CS200545B2 - Method of producing derivatives of guanidine - Google Patents
Method of producing derivatives of guanidine Download PDFInfo
- Publication number
- CS200545B2 CS200545B2 CS782521A CS252178A CS200545B2 CS 200545 B2 CS200545 B2 CS 200545B2 CS 782521 A CS782521 A CS 782521A CS 252178 A CS252178 A CS 252178A CS 200545 B2 CS200545 B2 CS 200545B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- formula
- atom
- thiazole
- guanidino
- Prior art date
Links
- 150000002357 guanidines Chemical class 0.000 title claims abstract description 22
- 238000000034 method Methods 0.000 title claims abstract description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 16
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 16
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 15
- 150000003839 salts Chemical class 0.000 claims abstract description 14
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 claims abstract description 11
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 10
- 239000001257 hydrogen Substances 0.000 claims abstract description 9
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 7
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 6
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 4
- 125000003435 aroyl group Chemical group 0.000 claims abstract description 4
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims abstract description 4
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims abstract description 3
- 125000003118 aryl group Chemical group 0.000 claims abstract description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 158
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 99
- 150000001875 compounds Chemical class 0.000 claims description 47
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 31
- -1 3,4-dioxocyclobutene-1,2-diyl Chemical group 0.000 claims description 30
- 229910052757 nitrogen Inorganic materials 0.000 claims description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 14
- 239000007858 starting material Substances 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 10
- 239000012458 free base Substances 0.000 claims description 9
- 125000004434 sulfur atom Chemical group 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 7
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 7
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 2
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims 2
- 150000001450 anions Chemical class 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 72
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 abstract description 26
- 229960001340 histamine Drugs 0.000 abstract description 13
- 230000028327 secretion Effects 0.000 abstract description 12
- 210000004211 gastric acid Anatomy 0.000 abstract description 6
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 5
- 101000989653 Homo sapiens Membrane frizzled-related protein Proteins 0.000 abstract description 3
- 102100029357 Membrane frizzled-related protein Human genes 0.000 abstract description 3
- 229910052736 halogen Inorganic materials 0.000 abstract description 3
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- 125000001589 carboacyl group Chemical group 0.000 abstract description 2
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 2
- 150000002367 halogens Chemical group 0.000 abstract description 2
- 150000003557 thiazoles Chemical class 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 74
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 57
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 48
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 26
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 238000012360 testing method Methods 0.000 description 17
- 239000011541 reaction mixture Substances 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 10
- 238000002425 crystallisation Methods 0.000 description 10
- 230000008025 crystallization Effects 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 9
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- 238000000354 decomposition reaction Methods 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- 102000005962 receptors Human genes 0.000 description 7
- 108020003175 receptors Proteins 0.000 description 7
- 241000282472 Canis lupus familiaris Species 0.000 description 6
- 241000700199 Cavia porcellus Species 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 239000000739 antihistaminic agent Substances 0.000 description 6
- 210000002837 heart atrium Anatomy 0.000 description 6
- 238000001990 intravenous administration Methods 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 239000012265 solid product Substances 0.000 description 6
- 210000002784 stomach Anatomy 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 230000002496 gastric effect Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 230000004044 response Effects 0.000 description 5
- SUNMBRGCANLOEG-UHFFFAOYSA-N 1,3-dichloroacetone Chemical compound ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 4
- FRBXHUUHIIGYDT-UHFFFAOYSA-N C(C=C/C(=O)O)(=O)O.S1C=NC=C1 Chemical compound C(C=C/C(=O)O)(=O)O.S1C=NC=C1 FRBXHUUHIIGYDT-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 206010016717 Fistula Diseases 0.000 description 4
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000003463 adsorbent Substances 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- AQIXAKUUQRKLND-UHFFFAOYSA-N cimetidine Chemical compound N#C/N=C(/NC)NCCSCC=1N=CNC=1C AQIXAKUUQRKLND-UHFFFAOYSA-N 0.000 description 4
- 229960001380 cimetidine Drugs 0.000 description 4
- 239000003623 enhancer Substances 0.000 description 4
- 230000003890 fistula Effects 0.000 description 4
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- 239000011976 maleic acid Substances 0.000 description 4
- BSRYQVAYLHEYGO-UHFFFAOYSA-N methyl n-cyano-n'-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]carbamimidothioate Chemical compound N#CN=C(SC)NCCSCC1=CSC(NC(N)=N)=N1 BSRYQVAYLHEYGO-UHFFFAOYSA-N 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- BGPJLYIFDLICMR-UHFFFAOYSA-N 1,4,2,3-dioxadithiolan-5-one Chemical compound O=C1OSSO1 BGPJLYIFDLICMR-UHFFFAOYSA-N 0.000 description 3
- IQUVPEBKMIEVMZ-UHFFFAOYSA-N 2-[4-(4-aminobutyl)-1,3-thiazol-2-yl]guanidine;hydrobromide;hydrochloride Chemical compound Cl.Br.NCCCCC1=CSC(NC(N)=N)=N1 IQUVPEBKMIEVMZ-UHFFFAOYSA-N 0.000 description 3
- ALUADPCVKGLEJH-UHFFFAOYSA-N 2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethylazanium;chloride Chemical compound Cl.NCCSCC1=CSC(NC(N)=N)=N1 ALUADPCVKGLEJH-UHFFFAOYSA-N 0.000 description 3
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 208000007107 Stomach Ulcer Diseases 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 230000009858 acid secretion Effects 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000006309 butyl amino group Chemical group 0.000 description 3
- OKGXJRGLYVRVNE-UHFFFAOYSA-N diaminomethylidenethiourea Chemical compound NC(N)=NC(N)=S OKGXJRGLYVRVNE-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 230000027119 gastric acid secretion Effects 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 229960000582 mepyramine Drugs 0.000 description 3
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- ORECNKBJIMKZNX-UHFFFAOYSA-N 1,3-thiazol-3-ium;chloride Chemical compound Cl.C1=CSC=N1 ORECNKBJIMKZNX-UHFFFAOYSA-N 0.000 description 2
- CCJBZSBTJMHAQM-UHFFFAOYSA-N 1-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-3-ethylguanidine Chemical compound CCNC(=NC#N)NCCSCC1=CSC(NC(N)=N)=N1 CCJBZSBTJMHAQM-UHFFFAOYSA-N 0.000 description 2
- JNHFQOCQRKPRPV-UHFFFAOYSA-N 2-[4-(3-aminopropylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride Chemical compound Cl.NCCCSCC1=CSC(NC(N)=N)=N1 JNHFQOCQRKPRPV-UHFFFAOYSA-N 0.000 description 2
- MTTWINGFPPFHBJ-UHFFFAOYSA-N 2-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-thiazol-2-yl]guanidine;hydrobromide Chemical compound Br.S1C(NC(=N)N)=NC(CCCCN2C(C3=CC=CC=C3C2=O)=O)=C1 MTTWINGFPPFHBJ-UHFFFAOYSA-N 0.000 description 2
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 2
- SPCKHVPPRJWQRZ-UHFFFAOYSA-N 2-benzhydryloxy-n,n-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 SPCKHVPPRJWQRZ-UHFFFAOYSA-N 0.000 description 2
- ZNHPMMBWZHUBNX-UHFFFAOYSA-N 2-butyl-1-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride Chemical compound Cl.CCCCN=C(N)NC1=NC(CCl)=CS1 ZNHPMMBWZHUBNX-UHFFFAOYSA-N 0.000 description 2
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 2
- 108010079943 Pentagastrin Proteins 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
- JUCVMCNRABNRJD-UHFFFAOYSA-N azane;ethyl acetate Chemical compound N.CCOC(C)=O JUCVMCNRABNRJD-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
- 229960000520 diphenhydramine Drugs 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 230000001747 exhibiting effect Effects 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000938 histamine H1 antagonist Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 150000002689 maleic acids Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- ANRIQLNBZQLTFV-DZUOILHNSA-N pentagastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1[C]2C=CC=CC2=NC=1)NC(=O)CCNC(=O)OC(C)(C)C)CCSC)C(N)=O)C1=CC=CC=C1 ANRIQLNBZQLTFV-DZUOILHNSA-N 0.000 description 2
- 229960000444 pentagastrin Drugs 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- NWZYKHSNRMAZLI-UHFFFAOYSA-N (n'-butylcarbamimidoyl)thiourea Chemical compound CCCCNC(=N)NC(N)=S NWZYKHSNRMAZLI-UHFFFAOYSA-N 0.000 description 1
- KFZQSRZJDFEUID-UHFFFAOYSA-N (n'-methylcarbamimidoyl)thiourea Chemical compound CNC(=N)NC(N)=S KFZQSRZJDFEUID-UHFFFAOYSA-N 0.000 description 1
- AHVWJQAKDMSCMD-BTJKTKAUSA-N (z)-but-2-enedioic acid;1-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-3-propan-2-ylguanidine Chemical compound OC(=O)\C=C/C(O)=O.CC(C)NC(=NC#N)NCCSCC1=CSC(NC(N)=N)=N1 AHVWJQAKDMSCMD-BTJKTKAUSA-N 0.000 description 1
- NGOALGCZRJXZPW-BTJKTKAUSA-N (z)-but-2-enedioic acid;1-cyano-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-(2-methoxyethyl)guanidine Chemical compound OC(=O)\C=C/C(O)=O.COCCN=C(NC#N)NCCSCC1=CSC(N=C(N)N)=N1 NGOALGCZRJXZPW-BTJKTKAUSA-N 0.000 description 1
- DDGHBOLOCQWPKE-UHFFFAOYSA-N 1,3-thiazole;hydrobromide Chemical compound [Br-].C1=CSC=[NH+]1 DDGHBOLOCQWPKE-UHFFFAOYSA-N 0.000 description 1
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- SGUWJWKVYWTNKK-UHFFFAOYSA-N 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-butylguanidine;hydrochloride Chemical compound Cl.CCCCN=C(N)NC1=NC(CSCCN)=CS1 SGUWJWKVYWTNKK-UHFFFAOYSA-N 0.000 description 1
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 1
- FLWLEGXUGDILNI-UHFFFAOYSA-N 1-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-thiazol-2-yl]-2-methylguanidine;hydrobromide Chemical compound Br.S1C(NC(N)=NC)=NC(CCCCN2C(C3=CC=CC=C3C2=O)=O)=C1 FLWLEGXUGDILNI-UHFFFAOYSA-N 0.000 description 1
- NYAMPFDYTBDISG-UHFFFAOYSA-N 1-chloro-3-(triphenyl-$l^{5}-phosphanylidene)propan-2-one Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)CCl)C1=CC=CC=C1 NYAMPFDYTBDISG-UHFFFAOYSA-N 0.000 description 1
- FFUPIIYGULDCEY-UHFFFAOYSA-N 1-cyano-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-(2-hydroxyethyl)guanidine Chemical compound NC(N)=NC1=NC(CSCCNC(NC#N)=NCCO)=CS1 FFUPIIYGULDCEY-UHFFFAOYSA-N 0.000 description 1
- QYXHFICHKVRPSH-UHFFFAOYSA-N 1-cyano-3-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]butyl]-2-methylguanidine Chemical compound N#CN=C(NC)NCCCCC1=CSC(NC(N)=N)=N1 QYXHFICHKVRPSH-UHFFFAOYSA-N 0.000 description 1
- LMRDBJZQDUVCQH-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)acetaldehyde Chemical compound C1=CC=C2C(=O)N(CC=O)C(=O)C2=C1 LMRDBJZQDUVCQH-UHFFFAOYSA-N 0.000 description 1
- SZJMLHRRRVLTQD-UHFFFAOYSA-N 2-(6-bromo-5-oxohexyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCCC(=O)CBr)C(=O)C2=C1 SZJMLHRRRVLTQD-UHFFFAOYSA-N 0.000 description 1
- ZDMJVZQTAJYNPF-UHFFFAOYSA-N 2-(6-chloro-5-oxoheptyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCCC(=O)C(Cl)C)C(=O)C2=C1 ZDMJVZQTAJYNPF-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- FGOADZSSHWIZHR-UHFFFAOYSA-N 2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-1-nitroguanidine Chemical compound NC(=N)NC1=NC(CSCCNC(N)=N[N+]([O-])=O)=CS1 FGOADZSSHWIZHR-UHFFFAOYSA-N 0.000 description 1
- JFINSZHXZPNADJ-UHFFFAOYSA-N 2-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine Chemical compound NCCSCC1=CSC(NC(N)=N)=N1 JFINSZHXZPNADJ-UHFFFAOYSA-N 0.000 description 1
- JXNJORJFKUCUSM-UHFFFAOYSA-N 2-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride Chemical compound Cl.Cl.NCCSCC1=CSC(NC(N)=N)=N1 JXNJORJFKUCUSM-UHFFFAOYSA-N 0.000 description 1
- SLKRPKDOFFHSCW-UHFFFAOYSA-N 2-[4-(4-aminobutyl)-1,3-thiazol-2-yl]guanidine Chemical compound NCCCCC1=CSC(NC(N)=N)=N1 SLKRPKDOFFHSCW-UHFFFAOYSA-N 0.000 description 1
- HKTIMFCVQVQNQN-UHFFFAOYSA-N 2-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]butyl]-1-nitroguanidine Chemical compound NC(=N)NC1=NC(CCCCNC(N)=N[N+]([O-])=O)=CS1 HKTIMFCVQVQNQN-UHFFFAOYSA-N 0.000 description 1
- HZMURLJYNYVFMN-UHFFFAOYSA-N 2-[4-[4-[[1-(methylamino)-2-nitroethenyl]amino]butyl]-1,3-thiazol-2-yl]guanidine Chemical group [O-][N+](=O)C=C(NC)NCCCCC1=CSC(NC(N)=N)=N1 HZMURLJYNYVFMN-UHFFFAOYSA-N 0.000 description 1
- VQTZKGCXTCXYMY-UHFFFAOYSA-N 2-[4-[4-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]butyl]-1,3-thiazol-2-yl]guanidine Chemical compound O=C1C(=O)C(NC)=C1NCCCCC1=CSC(NC(N)=N)=N1 VQTZKGCXTCXYMY-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- IWTFOFMTUOBLHG-UHFFFAOYSA-N 2-methoxypyridine Chemical compound COC1=CC=CC=N1 IWTFOFMTUOBLHG-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- WSGYTJNNHPZFKR-UHFFFAOYSA-N 3-hydroxypropanenitrile Chemical compound OCCC#N WSGYTJNNHPZFKR-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- GMEDUXHKSSWXSL-UHFFFAOYSA-N 3-sulfanylpropylazanium;chloride Chemical compound Cl.NCCCS GMEDUXHKSSWXSL-UHFFFAOYSA-N 0.000 description 1
- KHIMLQRMIOTPPJ-UHFFFAOYSA-N 4-(6-bromo-5-oxohexyl)isoindole-1,3-dione Chemical compound BrCC(CCCCC1=C2C(C(=O)NC2=O)=CC=C1)=O KHIMLQRMIOTPPJ-UHFFFAOYSA-N 0.000 description 1
- RLYUNPNLXMSXAX-UHFFFAOYSA-N 5-methylthiazole Chemical compound CC1=CN=CS1 RLYUNPNLXMSXAX-UHFFFAOYSA-N 0.000 description 1
- KOQCISGPATVUJH-UHFFFAOYSA-N 6-(1,3-dioxoisoindol-2-yl)hexanoyl chloride Chemical compound C1=CC=C2C(=O)N(CCCCCC(=O)Cl)C(=O)C2=C1 KOQCISGPATVUJH-UHFFFAOYSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- AKGDZWRMFDLKFE-UHFFFAOYSA-N Dihydrocanadensolide Natural products CC1C(=O)OC2C(CCCC)OC(=O)C21 AKGDZWRMFDLKFE-UHFFFAOYSA-N 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 206010065713 Gastric Fistula Diseases 0.000 description 1
- 208000012671 Gastrointestinal haemorrhages Diseases 0.000 description 1
- 102000000543 Histamine Receptors Human genes 0.000 description 1
- 108010002059 Histamine Receptors Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- DHUZAAUGHUHIDS-ONEGZZNKSA-N Isomyristicin Chemical compound COC1=CC(\C=C\C)=CC2=C1OCO2 DHUZAAUGHUHIDS-ONEGZZNKSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229940121948 Muscarinic receptor antagonist Drugs 0.000 description 1
- KQJQICVXLJTWQD-UHFFFAOYSA-N N-Methylthiourea Chemical compound CNC(N)=S KQJQICVXLJTWQD-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229940099471 Phosphodiesterase inhibitor Drugs 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 206010042220 Stress ulcer Diseases 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229960005305 adenosine Drugs 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000002467 anti-pepsin effect Effects 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- 238000010009 beating Methods 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- IULFXBLVJIPESI-UHFFFAOYSA-N bis(methylsulfanyl)methylidenecyanamide Chemical compound CSC(SC)=NC#N IULFXBLVJIPESI-UHFFFAOYSA-N 0.000 description 1
- 150000001621 bismuth Chemical class 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- ABFYVUGIGVULGU-WRYGTEGESA-N butanedioic acid (E)-but-2-enedioic acid 2,3-dihydroxybutanedioic acid hydrochloride Chemical compound Cl.OC(=O)CCC(O)=O.OC(=O)\C=C\C(O)=O.OC(=O)C(O)C(O)C(O)=O ABFYVUGIGVULGU-WRYGTEGESA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- SKOLWUPSYHWYAM-UHFFFAOYSA-N carbonodithioic O,S-acid Chemical compound SC(S)=O SKOLWUPSYHWYAM-UHFFFAOYSA-N 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229960004782 chlordiazepoxide Drugs 0.000 description 1
- ANTSCNMPPGJYLG-UHFFFAOYSA-N chlordiazepoxide Chemical compound O=N=1CC(NC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 ANTSCNMPPGJYLG-UHFFFAOYSA-N 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- AKGDZWRMFDLKFE-BZNPZCIMSA-N dihydrocanadensolide Chemical compound C[C@H]1C(=O)O[C@@H]2[C@H](CCCC)OC(=O)[C@@H]21 AKGDZWRMFDLKFE-BZNPZCIMSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000035622 drinking Effects 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 239000000469 ethanolic extract Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229940043075 fluocinolone Drugs 0.000 description 1
- FEBLZLNTKCEFIT-VSXGLTOVSA-N fluocinolone acetonide Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@]1(F)[C@@H]2[C@@H]2C[C@H]3OC(C)(C)O[C@@]3(C(=O)CO)[C@@]2(C)C[C@@H]1O FEBLZLNTKCEFIT-VSXGLTOVSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 208000030304 gastrointestinal bleeding Diseases 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- JEGUKCSWCFPDGT-UHFFFAOYSA-N h2o hydrate Chemical compound O.O JEGUKCSWCFPDGT-UHFFFAOYSA-N 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 239000013003 healing agent Substances 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- BICAGYDGRXJYGD-UHFFFAOYSA-N hydrobromide;hydrochloride Chemical compound Cl.Br BICAGYDGRXJYGD-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical class CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 229950000964 pepstatin Drugs 0.000 description 1
- 108010091212 pepstatin Proteins 0.000 description 1
- FAXGPCHRFPCXOO-LXTPJMTPSA-N pepstatin A Chemical compound OC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)CC(C)C FAXGPCHRFPCXOO-LXTPJMTPSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- 229960002695 phenobarbital Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002571 phosphodiesterase inhibitor Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 229960005439 propantheline bromide Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012260 resinous material Substances 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 210000005245 right atrium Anatomy 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000002294 steroidal antiinflammatory agent Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- GFNANZIMVAIWHM-OBYCQNJPSA-N triamcinolone Chemical compound O=C1C=C[C@]2(C)[C@@]3(F)[C@@H](O)C[C@](C)([C@@]([C@H](O)C4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 GFNANZIMVAIWHM-OBYCQNJPSA-N 0.000 description 1
- 229960005294 triamcinolone Drugs 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/88—Nitrogen atoms, e.g. allantoin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1638977 | 1977-04-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS200545B2 true CS200545B2 (en) | 1980-09-15 |
Family
ID=10076448
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS782521A CS200545B2 (en) | 1977-04-20 | 1978-04-19 | Method of producing derivatives of guanidine |
| CS788113A CS200546B2 (en) | 1977-04-20 | 1978-04-19 | Method of producing derivatives of guanidine |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS788113A CS200546B2 (en) | 1977-04-20 | 1978-04-19 | Method of producing derivatives of guanidine |
Country Status (28)
| Country | Link |
|---|---|
| US (4) | US4165377A (Direct) |
| JP (3) | JPS53147069A (Direct) |
| AR (1) | AR223315A1 (Direct) |
| AT (1) | AT363099B (Direct) |
| AU (1) | AU516297B2 (Direct) |
| BE (1) | BE866156A (Direct) |
| CA (1) | CA1097658A (Direct) |
| CS (2) | CS200545B2 (Direct) |
| DD (1) | DD135824A5 (Direct) |
| DK (1) | DK172778A (Direct) |
| ES (3) | ES468985A1 (Direct) |
| FI (1) | FI781230A7 (Direct) |
| FR (2) | FR2387970A1 (Direct) |
| GB (1) | GB2060607B (Direct) |
| GR (1) | GR62452B (Direct) |
| HU (1) | HU176807B (Direct) |
| IE (1) | IE47044B1 (Direct) |
| IL (1) | IL54549A0 (Direct) |
| IN (1) | IN148903B (Direct) |
| IT (1) | IT1094469B (Direct) |
| NL (1) | NL190486C (Direct) |
| NO (1) | NO781300L (Direct) |
| NZ (1) | NZ186965A (Direct) |
| PL (2) | PL113082B1 (Direct) |
| PT (1) | PT67921B (Direct) |
| SE (1) | SE7804461L (Direct) |
| SU (1) | SU730299A3 (Direct) |
| ZA (1) | ZA782129B (Direct) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL49528A (en) * | 1975-05-21 | 1980-11-30 | Smith Kline French Lab | Imidazolyl(or thiazolyl)methylthio(or butyl)guanidine or thiourea derivatives,their preparation and pharmaceutical compositions comprising them |
| DE2961923D1 (en) * | 1978-01-18 | 1982-03-11 | Ici Plc | Antisecretory guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| EP0006679B1 (en) * | 1978-05-24 | 1982-07-21 | Imperial Chemical Industries Plc | Antisecretory thiadiazole derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| US4200578A (en) | 1978-12-18 | 1980-04-29 | Bristol-Myers Company | Thiazole derivatives |
| EP0014057B1 (en) * | 1979-01-18 | 1985-01-02 | Imperial Chemical Industries Plc | Guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| US4521418A (en) * | 1979-02-21 | 1985-06-04 | Smith Kline & French Laboratories Limited | Guanidinothiazolyl derivatives |
| JPS6056143B2 (ja) * | 1979-08-02 | 1985-12-09 | 山之内製薬株式会社 | アミジン誘導体ならびにその製造法 |
| PH16099A (en) * | 1979-03-06 | 1983-06-24 | Yamanouchi Pharma Co Ltd | Guanidinothiazole compounds,process for preparing them and medical composition containing them |
| CH644369A5 (de) * | 1979-05-03 | 1984-07-31 | Sandoz Ag | 2-amino-4-chlorthiazolverbindungen. |
| US4242351A (en) * | 1979-05-07 | 1980-12-30 | Imperial Chemical Industries Limited | Antisecretory oxadiazoles and pharmaceutical compositions containing them |
| FI76795C (fi) * | 1979-09-04 | 1988-12-12 | Bristol Myers Co | Foerfarande foer framstaellning av nya, terapeutiskt anvaendbara 3,4-disubstituerade 1,2,5-tiadiazol-1-oxider och -1,1-dioxider samt nya mellanprodukter. |
| US4359466A (en) * | 1979-10-24 | 1982-11-16 | Smith Kline & French Laboratories Limited | Guanidine compounds |
| IL61234A (en) * | 1979-10-24 | 1984-03-30 | Smith Kline French Lab | Guanidino thiazolyl alkylamino(alkylthioalkylamino)nitrotetrahydropyridines,process for preparing them and pharmaceutical compositions containing them |
| GR71929B (Direct) * | 1979-11-13 | 1983-08-19 | Ici Ltd | |
| NZ196923A (en) * | 1980-04-29 | 1983-12-16 | Shionogi & Co | 2-guanidino-4-(-acylaminoalkyl(thio)methyl)thiazoles and analogs |
| EP0045155B1 (en) * | 1980-07-30 | 1985-01-02 | Imperial Chemical Industries Plc | Guanidine derivatives |
| WO1982000462A1 (fr) * | 1980-08-11 | 1982-02-18 | Rech Syntheses Organ | Imino-alkyle et amino-nitrile cyano-guanidines |
| US4760075A (en) * | 1980-10-02 | 1988-07-26 | Eli Lilly And Company | N-thiazolylmethylthioalkyl-N-alkyl-amidines and related compounds |
| US4904792A (en) * | 1980-10-02 | 1990-02-27 | Eli Lilly And Company | N-thiazolymethylthioalkyl-N'-alkylamidines and related compounds |
| US4374843A (en) * | 1980-10-14 | 1983-02-22 | Pfizer Inc. | 2-Guanidino-4-heteroarylthiazoles |
| DE3270716D1 (en) * | 1981-02-27 | 1986-05-28 | Ici Plc | Guanidino-substituted heterocyclic derivatives having histamine h-2 antagonist activity |
| CA1233818A (en) * | 1981-03-09 | 1988-03-08 | David J. Gilman | Guanidine derivatives as histamine h-2 receptor antagonists |
| CA1209998A (en) * | 1981-03-09 | 1986-08-19 | David J. Gilman | Amide derivatives as histamine h-2 receptor antagonists |
| US4460584A (en) * | 1981-03-13 | 1984-07-17 | Imperial Chemical Industries Plc | Nitrogen heterocycles |
| IN158869B (Direct) * | 1981-03-18 | 1987-02-07 | Ici Plc | |
| EP0065823A1 (en) * | 1981-05-13 | 1982-12-01 | Imperial Chemical Industries Plc | Heterocyclic guanidines as histamine H-2 antagonists |
| EP0067508B1 (en) * | 1981-05-18 | 1985-10-30 | Imperial Chemical Industries Plc | Amidine derivatives |
| US4452987A (en) * | 1981-08-20 | 1984-06-05 | Pfizer Inc. | Haloacetyl imidazoles |
| US4590299A (en) * | 1981-08-20 | 1986-05-20 | Pfizer Inc. | 2-guanidino-4-heteroarylthiazoles |
| US4510313A (en) * | 1981-08-20 | 1985-04-09 | Pfizer Inc. | 2-Guanidino-4-heteroarylthiazoles |
| JPS5872571A (ja) * | 1981-10-27 | 1983-04-30 | Shionogi & Co Ltd | 2−グアニジノ−4−〔2−(ホルムアミド)エチルチオメチル〕チアゾ−ルの製法 |
| US4647557A (en) * | 1982-12-28 | 1987-03-03 | Gerard Moinet | Novel heterocyclic derivatives bearing an amino radical, processes for their production and the pharmaceutical compositions containing them |
| JPS59227870A (ja) * | 1983-06-07 | 1984-12-21 | Yamanouchi Pharmaceut Co Ltd | 新規2−グアニジノチアゾリン誘導体ならびにその製造法 |
| JPS60255756A (ja) * | 1984-06-01 | 1985-12-17 | Ikeda Mohandou:Kk | アミノアルキルフエノキシ誘導体 |
| JPS6160673A (ja) * | 1984-08-30 | 1986-03-28 | Yamanouchi Pharmaceut Co Ltd | グアニジノチアゾ−ル誘導体の製造法 |
| US4814341A (en) * | 1986-08-26 | 1989-03-21 | Reiter Lawrence A | 2-guanidino-4-(2-furyl) thiazoles as antiulcer agents |
| FI892035L (fi) * | 1986-10-29 | 1989-04-28 | Pfizer | Foerfaranden foer 2-(1-pentyl-3-guanidino)-4-(2-metyl-4-imidazolyl) tiazol och analoger. |
| EP0861075A1 (en) * | 1995-11-13 | 1998-09-02 | Albany Medical College | Analgesic compounds and uses thereof |
| US5731442A (en) * | 1997-03-11 | 1998-03-24 | Albemarle Corporation | Synthesis of thiazole derivatives |
| WO1998040367A1 (en) * | 1997-03-11 | 1998-09-17 | Albemarle Corporation | Novel thiazole derivatives and their preparation |
| US5856500A (en) * | 1997-03-11 | 1999-01-05 | Albemarle Corporation | Synthesis of thiazole derivatives |
| JP6378179B2 (ja) * | 2013-07-03 | 2018-08-22 | 株式会社新日本科学 | 新規化合物,有機カチオントランスポーター3の検出剤及び活性阻害剤 |
| DE102019200350B4 (de) | 2019-01-14 | 2023-05-11 | Rud Ketten Rieger & Dietz Gmbh U. Co. Kg | Nutzfahrzeugreifenkette, Nutzfahrzeugreifen und Stollenplatte für eine Nutzfahrzeugreifenkette |
| US20230349922A1 (en) | 2020-08-11 | 2023-11-02 | Université De Strasbourg | H2 Blockers Targeting Liver Macrophages for the Prevention and Treatment of Liver Disease and Cancer |
Family Cites Families (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1305549A (Direct) | 1969-10-29 | 1973-02-07 | ||
| GB1305548A (Direct) | 1969-10-29 | 1973-02-07 | ||
| BE758145A (fr) | 1969-10-29 | 1971-04-28 | Smith Kline French Lab | Iso-thio-urees et derives |
| GB1305547A (Direct) | 1969-10-29 | 1973-02-07 | ||
| GB1305550A (Direct) | 1969-10-29 | 1973-02-07 | ||
| BE758146A (fr) | 1969-10-29 | 1971-04-28 | Smith Kline French Lab | Derives de l'amidine |
| GB1341376A (en) | 1969-11-19 | 1973-12-19 | Smith Kline French Lab | Pharmaceutical compositions comprising 4-methyl-5-2-aminoethyl imidazole |
| GB1341375A (en) | 1969-11-19 | 1973-12-19 | Smith Kline French Lab | Aminoalkylimidazoles and process for their production |
| CA946968A (en) | 1970-05-18 | 1974-05-07 | Xerox Corporation | System for generating laser light of the three primary colors |
| GB1307539A (en) | 1970-06-25 | 1973-02-21 | Smith Kline French Lab | Thiourea derivatives |
| GB1336061A (en) | 1971-02-03 | 1973-11-07 | Ilford Ltd | Photographic emulsions |
| US4049672A (en) * | 1971-03-09 | 1977-09-20 | Smith Kline & French Laboratories Limited | 4-Methyl-5-imidazolylmethylthioethylamine and -S-methylisothiourea |
| GB1338169A (en) * | 1971-03-09 | 1973-11-21 | Smith Kline French Lab | Ureas thioureas and guanidines |
| US3950353A (en) * | 1971-03-09 | 1976-04-13 | Smith Kline & French Laboratories Limited | Pharmacologically active thiourea and urea compounds |
| US4018931A (en) * | 1971-03-09 | 1977-04-19 | Smith Kline & French Laboratories Limited | Pharmacologically active thiourea and urea compounds |
| GB1395929A (en) | 1972-08-08 | 1975-05-29 | Smith Kline French Lab | Thioureas |
| US4018928A (en) * | 1971-03-09 | 1977-04-19 | Smith Kline & French Laboratories Limited | Pyridyl substituted aminoalkyl-thioureas and ureas |
| US3932427A (en) * | 1971-03-09 | 1976-01-13 | Smith Kline & French Laboratories, Inc. | Pyridyl substituted aminoalkyl-thioureas and ureas |
| US3905984A (en) * | 1971-03-09 | 1975-09-16 | Smith Kline French Lab | Pyridyl substituted thioalkyl-and oxyalkyl-thioureas and ureas |
| US4053473A (en) * | 1971-07-22 | 1977-10-11 | Smith Kline & French Laboratories Limited | Pharmacologically active thiourea and urea compounds |
| GB1400319A (en) | 1972-04-20 | 1975-07-16 | Smith Kline French Lab | Pharmaceutical compositions |
| GB1399283A (en) | 1972-04-20 | 1975-07-02 | Smith Kline French Lab | Pharmaceutical compositions |
| GB1397436A (en) * | 1972-09-05 | 1975-06-11 | Smith Kline French Lab | Heterocyclic n-cyanoguinidines |
| US3975530A (en) * | 1972-09-05 | 1976-08-17 | Smith Kline & French Laboratories Limited | N-cyano-N'-heterocyclic-alkyl quanidine inhibitors of H2 histamine receptors |
| US3920822A (en) * | 1972-09-05 | 1975-11-18 | Smith Kline French Lab | Inhibition of histamine activity with cyanoguanidines |
| GB1398426A (en) | 1972-09-05 | 1975-06-18 | Smith Kline French Lab | Heterocyclic substituted guanidines |
| GB1421999A (en) | 1973-02-08 | 1976-01-21 | Smith Kline French Lab | Heterocyclic containing sulphoxides |
| GB1419994A (en) | 1973-05-03 | 1976-01-07 | Smith Kline French Lab | Heterocyclicalkylaminotheterocyclic compounds methods for their preparation and compositions comprising them |
| GB1421792A (en) | 1973-05-17 | 1976-01-21 | Smith Kline French Lab | Heterocyclic substituted-1, 1-diamino-ethylene derivatives methods for their preparation and compositions containing them |
| GB1422408A (en) | 1973-06-12 | 1976-01-28 | Smith Kline French Lab | Imidazo 1,2-a pyridines |
| GB1431589A (en) | 1973-07-13 | 1976-04-07 | Smith Kline French Lab | Ureas, thioureas and guanidines n,n-disubstituted by heterocyclo- alkylene and/or heterocycloalkylenethioalkylene groups |
| GB1565205A (en) | 1975-07-31 | 1980-04-16 | Smith Kline French Lab | Heterocyclic sulphoxides |
| GB1493931A (en) | 1974-02-07 | 1977-11-30 | Smith Kline French Lab | Guanidines isothioureas and thioureas |
| GB1496787A (en) | 1974-03-12 | 1978-01-05 | Smith Kline French Lab | Heteroalkylthioalkyl amidine derivatives |
| CA1004576A (en) * | 1974-05-24 | 1977-02-01 | Ralph O. Jacobsen | Bale shredder |
| GB1497260A (en) | 1974-06-28 | 1978-01-05 | Smith Kline French Lab | Guanidine derivatives |
| GB1533378A (en) | 1974-09-02 | 1978-11-22 | Smith Kline French Lab | Process for the preparation of heterocyclic substituted thioureas |
| GB1533380A (en) | 1974-09-02 | 1978-11-22 | Smith Kline French Lab | Process for the preparation of heterocyclic substituted thioureas and h-cyanoguanidines |
| GB1530895A (en) | 1974-09-02 | 1978-11-01 | Smith Kline French Lab | Electrochemical reduction of 4-imidazole carboxylic acids |
| GB1531221A (en) | 1974-09-02 | 1978-11-08 | Smith Kline French Lab | Process for preparing guanidine derivatives |
| GB1531231A (en) | 1974-09-02 | 1978-11-08 | Smith Kline French Lab | Process for the production of cyanoguanidine derivatives |
| GB1533379A (en) | 1974-09-02 | 1978-11-22 | Smith Kline French Lab | Process for the preparation of heterocyclic substituted ureas |
| GB1542840A (en) | 1975-02-03 | 1979-03-28 | Smith Kline French Lab | Heterocyclic dithiocarbamates and isothioureas |
| GB1554153A (en) | 1975-05-15 | 1979-10-17 | Smith Kline French Lab | Process for making 2-amino-2-alkylthionitroethylenes |
| GB1563090A (en) | 1975-07-31 | 1980-03-19 | Smith Kline French Lab | Cyclobutene-diones |
| FR2317591B1 (fr) | 1975-07-08 | 1979-06-15 | Clarel | Appareil d'eclairage pour lampes fluorescentes |
| GB1564502A (en) | 1975-07-31 | 1980-04-10 | Smith Kline French Lab | Guanidines thioureas and 1,1-diamino-2-nitroethylene derivatives |
| GB1565647A (en) | 1975-07-31 | 1980-04-23 | Smith Kline French Lab | Pharmacologically active compounds 4-substituted-imidazole-5-methanols |
| IN146736B (Direct) | 1975-10-02 | 1979-08-25 | Smith Kline French Lab | |
| US4099672A (en) * | 1977-02-28 | 1978-07-11 | Ray Albert Sheahan | Shower-head fixture |
| US4309435A (en) * | 1978-10-16 | 1982-01-05 | Imperial Chemical Industries Ltd. | Antisecretory guanidine derivatives and pharmaceutical compositions containing them |
| JPS6056143B2 (ja) * | 1979-08-02 | 1985-12-09 | 山之内製薬株式会社 | アミジン誘導体ならびにその製造法 |
-
1978
- 1978-04-13 NZ NZ186965A patent/NZ186965A/xx unknown
- 1978-04-13 GR GR55969A patent/GR62452B/el unknown
- 1978-04-13 IE IE728/78A patent/IE47044B1/en not_active IP Right Cessation
- 1978-04-13 ZA ZA00782129A patent/ZA782129B/xx unknown
- 1978-04-13 NO NO781300A patent/NO781300L/no unknown
- 1978-04-14 AU AU35106/78A patent/AU516297B2/en not_active Expired
- 1978-04-15 IN IN274/DEL/78A patent/IN148903B/en unknown
- 1978-04-17 CA CA301,263A patent/CA1097658A/en not_active Expired
- 1978-04-18 PL PL1978206191A patent/PL113082B1/pl unknown
- 1978-04-18 PL PL1978218009A patent/PL113054B1/pl unknown
- 1978-04-19 NL NLAANVRAGE7804159,A patent/NL190486C/xx not_active IP Right Cessation
- 1978-04-19 US US05/897,910 patent/US4165377A/en not_active Expired - Lifetime
- 1978-04-19 CS CS782521A patent/CS200545B2/cs unknown
- 1978-04-19 CS CS788113A patent/CS200546B2/cs unknown
- 1978-04-19 BE BE186933A patent/BE866156A/xx not_active IP Right Cessation
- 1978-04-19 PT PT67921A patent/PT67921B/pt unknown
- 1978-04-19 IL IL54549A patent/IL54549A0/xx not_active IP Right Cessation
- 1978-04-19 SE SE7804461A patent/SE7804461L/xx unknown
- 1978-04-19 FR FR7811536A patent/FR2387970A1/fr active Granted
- 1978-04-19 DD DD78204901A patent/DD135824A5/xx unknown
- 1978-04-19 AT AT0276978A patent/AT363099B/de not_active IP Right Cessation
- 1978-04-20 ES ES468985A patent/ES468985A1/es not_active Expired
- 1978-04-20 DK DK172778A patent/DK172778A/da active IP Right Grant
- 1978-04-20 FI FI781230A patent/FI781230A7/fi not_active Application Discontinuation
- 1978-04-20 JP JP4713678A patent/JPS53147069A/ja active Granted
- 1978-04-20 SU SU782607390A patent/SU730299A3/ru active
- 1978-04-20 HU HU78IE834A patent/HU176807B/hu unknown
- 1978-04-20 IT IT22558/78A patent/IT1094469B/it active
- 1978-04-20 AR AR271843A patent/AR223315A1/es active
- 1978-06-22 GB GB8006269A patent/GB2060607B/en not_active Expired
- 1978-11-08 ES ES474929A patent/ES474929A1/es not_active Expired
-
1979
- 1979-02-01 ES ES477387A patent/ES477387A1/es not_active Expired
- 1979-08-13 US US06/065,801 patent/US4234735A/en not_active Expired - Lifetime
- 1979-08-13 US US06/065,802 patent/US4262126A/en not_active Expired - Lifetime
-
1980
- 1980-07-25 US US06/172,302 patent/US4347370A/en not_active Expired - Lifetime
-
1982
- 1982-06-16 FR FR8210491A patent/FR2519341A1/fr active Granted
-
1983
- 1983-11-18 JP JP58216402A patent/JPS59130277A/ja active Granted
- 1983-11-18 JP JP58216401A patent/JPS59130276A/ja active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS200545B2 (en) | Method of producing derivatives of guanidine | |
| EP0003640B1 (en) | Antisecretory guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them | |
| US4165378A (en) | Guanidine derivatives of imidazoles and thiazoles | |
| US4058614A (en) | Substituted imidazole compounds and therapeutic compositions therewith | |
| NO170883B (no) | Fremgangsmaate for fremstilling av 2-amino-5-hydroksy-4-metylpyrimidin-derivater | |
| US4493840A (en) | Antisecretory guanidine derivatives, and pharmaceutical compositions containing them | |
| JPS5916889A (ja) | 2↓−(4↓−ピリジル)↓−チアゾ−ル誘導体 | |
| HU179492B (en) | Process for producing 1,2,4-thiadiasole derivatives | |
| EP0116769B1 (en) | Dihydropyridines | |
| JPS6320231B2 (Direct) | ||
| HU205922B (en) | Process for producing thiazol derivatives and pharmaceutical compositions containing them | |
| JPS5830314B2 (ja) | グアニジン化合物の製法 | |
| US4496571A (en) | Histamine H2-antagonists | |
| HU212133B (en) | Therapeutic agents | |
| US3169966A (en) | Aminopyrazoles | |
| US4490393A (en) | Thiazolylurea derivatives, a process for preparing same and a pharmaceutical composition containing same | |
| EP0010893A1 (en) | Antisecretory branched-chain heterocyclic guanidine derivatives, processes for their manufacture, intermediates, and pharmaceutical compositions containing said derivatives | |
| US4141899A (en) | 4,5,6,7-Tetrahydroimidazo-[4,5-c]-pyridine derivatives | |
| KR870000912B1 (ko) | 디하이드로피리딘 유도체의 제조방법 | |
| US4338447A (en) | 5-Guanidino-1,2,4-oxadiazoles | |
| Bosin et al. | Routes of functionalized guanidines. Synthesis of guanidino diesters | |
| EP0102026A2 (en) | Thiazole derivatives | |
| CS235976B2 (en) | Method of pyrimidine derivatives production | |
| JPS5823688A (ja) | グアニジン誘導体、その製法及びこの化合物を含むヒスタミンh−2−「きつ」抗性で胃酸の分泌を抑制する医薬組成物 | |
| US4486431A (en) | Cardiotonic use of 4,5-dihydro-6-(4-pyridinyl)-3(2H)-pyridazinones |