CH640556A5 - Metallisierbare und metallisierte azoverbindungen, deren herstellung und verwendung. - Google Patents
Metallisierbare und metallisierte azoverbindungen, deren herstellung und verwendung. Download PDFInfo
- Publication number
- CH640556A5 CH640556A5 CH245579A CH245579A CH640556A5 CH 640556 A5 CH640556 A5 CH 640556A5 CH 245579 A CH245579 A CH 245579A CH 245579 A CH245579 A CH 245579A CH 640556 A5 CH640556 A5 CH 640556A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- hydrogen
- compounds
- coupling component
- diazo
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 33
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000001257 hydrogen Substances 0.000 claims description 69
- 229910052739 hydrogen Inorganic materials 0.000 claims description 69
- 230000008878 coupling Effects 0.000 claims description 58
- 238000010168 coupling process Methods 0.000 claims description 58
- 238000005859 coupling reaction Methods 0.000 claims description 58
- 150000002431 hydrogen Chemical class 0.000 claims description 33
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 32
- 229910052751 metal Inorganic materials 0.000 claims description 31
- 239000002184 metal Substances 0.000 claims description 31
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 30
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 30
- 239000000460 chlorine Substances 0.000 claims description 24
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 22
- 125000001424 substituent group Chemical group 0.000 claims description 21
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 13
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 13
- 150000008049 diazo compounds Chemical class 0.000 claims description 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 13
- 239000008139 complexing agent Substances 0.000 claims description 12
- 238000004043 dyeing Methods 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- 229910006069 SO3H Inorganic materials 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000000758 substrate Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 150000004696 coordination complex Chemical class 0.000 claims description 5
- 150000004985 diamines Chemical class 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 239000004753 textile Substances 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- 239000000975 dye Substances 0.000 description 44
- 239000010985 leather Substances 0.000 description 27
- -1 hydroxy, amino Chemical group 0.000 description 24
- 239000011651 chromium Substances 0.000 description 20
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 14
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 13
- 150000003254 radicals Chemical group 0.000 description 12
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 11
- 229910052804 chromium Inorganic materials 0.000 description 10
- 229910017052 cobalt Inorganic materials 0.000 description 10
- 239000010941 cobalt Substances 0.000 description 10
- 239000010949 copper Substances 0.000 description 10
- 238000001465 metallisation Methods 0.000 description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 10
- 125000003277 amino group Chemical group 0.000 description 9
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 9
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 229950011260 betanaphthol Drugs 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 6
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 6
- FTCOWMWIZNVSPP-UHFFFAOYSA-N 2-phenyl-4h-pyrazol-3-one Chemical compound O=C1CC=NN1C1=CC=CC=C1 FTCOWMWIZNVSPP-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 125000000129 anionic group Chemical group 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- CWJQQASJVVAXKL-UHFFFAOYSA-N 4-(3-Methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzenesulfonic acid Chemical compound O=C1CC(C)=NN1C1=CC=C(S(O)(=O)=O)C=C1 CWJQQASJVVAXKL-UHFFFAOYSA-N 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 5
- 206010039587 Scarlet Fever Diseases 0.000 description 5
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 150000001844 chromium Chemical class 0.000 description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 5
- 238000009792 diffusion process Methods 0.000 description 5
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 229960003742 phenol Drugs 0.000 description 5
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 5
