CH642995A5 - Nematische fluessigkristallzusammensetzung fuer anzeigevorrichtungen, insbesondere fuer schaltungen, die mit zeitteilung betrieben werden. - Google Patents
Nematische fluessigkristallzusammensetzung fuer anzeigevorrichtungen, insbesondere fuer schaltungen, die mit zeitteilung betrieben werden. Download PDFInfo
- Publication number
- CH642995A5 CH642995A5 CH785579A CH785579A CH642995A5 CH 642995 A5 CH642995 A5 CH 642995A5 CH 785579 A CH785579 A CH 785579A CH 785579 A CH785579 A CH 785579A CH 642995 A5 CH642995 A5 CH 642995A5
- Authority
- CH
- Switzerland
- Prior art keywords
- liquid crystal
- cmh2m
- cqh2q
- compound
- nematic liquid
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 51
- 239000004988 Nematic liquid crystal Substances 0.000 title claims description 42
- 239000004973 liquid crystal related substance Substances 0.000 claims description 119
- 150000001875 compounds Chemical class 0.000 claims description 88
- 239000000463 material Substances 0.000 claims description 23
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 10
- 230000004043 responsiveness Effects 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 6
- 235000010290 biphenyl Nutrition 0.000 claims description 5
- 239000004305 biphenyl Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 239000011159 matrix material Substances 0.000 claims description 4
- 238000007789 sealing Methods 0.000 claims description 4
- 230000005669 field effect Effects 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 2
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 claims 4
- 230000006978 adaptation Effects 0.000 claims 3
- 125000005843 halogen group Chemical group 0.000 claims 3
- 238000006552 photochemical reaction Methods 0.000 claims 2
- 238000006303 photolysis reaction Methods 0.000 claims 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 239000013078 crystal Substances 0.000 claims 1
- 239000012769 display material Substances 0.000 claims 1
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- 230000031700 light absorption Effects 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims 1
- 239000000758 substrate Substances 0.000 description 8
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 7
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 7
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 5
- 238000010586 diagram Methods 0.000 description 5
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 5
- 230000010287 polarization Effects 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 230000036316 preload Effects 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 230000003068 static effect Effects 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- 230000008859 change Effects 0.000 description 2
- 229940126214 compound 3 Drugs 0.000 description 2
- 230000005684 electric field Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 238000012935 Averaging Methods 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 239000004990 Smectic liquid crystal Substances 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000004297 night vision Effects 0.000 description 1
- LEMKWEBKVMWZDU-UHFFFAOYSA-N nonanedial Chemical compound O=CCCCCCCCC=O LEMKWEBKVMWZDU-UHFFFAOYSA-N 0.000 description 1
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000004781 supercooling Methods 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/42—Mixtures of liquid crystal compounds covered by two or more of the preceding groups C09K19/06 - C09K19/40
- C09K19/46—Mixtures of liquid crystal compounds covered by two or more of the preceding groups C09K19/06 - C09K19/40 containing esters
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Liquid Crystal Substances (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10493878A JPS5534206A (en) | 1978-08-30 | 1978-08-30 | Nematic liquid crystal for display unit |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH642995A5 true CH642995A5 (de) | 1984-05-15 |
Family
ID=14394024
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH785579A CH642995A5 (de) | 1978-08-30 | 1979-08-30 | Nematische fluessigkristallzusammensetzung fuer anzeigevorrichtungen, insbesondere fuer schaltungen, die mit zeitteilung betrieben werden. |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4588518A (enExample) |
| JP (1) | JPS5534206A (enExample) |
| CH (1) | CH642995A5 (enExample) |
| DE (1) | DE2934918C2 (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4328116A (en) * | 1979-11-01 | 1982-05-04 | Minnesota Mining And Manufacturing Company | Liquid crystal compositions for multiplexed displays |
| GB2085910B (en) * | 1980-10-13 | 1985-05-22 | Secr Defence | A liquid crystal composition comprising a mixture of diester(s) and cyclohexane derivative(s) |
| US4427569A (en) | 1980-12-18 | 1984-01-24 | Hughes Aircraft Company | Short length ester liquid crystal mixtures and process for making same |
| US4577931A (en) * | 1982-05-26 | 1986-03-25 | Epson Corporation | Liquid crystal composition |
| JPS596274A (ja) * | 1982-07-05 | 1984-01-13 | Seiko Epson Corp | 液晶組成物 |
| JPS59191789A (ja) * | 1983-04-15 | 1984-10-30 | Hitachi Ltd | 表示装置用ネマチツク液晶組成物 |
| JPS60101183A (ja) * | 1983-11-07 | 1985-06-05 | Hitachi Ltd | 液晶表示素子 |
| JPS61290A (ja) * | 1984-06-12 | 1986-01-06 | Seiko Epson Corp | 液晶組成物 |
| JPS6126691A (ja) * | 1984-07-13 | 1986-02-05 | Matsushita Electric Ind Co Ltd | 液晶組成物 |
| DE3582551D1 (de) * | 1984-10-19 | 1991-05-23 | Dainippon Ink & Chemicals | Nematische fluessigkristallzusammensetzung. |
| DE69225738T2 (de) * | 1991-03-27 | 1998-10-01 | Technology Co Ag | Flüssigkristallanzeigeelement und Projektionsanordnung unter Verwendung desselben |
Family Cites Families (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE787198A (fr) * | 1971-08-07 | 1973-02-05 | Merck Patent Gmbh | Composes et melanges nematiques |
| US4058478A (en) * | 1972-02-23 | 1977-11-15 | Hoffmann-La Roche Inc. | Liquid crystal esters |
| US4058477A (en) * | 1972-02-23 | 1977-11-15 | Hoffmann-La Roche Inc. | Liquid crystal Schiffs bases |
| US4011173A (en) * | 1972-08-03 | 1977-03-08 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Modified nematic mixtures with positive dielectric anisotropy |
| GB1433130A (en) * | 1972-11-09 | 1976-04-22 | Secr Defence | Substituted biphenyl and polyphenyl compounds and liquid crystal materials and devices containing them |
| DE2321032A1 (de) * | 1973-04-26 | 1974-11-14 | Alten K | Ueberfahrbruecke fuer rampen |
| DD105701A1 (enExample) * | 1973-07-02 | 1974-05-05 | ||
| JPS5043076A (enExample) * | 1973-08-20 | 1975-04-18 | ||
| US4053431A (en) * | 1973-11-19 | 1977-10-11 | Hoffmann-La Roche Inc. | Liquid crystalline biphenyls |
| US4137192A (en) * | 1974-01-25 | 1979-01-30 | Canon Kabushiki Kaisha | Liquid crystalline composition |
| US4020002A (en) * | 1974-02-28 | 1977-04-26 | Beckman Instruments, Inc. | Non-schiff base field effect liquid crystal composition |
| US3983049A (en) * | 1974-05-02 | 1976-09-28 | General Electric Company | Liquid crystal compositions with positive dielectric anisotropy |
| US4147651A (en) * | 1974-09-03 | 1979-04-03 | Beckman Instruments, Inc. | Biphenyl based liquid crystal compositions |
| US4136053A (en) * | 1974-10-22 | 1979-01-23 | Merck Patent Gesellschaft Mit Beschankter Haftung | Biphenyl esters and liquid crystalline mixtures comprising them |
| CH617452A5 (enExample) * | 1974-10-25 | 1980-05-30 | Hoffmann La Roche | |
| US4137250A (en) * | 1975-03-03 | 1979-01-30 | Motorola, Inc. | Liquid crystal compounds and composition |
| DE2548360C2 (de) * | 1975-10-29 | 1983-12-08 | Merck Patent Gmbh, 6100 Darmstadt | Flüssigkristalline Materialien mit verminderter Viskosität |
| DE2557267A1 (de) * | 1975-12-19 | 1977-06-30 | Bbc Brown Boveri & Cie | Fluessigkristallsubstanz |
| US4180475A (en) * | 1976-02-26 | 1979-12-25 | Hoffmann La Roche | Liquid crystal mixtures |
| US4031028A (en) * | 1976-06-18 | 1977-06-21 | Motorola, Inc. | Nematic liquid crystal composition |
| US4113647A (en) * | 1976-08-13 | 1978-09-12 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Northern Ireland | Liquid crystalline materials |
| DE2636684C3 (de) * | 1976-08-14 | 1980-06-19 | Merck Patent Gmbh, 6100 Darmstadt | Phenylcyclohexanderivate und ihre Verwendung in flüssigkristallinen Dielektrika |
| GB1596012A (en) * | 1976-08-16 | 1981-08-19 | Secr Defence | Optically active liquid crystal materials and liquid crystal devices containing them |
| DE2701591C3 (de) * | 1977-01-15 | 1979-12-20 | Merck Patent Gmbh, 6100 Darmstadt | Hexahydroterphenylderivate und deren Verwendung in flüssigkristallinen Dielektrika |
| US4337999A (en) * | 1977-08-29 | 1982-07-06 | Sharp Corporation | Fluorescent liquid crystal display compositions and devices |
| DD132591A1 (de) * | 1977-08-31 | 1978-10-11 | Dietrich Demus | Nematische fluessig-kristalline gemische |
| DD138558A1 (de) * | 1977-12-08 | 1979-11-07 | Frank Kuschel | Nematische fluessig-kristalline gemische |
| JPS5483694A (en) * | 1977-12-16 | 1979-07-03 | Hitachi Ltd | Nematic liquid crystal body for display device |
| GB2017742B (en) * | 1979-02-21 | 1982-08-18 | Suwa Seikosha Kk | Liquid crystal materials |
-
1978
- 1978-08-30 JP JP10493878A patent/JPS5534206A/ja active Granted
-
1979
- 1979-08-29 US US06/070,724 patent/US4588518A/en not_active Expired - Lifetime
- 1979-08-29 DE DE2934918A patent/DE2934918C2/de not_active Expired
- 1979-08-30 CH CH785579A patent/CH642995A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2934918C2 (de) | 1982-06-09 |
| US4588518A (en) | 1986-05-13 |
| JPS6360077B2 (enExample) | 1988-11-22 |
| JPS5534206A (en) | 1980-03-10 |
| DE2934918A1 (de) | 1980-03-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2854310A1 (de) | Nematisch-fluessige kristalle fuer anzeigevorrichtungen | |
| DE2502904C2 (enExample) | ||
| DE2656252C3 (de) | Dotierungsmittel für nematische Flüssigkristalle und damit dotiertes Flüssigkristallmaterial | |
| EP0131216B1 (de) | Flüssigkristallanzeige | |
| DE2244195A1 (de) | Elektrooptisch-aktive materialzusammensetzungen und elektrooptisch-aktive vorrichtung unter verwendung derartiger materialzusammensetzungen | |
| DE3238702C2 (enExample) | ||
| DE3608911A1 (de) | Fluessigkristall-anzeigevorrichtung | |
| CH639784A5 (de) | Fluessigkristall-fluoreszenzanzeigevorrichtung. | |
| CH642995A5 (de) | Nematische fluessigkristallzusammensetzung fuer anzeigevorrichtungen, insbesondere fuer schaltungen, die mit zeitteilung betrieben werden. | |
| DD222039A5 (de) | Nematische fluessigkristall-zusammensetzung | |
| DE3503259A1 (de) | Fluessigkristall-anzeigevorrichtung | |
| DE3614113A1 (de) | Fluessigkristallvorrichtung und verfahren zum steuern der ausrichtung eines fluessigkristalls | |
| DE2918000C2 (de) | Nematische kristallin-flüssige Mischungen | |
| DE2340637A1 (de) | Elektro-optische einrichtung mit einer verbesserten fluessigkristall-zubereitung | |
| DE3122529C2 (de) | Nematische Flüssigkristallmaterialien und ihre Verwendung | |
| DE3305711C2 (de) | Flüssigkristallzusammensetzung | |
| DE3243688A1 (de) | Fluessigkristall-zusammensetzung | |
| DE3419512C1 (de) | Zusammensetzung fuer Fluessigkristalle | |
| DE2441296C3 (de) | Nematische Flüssigkristallmassen und deren Verwendung | |
| DE3022559C2 (de) | Nematische Flüssigkristallzusammensetzungen und ihre Verwendung | |
| DE2419011C3 (de) | Flüssigkristallanzeigeelement | |
| DE2316864C3 (de) | FlüssigkristaUzusammensetzung | |
| DD144423A1 (de) | Nematische kristallin-fluessige substanzen | |
| DE69318779T2 (de) | Ferroelektrische Flüssigkristallzusammensetzung | |
| CH653051A5 (de) | Nematische fluessigkristallmischung mit einer negativen dielektrischen anisotropie. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |