-carboxylic acid Chemical compound NC1=C(C(O)=O)C=NN1C1=CC=CC=C1 BFMGSMOYBHOHGI-UHFFFAOYSA-N 0.000 description 1
- XHZWFUVEKDDQPF-UHFFFAOYSA-N 5-bromo-1h-pyrazole Chemical class BrC1=CC=NN1 XHZWFUVEKDDQPF-UHFFFAOYSA-N 0.000 description 1
- AQEWWELUWIOFHJ-UHFFFAOYSA-N 5-carbamoyl-1-(2,4-dichlorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(Cl)C=C1Cl AQEWWELUWIOFHJ-UHFFFAOYSA-N 0.000 description 1
- SUFHYKCKQJBXNS-UHFFFAOYSA-N 5-carbamoyl-1-(3,4-dichlorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(Cl)C(Cl)=C1 SUFHYKCKQJBXNS-UHFFFAOYSA-N 0.000 description 1
- BWWRKONHBJBVCD-UHFFFAOYSA-N 5-carbamoyl-1-(3,4-diethylphenyl)pyrazole-4-carboxylic acid Chemical compound C1=C(CC)C(CC)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 BWWRKONHBJBVCD-UHFFFAOYSA-N 0.000 description 1
- DGNXUWVZMWDZFS-UHFFFAOYSA-N 5-carbamoyl-1-(3,4-difluorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(F)C(F)=C1 DGNXUWVZMWDZFS-UHFFFAOYSA-N 0.000 description 1
- YCYQTXBVPJFNLI-UHFFFAOYSA-N 5-carbamoyl-1-(3,4-dimethylphenyl)pyrazole-4-carboxylic acid Chemical compound C1=C(C)C(C)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 YCYQTXBVPJFNLI-UHFFFAOYSA-N 0.000 description 1
- XMDNXOYKEGPFJT-UHFFFAOYSA-N 5-carbamoyl-1-(3-chloro-4-methylphenyl)pyrazole-4-carboxylic acid Chemical compound C1=C(Cl)C(C)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 XMDNXOYKEGPFJT-UHFFFAOYSA-N 0.000 description 1
- KUOQKODUOLZEJZ-UHFFFAOYSA-N 5-carbamoyl-1-(3-ethylphenyl)pyrazole-4-carboxylic acid Chemical compound CCC1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 KUOQKODUOLZEJZ-UHFFFAOYSA-N 0.000 description 1
- NWSLOWWHIFDJAJ-UHFFFAOYSA-N 5-carbamoyl-1-(3-fluorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=CC(F)=C1 NWSLOWWHIFDJAJ-UHFFFAOYSA-N 0.000 description 1
- XULNTJIJWLRLLQ-UHFFFAOYSA-N 5-carbamoyl-1-(3-propan-2-yl-4-propylphenyl)pyrazole-4-carboxylic acid Chemical compound C1=C(C(C)C)C(CCC)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 XULNTJIJWLRLLQ-UHFFFAOYSA-N 0.000 description 1
- FVXVJPSHGAHUAZ-UHFFFAOYSA-N 5-carbamoyl-1-(3-propylphenyl)pyrazole-4-carboxylic acid Chemical compound CCCC1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 FVXVJPSHGAHUAZ-UHFFFAOYSA-N 0.000 description 1
- GRGVONAJVBBUQJ-UHFFFAOYSA-N 5-carbamoyl-1-(4-chlorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(Cl)C=C1 GRGVONAJVBBUQJ-UHFFFAOYSA-N 0.000 description 1
- BSWIFACGGDSGQB-UHFFFAOYSA-N 5-carbamoyl-1-(4-ethyl-2-fluorophenyl)pyrazole-4-carboxylic acid Chemical compound FC1=CC(CC)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 BSWIFACGGDSGQB-UHFFFAOYSA-N 0.000 description 1
- JWFZUZCHNUPVRN-UHFFFAOYSA-N 5-carbamoyl-1-(4-fluoro-2-propylphenyl)pyrazole-4-carboxylic acid Chemical compound CCCC1=CC(F)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 JWFZUZCHNUPVRN-UHFFFAOYSA-N 0.000 description 1
- OANVWGXWCNTWSZ-UHFFFAOYSA-N 5-carbamoyl-1-(4-fluoro-3-methylphenyl)pyrazole-4-carboxylic acid Chemical compound C1=C(F)C(C)=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 OANVWGXWCNTWSZ-UHFFFAOYSA-N 0.000 description 1
- IBAQSRUBOLDQOG-UHFFFAOYSA-N 5-carbamoyl-1-(4-fluorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(F)C=C1 IBAQSRUBOLDQOG-UHFFFAOYSA-N 0.000 description 1
- QTUFEYWJMPIRNK-UHFFFAOYSA-N 5-carbamoyl-1-[3-(2-methylpropyl)phenyl]pyrazole-4-carboxylic acid Chemical compound CC(C)CC1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 QTUFEYWJMPIRNK-UHFFFAOYSA-N 0.000 description 1
- OTGQGZUBLONPQW-UHFFFAOYSA-N 5-carbamoyl-1-phenylpyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=CC=C1 OTGQGZUBLONPQW-UHFFFAOYSA-N 0.000 description 1
- HLZGTWKPWSNLLM-UHFFFAOYSA-N 5-chloro-1-(3-methylphenyl)pyrazole-4-carbaldehyde Chemical compound CC1=CC=CC(N2C(=C(C=O)C=N2)Cl)=C1 HLZGTWKPWSNLLM-UHFFFAOYSA-N 0.000 description 1
- IJPFBRONCJOTTA-UHFFFAOYSA-N 5-chloro-1h-pyrazole Chemical compound ClC1=CC=NN1 IJPFBRONCJOTTA-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 241000209763 Avena sativa Species 0.000 description 1
- 235000007558 Avena sp Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- DZNBVKBECGATHH-UHFFFAOYSA-N C1=CC(=CC(=C1)Cl)N2C=CC(=C2C(=O)N)C(=O)O Chemical compound C1=CC(=CC(=C1)Cl)N2C=CC(=C2C(=O)N)C(=O)O DZNBVKBECGATHH-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- UFRKHRTYACWGOX-UHFFFAOYSA-N OC1=C(C=NN1C1=CC(=CC=C1)C)C(=O)OCC Chemical compound OC1=C(C=NN1C1=CC(=CC=C1)C)C(=O)OCC UFRKHRTYACWGOX-UHFFFAOYSA-N 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 229920002059 Pluronic® P 104 Polymers 0.000 description 1
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 235000019714 Triticale Nutrition 0.000 description 1
- 229920001938 Vegetable gum Polymers 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- VBQDSLGFSUGBBE-UHFFFAOYSA-N benzyl(triethyl)azanium Chemical class CC[N+](CC)(CC)CC1=CC=CC=C1 VBQDSLGFSUGBBE-UHFFFAOYSA-N 0.000 description 1
- HRNJXGRZDDWLOM-UHFFFAOYSA-N butan-2-yl(trimethyl)azanium Chemical group CCC(C)[N+](C)(C)C HRNJXGRZDDWLOM-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUNCEDRRUNZACO-UHFFFAOYSA-N butyl(trimethyl)azanium Chemical class CCCC[N+](C)(C)C IUNCEDRRUNZACO-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000007333 cyanation reaction Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- CDJLHQRURPECEZ-UHFFFAOYSA-N dibutyl(diethyl)azanium Chemical group CCCC[N+](CC)(CC)CCCC CDJLHQRURPECEZ-UHFFFAOYSA-N 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- ZJHQDSMOYNLVLX-UHFFFAOYSA-N diethyl(dimethyl)azanium Chemical group CC[N+](C)(C)CC ZJHQDSMOYNLVLX-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- MXTMXRYBYWOAGX-UHFFFAOYSA-N dimethyl(diphenyl)azanium Chemical class C=1C=CC=CC=1[N+](C)(C)C1=CC=CC=C1 MXTMXRYBYWOAGX-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- HFEAXZXXJFTTQR-UHFFFAOYSA-N ethyl 1-(3-bromophenyl)-5-cyanopyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC(Br)=C1 HFEAXZXXJFTTQR-UHFFFAOYSA-N 0.000 description 1
- GKEWLUXDKOQYFL-UHFFFAOYSA-N ethyl 1-(3-chloro-4-methylphenyl)-5-cyanopyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(C)C(Cl)=C1 GKEWLUXDKOQYFL-UHFFFAOYSA-N 0.000 description 1
- JPKWVUOGGMHDQQ-UHFFFAOYSA-N ethyl 1-(3-chlorophenyl)-5-cyanopyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC(Cl)=C1 JPKWVUOGGMHDQQ-UHFFFAOYSA-N 0.000 description 1
- TWGLRUQZUNIEBJ-UHFFFAOYSA-N ethyl 1-(4-bromophenyl)-5-cyanopyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(Br)C=C1 TWGLRUQZUNIEBJ-UHFFFAOYSA-N 0.000 description 1
- YEQRDOUVFYVEED-UHFFFAOYSA-N ethyl 1-(4-butylphenyl)-5-carbamoylpyrazole-4-carboxylate Chemical compound C1=CC(CCCC)=CC=C1N1C(C(N)=O)=C(C(=O)OCC)C=N1 YEQRDOUVFYVEED-UHFFFAOYSA-N 0.000 description 1
- UWCIMORHYIYCOT-UHFFFAOYSA-N ethyl 1-(4-chlorophenyl)-5-cyanopyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(Cl)C=C1 UWCIMORHYIYCOT-UHFFFAOYSA-N 0.000 description 1
- CQYOTMSWCKDYTD-UHFFFAOYSA-N ethyl 5-amino-1-(3-chlorophenyl)pyrazole-4-carboxylate Chemical compound NC1=C(C(=O)OCC)C=NN1C1=CC=CC(Cl)=C1 CQYOTMSWCKDYTD-UHFFFAOYSA-N 0.000 description 1
- LTOXVDYMHRQESR-UHFFFAOYSA-N ethyl 5-amino-1-(3-ethylphenyl)pyrazole-4-carboxylate Chemical compound NC1=C(C(=O)OCC)C=NN1C1=CC=CC(CC)=C1 LTOXVDYMHRQESR-UHFFFAOYSA-N 0.000 description 1
- KNTBFUFWHAQCRF-UHFFFAOYSA-N ethyl 5-bromo-1-(3-methoxyphenyl)pyrazole-4-carboxylate Chemical compound BrC1=C(C(=O)OCC)C=NN1C1=CC=CC(OC)=C1 KNTBFUFWHAQCRF-UHFFFAOYSA-N 0.000 description 1
- RTFLPOJCXDZQIN-UHFFFAOYSA-N ethyl 5-carbamoyl-1-(2,4-dibromophenyl)pyrazole-4-carboxylate Chemical compound NC(=O)C1=C(C(=O)OCC)C=NN1C1=CC=C(Br)C=C1Br RTFLPOJCXDZQIN-UHFFFAOYSA-N 0.000 description 1
- MUZYZOUAGNKICN-UHFFFAOYSA-N ethyl 5-carbamoyl-1-(3-chlorophenyl)pyrazole-4-carboxylate Chemical compound NC(=O)C1=C(C(=O)OCC)C=NN1C1=CC=CC(Cl)=C1 MUZYZOUAGNKICN-UHFFFAOYSA-N 0.000 description 1
- CBWBLNNGPMXDKI-UHFFFAOYSA-N ethyl 5-chloro-1-(3-chlorophenyl)pyrazole-4-carboxylate Chemical compound ClC1=C(C(=O)OCC)C=NN1C1=CC=CC(Cl)=C1 CBWBLNNGPMXDKI-UHFFFAOYSA-N 0.000 description 1
- JVYOFICHEZBZMV-UHFFFAOYSA-N ethyl 5-chloro-1-(3-ethylphenyl)pyrazole-4-carboxylate Chemical compound ClC1=C(C(=O)OCC)C=NN1C1=CC=CC(CC)=C1 JVYOFICHEZBZMV-UHFFFAOYSA-N 0.000 description 1
- MAZMILGNOUVGCX-UHFFFAOYSA-N ethyl 5-chloro-1-(3-methylphenyl)pyrazole-4-carboxylate Chemical compound ClC1=C(C(=O)OCC)C=NN1C1=CC=CC(C)=C1 MAZMILGNOUVGCX-UHFFFAOYSA-N 0.000 description 1
- VJBRQOFRDZQHGH-UHFFFAOYSA-N ethyl 5-cyano-1-(2,4-dichlorophenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(Cl)C=C1Cl VJBRQOFRDZQHGH-UHFFFAOYSA-N 0.000 description 1
- IHHZRXCNMQXMAV-UHFFFAOYSA-N ethyl 5-cyano-1-(3,4-dimethylphenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(C)C(C)=C1 IHHZRXCNMQXMAV-UHFFFAOYSA-N 0.000 description 1
- FCKLUTFWDUMLPR-UHFFFAOYSA-N ethyl 5-cyano-1-(3-ethylphenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC(CC)=C1 FCKLUTFWDUMLPR-UHFFFAOYSA-N 0.000 description 1
- CETUIEPODWICIR-UHFFFAOYSA-N ethyl 5-cyano-1-(3-methoxyphenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC(OC)=C1 CETUIEPODWICIR-UHFFFAOYSA-N 0.000 description 1
- CTNNDBIRJRSKJF-UHFFFAOYSA-N ethyl 5-cyano-1-(4-fluorophenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(F)C=C1 CTNNDBIRJRSKJF-UHFFFAOYSA-N 0.000 description 1
- QNLWYPHPPPTTNM-UHFFFAOYSA-N ethyl 5-cyano-1-(4-methylphenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(C)C=C1 QNLWYPHPPPTTNM-UHFFFAOYSA-N 0.000 description 1
- LEVIYCDZXKNQPL-UHFFFAOYSA-N ethyl 5-cyano-1-phenylpyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC=C1 LEVIYCDZXKNQPL-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- GMXFZBZOVZOYNQ-UHFFFAOYSA-N hydron;(3-methoxyphenyl)hydrazine;chloride Chemical compound Cl.COC1=CC=CC(NN)=C1 GMXFZBZOVZOYNQ-UHFFFAOYSA-N 0.000 description 1
- SHTBTGXNVWYODU-UHFFFAOYSA-N hydron;(3-methylphenyl)hydrazine;chloride Chemical compound Cl.CC1=CC=CC(NN)=C1 SHTBTGXNVWYODU-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000002015 leaf growth Effects 0.000 description 1
- 235000019357 lignosulphonate Nutrition 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- FFIUSHSSADPQCE-UHFFFAOYSA-N methyl 1-(3-tert-butylphenyl)-5-carbamoylpyrazole-4-carboxylate Chemical compound NC(=O)C1=C(C(=O)OC)C=NN1C1=CC=CC(C(C)(C)C)=C1 FFIUSHSSADPQCE-UHFFFAOYSA-N 0.000 description 1
- NPQMWAIOIBCSQY-UHFFFAOYSA-N methyl 5-carbamoyl-1-(3-chlorophenyl)pyrazole-4-carboxylate Chemical compound NC(=O)C1=C(C(=O)OC)C=NN1C1=CC=CC(Cl)=C1 NPQMWAIOIBCSQY-UHFFFAOYSA-N 0.000 description 1
- KEXAGEPALYATQK-UHFFFAOYSA-N methyl 5-carbamoyl-1-(3-propan-2-yloxyphenyl)pyrazole-4-carboxylate Chemical compound NC(=O)C1=C(C(=O)OC)C=NN1C1=CC=CC(OC(C)C)=C1 KEXAGEPALYATQK-UHFFFAOYSA-N 0.000 description 1
- AEPTXICUZNPHNX-UHFFFAOYSA-N methyl 5-carbamoyl-1-(4-ethylphenyl)pyrazole-4-carboxylate Chemical compound C1=CC(CC)=CC=C1N1C(C(N)=O)=C(C(=O)OC)C=N1 AEPTXICUZNPHNX-UHFFFAOYSA-N 0.000 description 1
- RVQMPVGXGOTVPY-UHFFFAOYSA-N methyl 5-carbamoyl-1-(4-propoxyphenyl)pyrazole-4-carboxylate Chemical compound C1=CC(OCCC)=CC=C1N1C(C(N)=O)=C(C(=O)OC)C=N1 RVQMPVGXGOTVPY-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- MDXJYGLKYYBRCZ-UHFFFAOYSA-M potassium;n-amino-n-(3-ethylphenyl)sulfamate Chemical compound [K+].CCC1=CC=CC(N(N)S([O-])(=O)=O)=C1 MDXJYGLKYYBRCZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000012254 powdered material Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 230000010153 self-pollination Effects 0.000 description 1
- 238000009958 sewing Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 150000003505 terpenes Chemical class 0.000 description 1
- 235000007586 terpenes Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- SPJZSTLXABSXII-UHFFFAOYSA-N tert-butyl(trimethyl)azanium Chemical group CC(C)(C)[N+](C)(C)C SPJZSTLXABSXII-UHFFFAOYSA-N 0.000 description 1
- MHZQPZCBHKCIEN-UHFFFAOYSA-N tetrakis(2-methylpropyl)azanium Chemical class CC(C)C[N+](CC(C)C)(CC(C)C)CC(C)C MHZQPZCBHKCIEN-UHFFFAOYSA-N 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical group C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical class CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000004954 trialkylamino group Chemical group 0.000 description 1
- JJPVWQWOOQYHCB-UHFFFAOYSA-N triethyl(phenyl)azanium Chemical group CC[N+](CC)(CC)C1=CC=CC=C1 JJPVWQWOOQYHCB-UHFFFAOYSA-N 0.000 description 1
- COOSQAXLLKTSQO-UHFFFAOYSA-N trimethyl(2-methylpropyl)azanium Chemical group CC(C)C[N+](C)(C)C COOSQAXLLKTSQO-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 1
- 241000228158 x Triticosecale Species 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Plant Substances (AREA)
- Cosmetics (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Breeding Of Plants And Reproduction By Means Of Culturing (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Investigating Or Analysing Biological Materials (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Steroid Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65406184A | 1984-09-25 | 1984-09-25 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS678385A2 CS678385A2 (en) | 1988-03-15 |
| CS259532B2 true CS259532B2 (en) | 1988-10-14 |
Family
ID=24623299
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS856783A CS259532B2 (en) | 1984-09-25 | 1985-09-23 | Agent for pollen formation inhibition and method of efficient substances production |
Country Status (27)
| Country | Link |
|---|---|
| US (2) | US4666504A (show.php) |
| EP (1) | EP0177242B1 (show.php) |
| JP (1) | JPS6187668A (show.php) |
| KR (1) | KR910002078B1 (show.php) |
| CN (1) | CN1016398B (show.php) |
| AT (1) | ATE49197T1 (show.php) |
| AU (1) | AU581927B2 (show.php) |
| BG (1) | BG60351B2 (show.php) |
| BR (1) | BR8504722A (show.php) |
| CA (1) | CA1262911A (show.php) |
| CS (1) | CS259532B2 (show.php) |
| DD (1) | DD236870A5 (show.php) |
| DE (1) | DE3575129D1 (show.php) |
| DK (1) | DK432685A (show.php) |
| DO (1) | DOP1985004354A (show.php) |
| ES (1) | ES8703141A1 (show.php) |
| FI (1) | FI853644A7 (show.php) |
| GR (1) | GR852318B (show.php) |
| HU (1) | HU196291B (show.php) |
| IL (1) | IL76463A0 (show.php) |
| NZ (1) | NZ213590A (show.php) |
| PH (1) | PH21852A (show.php) |
| PL (1) | PL148599B1 (show.php) |
| PT (1) | PT81174B (show.php) |
| RO (1) | RO92792B (show.php) |
| SU (1) | SU1440343A3 (show.php) |
| ZA (1) | ZA857343B (show.php) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4801326A (en) * | 1986-03-19 | 1989-01-31 | Eli Lilly And Company | 1-phenylpyrazole-4,5-dicarboxylic acid derivatives, composition containing them, and pollen formation inhibiting method of using them |
| US4966623A (en) * | 1986-03-19 | 1990-10-30 | Ackmann Stephen A | Use of gametocidal pyrazoles to produce hybrid seed |
| KR870008849A (ko) * | 1986-03-19 | 1987-10-21 | 메어리 앤 턱커 | 생식자 박멸효능을 갖는 피라졸류 |
| US4913604A (en) * | 1987-09-23 | 1990-04-03 | Vargus Ltd. Tool Manufacturing Co. | Thread milling tool |
| JPH02503564A (ja) * | 1988-03-17 | 1990-10-25 | フセソユズニ ナウチノ‐イススレドバテルスキ インスティテュト セルスコホズヤイストベンノイ ビオテフノロギイ フセソユズノイ アカデミイ セルスコホズヤイストベンニフ ナウク イメニ ベー.イー.レニナ | 葯を不稔性化する方法 |
| DE3931786A1 (de) * | 1989-09-23 | 1991-04-04 | Basf Ag | Pyrazol-3-carbonsaeureamide |
| US5587485A (en) * | 1994-07-20 | 1996-12-24 | Monsanto Company | Heterocyclic- and carbocyclic- substituted benzoic acids and synthesis thereof |
| ID21775A (id) * | 1996-10-25 | 1999-07-22 | Yoshitomi Pharmaceutical | Senyawa-senyawa 1-fenilpirazol dan penggunaan farmasinya |
| DK175612B1 (da) * | 2003-11-11 | 2004-12-27 | Vks Inventa As | Ophængningsarrangement samt fremgangsmåde til fremstilling af et sådant arrangement |
| CN110731265B (zh) * | 2019-12-05 | 2021-04-02 | 河北省农林科学院旱作农业研究所 | 一种饲用小黑麦新种质的杂交选育方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3922163A (en) * | 1970-01-30 | 1975-11-25 | Upjohn Co | Organic compounds and process |
| US4147528A (en) * | 1973-04-23 | 1979-04-03 | Rohm And Haas Company | 6-Oxopyrimidine plant growth regulators |
| US4134987A (en) * | 1976-01-14 | 1979-01-16 | Huppatz John L | Compounds and compositions |
| US4345934A (en) * | 1977-03-10 | 1982-08-24 | Rohm And Haas Company | Method of producing hybrid cereal grain seeds by application of 1-aryl-1,4-dihydro-4-oxo(thio)-pyridazines |
| US4238220A (en) * | 1977-07-15 | 1980-12-09 | Rohm And Haas Company | 1-Aryl-5-carboxy-2-pyridones and derivatives thereof |
| DE2747531A1 (de) * | 1977-10-22 | 1979-04-26 | Basf Ag | Substituierte 3-aminopyrazole |
| DE2829289A1 (de) * | 1978-07-04 | 1980-01-24 | Basf Ag | Pyrazolaetherderivate |
| FR2486940A1 (fr) * | 1980-07-18 | 1982-01-22 | Ugine Kuhlmann | Procede de preparation de phenyl-1 carbamoyl-3 pyrazolones-5 |
| GR75799B (show.php) * | 1980-10-03 | 1984-08-02 | Ici Plc | |
| DE3129429A1 (de) * | 1981-07-25 | 1983-02-10 | Basf Ag, 6700 Ludwigshafen | 5-amino-1-phenyl-pyrazol-4-carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| KR870008849A (ko) * | 1986-03-19 | 1987-10-21 | 메어리 앤 턱커 | 생식자 박멸효능을 갖는 피라졸류 |
-
1985
- 1985-08-05 US US06/762,732 patent/US4666504A/en not_active Expired - Fee Related
- 1985-09-20 DO DO1985004354A patent/DOP1985004354A/es unknown
- 1985-09-23 RO RO120183A patent/RO92792B/ro unknown
- 1985-09-23 FI FI853644A patent/FI853644A7/fi not_active Application Discontinuation
- 1985-09-23 AU AU47680/85A patent/AU581927B2/en not_active Ceased
- 1985-09-23 SU SU853954000A patent/SU1440343A3/ru active
- 1985-09-23 PL PL1985255491A patent/PL148599B1/pl unknown
- 1985-09-23 CS CS856783A patent/CS259532B2/cs unknown
- 1985-09-23 BG BG071779A patent/BG60351B2/bg unknown
- 1985-09-23 IL IL76463A patent/IL76463A0/xx not_active IP Right Cessation
- 1985-09-23 GR GR852318A patent/GR852318B/el unknown
- 1985-09-23 PT PT81174A patent/PT81174B/pt not_active IP Right Cessation
- 1985-09-23 CN CN85107078A patent/CN1016398B/zh not_active Expired
- 1985-09-24 ES ES547260A patent/ES8703141A1/es not_active Expired
- 1985-09-24 CA CA000491462A patent/CA1262911A/en not_active Expired
- 1985-09-24 ZA ZA857343A patent/ZA857343B/xx unknown
- 1985-09-24 EP EP85306762A patent/EP0177242B1/en not_active Expired - Lifetime
- 1985-09-24 DK DK432685A patent/DK432685A/da not_active Application Discontinuation
- 1985-09-24 AT AT85306762T patent/ATE49197T1/de not_active IP Right Cessation
- 1985-09-24 NZ NZ213590A patent/NZ213590A/xx unknown
- 1985-09-24 PH PH32826A patent/PH21852A/en unknown
- 1985-09-24 DE DE8585306762T patent/DE3575129D1/de not_active Expired - Lifetime
- 1985-09-24 KR KR1019850007017A patent/KR910002078B1/ko not_active Expired
- 1985-09-24 HU HU853599A patent/HU196291B/hu not_active IP Right Cessation
- 1985-09-25 BR BR8504722A patent/BR8504722A/pt unknown
- 1985-09-25 JP JP60213600A patent/JPS6187668A/ja active Pending
- 1985-09-25 DD DD85281017A patent/DD236870A5/de not_active IP Right Cessation
-
1987
- 1987-02-02 US US07/009,971 patent/US4775409A/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4643757A (en) | Herbicidal 4-benzoyl-1-methyl-5-hydroxypyrazoles | |
| DE3226513A1 (de) | Als herbizide verwendbare n-phenylpyrazolderivate | |
| US4740233A (en) | Substituted 1,2,4-triazolo[1,5-a]-pyrimidine-2-sulfonamides and compositions and methods of controlling undesired vegetation and suppressing the nitrification of ammonium nitrogen in soil | |
| DE69839392T2 (de) | In 1-stellung substituierte 4-carbamoyl-1,2,4-triazol-5-on-derivate und herbizide | |
| US4345934A (en) | Method of producing hybrid cereal grain seeds by application of 1-aryl-1,4-dihydro-4-oxo(thio)-pyridazines | |
| EP0318602B1 (en) | Pyrazolesulfonamide derivative, process for its production and herbicide containing it | |
| RU2065861C1 (ru) | N-пиразолил-1,2,4-триазоло-[1,5-с]-пиримидин-2-сульфонамидные соединения, способ их получения, гербицидная композиция и способ борьбы с нежелательной растительностью | |
| US4059434A (en) | Cycloalkanapyrazole herbicides | |
| CS223840B2 (en) | Herbicide means and method of making the active substances | |
| CS259532B2 (en) | Agent for pollen formation inhibition and method of efficient substances production | |
| JPH0225886B2 (show.php) | ||
| CA1250292A (en) | Pollen suppressant comprising a fused pyridazine | |
| US4661145A (en) | Plant growth regulating 1-aryl-1,4-dihydro-4-oxo(thio)-pyridazines | |
| JPH04234368A (ja) | 4,5,6,7−テトラヒドロ−3−アリール−インダゾール、それらの製造方法および除草剤としてのそれらの用途 | |
| CA1228859A (en) | N-phenylpyrazole derivatives | |
| JPH11506767A (ja) | 除草性置換3−アリール−ピラゾール | |
| US4563210A (en) | Herbicidal 5-halo-1-halophenyl-1H-pyrazole-4-carbonitriles | |
| US4108628A (en) | Cycloalkanopyrazole herbicides mixtures | |
| WO2019080227A1 (zh) | 取代的苯甲酰基异恶唑类化合物或其互变异构体、盐、制备方法、除草组合物及应用 | |
| JPS61282365A (ja) | 1−アリ−ル−4−シアノ−5−ハロゲノピラゾ−ル類 | |
| HU206598B (en) | Composition for inhibiting pollen-forming containing pyrazol derivatives as active component | |
| US4966623A (en) | Use of gametocidal pyrazoles to produce hybrid seed | |
| US4902808A (en) | Process for preparing 4-carboxy-1-(3,5-dimethylphenyl)-5-pyrazolecarboxamide | |
| JP2002536379A (ja) | ホスホノピラゾールの製造 | |
| JP2020534341A (ja) | 除草剤としてのピラジン−4カルバメート又は−尿素誘導体 |