CH651827A5 - Carbostyrilderivate, verfahren zu ihrer herstellung und kardiotonische zusammensetzungen, welche diese enthalten. - Google Patents
Carbostyrilderivate, verfahren zu ihrer herstellung und kardiotonische zusammensetzungen, welche diese enthalten. Download PDFInfo
- Publication number
- CH651827A5 CH651827A5 CH996/82A CH99682A CH651827A5 CH 651827 A5 CH651827 A5 CH 651827A5 CH 996/82 A CH996/82 A CH 996/82A CH 99682 A CH99682 A CH 99682A CH 651827 A5 CH651827 A5 CH 651827A5
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- lower alkyl
- alkyl group
- carbostyril
- phenyl
- Prior art date
Links
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical class C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 title claims description 112
- 239000000203 mixture Substances 0.000 title claims description 54
- 238000000034 method Methods 0.000 title claims description 53
- 230000003177 cardiotonic effect Effects 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title description 6
- -1 1-piperidyl group Chemical group 0.000 claims description 681
- 150000001875 compounds Chemical class 0.000 claims description 176
- 125000000217 alkyl group Chemical group 0.000 claims description 149
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 110
- 125000001424 substituent group Chemical group 0.000 claims description 107
- 125000005843 halogen group Chemical group 0.000 claims description 67
- 125000003545 alkoxy group Chemical group 0.000 claims description 61
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 28
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 27
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 23
- 238000002360 preparation method Methods 0.000 claims description 22
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 18
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 17
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 17
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 16
- 125000004193 piperazinyl group Chemical group 0.000 claims description 16
- 125000003277 amino group Chemical group 0.000 claims description 15
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 15
- 125000002252 acyl group Chemical group 0.000 claims description 14
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 125000003342 alkenyl group Chemical group 0.000 claims description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 12
- 125000000304 alkynyl group Chemical group 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 12
- 230000008569 process Effects 0.000 claims description 10
- 125000004414 alkyl thio group Chemical group 0.000 claims description 9
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000004423 acyloxy group Chemical group 0.000 claims description 8
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 8
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 7
- 125000000623 heterocyclic group Chemical group 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 125000005090 alkenylcarbonyl group Chemical group 0.000 claims description 5
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 5
- 125000001589 carboacyl group Chemical group 0.000 claims description 5
- 238000006467 substitution reaction Methods 0.000 claims description 5
- UQYCHNFDTXIQMM-UHFFFAOYSA-N 6-(4-benzylpiperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1C(=O)N(CC1)CCN1CC1=CC=CC=C1 UQYCHNFDTXIQMM-UHFFFAOYSA-N 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 4
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 4
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 3
- HIMAPQCWSZVHEJ-UHFFFAOYSA-N 6-[4-(2-phenoxyethyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1C(=O)N(CC1)CCN1CCOC1=CC=CC=C1 HIMAPQCWSZVHEJ-UHFFFAOYSA-N 0.000 claims description 3
- CLHIDJDMMMVCFX-UHFFFAOYSA-N 6-[4-[(4-chlorophenyl)-phenylmethyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)N1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 CLHIDJDMMMVCFX-UHFFFAOYSA-N 0.000 claims description 3
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 239000012876 carrier material Substances 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 claims 1
- JXGUHKJKWBEVEP-UHFFFAOYSA-N 6-[4-(2-methylpropyl)piperazine-1-carbonyl]-1h-quinolin-2-one Chemical compound C1CN(CC(C)C)CCN1C(=O)C1=CC=C(NC(=O)C=C2)C2=C1 JXGUHKJKWBEVEP-UHFFFAOYSA-N 0.000 claims 1
- BRTSRAFGNVSHJV-UHFFFAOYSA-N 6-[4-(2-methylpropyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(CC(C)C)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 BRTSRAFGNVSHJV-UHFFFAOYSA-N 0.000 claims 1
- ZBRWSODNRGCQMV-UHFFFAOYSA-N 6-[4-(2-phenoxyethyl)piperazine-1-carbonyl]-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)C=CC2=CC=1C(=O)N(CC1)CCN1CCOC1=CC=CC=C1 ZBRWSODNRGCQMV-UHFFFAOYSA-N 0.000 claims 1
- MXCARJQEMVOHAU-UHFFFAOYSA-N 6-[4-(3-oxo-3-phenylpropyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CCN1CCC(=O)C1=CC=CC=C1 MXCARJQEMVOHAU-UHFFFAOYSA-N 0.000 claims 1
- CDRWBUGLZBPPCL-UHFFFAOYSA-N 6-[4-(3-phenylpropyl)piperazine-1-carbonyl]-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)C=CC2=CC=1C(=O)N(CC1)CCN1CCCC1=CC=CC=C1 CDRWBUGLZBPPCL-UHFFFAOYSA-N 0.000 claims 1
- MMPBSPPVURMDBU-UHFFFAOYSA-N 6-[4-[(4-methoxyphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 MMPBSPPVURMDBU-UHFFFAOYSA-N 0.000 claims 1
- 241000790917 Dioxys <bee> Species 0.000 claims 1
- 125000005605 benzo group Chemical group 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 239000013078 crystal Substances 0.000 description 189
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 130
- 238000006243 chemical reaction Methods 0.000 description 129
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 118
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 101
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 88
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 80
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 71
- 239000000243 solution Substances 0.000 description 66
- 239000002904 solvent Substances 0.000 description 65
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 63
- 238000000354 decomposition reaction Methods 0.000 description 61
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 48
- 235000019441 ethanol Nutrition 0.000 description 47
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 46
- 125000004432 carbon atom Chemical group C* 0.000 description 45
- 239000011541 reaction mixture Substances 0.000 description 44
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 42
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 37
- 150000001412 amines Chemical class 0.000 description 34
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 33
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- 239000007858 starting material Substances 0.000 description 28
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 26
- 239000002253 acid Substances 0.000 description 26
- 235000002639 sodium chloride Nutrition 0.000 description 25
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 239000003795 chemical substances by application Substances 0.000 description 23
- 229920006395 saturated elastomer Polymers 0.000 description 23
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 20