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000012736 aqueous medium Substances 0.000 description 4
- 150000004700 cobalt complex Chemical class 0.000 description 4
- 238000004040 coloring Methods 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 125000001624 naphthyl group Chemical group 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- RHPXYZMDLOJTFF-UHFFFAOYSA-N 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC([N+]([O-])=O)=C1O RHPXYZMDLOJTFF-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000004442 acylamino group Chemical group 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 230000009918 complex formation Effects 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 238000006193 diazotization reaction Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 150000002736 metal compounds Chemical class 0.000 description 3
- 230000003472 neutralizing effect Effects 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 229910052979 sodium sulfide Inorganic materials 0.000 description 3
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 3
- 125000000542 sulfonic acid group Chemical group 0.000 description 3
- SEWNAJIUKSTYOP-UHFFFAOYSA-N 4-chloro-3-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC(S(Cl)(=O)=O)=CC=C1Cl SEWNAJIUKSTYOP-UHFFFAOYSA-N 0.000 description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 2
- 150000001868 cobalt Chemical class 0.000 description 2
- MEYVLGVRTYSQHI-UHFFFAOYSA-L cobalt(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Co+2].[O-]S([O-])(=O)=O MEYVLGVRTYSQHI-UHFFFAOYSA-L 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 150000004688 heptahydrates Chemical class 0.000 description 2
- 150000002506 iron compounds Chemical class 0.000 description 2
- 239000000434 metal complex dye Substances 0.000 description 2
- CHMBIJAOCISYEW-UHFFFAOYSA-N n-(4-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1 CHMBIJAOCISYEW-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 150000002816 nickel compounds Chemical class 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- QLOKJRIVRGCVIM-UHFFFAOYSA-N 1-[(4-methylsulfanylphenyl)methyl]piperazine Chemical compound C1=CC(SC)=CC=C1CN1CCNCC1 QLOKJRIVRGCVIM-UHFFFAOYSA-N 0.000 description 1
- WITMXBRCQWOZPX-UHFFFAOYSA-N 1-phenylpyrazole Chemical compound C1=CC=NN1C1=CC=CC=C1 WITMXBRCQWOZPX-UHFFFAOYSA-N 0.000 description 1
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 1
- ASSKVPFEZFQQNQ-UHFFFAOYSA-N 2-benzoxazolinone Chemical compound C1=CC=C2OC(O)=NC2=C1 ASSKVPFEZFQQNQ-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 1
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 1
- NHLAPJMCARJFOG-UHFFFAOYSA-N 3-methyl-1,4-dihydropyrazol-5-one Chemical compound CC1=NNC(=O)C1 NHLAPJMCARJFOG-UHFFFAOYSA-N 0.000 description 1
- GRDXCFKBQWDAJH-UHFFFAOYSA-N 4-acetamidobenzenesulfonyl chloride Chemical compound CC(=O)NC1=CC=C(S(Cl)(=O)=O)C=C1 GRDXCFKBQWDAJH-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- VVPHSMHEYVOVLH-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 VVPHSMHEYVOVLH-UHFFFAOYSA-N 0.000 description 1
- HWTDMFJYBAURQR-UHFFFAOYSA-N 80-82-0 Chemical compound OS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O HWTDMFJYBAURQR-UHFFFAOYSA-N 0.000 description 1
- DQIVFTJHYKDOMZ-UHFFFAOYSA-N 96-67-3 Chemical compound NC1=CC([N+]([O-])=O)=CC(S(O)(=O)=O)=C1O DQIVFTJHYKDOMZ-UHFFFAOYSA-N 0.000 description 1
- 241001136792 Alle Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 235000019687 Lamb Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- WKNIDMJWLWUOMZ-UHFFFAOYSA-N [K].[Cr] Chemical compound [K].[Cr] WKNIDMJWLWUOMZ-UHFFFAOYSA-N 0.000 description 1
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 description 1
- GCPWJFKTWGFEHH-UHFFFAOYSA-N acetoacetamide Chemical compound CC(=O)CC(N)=O GCPWJFKTWGFEHH-UHFFFAOYSA-N 0.000 description 1
- 125000002339 acetoacetyl group Chemical class O=C([*])C([H])([H])C(=O)C([H])([H])[H] 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- PYKNDCILXQWMJP-UHFFFAOYSA-N azane;chromium(3+) Chemical compound N.[Cr+3] PYKNDCILXQWMJP-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- 150000001869 cobalt compounds Chemical class 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 1
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- LNQUWGZAZIOHMM-UHFFFAOYSA-N ethoxy-hydroxy-methoxy-lambda3-chlorane Chemical group CCOCl(O)OC LNQUWGZAZIOHMM-UHFFFAOYSA-N 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002505 iron Chemical class 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229940078494 nickel acetate Drugs 0.000 description 1
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 1
- HZPNKQREYVVATQ-UHFFFAOYSA-L nickel(2+);diformate Chemical compound [Ni+2].[O-]C=O.[O-]C=O HZPNKQREYVVATQ-UHFFFAOYSA-L 0.000 description 1
- 229910000363 nickel(II) sulfate Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/24—Disazo or polyazo compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH245579A CH640556A5 (de) | 1979-03-15 | 1979-03-15 | Metallisierbare und metallisierte azoverbindungen, deren herstellung und verwendung. |
| DE19803008086 DE3008086A1 (de) | 1979-03-15 | 1980-03-03 | Monometallkomplexe, deren herstellung und verwendung |
| GB8008174A GB2048295B (en) | 1979-03-15 | 1980-03-11 | Diazo compounds and their metal complexes |
| IT48147/80A IT1128100B (it) | 1979-03-15 | 1980-03-13 | Complessi metalliferi impiegabili come coloranti e lore preparazione |
| FR8005608A FR2451389A1 (fr) | 1979-03-15 | 1980-03-13 | Nouveaux complexes metalliferes utilisables comme colorants et leur preparation |
| BR8001543A BR8001543A (pt) | 1979-03-15 | 1980-03-14 | Process para a producao de um complexo de metal, processo para a producao de um composto mono-metalizavel, intermediario para o dito complexo, e processo para tingimento ou estampagem de substratos anionicos tingiveis |
| ES489605A ES8104361A1 (es) | 1979-03-15 | 1980-03-14 | Procedimiento para la produccion de complejos metalicos. |
| JP3171080A JPS55125159A (en) | 1979-03-15 | 1980-03-14 | Metal complex salt compound |
| US06/270,571 US4623720A (en) | 1979-03-15 | 1981-06-04 | 1:2 metal complexes of AZO compounds having a central substituted phenylenesulfonylaminophenylene radical |
| HK297/86A HK29786A (en) | 1979-03-15 | 1986-04-24 | Metal complex dyestuffs and their preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH245579A CH640556A5 (de) | 1979-03-15 | 1979-03-15 | Metallisierbare und metallisierte azoverbindungen, deren herstellung und verwendung. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH640556A5 true CH640556A5 (de) | 1984-01-13 |
Family
ID=4234213
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH245579A CH640556A5 (de) | 1979-03-15 | 1979-03-15 | Metallisierbare und metallisierte azoverbindungen, deren herstellung und verwendung. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4623720A (enExample) |
| JP (1) | JPS55125159A (enExample) |
| BR (1) | BR8001543A (enExample) |
| CH (1) | CH640556A5 (enExample) |
| DE (1) | DE3008086A1 (enExample) |
| ES (1) | ES8104361A1 (enExample) |
| FR (1) | FR2451389A1 (enExample) |
| GB (1) | GB2048295B (enExample) |
| HK (1) | HK29786A (enExample) |
| IT (1) | IT1128100B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2581072B1 (fr) * | 1985-04-26 | 1989-07-13 | Sandoz Sa | Nouveaux composes disazoiques contenant des groupes sulfo, leur preparation et leur utilisation comme colorants |
| DE3805746C2 (de) * | 1987-03-05 | 2003-04-10 | Clariant Finance Bvi Ltd | 1:2-Chromkomplexfarbstoffe |
| GB9406289D0 (en) * | 1994-03-30 | 1994-05-25 | Sandoz Ltd | Improvements in or relating to organic compounds |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA631460A (en) | 1961-11-21 | Beffa Fabio | Chromium-containing azo dyestuffs | |
| CH81256A (de) * | 1917-06-19 | 1919-05-16 | Chem Ind Basel | Verfahren zur Darstellung eines beizenfärbenden Azofarbstoffes |
| CH81255A (de) * | 1917-06-19 | 1919-05-16 | Chem Ind Basel | Verfahren zur Darstellung eines beizenfärbenden Azofarbstoffes |
| GB402920A (en) | 1932-10-12 | 1933-12-14 | Ig Farbenindustrie Ag | Improvements in colouring rubber and masses containing rubber |
| US2152007A (en) | 1934-01-31 | 1939-03-28 | Gen Aniline Works Inc | Azo dyestuffs and their production |
| FR842972A (fr) | 1937-09-07 | 1939-06-22 | Ig Farbenindustrie Ag | Colorants azoïques et leur procédé de production |
| GB502420A (en) * | 1937-09-16 | 1939-03-16 | Wilfrid Herbert Cliffe | Manufacture of new azo dyestuffs |
| US2384419A (en) | 1940-06-24 | 1945-09-04 | Gen Aniline & Film Corp | Azo dyestuffs |
| US2861985A (en) | 1952-12-24 | 1958-11-25 | Saul & Co | Disazo dyestuffs |
| US2886562A (en) | 1955-08-11 | 1959-05-12 | Bayer Ag | Disazo dyestuffs |
| NL219956A (enExample) | 1956-08-16 | |||
| DE1114961B (de) * | 1958-04-14 | 1961-10-12 | Geigy Ag J R | Verfahren zur Herstellung von chromhaltigen Azofarbstoffen |
| CH437589A (de) * | 1963-11-08 | 1967-06-15 | Durand & Huguenin Ag | Verfahren zur Herstellung von wasserlöslichen metallisierbaren Disazofarbstoffen |
| US3346550A (en) | 1964-07-16 | 1967-10-10 | Martin Marietta Corp | Azo dyestuffs containing thiosulfatoarylpyrazolone groups |
| DE1794331A1 (de) * | 1968-04-21 | 1971-10-28 | Bayer Ag | Metallhaltige Azofarbstoffe und Verfahren zu ihrer Herstellung |
| CH567550A5 (en) | 1972-02-25 | 1975-10-15 | Ciba Geigy Ag | Bisazo pigments prepn of pyrazolone series - for use in high-molecular organic cpds |
| FR2255356B1 (enExample) * | 1973-12-19 | 1978-03-24 | Ugine Kuhlmann | |
| DE2415690A1 (de) | 1974-04-01 | 1975-10-23 | Basf Ag | Trisazofarbstoffe |
| DE2416551A1 (de) | 1974-04-05 | 1975-10-23 | Basf Ag | Trisazofarbstoffe |
| DE2416670A1 (de) | 1974-04-05 | 1975-10-23 | Basf Ag | Trisazofarbstoffe |
| DE2440404A1 (de) | 1974-08-23 | 1976-03-04 | Basf Ag | Trisazofarbstoffe |
| FR2357611A1 (fr) * | 1976-07-09 | 1978-02-03 | Ugine Kuhlmann | Nouveaux colorants disazoiques hydrosolubles |
-
1979
- 1979-03-15 CH CH245579A patent/CH640556A5/de not_active IP Right Cessation
-
1980
- 1980-03-03 DE DE19803008086 patent/DE3008086A1/de active Granted
- 1980-03-11 GB GB8008174A patent/GB2048295B/en not_active Expired
- 1980-03-13 FR FR8005608A patent/FR2451389A1/fr active Granted
- 1980-03-13 IT IT48147/80A patent/IT1128100B/it active
- 1980-03-14 BR BR8001543A patent/BR8001543A/pt unknown
- 1980-03-14 JP JP3171080A patent/JPS55125159A/ja active Granted
- 1980-03-14 ES ES489605A patent/ES8104361A1/es not_active Expired
-
1981
- 1981-06-04 US US06/270,571 patent/US4623720A/en not_active Expired - Lifetime
-
1986
- 1986-04-24 HK HK297/86A patent/HK29786A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB2048295B (en) | 1983-03-30 |
| HK29786A (en) | 1986-05-02 |
| FR2451389A1 (fr) | 1980-10-10 |
| JPS6115902B2 (enExample) | 1986-04-26 |
| DE3008086C2 (enExample) | 1989-04-20 |
| IT1128100B (it) | 1986-05-28 |
| IT8048147A0 (it) | 1980-03-13 |
| ES489605A0 (es) | 1981-04-16 |
| FR2451389B1 (enExample) | 1981-11-06 |
| GB2048295A (en) | 1980-12-10 |
| ES8104361A1 (es) | 1981-04-16 |
| DE3008086A1 (de) | 1980-09-18 |
| JPS55125159A (en) | 1980-09-26 |
| US4623720A (en) | 1986-11-18 |
| BR8001543A (pt) | 1980-11-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2520526C2 (de) | Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung | |
| DE2745024C2 (enExample) | ||
| DE2722855C2 (enExample) | ||
| DE3034686C2 (de) | Wasserlösliche 1:2-Chromkomplexe von Disazoverbindungen, deren Herstellung und Verwendung | |
| DE2704364C2 (enExample) | ||
| EP0157733B1 (de) | Verfahren zur Herstellung von 1:2-Chromkomplexazofarbstoffen | |
| DE1544464B1 (de) | Verfahren zur Herstellung von wasserloeslichen,metallisierbaren Dis- und Trisazofarbstoffen und deren Schwermetallkomplexen | |
| DE2514008C2 (de) | Organische Verbindungen, deren Herstellung und Verwendung | |
| DE2236299C2 (de) | Azoverbindungen, deren Herstellung und Verwendung | |
| CH640556A5 (de) | Metallisierbare und metallisierte azoverbindungen, deren herstellung und verwendung. | |
| EP0156768B1 (de) | Verfahren zur Herstellung von 1:2-Chromkomplexfarbstoffen | |
| DE1155548B (de) | Verfahren zur Herstellung von metallisierten Azofarbstoffen | |
| CH622543A5 (enExample) | ||
| DE2501039C2 (de) | Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung | |
| DE1904113B2 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE951527C (de) | Verfahren zur Herstellung von metallisierbaren Disazofarbstoffen | |
| DE842091C (de) | Verfahren zur Herstellung von metallisierbaren Azofarbstoffen | |
| DE957507C (de) | Verfahren zur Herstellung von chromhaltigen Azofarbstoffen | |
| DE2608535A1 (de) | Neue chromkomplexfarbstoffe, ihre herstellung und verwendung | |
| DE1085987B (de) | Verfahren zur Herstellung metallhaltiger Monoazofarbstoffe | |
| DE2805243A1 (de) | 1 zu 2-metallkomplexe, deren herstellung und verwendung | |
| DE2039737A1 (de) | Azoverbindungen,deren Herstellung und Verwendung | |
| DE19511830A1 (de) | Polyazometallkomplexfarbstoffe, deren Herstellung und Verwendung | |
| CH367911A (de) | Verfahren zur Herstellung von Monoazofarbstoffen und ihren Metallkomplexverbindungen | |
| EP0037377A1 (de) | Metallkomplexfarbstoffe, deren Herstellung und Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |