JPS6115902B2 - - Google Patents
Info
- Publication number
- JPS6115902B2 JPS6115902B2 JP55031710A JP3171080A JPS6115902B2 JP S6115902 B2 JPS6115902 B2 JP S6115902B2 JP 55031710 A JP55031710 A JP 55031710A JP 3171080 A JP3171080 A JP 3171080A JP S6115902 B2 JPS6115902 B2 JP S6115902B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- hydrogen
- group
- complex salt
- sulfo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052739 hydrogen Inorganic materials 0.000 claims description 65
- 239000001257 hydrogen Substances 0.000 claims description 63
- -1 metal complex salt Chemical class 0.000 claims description 35
- 238000005859 coupling reaction Methods 0.000 claims description 32
- 150000002431 hydrogen Chemical class 0.000 claims description 32
- 150000003839 salts Chemical class 0.000 claims description 32
- 230000008878 coupling Effects 0.000 claims description 31
- 238000010168 coupling process Methods 0.000 claims description 31
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 27
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 24
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 18
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 17
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 14
- 229910052801 chlorine Inorganic materials 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- 239000010941 cobalt Substances 0.000 claims description 6
- 229910017052 cobalt Inorganic materials 0.000 claims description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 claims description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- LFMFPKKYRXFHHZ-UHFFFAOYSA-N R24 Chemical compound C1=C(Cl)C(C)=CC=C1NC1=NC(N)=C(C=CC=C2)C2=N1 LFMFPKKYRXFHHZ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- LNQUWGZAZIOHMM-UHFFFAOYSA-N ethoxy-hydroxy-methoxy-lambda3-chlorane Chemical group CCOCl(O)OC LNQUWGZAZIOHMM-UHFFFAOYSA-N 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- 150000004696 coordination complex Chemical class 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 57
- 239000000975 dye Substances 0.000 description 34
- 238000004043 dyeing Methods 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 239000010985 leather Substances 0.000 description 19
- 235000011121 sodium hydroxide Nutrition 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 238000001465 metallisation Methods 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 238000009792 diffusion process Methods 0.000 description 5
- 159000000000 sodium salts Chemical group 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- MEYVLGVRTYSQHI-UHFFFAOYSA-L cobalt(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Co+2].[O-]S([O-])(=O)=O MEYVLGVRTYSQHI-UHFFFAOYSA-L 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 230000005540 biological transmission Effects 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 238000006193 diazotization reaction Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 229910052979 sodium sulfide Inorganic materials 0.000 description 3
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- CWJQQASJVVAXKL-UHFFFAOYSA-N 4-(3-Methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzenesulfonic acid Chemical compound O=C1CC(C)=NN1C1=CC=C(S(O)(=O)=O)C=C1 CWJQQASJVVAXKL-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 150000004700 cobalt complex Chemical class 0.000 description 2
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 2
- CHMBIJAOCISYEW-UHFFFAOYSA-N n-(4-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1 CHMBIJAOCISYEW-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 239000010698 whale oil Substances 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- SPXOTSHWBDUUMT-UHFFFAOYSA-N 138-42-1 Chemical compound OS(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 SPXOTSHWBDUUMT-UHFFFAOYSA-N 0.000 description 1
- IUVCFHHAEHNCFT-INIZCTEOSA-N 2-[(1s)-1-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)chromen-4-one Chemical compound C1=C(F)C(OC(C)C)=CC=C1C(C1=C(N)N=CN=C11)=NN1[C@@H](C)C1=C(C=2C=C(F)C=CC=2)C(=O)C2=CC(F)=CC=C2O1 IUVCFHHAEHNCFT-INIZCTEOSA-N 0.000 description 1
- SXSBVVOHCWKOJR-UHFFFAOYSA-N 2-oxo-3h-1,3-benzoxazole-6-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2NC(=O)OC2=C1 SXSBVVOHCWKOJR-UHFFFAOYSA-N 0.000 description 1
- RHPXYZMDLOJTFF-UHFFFAOYSA-N 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC([N+]([O-])=O)=C1O RHPXYZMDLOJTFF-UHFFFAOYSA-N 0.000 description 1
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 1
- CWIZVEZLOAIJFA-UHFFFAOYSA-N 4-acetamidobenzenesulfonic acid hydrochloride Chemical compound Cl.CC(=O)NC1=CC=C(S(O)(=O)=O)C=C1 CWIZVEZLOAIJFA-UHFFFAOYSA-N 0.000 description 1
- GRDXCFKBQWDAJH-UHFFFAOYSA-N 4-acetamidobenzenesulfonyl chloride Chemical compound CC(=O)NC1=CC=C(S(Cl)(=O)=O)C=C1 GRDXCFKBQWDAJH-UHFFFAOYSA-N 0.000 description 1
- SEWNAJIUKSTYOP-UHFFFAOYSA-N 4-chloro-3-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC(S(Cl)(=O)=O)=CC=C1Cl SEWNAJIUKSTYOP-UHFFFAOYSA-N 0.000 description 1
- VVPHSMHEYVOVLH-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 VVPHSMHEYVOVLH-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 235000000536 Brassica rapa subsp pekinensis Nutrition 0.000 description 1
- 241000499436 Brassica rapa subsp. pekinensis Species 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- RZXZXSFKKFUEEI-UHFFFAOYSA-N [O-][N+](C(C=CC=C1)=C1Cl)=O.Cl Chemical compound [O-][N+](C(C=CC=C1)=C1Cl)=O.Cl RZXZXSFKKFUEEI-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010016 exhaust dyeing Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/24—Disazo or polyazo compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH245579A CH640556A5 (de) | 1979-03-15 | 1979-03-15 | Metallisierbare und metallisierte azoverbindungen, deren herstellung und verwendung. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS55125159A JPS55125159A (en) | 1980-09-26 |
| JPS6115902B2 true JPS6115902B2 (enExample) | 1986-04-26 |
Family
ID=4234213
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP3171080A Granted JPS55125159A (en) | 1979-03-15 | 1980-03-14 | Metal complex salt compound |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4623720A (enExample) |
| JP (1) | JPS55125159A (enExample) |
| BR (1) | BR8001543A (enExample) |
| CH (1) | CH640556A5 (enExample) |
| DE (1) | DE3008086A1 (enExample) |
| ES (1) | ES8104361A1 (enExample) |
| FR (1) | FR2451389A1 (enExample) |
| GB (1) | GB2048295B (enExample) |
| HK (1) | HK29786A (enExample) |
| IT (1) | IT1128100B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH667663A5 (de) * | 1985-04-26 | 1988-10-31 | Sandoz Ag | Anionische disazoverbindungen. |
| DE3805746C2 (de) * | 1987-03-05 | 2003-04-10 | Clariant Finance Bvi Ltd | 1:2-Chromkomplexfarbstoffe |
| GB9406289D0 (en) * | 1994-03-30 | 1994-05-25 | Sandoz Ltd | Improvements in or relating to organic compounds |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA631460A (en) | 1961-11-21 | Beffa Fabio | Chromium-containing azo dyestuffs | |
| CH81255A (de) * | 1917-06-19 | 1919-05-16 | Chem Ind Basel | Verfahren zur Darstellung eines beizenfärbenden Azofarbstoffes |
| CH81256A (de) * | 1917-06-19 | 1919-05-16 | Chem Ind Basel | Verfahren zur Darstellung eines beizenfärbenden Azofarbstoffes |
| GB402920A (en) | 1932-10-12 | 1933-12-14 | Ig Farbenindustrie Ag | Improvements in colouring rubber and masses containing rubber |
| US2152007A (en) | 1934-01-31 | 1939-03-28 | Gen Aniline Works Inc | Azo dyestuffs and their production |
| FR842972A (fr) | 1937-09-07 | 1939-06-22 | Ig Farbenindustrie Ag | Colorants azoïques et leur procédé de production |
| GB502420A (en) * | 1937-09-16 | 1939-03-16 | Wilfrid Herbert Cliffe | Manufacture of new azo dyestuffs |
| US2384419A (en) | 1940-06-24 | 1945-09-04 | Gen Aniline & Film Corp | Azo dyestuffs |
| US2861985A (en) | 1952-12-24 | 1958-11-25 | Saul & Co | Disazo dyestuffs |
| US2886562A (en) | 1955-08-11 | 1959-05-12 | Bayer Ag | Disazo dyestuffs |
| NL219956A (enExample) | 1956-08-16 | |||
| DE1114961B (de) * | 1958-04-14 | 1961-10-12 | Geigy Ag J R | Verfahren zur Herstellung von chromhaltigen Azofarbstoffen |
| CH437589A (de) * | 1963-11-08 | 1967-06-15 | Durand & Huguenin Ag | Verfahren zur Herstellung von wasserlöslichen metallisierbaren Disazofarbstoffen |
| US3346550A (en) | 1964-07-16 | 1967-10-10 | Martin Marietta Corp | Azo dyestuffs containing thiosulfatoarylpyrazolone groups |
| DE1794331A1 (de) * | 1968-04-21 | 1971-10-28 | Bayer Ag | Metallhaltige Azofarbstoffe und Verfahren zu ihrer Herstellung |
| CH567550A5 (en) | 1972-02-25 | 1975-10-15 | Ciba Geigy Ag | Bisazo pigments prepn of pyrazolone series - for use in high-molecular organic cpds |
| FR2255356B1 (enExample) | 1973-12-19 | 1978-03-24 | Ugine Kuhlmann | |
| DE2415690A1 (de) | 1974-04-01 | 1975-10-23 | Basf Ag | Trisazofarbstoffe |
| DE2416670A1 (de) | 1974-04-05 | 1975-10-23 | Basf Ag | Trisazofarbstoffe |
| DE2416551A1 (de) | 1974-04-05 | 1975-10-23 | Basf Ag | Trisazofarbstoffe |
| DE2440404A1 (de) | 1974-08-23 | 1976-03-04 | Basf Ag | Trisazofarbstoffe |
| FR2357611A1 (fr) * | 1976-07-09 | 1978-02-03 | Ugine Kuhlmann | Nouveaux colorants disazoiques hydrosolubles |
-
1979
- 1979-03-15 CH CH245579A patent/CH640556A5/de not_active IP Right Cessation
-
1980
- 1980-03-03 DE DE19803008086 patent/DE3008086A1/de active Granted
- 1980-03-11 GB GB8008174A patent/GB2048295B/en not_active Expired
- 1980-03-13 FR FR8005608A patent/FR2451389A1/fr active Granted
- 1980-03-13 IT IT48147/80A patent/IT1128100B/it active
- 1980-03-14 JP JP3171080A patent/JPS55125159A/ja active Granted
- 1980-03-14 BR BR8001543A patent/BR8001543A/pt unknown
- 1980-03-14 ES ES489605A patent/ES8104361A1/es not_active Expired
-
1981
- 1981-06-04 US US06/270,571 patent/US4623720A/en not_active Expired - Lifetime
-
1986
- 1986-04-24 HK HK297/86A patent/HK29786A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3008086A1 (de) | 1980-09-18 |
| CH640556A5 (de) | 1984-01-13 |
| GB2048295B (en) | 1983-03-30 |
| JPS55125159A (en) | 1980-09-26 |
| FR2451389B1 (enExample) | 1981-11-06 |
| HK29786A (en) | 1986-05-02 |
| FR2451389A1 (fr) | 1980-10-10 |
| US4623720A (en) | 1986-11-18 |
| BR8001543A (pt) | 1980-11-11 |
| DE3008086C2 (enExample) | 1989-04-20 |
| ES489605A0 (es) | 1981-04-16 |
| IT8048147A0 (it) | 1980-03-13 |
| ES8104361A1 (es) | 1981-04-16 |
| IT1128100B (it) | 1986-05-28 |
| GB2048295A (en) | 1980-12-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU184830B (en) | Process for producing chromocomplexes of diazo-compounds | |
| JPS5921345B2 (ja) | 1:2金属錯塩 | |
| CA1088051A (en) | Chromium complex dyes, process for their manufacture and use thereof | |
| US4120854A (en) | Disazo and trisazo dyes having a 1,3-diamino-, dihydroxy- or amino-hydroxy-benzene nucleus and metal complexes thereof | |
| JPS6115902B2 (enExample) | ||
| JPH0778181B2 (ja) | ポリアゾ染料のクロム錯体 | |
| FR2702770A1 (fr) | Composés azoïques dérivés de la pyrimidine, leur préparation et leur utilisation comme colorants. | |
| JPH0511149B2 (enExample) | ||
| JPH06287460A (ja) | 1:2クロム錯体染料 | |
| US3943122A (en) | Polyazo compounds containing benzhydrol as a component | |
| JPS6334185B2 (enExample) | ||
| JPH08337732A (ja) | アゾ染料、その製造方法およびその使用方法 | |
| JPH0521152B2 (enExample) | ||
| US5696242A (en) | Polyazo dyes containing the radical of a bis-coupling component, and process for their production | |
| US5095100A (en) | Metal complex dyes and preparation thereof | |
| JPS6147174B2 (enExample) | ||
| JPH0239543B2 (enExample) | ||
| US2022243A (en) | Azo dye | |
| US4005067A (en) | Process for the synthesis of nitrite ion-containing 1:1 complexes of cobalt and metallizable monoazo or azomethine compounds and such complexes | |
| US3218308A (en) | Metal-containing reactive phenylazo-napthylaminophenyleneam inopoly-halogenatedpyrimidyl dyestuffs | |
| JPS6025065B2 (ja) | 金属錯塩染料 | |
| US2749333A (en) | Metal-containing polyazo dyestuffs | |
| JPS6124421B2 (enExample) | ||
| FR2594128A1 (fr) | Colorants a complexe de chrome 1:2 asymetrique, leur preparation et leur utilisation | |
| JPS60229955A (ja) | クロム錯塩染料、その製法、及びその使用 |