- 238000003756 stirring Methods 0.000 description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 19
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 18
- 239000010410 layer Substances 0.000 description 18
- 238000006722 reduction reaction Methods 0.000 description 18
- 239000011780 sodium chloride Substances 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 150000007514 bases Chemical class 0.000 description 16
- 238000001914 filtration Methods 0.000 description 16
- 230000009467 reduction Effects 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 14
- 239000003054 catalyst Substances 0.000 description 14
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 14
- 239000000725 suspension Substances 0.000 description 13
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 12
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 12
- 238000001953 recrystallisation Methods 0.000 description 12
- 239000003826 tablet Substances 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 241000282472 Canis lupus familiaris Species 0.000 description 11
- 230000000144 pharmacologic effect Effects 0.000 description 11
- 230000008859 change Effects 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 235000017557 sodium bicarbonate Nutrition 0.000 description 10
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 150000008065 acid anhydrides Chemical class 0.000 description 9
- 239000008280 blood Substances 0.000 description 9
- 210000004369 blood Anatomy 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 239000012044 organic layer Substances 0.000 description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 8
- 230000017531 blood circulation Effects 0.000 description 8
- 239000012452 mother liquor Substances 0.000 description 8
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 7
- 150000008282 halocarbons Chemical class 0.000 description 7
- 230000002140 halogenating effect Effects 0.000 description 7
- 238000001990 intravenous administration Methods 0.000 description 7
- 239000008101 lactose Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- QNRATNLHPGXHMA-XZHTYLCXSA-N (r)-(6-ethoxyquinolin-4-yl)-[(2s,4s,5r)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride Chemical compound Cl.C([C@H]([C@H](C1)CC)C2)CN1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OCC)C=C21 QNRATNLHPGXHMA-XZHTYLCXSA-N 0.000 description 6
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 229920002472 Starch Polymers 0.000 description 6
- 210000004351 coronary vessel Anatomy 0.000 description 6
- 150000002170 ethers Chemical class 0.000 description 6
- 239000012442 inert solvent Substances 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000010898 silica gel chromatography Methods 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 235000019698 starch Nutrition 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 5
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 5
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 5
- DUFYYKGNRAMGNG-UHFFFAOYSA-N 2-oxo-3,4-dihydro-1h-quinoline-6-carboxylic acid Chemical compound N1C(=O)CCC2=CC(C(=O)O)=CC=C21 DUFYYKGNRAMGNG-UHFFFAOYSA-N 0.000 description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 5
- DRMRWGJNMPRBIO-UHFFFAOYSA-N 6-(piperazine-1-carbonyl)-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)C=CC2=CC=1C(=O)N1CCNCC1 DRMRWGJNMPRBIO-UHFFFAOYSA-N 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 5
- 239000002841 Lewis acid Substances 0.000 description 5
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 5
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 5
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 5
- 210000001367 artery Anatomy 0.000 description 5
- 238000010531 catalytic reduction reaction Methods 0.000 description 5
- 239000003638 chemical reducing agent Substances 0.000 description 5
- 239000002026 chloroform extract Substances 0.000 description 5
- 238000006356 dehydrogenation reaction Methods 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- 150000007517 lewis acids Chemical class 0.000 description 5
- 210000003205 muscle Anatomy 0.000 description 5
- 238000006396 nitration reaction Methods 0.000 description 5
- 229960001412 pentobarbital Drugs 0.000 description 5
- 239000002798 polar solvent Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 5
- ZUGRYLJRHKHZLR-UHFFFAOYSA-N 1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC=C2NC(=O)C=CC2=C1 ZUGRYLJRHKHZLR-UHFFFAOYSA-N 0.000 description 4
- ZJNIZXCCXHUGPO-UHFFFAOYSA-N 2-oxo-3,4-dihydro-1h-quinoline-6-carboxylic acid;pyrrolidine-2,5-dione Chemical compound O=C1CCC(=O)N1.N1C(=O)CCC2=CC(C(=O)O)=CC=C21 ZJNIZXCCXHUGPO-UHFFFAOYSA-N 0.000 description 4
- DVAXCYOGICFKQM-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC=C2NC(=O)CCC2=C1 DVAXCYOGICFKQM-UHFFFAOYSA-N 0.000 description 4
- UKRYUVLBWGYQBY-UHFFFAOYSA-N 6-(piperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1C(=O)N1CCNCC1 UKRYUVLBWGYQBY-UHFFFAOYSA-N 0.000 description 4
- GCHAVGULYPPIHQ-UHFFFAOYSA-N 6-[4-(3,4-dimethoxybenzoyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)N1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 GCHAVGULYPPIHQ-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 150000004982 aromatic amines Chemical class 0.000 description 4
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 4
- 239000008103 glucose Substances 0.000 description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000012046 mixed solvent Substances 0.000 description 4
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 4
- 235000011007 phosphoric acid Nutrition 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 230000009090 positive inotropic effect Effects 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 3
- WNWHHMBRJJOGFJ-UHFFFAOYSA-N 16-methylheptadecan-1-ol Chemical class CC(C)CCCCCCCCCCCCCCCO WNWHHMBRJJOGFJ-UHFFFAOYSA-N 0.000 description 3
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 3
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 3
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 3
- NOTNUVGFGVOYCH-UHFFFAOYSA-N 6-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 NOTNUVGFGVOYCH-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 3
- GQHTUMJGOHRCHB-UHFFFAOYSA-N DBU Substances C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 239000000739 antihistaminic agent Substances 0.000 description 3
- 229940125715 antihistaminic agent Drugs 0.000 description 3
- 239000002220 antihypertensive agent Substances 0.000 description 3
- 230000001746 atrial effect Effects 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 235000014121 butter Nutrition 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000007884 disintegrant Substances 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- ZFGMDIBRIDKWMY-PASTXAENSA-N heparin Chemical compound CC(O)=N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COS(O)(=O)=O)O[C@@H]1O[C@@H]1[C@@H](C(O)=O)O[C@@H](O[C@H]2[C@@H]([C@@H](OS(O)(=O)=O)[C@@H](O[C@@H]3[C@@H](OC(O)[C@H](OS(O)(=O)=O)[C@H]3O)C(O)=O)O[C@@H]2O)CS(O)(=O)=O)[C@H](O)[C@H]1O ZFGMDIBRIDKWMY-PASTXAENSA-N 0.000 description 3
- 229920000669 heparin Polymers 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- XVDBWWRIXBMVJV-UHFFFAOYSA-N n-[bis(dimethylamino)phosphanyl]-n-methylmethanamine Chemical compound CN(C)P(N(C)C)N(C)C XVDBWWRIXBMVJV-UHFFFAOYSA-N 0.000 description 3
- 230000000802 nitrating effect Effects 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 3
- 210000003540 papillary muscle Anatomy 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 210000005245 right atrium Anatomy 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 238000005303 weighing Methods 0.000 description 3
- DIVNUTGTTIRPQA-UHFFFAOYSA-N (3,4-dimethoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1OC DIVNUTGTTIRPQA-UHFFFAOYSA-N 0.000 description 2
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 2
- GNXMCWKBRHHVBF-UHFFFAOYSA-N 1-benzyl-6-[4-(2-phenoxyethyl)piperazine-1-carbonyl]-3,4-dihydroquinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2N(CC=3C=CC=CC=3)C(=O)CCC2=CC=1C(=O)N(CC1)CCN1CCOC1=CC=CC=C1 GNXMCWKBRHHVBF-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- 125000006197 2-benzoyl ethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(=O)C([H])([H])C([H])([H])* 0.000 description 2
- 125000005999 2-bromoethyl group Chemical group 0.000 description 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 2
- ORBGMTCJGXSBNO-UHFFFAOYSA-N 2-oxo-3,4-dihydro-1h-quinoline-5-carboxylic acid Chemical compound N1C(=O)CCC2=C1C=CC=C2C(=O)O ORBGMTCJGXSBNO-UHFFFAOYSA-N 0.000 description 2
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 description 2
- DAUAQNGYDSHRET-UHFFFAOYSA-N 3,4-dimethoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1OC DAUAQNGYDSHRET-UHFFFAOYSA-N 0.000 description 2
- YZMGOVZHTUYCIT-UHFFFAOYSA-N 3-(3-ethoxyprop-2-enoylamino)benzoic acid Chemical compound CCOC=CC(=O)NC1=CC=CC(C(O)=O)=C1 YZMGOVZHTUYCIT-UHFFFAOYSA-N 0.000 description 2
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 2
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 2
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- SYVYBZHDXBOMSW-UHFFFAOYSA-N 5-[4-(2-methylpropyl)piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(CC(C)C)CCN1C(=O)C1=CC=CC2=C1C=CC(=O)N2 SYVYBZHDXBOMSW-UHFFFAOYSA-N 0.000 description 2
- GKSSJCYQLHDXCK-UHFFFAOYSA-N 6-(2,2-dibromoacetyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(C(=O)C(Br)Br)=CC=C21 GKSSJCYQLHDXCK-UHFFFAOYSA-N 0.000 description 2
- LWNXMMSHCITRQJ-UHFFFAOYSA-N 6-(4-hexylpiperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(CCCCCC)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 LWNXMMSHCITRQJ-UHFFFAOYSA-N 0.000 description 2
- IOJKNUKBGYDVPH-UHFFFAOYSA-N 6-(4-methylpiperidine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(C)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 IOJKNUKBGYDVPH-UHFFFAOYSA-N 0.000 description 2
- HNRUHXWHCXANTR-UHFFFAOYSA-N 6-(morpholine-4-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1C(=O)N1CCOCC1 HNRUHXWHCXANTR-UHFFFAOYSA-N 0.000 description 2
- RINMNHWVSCYIHO-UHFFFAOYSA-N 6-(pyrrolidine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1C(=O)N1CCCC1 RINMNHWVSCYIHO-UHFFFAOYSA-N 0.000 description 2
- AIAGSFMDZZSAQY-UHFFFAOYSA-N 6-[4-(2-hydroxypropyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(CC(O)C)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 AIAGSFMDZZSAQY-UHFFFAOYSA-N 0.000 description 2
- RWLKCAOKKAIXLY-UHFFFAOYSA-N 6-[4-(2-oxopropyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(CC(=O)C)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 RWLKCAOKKAIXLY-UHFFFAOYSA-N 0.000 description 2
- NBTBPOTZYIELRN-UHFFFAOYSA-N 6-[4-(2-phenoxyethyl)piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)C=CC2=CC=1C(=O)N(CC1)CCN1CCOC1=CC=CC=C1 NBTBPOTZYIELRN-UHFFFAOYSA-N 0.000 description 2
- PTNKLIZJQQTUHG-UHFFFAOYSA-N 6-[4-(3-chlorobenzoyl)piperazine-1-carbonyl]-1h-quinolin-2-one Chemical compound ClC1=CC=CC(C(=O)N2CCN(CC2)C(=O)C=2C=C3C=CC(=O)NC3=CC=2)=C1 PTNKLIZJQQTUHG-UHFFFAOYSA-N 0.000 description 2
- SLEFKXUAKPLBGR-UHFFFAOYSA-N 6-[4-(3-oxo-3-phenylpropyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CCN1CCC(=O)C1=CC=CC=C1 SLEFKXUAKPLBGR-UHFFFAOYSA-N 0.000 description 2
- JTWNLINHXMNUNX-UHFFFAOYSA-N 6-[4-(cyclohexylmethyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)CCC2=CC=1C(=O)N(CC1)CCN1CC1CCCCC1 JTWNLINHXMNUNX-UHFFFAOYSA-N 0.000 description 2
- REWJSHWKTUCBPM-UHFFFAOYSA-N 6-[4-[(4-aminophenyl)methyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(N)=CC=C1CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 REWJSHWKTUCBPM-UHFFFAOYSA-N 0.000 description 2
- CANFYHZNNBRZSD-UHFFFAOYSA-N 6-[4-[(4-methoxyphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 CANFYHZNNBRZSD-UHFFFAOYSA-N 0.000 description 2
- AZARCYOLHCRETG-UHFFFAOYSA-N 6-[4-[2-(4-hydroxyphenyl)-2-oxoethyl]piperazine-1-carbonyl]-3,4-dihydro-1H-quinolin-2-one hydrochloride Chemical compound Cl.C1=CC(O)=CC=C1C(=O)CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 AZARCYOLHCRETG-UHFFFAOYSA-N 0.000 description 2
- LOQQTAUHDUFIMM-UHFFFAOYSA-N 6-[4-[2-(4-methylphenyl)-2-oxoethyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC(C)=CC=C1C(=O)CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 LOQQTAUHDUFIMM-UHFFFAOYSA-N 0.000 description 2
- RGTVQPWMSCXNCX-UHFFFAOYSA-N 7-(4-benzylpiperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2CCC(=O)NC2=CC=1C(=O)N(CC1)CCN1CC1=CC=CC=C1 RGTVQPWMSCXNCX-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- XXNVFKODTPSOAI-UHFFFAOYSA-N 8-(2-chloroacetyl)-1h-quinolin-2-one Chemical compound C1=CC(=O)NC2=C1C=CC=C2C(=O)CCl XXNVFKODTPSOAI-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- JRWZLRBJNMZMFE-UHFFFAOYSA-N Dobutamine Chemical compound C=1C=C(O)C(O)=CC=1CCNC(C)CCC1=CC=C(O)C=C1 JRWZLRBJNMZMFE-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- DCXXMTOCNZCJGO-UHFFFAOYSA-N Glycerol trioctadecanoate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC DCXXMTOCNZCJGO-UHFFFAOYSA-N 0.000 description 2
- 241001466453 Laminaria Species 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- GPVDHNVGGIAOQT-UHFFFAOYSA-N Veratric acid Natural products COC1=CC=C(C(O)=O)C(OC)=C1 GPVDHNVGGIAOQT-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 235000010419 agar Nutrition 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 230000000740 bleeding effect Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000005997 bromomethyl group Chemical group 0.000 description 2
- 229940124630 bronchodilator Drugs 0.000 description 2
- 239000000168 bronchodilator agent Substances 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 239000012973 diazabicyclooctane Substances 0.000 description 2
- LGTLXDJOAJDFLR-UHFFFAOYSA-N diethyl chlorophosphate Chemical compound CCOP(Cl)(=O)OCC LGTLXDJOAJDFLR-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- BAKNVNRBDDSWAO-UHFFFAOYSA-N ethyl 2-[4-(2-oxo-3,4-dihydro-1h-quinoline-6-carbonyl)piperazin-1-yl]acetate;hydrochloride Chemical compound Cl.C1CN(CC(=O)OCC)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 BAKNVNRBDDSWAO-UHFFFAOYSA-N 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 230000000297 inotrophic effect Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 150000002641 lithium Chemical class 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- WZTUDEBHYBHGHD-UHFFFAOYSA-N methyl 3-[4-(2-chloroacetyl)phenyl]propanoate Chemical compound COC(=O)CCC1=CC=C(C(=O)CCl)C=C1 WZTUDEBHYBHGHD-UHFFFAOYSA-N 0.000 description 2
- RPUSRLKKXPQSGP-UHFFFAOYSA-N methyl 3-phenylpropanoate Chemical compound COC(=O)CCC1=CC=CC=C1 RPUSRLKKXPQSGP-UHFFFAOYSA-N 0.000 description 2
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 229960002216 methylparaben Drugs 0.000 description 2
- 150000002780 morpholines Chemical class 0.000 description 2
- 230000002107 myocardial effect Effects 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229960003975 potassium Drugs 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 2
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 229940001584 sodium metabisulfite Drugs 0.000 description 2
- 235000010262 sodium metabisulphite Nutrition 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 2
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- 229940124549 vasodilator Drugs 0.000 description 2
- 239000003071 vasodilator agent Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- ZXSQEZNORDWBGZ-UHFFFAOYSA-N 1,3-dihydropyrrolo[2,3-b]pyridin-2-one Chemical compound C1=CN=C2NC(=O)CC2=C1 ZXSQEZNORDWBGZ-UHFFFAOYSA-N 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- JVDVDHKLAUQUCK-UHFFFAOYSA-N 1-[4-(2-oxo-3,4-dihydro-1h-quinoline-6-carbonyl)piperazin-1-yl]propan-2-yl acetate;hydrochloride Chemical compound Cl.C1CN(CC(C)OC(C)=O)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 JVDVDHKLAUQUCK-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- YOYAIZYFCNQIRF-UHFFFAOYSA-N 2,6-dichlorobenzonitrile Chemical compound ClC1=CC=CC(Cl)=C1C#N YOYAIZYFCNQIRF-UHFFFAOYSA-N 0.000 description 1
- IWSIHNNMAPOMPL-UHFFFAOYSA-N 2-[4-(2-oxo-3,4-dihydro-1h-quinoline-6-carbonyl)piperazin-1-yl]acetamide Chemical compound C1CN(CC(=O)N)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 IWSIHNNMAPOMPL-UHFFFAOYSA-N 0.000 description 1
- XCSDHTIOXSNJNO-UHFFFAOYSA-N 2-[4-(2-oxo-3,4-dihydro-1h-quinoline-6-carbonyl)piperazin-1-yl]ethyl 3,4-dimethoxybenzoate;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C(=O)OCCN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 XCSDHTIOXSNJNO-UHFFFAOYSA-N 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000002379 2-iodobenzoyl group Chemical group IC1=C(C(=O)*)C=CC=C1 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- MYHZJFNXPLDYNN-UHFFFAOYSA-N 2-oxo-1h-quinoline-5-carboxylic acid Chemical compound N1C(=O)C=CC2=C1C=CC=C2C(=O)O MYHZJFNXPLDYNN-UHFFFAOYSA-N 0.000 description 1
- ZEGJLQZSCUPAPR-UHFFFAOYSA-N 2-oxo-1h-quinoline-6-carboxylic acid Chemical compound N1C(=O)C=CC2=CC(C(=O)O)=CC=C21 ZEGJLQZSCUPAPR-UHFFFAOYSA-N 0.000 description 1
- VMHBVINKMWNOED-UHFFFAOYSA-N 2-oxo-3,4-dihydro-1h-quinoline-7-carboxylic acid Chemical compound C1CC(=O)NC2=CC(C(=O)O)=CC=C21 VMHBVINKMWNOED-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- OZCVAKXZXRZWBM-UHFFFAOYSA-N 3,4-dimethoxybenzoic acid;pyrrolidine-2,5-dione Chemical compound O=C1CCC(=O)N1.COC1=CC=C(C(O)=O)C=C1OC OZCVAKXZXRZWBM-UHFFFAOYSA-N 0.000 description 1
- VIOBGCWEHLRBEP-UHFFFAOYSA-N 3,4-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1OC VIOBGCWEHLRBEP-UHFFFAOYSA-N 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- NMUGYYIGJDGBGN-UHFFFAOYSA-N 3-[4-(2-oxo-3,4-dihydro-1h-quinoline-6-carbonyl)piperazin-1-yl]propanenitrile;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)CCC2=CC=1C(=O)N1CCN(CCC#N)CC1 NMUGYYIGJDGBGN-UHFFFAOYSA-N 0.000 description 1
- XFDUHJPVQKIXHO-UHFFFAOYSA-N 3-aminobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1 XFDUHJPVQKIXHO-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- SFMFACMIOWQIPR-UHFFFAOYSA-N 3-ethoxyprop-2-enoyl chloride Chemical compound CCOC=CC(Cl)=O SFMFACMIOWQIPR-UHFFFAOYSA-N 0.000 description 1
- JSGVZVOGOQILFM-UHFFFAOYSA-N 3-methoxy-1-butanol Chemical compound COC(C)CCO JSGVZVOGOQILFM-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 1
- ZORFDKGBWZIFFU-UHFFFAOYSA-N 4-(2-oxo-3,4-dihydro-1h-quinoline-6-carbonyl)piperazine-1-carbaldehyde Chemical compound C1CN(C=O)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 ZORFDKGBWZIFFU-UHFFFAOYSA-N 0.000 description 1
- IPQDJUJVYXUXJQ-UHFFFAOYSA-N 4-(3-methoxy-3-oxopropyl)-3-nitrobenzoic acid Chemical compound COC(=O)CCC1=CC=C(C(O)=O)C=C1[N+]([O-])=O IPQDJUJVYXUXJQ-UHFFFAOYSA-N 0.000 description 1
- WWHJLVMBXXXUFO-UHFFFAOYSA-N 4-(chloromethyl)-1,2-dimethoxybenzene Chemical compound COC1=CC=C(CCl)C=C1OC WWHJLVMBXXXUFO-UHFFFAOYSA-N 0.000 description 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 1
- GJEHIZRZCVVYIY-UHFFFAOYSA-N 4-[4-(2-oxo-3,4-dihydro-1h-quinoline-6-carbonyl)piperazine-1-carbonyl]benzonitrile Chemical compound C1CN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CCN1C(=O)C1=CC=C(C#N)C=C1 GJEHIZRZCVVYIY-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- CMGDVUCDZOBDNL-UHFFFAOYSA-N 4-methyl-2h-benzotriazole Chemical compound CC1=CC=CC2=NNN=C12 CMGDVUCDZOBDNL-UHFFFAOYSA-N 0.000 description 1
- JCLFHZLOKITRCE-UHFFFAOYSA-N 4-pentoxyphenol Chemical compound CCCCCOC1=CC=C(O)C=C1 JCLFHZLOKITRCE-UHFFFAOYSA-N 0.000 description 1
- SIZACWVIUPLULB-UHFFFAOYSA-N 5-(4-benzylpiperazine-1-carbonyl)-1h-quinolin-2-one;hydrate;hydrochloride Chemical compound O.Cl.C=1C=CC=2NC(=O)C=CC=2C=1C(=O)N(CC1)CCN1CC1=CC=CC=C1 SIZACWVIUPLULB-UHFFFAOYSA-N 0.000 description 1
- RNNRZNMLZNCYQY-UHFFFAOYSA-N 5-(piperazine-1-carbonyl)-1h-quinolin-2-one Chemical compound C=1C=CC=2NC(=O)C=CC=2C=1C(=O)N1CCNCC1 RNNRZNMLZNCYQY-UHFFFAOYSA-N 0.000 description 1
- WYSFXNXQGVOJKV-UHFFFAOYSA-N 5-(piperazine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one Chemical compound N1(CCNCC1)C(=O)C1=C2CCC(NC2=CC=C1)=O WYSFXNXQGVOJKV-UHFFFAOYSA-N 0.000 description 1
- DEYFAKXZXXKPRE-UHFFFAOYSA-N 5-[4-(2-phenoxyethyl)piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=CC=2NC(=O)C=CC=2C=1C(=O)N(CC1)CCN1CCOC1=CC=CC=C1 DEYFAKXZXXKPRE-UHFFFAOYSA-N 0.000 description 1
- NZDOVCMKONSENV-UHFFFAOYSA-N 5-[4-(3-oxo-3-phenylpropyl)piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(C(=O)C=2C=3C=CC(=O)NC=3C=CC=2)CCN1CCC(=O)C1=CC=CC=C1 NZDOVCMKONSENV-UHFFFAOYSA-N 0.000 description 1
- VXTLVUZVUNWSGR-UHFFFAOYSA-N 5-[4-(3-phenylpropyl)piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=CC=2NC(=O)C=CC=2C=1C(=O)N(CC1)CCN1CCCC1=CC=CC=C1 VXTLVUZVUNWSGR-UHFFFAOYSA-N 0.000 description 1
- ZDZLUAJGHKSFEJ-UHFFFAOYSA-N 6-(2-chloroacetyl)-1h-quinolin-2-one Chemical compound N1C(=O)C=CC2=CC(C(=O)CCl)=CC=C21 ZDZLUAJGHKSFEJ-UHFFFAOYSA-N 0.000 description 1
- PUAKBWKOYSILGW-UHFFFAOYSA-N 6-(4-benzylpiperazine-1-carbonyl)-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)C=CC2=CC=1C(=O)N(CC1)CCN1CC1=CC=CC=C1 PUAKBWKOYSILGW-UHFFFAOYSA-N 0.000 description 1
- OTNPFWLKYCPXFT-UHFFFAOYSA-N 6-(4-benzylpiperidine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1C(=O)N(CC1)CCC1CC1=CC=CC=C1 OTNPFWLKYCPXFT-UHFFFAOYSA-N 0.000 description 1
- UZZOCKFNYMFION-UHFFFAOYSA-N 6-(4-cyclohexylpiperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1C(=O)N(CC1)CCN1C1CCCCC1 UZZOCKFNYMFION-UHFFFAOYSA-N 0.000 description 1
- SYXXDLOGQUYHSW-UHFFFAOYSA-N 6-(4-methylpiperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(C)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 SYXXDLOGQUYHSW-UHFFFAOYSA-N 0.000 description 1
- FRNKENIUQNPLRL-UHFFFAOYSA-N 6-(4-methylpiperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one;hydroiodide Chemical compound I.C1CN(C)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 FRNKENIUQNPLRL-UHFFFAOYSA-N 0.000 description 1
- YERFNWHFHULKBU-UHFFFAOYSA-N 6-(4-methylsulfonylpiperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(S(=O)(=O)C)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 YERFNWHFHULKBU-UHFFFAOYSA-N 0.000 description 1
- GZPARWHKGUPGSL-UHFFFAOYSA-N 6-(4-phenacylpiperazine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one hydrochloride Chemical compound Cl.C1CN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CCN1CC(=O)C1=CC=CC=C1 GZPARWHKGUPGSL-UHFFFAOYSA-N 0.000 description 1
- ONZHTNMSDJYWRW-UHFFFAOYSA-N 6-(4-propylpiperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(CCC)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 ONZHTNMSDJYWRW-UHFFFAOYSA-N 0.000 description 1
- YEBPUKCCDDFCBM-UHFFFAOYSA-N 6-(piperazine-1-carbonyl)-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)C=CC2=CC=1C(=O)N1CCNCC1 YEBPUKCCDDFCBM-UHFFFAOYSA-N 0.000 description 1
- LZJNRAGKGAHNMW-UHFFFAOYSA-N 6-(piperidine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1C(=O)N1CCCCC1 LZJNRAGKGAHNMW-UHFFFAOYSA-N 0.000 description 1
- ZLVCAJPOBSDRBT-UHFFFAOYSA-N 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.N1C(=O)CCC2=CC(C(N3CCN(CC=4C=C5OCOC5=CC=4)CC3)=O)=CC=C21 ZLVCAJPOBSDRBT-UHFFFAOYSA-N 0.000 description 1
- CHHBVFCMNWFKQY-UHFFFAOYSA-N 6-[4-(1,3-benzodioxole-5-carbonyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C2OCOC2=CC(C(N2CCN(CC2)C(=O)C=2C=C3CCC(=O)NC3=CC=2)=O)=C1 CHHBVFCMNWFKQY-UHFFFAOYSA-N 0.000 description 1
- WEGJMNISLFTAAQ-UHFFFAOYSA-N 6-[4-(2-methylpropyl)piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(CC(C)C)CCN1C(=O)C1=CC=C(NC(=O)C=C2)C2=C1 WEGJMNISLFTAAQ-UHFFFAOYSA-N 0.000 description 1
- BEVXRAJGLKTZCP-UHFFFAOYSA-N 6-[4-(2-phenoxyethyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)CCC2=CC=1C(=O)N(CC1)CCN1CCOC1=CC=CC=C1 BEVXRAJGLKTZCP-UHFFFAOYSA-N 0.000 description 1
- DNEAKAQMJPVYDA-UHFFFAOYSA-N 6-[4-(2-phenylethyl)piperazine-1-carbonyl]-3,4-dihydro-1H-quinolin-2-one hydrochloride Chemical compound Cl.C=1C=C2NC(=O)CCC2=CC=1C(=O)N(CC1)CCN1CCC1=CC=CC=C1 DNEAKAQMJPVYDA-UHFFFAOYSA-N 0.000 description 1
- PQAPHTBNBPPMND-UHFFFAOYSA-N 6-[4-(3,4-dichlorobenzoyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(Cl)C(Cl)=CC=C1C(=O)N1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 PQAPHTBNBPPMND-UHFFFAOYSA-N 0.000 description 1
- WXICCVZTXPKZGO-UHFFFAOYSA-N 6-[4-(3-chlorobenzoyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound ClC1=CC=CC(C(=O)N2CCN(CC2)C(=O)C=2C=C3CCC(=O)NC3=CC=2)=C1 WXICCVZTXPKZGO-UHFFFAOYSA-N 0.000 description 1
- CYAHKZXABIQOEV-UHFFFAOYSA-N 6-[4-(3-methoxybenzoyl)piperazine-1-carbonyl]-3,4-dihydro-1H-quinolin-2-one Chemical compound COC=1C=C(C(=O)N2CCN(CC2)C(=O)C=2C=C3CCC(NC3=CC=2)=O)C=CC=1 CYAHKZXABIQOEV-UHFFFAOYSA-N 0.000 description 1
- ZFEBIBKKUVWYHZ-UHFFFAOYSA-N 6-[4-(3-methylbutyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(CCC(C)C)CCN1C(=O)C1=CC=C(NC(=O)CC2)C2=C1 ZFEBIBKKUVWYHZ-UHFFFAOYSA-N 0.000 description 1
- NAJHEDHWUWPJIL-UHFFFAOYSA-N 6-[4-(3-phenoxypropyl)piperazine-1-carbonyl]-1-prop-2-ynyl-3,4-dihydroquinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2N(CC#C)C(=O)CCC2=CC=1C(=O)N(CC1)CCN1CCCOC1=CC=CC=C1 NAJHEDHWUWPJIL-UHFFFAOYSA-N 0.000 description 1
- MHECBQLTCOJICF-UHFFFAOYSA-N 6-[4-(3-phenoxypropyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)CCC2=CC=1C(=O)N(CC1)CCN1CCCOC1=CC=CC=C1 MHECBQLTCOJICF-UHFFFAOYSA-N 0.000 description 1
- ULOLCUDKEFOVJB-UHFFFAOYSA-N 6-[4-(3-phenylpropyl)piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)C=CC2=CC=1C(=O)N(CC1)CCN1CCCC1=CC=CC=C1 ULOLCUDKEFOVJB-UHFFFAOYSA-N 0.000 description 1
- RMDYRSQEAVNVOG-UHFFFAOYSA-N 6-[4-(4-methylbenzoyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(C)=CC=C1C(=O)N1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 RMDYRSQEAVNVOG-UHFFFAOYSA-N 0.000 description 1
- LJIHJAZGCUFQSV-UHFFFAOYSA-N 6-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 LJIHJAZGCUFQSV-UHFFFAOYSA-N 0.000 description 1
- FWQJNCGTTHQETC-UHFFFAOYSA-N 6-[4-(4-nitrobenzoyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)N1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 FWQJNCGTTHQETC-UHFFFAOYSA-N 0.000 description 1
- JJODMNWKHQANHR-UHFFFAOYSA-N 6-[4-(4-oxo-4-phenylbutyl)piperazine-1-carbonyl]-3,4-dihydro-1H-quinolin-2-one hydrochloride Chemical compound Cl.C1CN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CCN1CCCC(=O)C1=CC=CC=C1 JJODMNWKHQANHR-UHFFFAOYSA-N 0.000 description 1
- XCDVRGSFPQVBRV-UHFFFAOYSA-N 6-[4-(6-oxo-6-phenylhexyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrate;hydrochloride Chemical compound O.Cl.C1CN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CCN1CCCCCC(=O)C1=CC=CC=C1 XCDVRGSFPQVBRV-UHFFFAOYSA-N 0.000 description 1
- UKOJDUPFVXRECC-UHFFFAOYSA-N 6-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CCN1C(=O)C1=CC=CO1 UKOJDUPFVXRECC-UHFFFAOYSA-N 0.000 description 1
- BMNHGEYASSKGLF-UHFFFAOYSA-N 6-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.COC1=C(OC)C(OC)=CC(CN2CCN(CC2)C(=O)C=2C=C3CCC(=O)NC3=CC=2)=C1 BMNHGEYASSKGLF-UHFFFAOYSA-N 0.000 description 1
- GQXDSDVZBDOUSW-UHFFFAOYSA-N 6-[4-[(3,4-dichlorophenyl)methyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=C(Cl)C(Cl)=CC=C1CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 GQXDSDVZBDOUSW-UHFFFAOYSA-N 0.000 description 1
- AMNFMUTUHVIEGE-UHFFFAOYSA-N 6-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1CN1CCN(C(=O)C=2C=C3C=CC(=O)NC3=CC=2)CC1 AMNFMUTUHVIEGE-UHFFFAOYSA-N 0.000 description 1
- CDHYTSZKJADADO-UHFFFAOYSA-N 6-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC(C)=CC=C1CN1CCN(C(=O)C=2C=C3C=CC(=O)NC3=CC=2)CC1 CDHYTSZKJADADO-UHFFFAOYSA-N 0.000 description 1
- CINIBFRPEYCAHX-UHFFFAOYSA-N 6-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC(C)=CC=C1CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 CINIBFRPEYCAHX-UHFFFAOYSA-N 0.000 description 1
- KCSDZFJPJHUULP-UHFFFAOYSA-N 6-[4-[(4-methylsulfanylphenyl)methyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC(SC)=CC=C1CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 KCSDZFJPJHUULP-UHFFFAOYSA-N 0.000 description 1
- VECOGRIZSXIRNF-UHFFFAOYSA-N 6-[4-[2-(3-chlorophenoxy)ethyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.ClC1=CC=CC(OCCN2CCN(CC2)C(=O)C=2C=C3CCC(=O)NC3=CC=2)=C1 VECOGRIZSXIRNF-UHFFFAOYSA-N 0.000 description 1
- QMHXRNKJMRAADF-UHFFFAOYSA-N 6-[4-[2-(3-chlorophenyl)-2-oxoethyl]piperazine-1-carbonyl]-3,4-dihydro-1H-quinolin-2-one hydrochloride Chemical compound Cl.ClC1=CC=CC(C(=O)CN2CCN(CC2)C(=O)C=2C=C3CCC(=O)NC3=CC=2)=C1 QMHXRNKJMRAADF-UHFFFAOYSA-N 0.000 description 1
- SHHNXNVOQJOOQV-UHFFFAOYSA-N 6-[4-[2-(4-methoxyphenoxy)ethyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1OCCN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 SHHNXNVOQJOOQV-UHFFFAOYSA-N 0.000 description 1
- RHRNGDSRNXXYPA-UHFFFAOYSA-N 6-[4-[2-(4-methoxyphenyl)-2-oxoethyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C(=O)CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 RHRNGDSRNXXYPA-UHFFFAOYSA-N 0.000 description 1
- XSWXVNBFWAPSCP-UHFFFAOYSA-N 6-[4-[2-(4-methoxyphenyl)acetyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(OC)=CC=C1CC(=O)N1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 XSWXVNBFWAPSCP-UHFFFAOYSA-N 0.000 description 1
- LZCRMPYSTGLESX-UHFFFAOYSA-N 6-[4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound COC1=C(OC)C(OC)=CC(C=CC(=O)N2CCN(CC2)C(=O)C=2C=C3CCC(=O)NC3=CC=2)=C1 LZCRMPYSTGLESX-UHFFFAOYSA-N 0.000 description 1
- ZEIJIJIOJFZJGC-UHFFFAOYSA-N 6-[4-[3-(3-chlorophenoxy)propyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.ClC1=CC=CC(OCCCN2CCN(CC2)C(=O)C=2C=C3CCC(=O)NC3=CC=2)=C1 ZEIJIJIOJFZJGC-UHFFFAOYSA-N 0.000 description 1
- OAOFOJAQEFTKOS-UHFFFAOYSA-N 6-[4-[3-(3-chlorophenyl)prop-2-enoyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound ClC1=CC=CC(C=CC(=O)N2CCN(CC2)C(=O)C=2C=C3CCC(=O)NC3=CC=2)=C1 OAOFOJAQEFTKOS-UHFFFAOYSA-N 0.000 description 1
- OGUPZDROAKHDLC-UHFFFAOYSA-N 6-[4-[3-(4-methoxyphenyl)-3-oxopropyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrate;hydrochloride Chemical compound O.Cl.C1=CC(OC)=CC=C1C(=O)CCN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 OGUPZDROAKHDLC-UHFFFAOYSA-N 0.000 description 1
- ORHWXVUIJIBDMY-UHFFFAOYSA-N 6-[4-[3-(4-methylphenoxy)propyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1=CC(C)=CC=C1OCCCN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 ORHWXVUIJIBDMY-UHFFFAOYSA-N 0.000 description 1
- USNBPKVLFBHZJA-UHFFFAOYSA-N 6-[4-[3-(4-methylphenyl)-3-oxopropyl]piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC(C)=CC=C1C(=O)CCN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 USNBPKVLFBHZJA-UHFFFAOYSA-N 0.000 description 1
- FXPPYJRCOQZMIL-UHFFFAOYSA-N 6-acetyl-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(C(=O)C)=CC=C21 FXPPYJRCOQZMIL-UHFFFAOYSA-N 0.000 description 1
- GNDWMXGYGHZYHQ-UHFFFAOYSA-N 7-(piperazine-1-carbonyl)-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2CCC(=O)NC2=CC=1C(=O)N1CCNCC1 GNDWMXGYGHZYHQ-UHFFFAOYSA-N 0.000 description 1
- ZRKSQTNKPVNVHS-UHFFFAOYSA-N 7-[4-(2-phenoxyethyl)piperazine-1-carbonyl]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2CCC(=O)NC2=CC=1C(=O)N(CC1)CCN1CCOC1=CC=CC=C1 ZRKSQTNKPVNVHS-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- GFMGUMPUZNCMNG-UHFFFAOYSA-N 8-(4-benzylpiperazine-1-carbonyl)-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=CC=2C=CC(=O)NC=2C=1C(=O)N(CC1)CCN1CC1=CC=CC=C1 GFMGUMPUZNCMNG-UHFFFAOYSA-N 0.000 description 1
- IPQCADTUSPYPEZ-UHFFFAOYSA-N 8-(piperazine-1-carbonyl)-1h-quinolin-2-one Chemical compound C=1C=CC=2C=CC(=O)NC=2C=1C(=O)N1CCNCC1 IPQCADTUSPYPEZ-UHFFFAOYSA-N 0.000 description 1
- XBXGJWOWXZPSGV-UHFFFAOYSA-N 8-[4-(2-methylpropyl)piperazine-1-carbonyl]-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(CC(C)C)CCN1C(=O)C1=CC=CC2=C1NC(=O)C=C2 XBXGJWOWXZPSGV-UHFFFAOYSA-N 0.000 description 1
- CGHWTHOAQXYGMW-UHFFFAOYSA-N 8-[4-(3-phenylpropyl)piperazine-1-carbonyl]-1h-quinolin-2-one Chemical compound C=1C=CC=2C=CC(=O)NC=2C=1C(=O)N(CC1)CCN1CCCC1=CC=CC=C1 CGHWTHOAQXYGMW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 208000023514 Barrett esophagus Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- IZCRNGCHGDACEG-UHFFFAOYSA-N Cl.C(C)C1=CC=C(C(=O)CCCN2CCN(CC2)C(=O)C=2C=C3CCC(NC3=CC2)=O)C=C1 Chemical compound Cl.C(C)C1=CC=C(C(=O)CCCN2CCN(CC2)C(=O)C=2C=C3CCC(NC3=CC2)=O)C=C1 IZCRNGCHGDACEG-UHFFFAOYSA-N 0.000 description 1
- JJTFGONMGINGJN-UHFFFAOYSA-N Cl.C1CN(CC(C)C)CCN1C(=O)C1=CC=C(CCC(=O)N2)C2=C1 Chemical compound Cl.C1CN(CC(C)C)CCN1C(=O)C1=CC=C(CCC(=O)N2)C2=C1 JJTFGONMGINGJN-UHFFFAOYSA-N 0.000 description 1
- RRYSMLYZIPLVIZ-UHFFFAOYSA-N Cl.C=1C=CC=2CCC(=O)NC=2C=1C(=O)N(CC1)CCN1CCCC1=CC=CC=C1 Chemical compound Cl.C=1C=CC=2CCC(=O)NC=2C=1C(=O)N(CC1)CCN1CCCC1=CC=CC=C1 RRYSMLYZIPLVIZ-UHFFFAOYSA-N 0.000 description 1
- QLXOXHMSYXYWKW-UHFFFAOYSA-N Cl.ClC1=CC=C(C=C1)C(=O)CCCN1CCN(CC1)C(=O)C1=CC=C2NC(=O)CCC2=C1 Chemical compound Cl.ClC1=CC=C(C=C1)C(=O)CCCN1CCN(CC1)C(=O)C1=CC=C2NC(=O)CCC2=C1 QLXOXHMSYXYWKW-UHFFFAOYSA-N 0.000 description 1
- JOIDSVUGTJVQHM-UHFFFAOYSA-N Cl.N1C(=O)C=CC2=C1C=CC=C2C(=O)N1CCN(CC=2C=C3OCOC3=CC=2)CC1 Chemical compound Cl.N1C(=O)C=CC2=C1C=CC=C2C(=O)N1CCN(CC=2C=C3OCOC3=CC=2)CC1 JOIDSVUGTJVQHM-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 244000239659 Eucalyptus pulverulenta Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- QWJINIUECCKAOF-UHFFFAOYSA-N N-[4-[[4-(2-oxo-3,4-dihydro-1H-quinoline-6-carbonyl)piperazin-1-yl]methyl]phenyl]acetamide hydrochloride Chemical compound Cl.C1=CC(NC(=O)C)=CC=C1CN1CCN(C(=O)C=2C=C3CCC(=O)NC3=CC=2)CC1 QWJINIUECCKAOF-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 208000031481 Pathologic Constriction Diseases 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 101150046432 Tril gene Proteins 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- ILRRQNADMUWWFW-UHFFFAOYSA-K aluminium phosphate Chemical compound O1[Al]2OP1(=O)O2 ILRRQNADMUWWFW-UHFFFAOYSA-K 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 1
- RNLQIBCLLYYYFJ-UHFFFAOYSA-N amrinone Chemical compound N1C(=O)C(N)=CC(C=2C=CN=CC=2)=C1 RNLQIBCLLYYYFJ-UHFFFAOYSA-N 0.000 description 1
- 229960002105 amrinone Drugs 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- GPRLTFBKWDERLU-UHFFFAOYSA-N bicyclo[2.2.2]octane Chemical compound C1CC2CCC1CC2 GPRLTFBKWDERLU-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- YZYDPPZYDIRSJT-UHFFFAOYSA-K boron phosphate Chemical compound [B+3].[O-]P([O-])([O-])=O YZYDPPZYDIRSJT-UHFFFAOYSA-K 0.000 description 1
- 229910000149 boron phosphate Inorganic materials 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000496 cardiotonic agent Substances 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 229940089960 chloroacetate Drugs 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229920001577 copolymer Chemical group 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000003205 diastolic effect Effects 0.000 description 1
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 229960001089 dobutamine Drugs 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 108010025899 gelatin film Proteins 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000000544 hyperemic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 229910000398 iron phosphate Inorganic materials 0.000 description 1
- SURQXAFEQWPFPV-UHFFFAOYSA-L iron(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Fe+2].[O-]S([O-])(=O)=O SURQXAFEQWPFPV-UHFFFAOYSA-L 0.000 description 1
- WBJZTOZJJYAKHQ-UHFFFAOYSA-K iron(3+) phosphate Chemical compound [Fe+3].[O-]P([O-])([O-])=O WBJZTOZJJYAKHQ-UHFFFAOYSA-K 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 210000005240 left ventricle Anatomy 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229910001463 metal phosphate Inorganic materials 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- QQHNGZNHRRLNKI-UHFFFAOYSA-N methyl carbonobromidate Chemical compound COC(Br)=O QQHNGZNHRRLNKI-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- SMBBZHGTZJNSRQ-UHFFFAOYSA-N n'-(6,6-dichlorohexyl)methanediimine Chemical compound ClC(Cl)CCCCCN=C=N SMBBZHGTZJNSRQ-UHFFFAOYSA-N 0.000 description 1
- FJEVLIYCLTVMPM-UHFFFAOYSA-N n-(1,3-benzodioxol-5-ylmethyl)-n-methyl-2-oxo-3,4-dihydro-1h-quinoline-6-carboxamide Chemical compound N1C(=O)CCC2=CC(C(=O)N(CC=3C=C4OCOC4=CC=3)C)=CC=C21 FJEVLIYCLTVMPM-UHFFFAOYSA-N 0.000 description 1
- POVKLTHRUAHAHM-UHFFFAOYSA-N n-[(4-chlorophenyl)methyl]-n-methyl-2-oxo-3,4-dihydro-1h-quinoline-6-carboxamide Chemical compound C=1C=C2NC(=O)CCC2=CC=1C(=O)N(C)CC1=CC=C(Cl)C=C1 POVKLTHRUAHAHM-UHFFFAOYSA-N 0.000 description 1
- SVEUVITYHIHZQE-UHFFFAOYSA-N n-methylpyridin-2-amine Chemical compound CNC1=CC=CC=N1 SVEUVITYHIHZQE-UHFFFAOYSA-N 0.000 description 1
- 238000005121 nitriding Methods 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 229960002275 pentobarbital sodium Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- WEYVCQFUGFRXOM-UHFFFAOYSA-N perazine Chemical compound C1CN(C)CCN1CCCN1C2=CC=CC=C2SC2=CC=CC=C21 WEYVCQFUGFRXOM-UHFFFAOYSA-N 0.000 description 1
- 229960002195 perazine Drugs 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000008196 pharmacological composition Substances 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NFIYTPYOYDDLGO-UHFFFAOYSA-N phosphoric acid;sodium Chemical compound [Na].OP(O)(O)=O NFIYTPYOYDDLGO-UHFFFAOYSA-N 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Substances CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- LKZMBDSASOBTPN-UHFFFAOYSA-L silver carbonate Substances [Ag].[O-]C([O-])=O LKZMBDSASOBTPN-UHFFFAOYSA-L 0.000 description 1
- 229910001958 silver carbonate Inorganic materials 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000006253 t-butylcarbonyl group Chemical group [H]C([H])([H])C(C(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 210000000596 ventricular septum Anatomy 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000003021 water soluble solvent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Heart & Thoracic Surgery (AREA)
- Hospice & Palliative Care (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP56022437A JPS57136517A (en) | 1981-02-17 | 1981-02-17 | Cardiotonic |
| JP56057732A JPS57171974A (en) | 1981-04-15 | 1981-04-15 | Carbostyril derivative |
| JP12714581A JPS5829766A (ja) | 1981-08-12 | 1981-08-12 | カルボスチリル誘導体 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH651827A5 true CH651827A5 (de) | 1985-10-15 |
Family
ID=27283844
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH996/82A CH651827A5 (de) | 1981-02-17 | 1982-02-17 | Carbostyrilderivate, verfahren zu ihrer herstellung und kardiotonische zusammensetzungen, welche diese enthalten. |
Country Status (21)
| Country | Link |
|---|---|
| US (3) | US4487772A (enExample) |
| KR (1) | KR860001337B1 (enExample) |
| AT (1) | AT386198B (enExample) |
| AU (1) | AU530264B2 (enExample) |
| BE (1) | BE892148A (enExample) |
| CA (1) | CA1199915A (enExample) |
| CH (1) | CH651827A5 (enExample) |
| DE (1) | DE3204892A1 (enExample) |
| DK (1) | DK152287C (enExample) |
| ES (2) | ES509693A0 (enExample) |
| FI (1) | FI77852C (enExample) |
| FR (1) | FR2512818B1 (enExample) |
| GB (1) | GB2094789B (enExample) |
| IT (1) | IT1157002B (enExample) |
| MX (1) | MX156153A (enExample) |
| NL (1) | NL8200593A (enExample) |
| NO (1) | NO159446C (enExample) |
| PH (1) | PH18085A (enExample) |
| PT (1) | PT74440B (enExample) |
| SE (1) | SE445348B (enExample) |
| SU (1) | SU1331426A3 (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PH17194A (en) * | 1980-03-06 | 1984-06-19 | Otsuka Pharma Co Ltd | Novel carbostyril derivatives,and pharmaceutical composition containing the same |
| FI77852C (fi) * | 1981-02-17 | 1989-05-10 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av nya, saosom hjaertmediciner anvaendbara substituerade amid- och (maettad heterocykel)karbonylkarbostyrilderivat. |
| AU532361B2 (en) * | 1981-09-01 | 1983-09-29 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives |
| US4578381A (en) * | 1982-07-05 | 1986-03-25 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives |
| US4845100A (en) * | 1985-04-12 | 1989-07-04 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives and salts thereof, processes for preparing the same and cardiotonic composition containing the same |
| US4792561A (en) * | 1986-05-29 | 1988-12-20 | Syntex (U.S.A.) Inc. | Carbostyril derivatives as combined thromboxane synthetase and cyclic-AMP phosphodiesterase inhibitors |
| US4921862A (en) * | 1986-05-29 | 1990-05-01 | Syntex (U.S.A.) Inc. | Carbostyril derivatives as combined thromboxane synthetase and cyclic-amp phosphodiesterase inhibitors |
| EP0255134B1 (en) * | 1986-07-31 | 1993-03-03 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives and salts thereof, process for preparing them, and cardiotonic composition containing same |
| GB8709448D0 (en) * | 1987-04-21 | 1987-05-28 | Pfizer Ltd | Heterobicyclic quinoline derivatives |
| US5227381A (en) * | 1988-05-02 | 1993-07-13 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivative |
| DE3818830A1 (de) * | 1988-06-03 | 1989-12-14 | Boehringer Mannheim Gmbh | Bicyclische carboxamide, verfahren zu ihrer herstellung, deren vorstufen, und diese verbindungen enthaltende arzneimittel |
| JP2686887B2 (ja) * | 1992-08-11 | 1997-12-08 | キッセイ薬品工業株式会社 | ピペリジノ−3,4−ジヒドロカルボスチリル誘導体 |
| JPH06239858A (ja) * | 1993-02-16 | 1994-08-30 | Otsuka Pharmaceut Co Ltd | 末梢血管拡張剤 |
| DE69430861T2 (de) * | 1993-04-07 | 2003-01-23 | Otsuka Pharmaceutical Co., Ltd. | N-acylierte 4-aminopiperidin derivate als aktive bestandteile von peripher gefässerweiternden wikstoffen |
| EP0709384B1 (de) * | 1994-10-31 | 1998-12-23 | MERCK PATENT GmbH | Benzylpiperidinderivate mit hoher Affinität zu Bindungsstellen von Aminosäure-Rezeptoren |
| US6448257B1 (en) | 1998-05-22 | 2002-09-10 | Scios, Inc. | Compounds and methods to treat cardiac failure and other disorders |
| US6340685B1 (en) * | 1998-05-22 | 2002-01-22 | Scios, Inc. | Compounds and methods to treat cardiac failure and other disorders |
| US6589954B1 (en) | 1998-05-22 | 2003-07-08 | Scios, Inc. | Compounds and methods to treat cardiac failure and other disorders |
| US6867209B1 (en) | 1998-05-22 | 2005-03-15 | Scios, Inc. | Indole-type derivatives as inhibitors of p38 kinase |
| IL146309A (en) | 1999-05-21 | 2008-03-20 | Scios Inc | Derivatives of the indole type and pharmaceutical preparations containing them as inhibitors of kinase p38 |
| AU2003253149A1 (en) * | 2002-08-13 | 2004-02-25 | Warner-Lambert Company Llc | 3,4-dihydroquinolin-2-one, 5,6-fused oxazin-3-one, and 5,6-fused thiazin-3-one derivatives as matrix metalloproteinase inhibitors |
| BRPI0417571A (pt) * | 2003-12-10 | 2007-03-20 | Janssen Pharmaceutica Nv | 2-quinolinonas e 2-quinoxalinonas substituìdas por 6-ciclohexil-alquila substituìda como inibidores da poli(adp-ribose) polimerase |
| MY142362A (en) * | 2004-01-29 | 2010-11-30 | Otsuka Pharma Co Ltd | Pharmaceutical composition for promoting angiogenesis |
| WO2007124345A2 (en) | 2006-04-21 | 2007-11-01 | The Government Of The United States, As Represented By The Secretary Of Health And Human Services | Beta-amyloid pet imaging agents |
| US20100092479A1 (en) * | 2008-08-18 | 2010-04-15 | Combinatorx (Singapore) Pte. Ltd. | Compositions and methods for treatment of viral diseases |
| AU2010266018B2 (en) | 2009-06-25 | 2014-01-09 | Alkermes Pharma Ireland Limited | Heterocyclic compounds for the treatment of neurological and psychological disorders |
| WO2011140183A1 (en) | 2010-05-04 | 2011-11-10 | Alkermes, Inc. | Process for synthesizing oxidized lactam compounds |
| CA2802733C (en) | 2010-06-24 | 2017-11-21 | Alkermes Pharma Ireland Limited | Prodrugs of nh-acidic compounds: ester, carbonate, carbamate and phosphonate derivatives |
| CN111386269A (zh) * | 2017-11-28 | 2020-07-07 | 豪夫迈·罗氏有限公司 | 新型杂环化合物 |
| EP3737680A1 (en) | 2018-01-08 | 2020-11-18 | F. Hoffmann-La Roche AG | Octahydropyrido[1,2-alpha]pyrazines as magl inhibitors |
| CN109651285B (zh) * | 2019-01-30 | 2020-06-30 | 苏州大学 | 多溴代苯并[1,3]噁嗪衍生物的合成方法 |
| MX2023002224A (es) | 2020-09-03 | 2023-03-15 | Hoffmann La Roche | Compuestos heterociclicos. |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2997474A (en) * | 1959-10-12 | 1961-08-22 | Paul A J Janssen | 1-aryl-omega-(4-arylpiperazine) alkanols |
| US3555030A (en) * | 1964-11-25 | 1971-01-12 | Smith Kline French Lab | Muscle relaxant and analgesic compositions |
| US4115569A (en) * | 1971-11-19 | 1978-09-19 | Hoechst Aktiengesellschaft | Cyclic diamine derivatives |
| US4256890A (en) * | 1972-09-14 | 1981-03-17 | Otsukapharmaceutical Co., Ltd. | 3,4-Dihydrocarbostyril derivatives and process for producing the same |
| IT998326B (it) * | 1973-08-06 | 1976-01-20 | Montedison Spa | Derivati degli acidi chinolin 8 carbossilici ad attivita antiparas sitaria |
| US4022776A (en) * | 1974-01-31 | 1977-05-10 | Otsuka Pharmaceutical Company Limited | 5-[1-Hydroxy-2-(substituted-amino)]ethyl-8-hydroxycarbostyril derivatives |
| US4022784A (en) * | 1974-01-31 | 1977-05-10 | Otsuka Pharmaceutical Company Limited | 5-[1-Hydroxy-2-(substituted-amino)]alkyl-8-substituted-carbostyril and -3,4-dihydrocarbostyril derivatives |
| US4145542A (en) * | 1974-06-13 | 1979-03-20 | Otsuka Pharmaceutical Co., Ltd. | 5- 1-Hydroxy-2-(heterocyclic-amino)!alkyl-8-hydroxy-3,4-dihydrocarbostyril derivatives |
| FI59246C (fi) * | 1974-06-24 | 1981-07-10 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av benscykloamidderivat anvaendbara vid trombos- och emboliterapin |
| JPS51118771A (en) * | 1975-04-09 | 1976-10-18 | Otsuka Pharmaceut Co Ltd | Method for preparing carbostyryl derivatives |
| US3994900A (en) * | 1976-01-23 | 1976-11-30 | E. R. Squibb & Sons, Inc. | 6-(Or 8)-[[(substituted amino)alkyl]oxy(or thio)]-3,4-dihydro-4-phenyl-2(1H)-quinolinones |
| US4210753A (en) * | 1976-03-17 | 1980-07-01 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril compounds |
| GB1589871A (en) * | 1976-07-19 | 1981-05-20 | Conder Group Serv Ltd | Tank construction |
| JPS609713B2 (ja) * | 1976-10-08 | 1985-03-12 | 大塚製薬株式会社 | カルボスチリル誘導体 |
| IE46852B1 (en) * | 1977-06-10 | 1983-10-05 | Otsuka Pharma Co Ltd | Novel carbostyril derivatives |
| JPS5416478A (en) * | 1977-07-08 | 1979-02-07 | Otsuka Pharmaceut Co Ltd | 3,4-dihydrocarbostyril herivative |
| DE2928583A1 (de) * | 1979-07-14 | 1981-01-29 | Thomae Gmbh Dr K | Verfahren zur herstellung von carbostyrilderivaten |
| PH17194A (en) * | 1980-03-06 | 1984-06-19 | Otsuka Pharma Co Ltd | Novel carbostyril derivatives,and pharmaceutical composition containing the same |
| FI77852C (fi) * | 1981-02-17 | 1989-05-10 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av nya, saosom hjaertmediciner anvaendbara substituerade amid- och (maettad heterocykel)karbonylkarbostyrilderivat. |
-
1982
- 1982-02-03 FI FI820338A patent/FI77852C/fi not_active IP Right Cessation
- 1982-02-12 DE DE19823204892 patent/DE3204892A1/de active Granted
- 1982-02-15 BE BE0/207321A patent/BE892148A/fr not_active IP Right Cessation
- 1982-02-15 MX MX8210261A patent/MX156153A/es unknown
- 1982-02-15 PH PH26870A patent/PH18085A/en unknown
- 1982-02-15 SU SU823394100A patent/SU1331426A3/ru active
- 1982-02-16 NL NL8200593A patent/NL8200593A/nl not_active Application Discontinuation
- 1982-02-16 KR KR8200668A patent/KR860001337B1/ko not_active Expired
- 1982-02-16 DK DK066582A patent/DK152287C/da active
- 1982-02-16 AT AT0059582A patent/AT386198B/de not_active IP Right Cessation
- 1982-02-16 FR FR8202479A patent/FR2512818B1/fr not_active Expired
- 1982-02-16 US US06/348,709 patent/US4487772A/en not_active Expired - Lifetime
- 1982-02-16 NO NO820479A patent/NO159446C/no unknown
- 1982-02-16 CA CA000396327A patent/CA1199915A/en not_active Expired
- 1982-02-16 AU AU80528/82A patent/AU530264B2/en not_active Ceased
- 1982-02-16 SE SE8200916A patent/SE445348B/sv not_active IP Right Cessation
- 1982-02-16 PT PT74440A patent/PT74440B/pt not_active IP Right Cessation
- 1982-02-17 CH CH996/82A patent/CH651827A5/de not_active IP Right Cessation
- 1982-02-17 ES ES509693A patent/ES509693A0/es active Granted
- 1982-02-17 IT IT67177/82A patent/IT1157002B/it active
- 1982-02-17 GB GB8204581A patent/GB2094789B/en not_active Expired
- 1982-12-16 ES ES518303A patent/ES8401959A1/es not_active Expired
-
1983
- 1983-08-22 US US06/525,284 patent/US4468402A/en not_active Expired - Lifetime
- 1983-08-22 US US06/525,812 patent/US4454130A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH651827A5 (de) | Carbostyrilderivate, verfahren zu ihrer herstellung und kardiotonische zusammensetzungen, welche diese enthalten. | |
| CH650782A5 (de) | Carbostyrilverbindungen, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. | |
| DE3324034C2 (enExample) | ||
| DE3632329A1 (de) | Substituierte phenylsulfonamide | |
| DE2527937A1 (de) | Benzcycloamidderivate und verfahren zu ihrer herstellung sowie pharmazeutische mittel, worin sie enthalten sind | |
| CH619209A5 (enExample) | ||
| CH616921A5 (enExample) | ||
| EP0013894B1 (de) | Neue Arylether, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE3132882A1 (de) | Neue piperazinone, ihre herstellung und verwendung | |
| CH678852A5 (enExample) | ||
| DE3830060A1 (de) | 2-phenylbenzimidazole - verfahren zu ihrer herstellung sowie diese verbindungen enthaltende arzneimittel | |
| CH650783A5 (de) | Carbostyrilderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. | |
| EP0250361B1 (de) | Disubstituierte Piperazine | |
| DE3049959C2 (enExample) | ||
| CH635092A5 (de) | Verfahren zur herstellung neuer benzopyranderivate. | |
| DE3781703T2 (de) | 2-benzimidazolylalkylthio(oder sulfinyl- oder sulfonyl)-derivate, verfahren zu deren herstellung und deren anwendung als arzneimittel. | |
| DE3424586A1 (de) | 3-aminocarbonylmethoxy-5-phenyl-pyrazol-verbindungen sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3642497A1 (de) | Substituierte aminopropionsaeureamide, verfahren zu ihrer herstellung, diese enthaltende mittel und ihre verwendung sowie die bei der herstellung anfallenden neuen zwischenprodukte | |
| DE69531691T2 (de) | Neues amin-derivat, verfahren zur herstellung und dessen verwendung als anti-arrhythmisches mittel | |
| EP0428860B1 (de) | Substituierte (Chinolin-2-yl-methoxy)phenyl-carbonyl-harnstoffe | |
| DE3878578T2 (de) | Benzimidazol-derivate und verfahren zu ihrer herstellung. | |
| JPH0216299B2 (enExample) | ||
| EP0004322A1 (de) | Isochinolinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Arzneimitteln | |
| DE1939895A1 (de) | Carbonamidgruppen enthaltende Arylsulfonylharnstoffe und Arylsulfonylsemicarbazide mi blutzuckersenkender Wirkung | |
| EP1220845B1 (de) | Arylsulfonamid-substituierte benzimidazolderivate ihre verwendung als tryptase-inhibitoren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |