CH695217A5 - Verfahren zur Trennung optischer Isomeren von Tetrahydrofolsäureestersalzen und Tetrahydrofolsäure. - Google Patents
Verfahren zur Trennung optischer Isomeren von Tetrahydrofolsäureestersalzen und Tetrahydrofolsäure. Download PDFInfo
- Publication number
- CH695217A5 CH695217A5 CH01300/99A CH130099A CH695217A5 CH 695217 A5 CH695217 A5 CH 695217A5 CH 01300/99 A CH01300/99 A CH 01300/99A CH 130099 A CH130099 A CH 130099A CH 695217 A5 CH695217 A5 CH 695217A5
- Authority
- CH
- Switzerland
- Prior art keywords
- alpha
- tetrahydrofolic acid
- diastereomers
- acid
- tetrahydrofolic
- Prior art date
Links
- MSTNYGQPCMXVAQ-KIYNQFGBSA-N 5,6,7,8-tetrahydrofolic acid Chemical class N1C=2C(=O)NC(N)=NC=2NCC1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 MSTNYGQPCMXVAQ-KIYNQFGBSA-N 0.000 title claims abstract description 51
- 150000003839 salts Chemical class 0.000 title claims abstract description 36
- 238000000034 method Methods 0.000 title claims description 26
- 238000000926 separation method Methods 0.000 title description 4
- 230000003287 optical effect Effects 0.000 title description 2
- -1 tetrahydrofolic acid ester salts Chemical class 0.000 claims abstract description 61
- 239000000203 mixture Substances 0.000 claims abstract description 30
- 239000002253 acid Substances 0.000 claims abstract description 9
- 125000003118 aryl group Chemical group 0.000 claims abstract description 7
- 239000003960 organic solvent Substances 0.000 claims abstract description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 27
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 claims description 22
- 238000002360 preparation method Methods 0.000 claims description 16
- 238000005984 hydrogenation reaction Methods 0.000 claims description 15
- 229960000304 folic acid Drugs 0.000 claims description 14
- 239000011724 folic acid Substances 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 14
- 235000019152 folic acid Nutrition 0.000 claims description 13
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 claims description 12
- 150000003460 sulfonic acids Chemical class 0.000 claims description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims description 10
- 229930195733 hydrocarbon Natural products 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 150000002224 folic acids Chemical class 0.000 claims description 8
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 7
- 150000001298 alcohols Chemical class 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000013078 crystal Substances 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 4
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 239000003495 polar organic solvent Substances 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- 229910006069 SO3H Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 238000001914 filtration Methods 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 125000005425 toluyl group Chemical group 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- 238000001816 cooling Methods 0.000 claims 1
- 150000007513 acids Chemical class 0.000 abstract description 5
- 238000004519 manufacturing process Methods 0.000 abstract description 5
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 72
- 229940077388 benzenesulfonate Drugs 0.000 description 22
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 21
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 238000002425 crystallisation Methods 0.000 description 10
- 230000008025 crystallization Effects 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 8
- 238000002955 isolation Methods 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical group 0.000 description 6
- 239000012429 reaction media Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 5
- 229940092714 benzenesulfonic acid Drugs 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 230000032050 esterification Effects 0.000 description 4
- 238000005886 esterification reaction Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- RAFKAKSKKRLEJW-MMFRDWCLSA-N (2S)-2-[[4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid benzenesulfonic acid Chemical compound C1(=CC=CC=C1)S(=O)(=O)O.C(CC[C@@H](C(=O)O)NC(=O)C1=CC=C(NCC2CNC=3N=C(N)NC(=O)C3N2)C=C1)(=O)O RAFKAKSKKRLEJW-MMFRDWCLSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 230000007717 exclusion Effects 0.000 description 3
- 238000001640 fractional crystallisation Methods 0.000 description 3
- 125000000291 glutamic acid group Chemical group N[C@@H](CCC(O)=O)C(=O)* 0.000 description 3
- 125000004404 heteroalkyl group Chemical group 0.000 description 3
- 238000009904 heterogeneous catalytic hydrogenation reaction Methods 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 2
- OZJPLYNZGCXSJM-UHFFFAOYSA-N 5-valerolactone Chemical compound O=C1CCCCO1 OZJPLYNZGCXSJM-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical group COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- 239000001116 FEMA 4028 Substances 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- WHGYBXFWUBPSRW-FOUAGVGXSA-N beta-cyclodextrin Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO WHGYBXFWUBPSRW-FOUAGVGXSA-N 0.000 description 2
- 235000011175 beta-cyclodextrine Nutrition 0.000 description 2
- 229960004853 betadex Drugs 0.000 description 2
- 125000000484 butyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004475 heteroaralkyl group Chemical group 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 238000009905 homogeneous catalytic hydrogenation reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000001436 propyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- RRKODOZNUZCUBN-CCAGOZQPSA-N (1z,3z)-cycloocta-1,3-diene Chemical compound C1CC\C=C/C=C\C1 RRKODOZNUZCUBN-CCAGOZQPSA-N 0.000 description 1
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- IUVCFHHAEHNCFT-INIZCTEOSA-N 2-[(1s)-1-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)chromen-4-one Chemical compound C1=C(F)C(OC(C)C)=CC=C1C(C1=C(N)N=CN=C11)=NN1[C@@H](C)C1=C(C=2C=C(F)C=CC=2)C(=O)C2=CC(F)=CC=C2O1 IUVCFHHAEHNCFT-INIZCTEOSA-N 0.000 description 1
- VNJOEUSYAMPBAK-UHFFFAOYSA-N 2-methylbenzenesulfonic acid;hydrate Chemical compound O.CC1=CC=CC=C1S(O)(=O)=O VNJOEUSYAMPBAK-UHFFFAOYSA-N 0.000 description 1
- 125000000041 C6-C10 aryl group Chemical group 0.000 description 1
- PVEBKTNGBSBPIV-MMFRDWCLSA-N CC1=C(C=CC=C1)C.C(CC[C@@H](C(=O)O)NC(=O)C1=CC=C(NCC2CNC=3N=C(N)NC(=O)C3N2)C=C1)(=O)O Chemical compound CC1=C(C=CC=C1)C.C(CC[C@@H](C(=O)O)NC(=O)C1=CC=C(NCC2CNC=3N=C(N)NC(=O)C3N2)C=C1)(=O)O PVEBKTNGBSBPIV-MMFRDWCLSA-N 0.000 description 1
- PWDKZELWQMHUTI-MMFRDWCLSA-N CC=1C(=C(C2=CC=CC=C2C1)S(=O)(=O)O)C.C(CC[C@@H](C(=O)O)NC(=O)C1=CC=C(NCC2CNC=3N=C(N)NC(=O)C3N2)C=C1)(=O)O Chemical compound CC=1C(=C(C2=CC=CC=C2C1)S(=O)(=O)O)C.C(CC[C@@H](C(=O)O)NC(=O)C1=CC=C(NCC2CNC=3N=C(N)NC(=O)C3N2)C=C1)(=O)O PWDKZELWQMHUTI-MMFRDWCLSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Chemical class CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 125000006177 alkyl benzyl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000001204 arachidyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000006622 cycloheptylmethyl group Chemical group 0.000 description 1
- PDXRQENMIVHKPI-UHFFFAOYSA-N cyclohexane-1,1-diol Chemical compound OC1(O)CCCCC1 PDXRQENMIVHKPI-UHFFFAOYSA-N 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- IIXOVPGRABFCAI-UHFFFAOYSA-N cyclohexylmethanediol Chemical compound OC(O)C1CCCCC1 IIXOVPGRABFCAI-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000006623 cyclooctylmethyl group Chemical group 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 125000003438 dodecyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005885 heterocycloalkylalkyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000000879 imine group Chemical group 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 125000006301 indolyl methyl group Chemical group 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229940017219 methyl propionate Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 125000001421 myristyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 125000002347 octyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
- 125000000913 palmityl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical class C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000006513 pyridinyl methyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000004079 stearyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000006173 tetrahydropyranylmethyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D475/00—Heterocyclic compounds containing pteridine ring systems
- C07D475/02—Heterocyclic compounds containing pteridine ring systems with an oxygen atom directly attached in position 4
- C07D475/04—Heterocyclic compounds containing pteridine ring systems with an oxygen atom directly attached in position 4 with a nitrogen atom directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH01300/99A CH695217A5 (de) | 1999-07-14 | 1999-07-14 | Verfahren zur Trennung optischer Isomeren von Tetrahydrofolsäureestersalzen und Tetrahydrofolsäure. |
| EP00949322A EP1200436B1 (de) | 1999-07-14 | 2000-07-12 | Verfahren zur herstellung reiner stereoisomeren von tetrahydrofolsäureestersalzen und tetrahydrofolsäure durch fraktionierte kristallisation von tetrahydrofolsäureestersalzen |
| JP2001509730A JP4949581B2 (ja) | 1999-07-14 | 2000-07-12 | テトラヒドロ葉酸エステル塩およびテトラヒドロ葉酸の純粋異性体をテトラヒドロ葉酸エステル塩の分別結晶化によって製造する方法 |
| US10/030,693 US6858731B1 (en) | 1999-07-14 | 2000-07-12 | Process for the preparation of pure stereoisomers of tetrahydrofolic acid esters salts and tetrahydrofolic acid by fractionated crystallization of tetrahydrofolic acid esters salts |
| AU62727/00A AU6272700A (en) | 1999-07-14 | 2000-07-12 | Method for making pure stereoisomers of tetrahydrofolic acid ester salts and tetrahydrofolic acid by fractionated crystallisation of tetrahydrofolic acid salts |
| CNB008102430A CN1206229C (zh) | 1999-07-14 | 2000-07-12 | 通过对四氢叶酸酯盐分级结晶来制备四氢叶酸酯盐和四氢叶酸的纯立体异构体的方法 |
| DE50015428T DE50015428D1 (de) | 1999-07-14 | 2000-07-12 | Verfahren zur herstellung reiner stereoisomeren von tetrahydrofolsäureestersalzen und tetrahydrofolsäure durch fraktionierte kristallisation von tetrahydrofolsäureestersalzen |
| ES00949322T ES2316375T3 (es) | 1999-07-14 | 2000-07-12 | Procedimiento para la preparacion de estereoisomeros puros de ciertas sales de esteres del acido tetrahidrofilico y del acido tetrahidrofilico mediante cristalizacion fraccionada de sales de esteres del acido tetrahidrofolico. |
| DK00949322T DK1200436T3 (da) | 1999-07-14 | 2000-07-12 | Fremgangsmåde til fremstilling af rene stereoisomerer af tetrahydrofolsyreestersalte og tetrahydrofolsyre ved fraktioneret krystallisering af tetrahydrofolsyreestersalte |
| AT00949322T ATE412654T1 (de) | 1999-07-14 | 2000-07-12 | Verfahren zur herstellung reiner stereoisomeren von tetrahydrofolsäureestersalzen und tetrahydrofolsäure durch fraktionierte kristallisation von tetrahydrofolsäureestersalzen |
| PCT/EP2000/006647 WO2001004121A1 (de) | 1999-07-14 | 2000-07-12 | Verfahren zur herstellung reiner stereoisomeren von tetrahydrofolsäureestersalzen und tetrahydrofolsäure durch fraktionierte kristallisation von tetrahydrofolsäureestersalzen |
| CA002378869A CA2378869C (en) | 1999-07-14 | 2000-07-12 | Method for making pure stereoisomers of tetrahydrofolic acid ester salts and tetrahydrofolic acid by fractionated crystallisation of tetrahydrofolic acid salts |
| PT00949322T PT1200436E (pt) | 1999-07-14 | 2000-07-12 | Método para fazer estereoisómeros puros de sais de éster do ácido tetra-hidrofólico e do ácido tetra-hidrofólico por cristalização fraccionada de sais do ácido tetra-hidrofólico |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH01300/99A CH695217A5 (de) | 1999-07-14 | 1999-07-14 | Verfahren zur Trennung optischer Isomeren von Tetrahydrofolsäureestersalzen und Tetrahydrofolsäure. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH695217A5 true CH695217A5 (de) | 2006-01-31 |
Family
ID=4207222
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH01300/99A CH695217A5 (de) | 1999-07-14 | 1999-07-14 | Verfahren zur Trennung optischer Isomeren von Tetrahydrofolsäureestersalzen und Tetrahydrofolsäure. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US6858731B1 (https=) |
| EP (1) | EP1200436B1 (https=) |
| JP (1) | JP4949581B2 (https=) |
| CN (1) | CN1206229C (https=) |
| AT (1) | ATE412654T1 (https=) |
| AU (1) | AU6272700A (https=) |
| CA (1) | CA2378869C (https=) |
| CH (1) | CH695217A5 (https=) |
| DE (1) | DE50015428D1 (https=) |
| DK (1) | DK1200436T3 (https=) |
| ES (1) | ES2316375T3 (https=) |
| PT (1) | PT1200436E (https=) |
| WO (1) | WO2001004121A1 (https=) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH694251A5 (de) * | 1999-07-14 | 2004-10-15 | Eprova Ag | Herstellung von Tetrahydropterin und Derivaten. |
| ITMI20020132A1 (it) | 2002-01-25 | 2003-07-25 | Gmt Fine Chemicals Sa | Processo per l'ottenimento dell'acido (6s)-5,6,7,8-tetraidrofolico |
| PT3817812T (pt) | 2018-07-06 | 2023-12-28 | Merck Patent Gmbh | Sal cristalino de acido 5-metil-(68)-tetra-hidrofólico e éster etílico de l-isoleucina |
| CN116836166B (zh) * | 2023-06-30 | 2025-10-31 | 山东师范大学 | 一种叶酸衍生物及其制备方法和防治铁死亡中的应用 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS497416A (https=) * | 1972-05-12 | 1974-01-23 | ||
| DE3821875C1 (https=) | 1988-06-29 | 1990-02-15 | Eprova Ag, Forschungsinstitut, Schaffhausen, Ch | |
| CH681303A5 (https=) | 1991-01-16 | 1993-02-26 | Eprova Ag | |
| CH682664A5 (en) * | 1991-10-15 | 1993-10-29 | Eprova Ag | Stable salts of 5,10-methylene tetrahydrofolate. |
| US5300503A (en) | 1991-11-01 | 1994-04-05 | Fmc Corporation | Insecticidal 4,6-diamino-1,2-dihydro-1,3,5-triazine derivatives |
| US5698693A (en) * | 1992-11-16 | 1997-12-16 | The United States Of America As Represented By The Department Of Health And Human Services | Process of separating the diastereomers of (6R,6S) -5,6,7,8-tetrahydrofolic acid derivatives |
| CH686672A5 (de) * | 1992-12-01 | 1996-05-31 | Cerbios Pharma Sa | Verfahren zur Herstellung von (6S)-5,6,7,8-Tetrahydrofolsaeure. |
| CH686369A5 (de) * | 1994-05-09 | 1996-03-15 | Eprova Ag | Stabile kristalline (6S)- und (6R)-Tetrahydrofolseure. |
| JP3433301B2 (ja) * | 1993-11-25 | 2003-08-04 | アサヒビール株式会社 | 5,6,7,8−テトラヒドロ−d−ネオプテリンの有機酸塩の製造法 |
-
1999
- 1999-07-14 CH CH01300/99A patent/CH695217A5/de not_active IP Right Cessation
-
2000
- 2000-07-12 WO PCT/EP2000/006647 patent/WO2001004121A1/de not_active Ceased
- 2000-07-12 AT AT00949322T patent/ATE412654T1/de active
- 2000-07-12 EP EP00949322A patent/EP1200436B1/de not_active Expired - Lifetime
- 2000-07-12 DE DE50015428T patent/DE50015428D1/de not_active Expired - Lifetime
- 2000-07-12 AU AU62727/00A patent/AU6272700A/en not_active Abandoned
- 2000-07-12 ES ES00949322T patent/ES2316375T3/es not_active Expired - Lifetime
- 2000-07-12 US US10/030,693 patent/US6858731B1/en not_active Expired - Lifetime
- 2000-07-12 PT PT00949322T patent/PT1200436E/pt unknown
- 2000-07-12 JP JP2001509730A patent/JP4949581B2/ja not_active Expired - Lifetime
- 2000-07-12 CA CA002378869A patent/CA2378869C/en not_active Expired - Lifetime
- 2000-07-12 CN CNB008102430A patent/CN1206229C/zh not_active Expired - Lifetime
- 2000-07-12 DK DK00949322T patent/DK1200436T3/da active
Also Published As
| Publication number | Publication date |
|---|---|
| CN1206229C (zh) | 2005-06-15 |
| CN1360586A (zh) | 2002-07-24 |
| JP2003504371A (ja) | 2003-02-04 |
| CA2378869C (en) | 2006-12-12 |
| JP4949581B2 (ja) | 2012-06-13 |
| CA2378869A1 (en) | 2001-01-18 |
| WO2001004121A1 (de) | 2001-01-18 |
| US6858731B1 (en) | 2005-02-22 |
| DK1200436T3 (da) | 2009-02-23 |
| ATE412654T1 (de) | 2008-11-15 |
| AU6272700A (en) | 2001-01-30 |
| EP1200436B1 (de) | 2008-10-29 |
| DE50015428D1 (de) | 2008-12-11 |
| EP1200436A1 (de) | 2002-05-02 |
| PT1200436E (pt) | 2009-02-10 |
| ES2316375T3 (es) | 2009-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP3415515A1 (de) | Verfahren zur herstellung von methyl-{4,6-diamino-2-[1-(2-fluorobenzyl)-1h-pyrazolo[3,4-b]pyridin-3-yl]pyrimidin-5-yl}methylcarbamat | |
| HUE032304T2 (en) | Process for the preparation of pemetrexed and lysin salt thereof | |
| DE60215213T2 (de) | Herstellung von levofloxacin hemihydrat | |
| CH689831A5 (de) | Stabile kristalline Tetrahydrofolsaeure-Salze. | |
| EP0682026A1 (de) | Stabile kristalline (6S)- und (6R)-Tetrahydrofolsäure | |
| US4649197A (en) | Sulfate of 5,6,7,8-tetrahydro-L-erythro-biopterin and process for preparing the same | |
| EP1200437B1 (de) | Verfahren zur herstellung von optisch reinen tetrahydropterinen und derivaten, im speziellen optisch reiner tetrahydrofolsäure und ihren derivaten, durch stereospezifische hydrierung | |
| DE69400334T2 (de) | Diaminsalze von clavulansäure | |
| WO2017080770A1 (de) | Synthese von (z)-endoxifenhydrochlorid | |
| DE69027063T2 (de) | Enantioselektive Synthese von Antifolaten | |
| DE2425983B2 (de) | Sulfonsaeuresalze von acylcholinen, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische zusammensetzung | |
| EP3271337B1 (de) | Verfahren zur herstellung von (4s)-4-[4-cyano-2-(methylsulfonyl)phenyl]-3,6-dimethyl-2-oxo-1-[3-(trifluormethyl)phenyl]-1,2,3,4-tetrahydro pyrimidin-5-carbonitril | |
| EP1200436B1 (de) | Verfahren zur herstellung reiner stereoisomeren von tetrahydrofolsäureestersalzen und tetrahydrofolsäure durch fraktionierte kristallisation von tetrahydrofolsäureestersalzen | |
| US6197998B1 (en) | Process for producing N-glycyltyrosine and its crystal structure | |
| EP1444234A2 (de) | Deuterierte pyrazolopyrimidinone sowie diese verbindungen enthaltende arzneimittel | |
| EP0570764A2 (de) | Asymmetrische Hydrierung | |
| EP0600460A1 (de) | Verfahren zur Herstellung von (6S)-5,6,7,8-Tetrahydrofolsäure | |
| DE69108743T2 (de) | Recematspaltung von trans-2-(2-pyrimidinyl)-7-(hydroxymethyl)octahydro-2h-pyrido[1,2-a]-pyrazin. | |
| DE69504189T2 (de) | Verfahren zur herstellung und trennung von diastereomeren salzen von folinsäure | |
| AT392068B (de) | Optisch aktive oxo-isoindolinylderivate | |
| EP0167045A1 (de) | Benzo (c)(1,8)naphthyridine, Verfahren zu ihrer Herstellung und ihre Verwendung sowie diese Verbindungen enthaltende Zubereitungen | |
| KR20060009155A (ko) | 고순도의 레보플록사신 제조방법 | |
| DE2240442A1 (de) | Verfahren zur herstellung von aminopenicillinen | |
| DE68916126T2 (de) | Optisch aktive Piperazin-Derivate. | |
| DE4309123C2 (de) | Verfahren zur Herstellung von 2,4-Diamino-6-(hydroxymethyl)pteridin-Salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PFA | Name/firm changed |
Owner name: MERCK EPROVA AG Free format text: EPROVA AG#IM LATERNENACKER 5#8200 SCHAFFHAUSEN (CH) -TRANSFER TO- MERCK EPROVA AG#IM LATERNENACKER 5#8200 SCHAFFHAUSEN (CH) |
|
| PL | Patent ceased |