CH630615A5 - Derives d'imidazole a proprietes herbicides. - Google Patents
Derives d'imidazole a proprietes herbicides. Download PDFInfo
- Publication number
- CH630615A5 CH630615A5 CH234478A CH234478A CH630615A5 CH 630615 A5 CH630615 A5 CH 630615A5 CH 234478 A CH234478 A CH 234478A CH 234478 A CH234478 A CH 234478A CH 630615 A5 CH630615 A5 CH 630615A5
- Authority
- CH
- Switzerland
- Prior art keywords
- imidazole
- dimethyl
- dicarboxamide
- ethyl
- spp
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 50
- 239000004009 herbicide Substances 0.000 title claims description 12
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 title claims description 10
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical class C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 title description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 438
- 150000001875 compounds Chemical class 0.000 claims description 120
- -1 trifluoromethoxy, methyl Chemical group 0.000 claims description 94
- 239000000203 mixture Substances 0.000 claims description 85
- 241000196324 Embryophyta Species 0.000 claims description 56
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 56
- 238000000034 method Methods 0.000 claims description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 43
- 239000000243 solution Substances 0.000 claims description 39
- 150000002460 imidazoles Chemical class 0.000 claims description 34
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 claims description 29
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims description 29
- 238000002360 preparation method Methods 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 27
- 230000012010 growth Effects 0.000 claims description 25
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 22
- 238000011282 treatment Methods 0.000 claims description 22
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 claims description 18
- 239000003085 diluting agent Substances 0.000 claims description 18
- 239000000945 filler Substances 0.000 claims description 16
- 241000209504 Poaceae Species 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 239000000843 powder Substances 0.000 claims description 12
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 12
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 12
- 239000008187 granular material Substances 0.000 claims description 11
- 240000008042 Zea mays Species 0.000 claims description 10
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 claims description 10
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 10
- 235000005822 corn Nutrition 0.000 claims description 10
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 9
- 241001233957 eudicotyledons Species 0.000 claims description 9
- 239000003960 organic solvent Substances 0.000 claims description 9
- 239000002689 soil Substances 0.000 claims description 9
- 235000021307 Triticum Nutrition 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 240000007594 Oryza sativa Species 0.000 claims description 7
- 235000007164 Oryza sativa Nutrition 0.000 claims description 7
- 240000006694 Stellaria media Species 0.000 claims description 7
- 239000004480 active ingredient Substances 0.000 claims description 7
- 239000011149 active material Substances 0.000 claims description 7
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 7
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 7
- 235000009566 rice Nutrition 0.000 claims description 7
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 6
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 claims description 6
- 240000006995 Abutilon theophrasti Species 0.000 claims description 6
- 244000291564 Allium cepa Species 0.000 claims description 6
- 235000002732 Allium cepa var. cepa Nutrition 0.000 claims description 6
- 235000007319 Avena orientalis Nutrition 0.000 claims description 6
- 241000209510 Liliopsida Species 0.000 claims description 6
- 235000007238 Secale cereale Nutrition 0.000 claims description 6
- 244000082988 Secale cereale Species 0.000 claims description 6
- 240000003829 Sorghum propinquum Species 0.000 claims description 6
- 235000011684 Sorghum saccharatum Nutrition 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 239000004094 surface-active agent Substances 0.000 claims description 6
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 claims description 5
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 claims description 5
- 125000006483 4-iodobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1I)C([H])([H])* 0.000 claims description 5
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 claims description 5
- 125000000173 4-trifluoromethoxy benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC(F)(F)F)C([H])([H])* 0.000 claims description 5
- 235000010469 Glycine max Nutrition 0.000 claims description 5
- 240000005979 Hordeum vulgare Species 0.000 claims description 5
- 235000007340 Hordeum vulgare Nutrition 0.000 claims description 5
- 240000000111 Saccharum officinarum Species 0.000 claims description 5
- 235000007201 Saccharum officinarum Nutrition 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 5
- 125000006185 3,4-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])[H])C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 claims description 4
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 claims description 4
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 claims description 4
- 125000006482 3-iodobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(I)=C1[H])C([H])([H])* 0.000 claims description 4
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000006495 3-trifluoromethyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])*)C(F)(F)F 0.000 claims description 4
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 claims description 4
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 claims description 4
- 125000002528 4-isopropyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 claims description 4
- 235000016068 Berberis vulgaris Nutrition 0.000 claims description 4
- 241000335053 Beta vulgaris Species 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 229920000742 Cotton Polymers 0.000 claims description 4
- 241001508646 Galeopsis tetrahit Species 0.000 claims description 4
- 235000002595 Solanum tuberosum Nutrition 0.000 claims description 4
- 244000061456 Solanum tuberosum Species 0.000 claims description 4
- 230000006378 damage Effects 0.000 claims description 4
- 239000002420 orchard Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 239000004563 wettable powder Substances 0.000 claims description 4
- 241000219318 Amaranthus Species 0.000 claims description 3
- 235000021537 Beetroot Nutrition 0.000 claims description 3
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 claims description 3
- 240000008853 Datura stramonium Species 0.000 claims description 3
- 241000192043 Echinochloa Species 0.000 claims description 3
- 241000219146 Gossypium Species 0.000 claims description 3
- 241000205407 Polygonum Species 0.000 claims description 3
- 235000002594 Solanum nigrum Nutrition 0.000 claims description 3
- 244000061457 Solanum nigrum Species 0.000 claims description 3
- 240000003728 Spergula arvensis Species 0.000 claims description 3
- 235000021536 Sugar beet Nutrition 0.000 claims description 3
- 244000067505 Xanthium strumarium Species 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims description 3
- 241000743339 Agrostis Species 0.000 claims description 2
- 241000743985 Alopecurus Species 0.000 claims description 2
- 244000105624 Arachis hypogaea Species 0.000 claims description 2
- 235000005781 Avena Nutrition 0.000 claims description 2
- 244000025254 Cannabis sativa Species 0.000 claims description 2
- 241000219312 Chenopodium Species 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 244000192528 Chrysanthemum parthenium Species 0.000 claims description 2
- 244000144786 Chrysanthemum segetum Species 0.000 claims description 2
- 235000005470 Chrysanthemum segetum Nutrition 0.000 claims description 2
- 244000052363 Cynodon dactylon Species 0.000 claims description 2
- 244000000626 Daucus carota Species 0.000 claims description 2
- 235000002767 Daucus carota Nutrition 0.000 claims description 2
- 235000007351 Eleusine Nutrition 0.000 claims description 2
- 241000209215 Eleusine Species 0.000 claims description 2
- 241000508725 Elymus repens Species 0.000 claims description 2
- 241000221079 Euphorbia <genus> Species 0.000 claims description 2
- 241001101998 Galium Species 0.000 claims description 2
- 244000068988 Glycine max Species 0.000 claims description 2
- 235000004431 Linum usitatissimum Nutrition 0.000 claims description 2
- 240000006240 Linum usitatissimum Species 0.000 claims description 2
- 235000017945 Matricaria Nutrition 0.000 claims description 2
- 235000007232 Matricaria chamomilla Nutrition 0.000 claims description 2
- 240000000178 Monochoria vaginalis Species 0.000 claims description 2
- 241001442135 Myosotis arvensis Species 0.000 claims description 2
- 235000010582 Pisum sativum Nutrition 0.000 claims description 2
- 240000004713 Pisum sativum Species 0.000 claims description 2
- 241000209048 Poa Species 0.000 claims description 2
- 241000219295 Portulaca Species 0.000 claims description 2
- 244000286177 Raphanus raphanistrum Species 0.000 claims description 2
- 235000000241 Raphanus raphanistrum Nutrition 0.000 claims description 2
- 244000155504 Rotala indica Species 0.000 claims description 2
- 241001373037 Rumex hypogaeus Species 0.000 claims description 2
- 235000005775 Setaria Nutrition 0.000 claims description 2
- 241000232088 Setaria <nematode> Species 0.000 claims description 2
- 241000220261 Sinapis Species 0.000 claims description 2
- 235000009108 Urtica dioica Nutrition 0.000 claims description 2
- 240000001261 Urtica urens Species 0.000 claims description 2
- 240000005592 Veronica officinalis Species 0.000 claims description 2
- 241000394440 Viola arvensis Species 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000006286 dichlorobenzyl group Chemical group 0.000 claims description 2
- 239000000839 emulsion Substances 0.000 claims description 2
- 239000003337 fertilizer Substances 0.000 claims description 2
- 239000000417 fungicide Substances 0.000 claims description 2
- 239000002917 insecticide Substances 0.000 claims description 2
- 235000020232 peanut Nutrition 0.000 claims description 2
- 239000000575 pesticide Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 5
- 244000075850 Avena orientalis Species 0.000 claims 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 3
- 244000098338 Triticum aestivum Species 0.000 claims 3
- 239000001257 hydrogen Substances 0.000 claims 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 3
- 125000004429 atom Chemical group 0.000 claims 2
- 235000012015 potatoes Nutrition 0.000 claims 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- 241000208479 Anagallis arvensis Species 0.000 claims 1
- 235000017060 Arachis glabrata Nutrition 0.000 claims 1
- 235000010777 Arachis hypogaea Nutrition 0.000 claims 1
- 235000018262 Arachis monticola Nutrition 0.000 claims 1
- 235000011305 Capsella bursa pastoris Nutrition 0.000 claims 1
- 240000008867 Capsella bursa-pastoris Species 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 235000017896 Digitaria Nutrition 0.000 claims 1
- 241001303487 Digitaria <clam> Species 0.000 claims 1
- 241000919496 Erysimum Species 0.000 claims 1
- 235000007846 Papaver rhoeas Nutrition 0.000 claims 1
- 240000004674 Papaver rhoeas Species 0.000 claims 1
- 244000047670 Viola x wittrockiana Species 0.000 claims 1
- 235000004031 Viola x wittrockiana Nutrition 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 239000011230 binding agent Substances 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000003630 growth substance Substances 0.000 claims 1
- JPQFUHCOKXIWBB-ZCRGAIPPSA-N isoobtusol Natural products CC1(C)[C@@H](Br)[C@@H](O)CC(=C)[C@@]11C[C@H](Cl)[C@@](C)(Br)CC1 JPQFUHCOKXIWBB-ZCRGAIPPSA-N 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- JPQFUHCOKXIWBB-FWZIUSJTSA-N obtusol Chemical compound CC1(C)[C@H](Br)[C@H](O)CC(=C)[C@]11C[C@@H](Cl)[C@](C)(Br)CC1 JPQFUHCOKXIWBB-FWZIUSJTSA-N 0.000 claims 1
- MJYXNLJVQSSJFM-UHFFFAOYSA-N obtusol Natural products C1CC(O)C(C)(C)C2CCC3(C)C4(CO)CCC5(C)CCC(C)C(C)C5C4=CCC3C21C MJYXNLJVQSSJFM-UHFFFAOYSA-N 0.000 claims 1
- 239000011435 rock Substances 0.000 claims 1
- 238000002844 melting Methods 0.000 description 109
- 230000008018 melting Effects 0.000 description 109
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 99
- 238000002425 crystallisation Methods 0.000 description 66
- 230000008025 crystallization Effects 0.000 description 66
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 54
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 35
- 238000000354 decomposition reaction Methods 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 24
- 238000009835 boiling Methods 0.000 description 20
- 239000007787 solid Substances 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 239000007788 liquid Substances 0.000 description 17
- 239000003921 oil Substances 0.000 description 17
- 235000019198 oils Nutrition 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 239000012141 concentrate Substances 0.000 description 14
- 235000008504 concentrate Nutrition 0.000 description 14
- 238000010992 reflux Methods 0.000 description 14
- 239000000047 product Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 238000001704 evaporation Methods 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- ZEVWQFWTGHFIDH-UHFFFAOYSA-N 1h-imidazole-4,5-dicarboxylic acid Chemical class OC(=O)C=1N=CNC=1C(O)=O ZEVWQFWTGHFIDH-UHFFFAOYSA-N 0.000 description 9
- 230000008020 evaporation Effects 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- 238000005507 spraying Methods 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- YZIFVWOCPGPNHB-UHFFFAOYSA-N 1,2-dichloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C(Cl)=C1 YZIFVWOCPGPNHB-UHFFFAOYSA-N 0.000 description 6
- 235000008427 Brassica arvensis Nutrition 0.000 description 6
- 244000024671 Brassica kaber Species 0.000 description 6
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 6
- 240000006122 Chenopodium album Species 0.000 description 6
- 235000009344 Chenopodium album Nutrition 0.000 description 6
- 235000019502 Orange oil Nutrition 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 6
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 6
- 239000010502 orange oil Substances 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- QFMDFTQOJHFVNR-UHFFFAOYSA-N 1-[2,2-dichloro-1-(4-ethylphenyl)ethyl]-4-ethylbenzene Chemical compound C1=CC(CC)=CC=C1C(C(Cl)Cl)C1=CC=C(CC)C=C1 QFMDFTQOJHFVNR-UHFFFAOYSA-N 0.000 description 5
- BHAAQCPWCCKULK-UHFFFAOYSA-N 2-benzyl-1h-imidazole-4,5-dicarbonitrile Chemical class N1C(C#N)=C(C#N)N=C1CC1=CC=CC=C1 BHAAQCPWCCKULK-UHFFFAOYSA-N 0.000 description 5
- 235000007320 Avena fatua Nutrition 0.000 description 5
- 241000209764 Avena fatua Species 0.000 description 5
- 244000058871 Echinochloa crus-galli Species 0.000 description 5
- 241001289540 Fallopia convolvulus Species 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 235000011999 Panicum crusgalli Nutrition 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 241000209140 Triticum Species 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- KYPOHTVBFVELTG-UPHRSURJSA-N (z)-but-2-enedinitrile Chemical compound N#C\C=C/C#N KYPOHTVBFVELTG-UPHRSURJSA-N 0.000 description 4
- ABAUGTVEDXFARS-UHFFFAOYSA-N 1,2-dibromo-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Br)C(Br)=C1 ABAUGTVEDXFARS-UHFFFAOYSA-N 0.000 description 4
- HWQGXBCAMFVSPB-UHFFFAOYSA-N 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(Cl)=CC=C1CN1C(C#N)=C(C#N)N=C1 HWQGXBCAMFVSPB-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 241000209761 Avena Species 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- 240000006928 Persicaria lapathifolia Species 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000009333 weeding Methods 0.000 description 4
- UZGUMBYWNGRUSI-KHPPLWFESA-N (z)-2-amino-3-[(3,4-dichlorophenyl)methylamino]but-2-enedinitrile Chemical compound N#CC(/N)=C(C#N)/NCC1=CC=C(Cl)C(Cl)=C1 UZGUMBYWNGRUSI-KHPPLWFESA-N 0.000 description 3
- IHSYKQWWDAFVSB-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)butan-1-ol Chemical compound CCCC(O)C1=CC=C(Cl)C(Cl)=C1 IHSYKQWWDAFVSB-UHFFFAOYSA-N 0.000 description 3
- YNVXCOKNHXMBQC-UHFFFAOYSA-N 1-[3-(trifluoromethyl)phenyl]ethanol Chemical compound CC(O)C1=CC=CC(C(F)(F)F)=C1 YNVXCOKNHXMBQC-UHFFFAOYSA-N 0.000 description 3
- XCJXYTFYKPVYMK-UHFFFAOYSA-N 1-bromo-4-(bromomethyl)-2-chlorobenzene Chemical compound ClC1=CC(CBr)=CC=C1Br XCJXYTFYKPVYMK-UHFFFAOYSA-N 0.000 description 3
- DHMPDNLGFIBQCK-UHFFFAOYSA-N 3,4-dibromobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C(Br)=C1 DHMPDNLGFIBQCK-UHFFFAOYSA-N 0.000 description 3
- 241001621841 Alopecurus myosuroides Species 0.000 description 3
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 3
- 244000237956 Amaranthus retroflexus Species 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 230000006978 adaptation Effects 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- UOUIDNHNSLAJDQ-UHFFFAOYSA-N diethyl 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C(=O)OCC)N=CN1CC1=CC=C(Cl)C(Cl)=C1 UOUIDNHNSLAJDQ-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000004495 emulsifiable concentrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 159000000011 group IA salts Chemical class 0.000 description 3
- 239000007970 homogeneous dispersion Substances 0.000 description 3
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 3
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 3
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- LEBUFKMXQTTWDK-UHFFFAOYSA-N (3,4-dibromophenyl)methanol Chemical compound OCC1=CC=C(Br)C(Br)=C1 LEBUFKMXQTTWDK-UHFFFAOYSA-N 0.000 description 2
- ZRBDUKUJADUIEO-UHFFFAOYSA-N (3-bromo-4-methylphenyl)methanol Chemical compound CC1=CC=C(CO)C=C1Br ZRBDUKUJADUIEO-UHFFFAOYSA-N 0.000 description 2
- DPZSNGJNFHWQDC-ARJAWSKDSA-N (z)-2,3-diaminobut-2-enedinitrile Chemical compound N#CC(/N)=C(/N)C#N DPZSNGJNFHWQDC-ARJAWSKDSA-N 0.000 description 2
- SUZMKBXAFSJVRG-UHFFFAOYSA-N 1,2-dichloro-4-(1-chloroheptyl)benzene Chemical compound CCCCCCC(Cl)C1=CC=C(Cl)C(Cl)=C1 SUZMKBXAFSJVRG-UHFFFAOYSA-N 0.000 description 2
- ROEYQOPGMISNEU-UHFFFAOYSA-N 1,2-dichloro-4-(1-chloropropyl)benzene Chemical compound CCC(Cl)C1=CC=C(Cl)C(Cl)=C1 ROEYQOPGMISNEU-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- AJBWDFPJLDDEPQ-UHFFFAOYSA-N 1-(1-bromoethyl)-3-(trifluoromethyl)benzene Chemical compound CC(Br)C1=CC=CC(C(F)(F)F)=C1 AJBWDFPJLDDEPQ-UHFFFAOYSA-N 0.000 description 2
- GDOJIBUYYIFJJW-UHFFFAOYSA-N 1-(1-bromoethyl)-4-iodobenzene Chemical compound CC(Br)C1=CC=C(I)C=C1 GDOJIBUYYIFJJW-UHFFFAOYSA-N 0.000 description 2
- WQDFMIFUDQOCNK-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)heptan-1-ol Chemical compound CCCCCCC(O)C1=CC=C(Cl)C(Cl)=C1 WQDFMIFUDQOCNK-UHFFFAOYSA-N 0.000 description 2
- BGBWPENBUQVNSY-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)hexan-1-one Chemical compound CCCCCC(=O)C1=CC=C(Cl)C(Cl)=C1 BGBWPENBUQVNSY-UHFFFAOYSA-N 0.000 description 2
- DVJCOSCVKHXJQM-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)nonan-1-one Chemical compound CCCCCCCCC(=O)C1=CC=C(Cl)C(Cl)=C1 DVJCOSCVKHXJQM-UHFFFAOYSA-N 0.000 description 2
- WOFALSIAGLLIEF-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)pentan-1-ol Chemical compound CCCCC(O)C1=CC=C(Cl)C(Cl)=C1 WOFALSIAGLLIEF-UHFFFAOYSA-N 0.000 description 2
- DAQIQOIKLVJWKH-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)pentan-1-one Chemical compound CCCCC(=O)C1=CC=C(Cl)C(Cl)=C1 DAQIQOIKLVJWKH-UHFFFAOYSA-N 0.000 description 2
- KWUDBZIJCVKUHM-UHFFFAOYSA-N 1-(4-iodophenyl)ethanol Chemical compound CC(O)C1=CC=C(I)C=C1 KWUDBZIJCVKUHM-UHFFFAOYSA-N 0.000 description 2
- LBMKFQMJURUPKC-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CCl)C=C1 LBMKFQMJURUPKC-UHFFFAOYSA-N 0.000 description 2
- UEIJPSVZLULBMX-UHFFFAOYSA-N 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(Cl)C(Cl)=C1 UEIJPSVZLULBMX-UHFFFAOYSA-N 0.000 description 2
- HTBFMVXYLRUDEP-UHFFFAOYSA-N 1-[(4-chloro-3-methylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(C)=CC(CN2C(=C(C#N)N=C2)C#N)=C1 HTBFMVXYLRUDEP-UHFFFAOYSA-N 0.000 description 2
- IOBGWZLVDRJKRX-UHFFFAOYSA-N 1-[1-(3,4-dibromophenyl)ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=C(Br)C(Br)=C1 IOBGWZLVDRJKRX-UHFFFAOYSA-N 0.000 description 2
- GTPQWFWKTVIYIL-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)propyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(CC)C1=CC=C(Cl)C(Cl)=C1 GTPQWFWKTVIYIL-UHFFFAOYSA-N 0.000 description 2
- CVAKKNUFZQUCBW-UHFFFAOYSA-N 1-[1-[3-(trifluoromethyl)phenyl]ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=CC(C(F)(F)F)=C1 CVAKKNUFZQUCBW-UHFFFAOYSA-N 0.000 description 2
- PJPSOTLRLORLGJ-UHFFFAOYSA-N 1-[1-[4-(trifluoromethyl)phenyl]ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=C(C(F)(F)F)C=C1 PJPSOTLRLORLGJ-UHFFFAOYSA-N 0.000 description 2
- RFESEZYNEIOJHS-UHFFFAOYSA-N 1-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound CC(O)C1=CC=C(OC(F)(F)F)C=C1 RFESEZYNEIOJHS-UHFFFAOYSA-N 0.000 description 2
- SDTULEXOSNNGAW-UHFFFAOYSA-N 1-bromo-2-chloro-4-methylbenzene Chemical compound CC1=CC=C(Br)C(Cl)=C1 SDTULEXOSNNGAW-UHFFFAOYSA-N 0.000 description 2
- XGDRLCRGKUCBQL-UHFFFAOYSA-N 1h-imidazole-4,5-dicarbonitrile Chemical compound N#CC=1N=CNC=1C#N XGDRLCRGKUCBQL-UHFFFAOYSA-N 0.000 description 2
- 239000002794 2,4-DB Substances 0.000 description 2
- YIVXMZJTEQBPQO-UHFFFAOYSA-N 2,4-DB Chemical compound OC(=O)CCCOC1=CC=C(Cl)C=C1Cl YIVXMZJTEQBPQO-UHFFFAOYSA-N 0.000 description 2
- JNPGXYPTTMKNJS-UHFFFAOYSA-N 2-benzyl-1h-imidazole-4,5-dicarboxylic acid Chemical class N1C(C(O)=O)=C(C(=O)O)N=C1CC1=CC=CC=C1 JNPGXYPTTMKNJS-UHFFFAOYSA-N 0.000 description 2
- IGIMRHMZHOJBKZ-UHFFFAOYSA-N 2-bromo-4-(chloromethyl)-1-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1Br IGIMRHMZHOJBKZ-UHFFFAOYSA-N 0.000 description 2
- LLWADFLAOKUBDR-UHFFFAOYSA-N 2-methyl-4-chlorophenoxybutyric acid Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 2
- BDAHJRSPLTZINY-UHFFFAOYSA-N 3,4-dichloro-1-phenylbutan-1-one Chemical compound ClCC(Cl)CC(=O)C1=CC=CC=C1 BDAHJRSPLTZINY-UHFFFAOYSA-N 0.000 description 2
- ZWUSBSHBFFPRNE-UHFFFAOYSA-N 3,4-dichlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1Cl ZWUSBSHBFFPRNE-UHFFFAOYSA-N 0.000 description 2
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 2
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 2
- RIZRQBKYAVIFCA-UHFFFAOYSA-N 4-(1-bromopentyl)-1,2-dichlorobenzene Chemical compound CCCCC(Br)C1=CC=C(Cl)C(Cl)=C1 RIZRQBKYAVIFCA-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- UZGBMCVSBCAVMY-UHFFFAOYSA-N 4-(bromomethyl)-1,2-diiodobenzene Chemical compound BrCC1=CC=C(I)C(I)=C1 UZGBMCVSBCAVMY-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 2
- YJKIALIXRCSISK-UHFFFAOYSA-N Chlorfenprop-methyl Chemical group COC(=O)C(Cl)CC1=CC=C(Cl)C=C1 YJKIALIXRCSISK-UHFFFAOYSA-N 0.000 description 2
- OFDYMSKSGFSLLM-UHFFFAOYSA-N Dinitramine Chemical compound CCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C(N)=C1[N+]([O-])=O OFDYMSKSGFSLLM-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 235000009193 Lamium purpureum Nutrition 0.000 description 2
- 240000006503 Lamium purpureum Species 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 235000001855 Portulaca oleracea Nutrition 0.000 description 2
- 244000234609 Portulaca oleracea Species 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 240000003461 Setaria viridis Species 0.000 description 2
- 235000002248 Setaria viridis Nutrition 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- RCTGMCJBQGBLKT-UHFFFAOYSA-N Sudan IV Chemical compound CC1=CC=CC=C1N=NC(C=C1C)=CC=C1N=NC1=C(O)C=CC2=CC=CC=C12 RCTGMCJBQGBLKT-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- QHTQREMOGMZHJV-UHFFFAOYSA-N Thiobencarb Chemical compound CCN(CC)C(=O)SCC1=CC=C(Cl)C=C1 QHTQREMOGMZHJV-UHFFFAOYSA-N 0.000 description 2
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 2
- 241000404538 Tripleurospermum maritimum subsp. inodorum Species 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000012874 anionic emulsifier Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 2
- MCOQHIWZJUDQIC-UHFFFAOYSA-N barban Chemical compound ClCC#CCOC(=O)NC1=CC=CC(Cl)=C1 MCOQHIWZJUDQIC-UHFFFAOYSA-N 0.000 description 2
- 150000003938 benzyl alcohols Chemical class 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- WYKYKTKDBLFHCY-UHFFFAOYSA-N chloridazon Chemical compound O=C1C(Cl)=C(N)C=NN1C1=CC=CC=C1 WYKYKTKDBLFHCY-UHFFFAOYSA-N 0.000 description 2
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 2
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 2
- 239000004491 dispersible concentrate Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- NRXQIUSYPAHGNM-UHFFFAOYSA-N ioxynil Chemical compound OC1=C(I)C=C(C#N)C=C1I NRXQIUSYPAHGNM-UHFFFAOYSA-N 0.000 description 2
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 229910052919 magnesium silicate Inorganic materials 0.000 description 2
- 235000019792 magnesium silicate Nutrition 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- VHCNQEUWZYOAEV-UHFFFAOYSA-N metamitron Chemical compound O=C1N(N)C(C)=NN=C1C1=CC=CC=C1 VHCNQEUWZYOAEV-UHFFFAOYSA-N 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 2
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 235000014483 powder concentrate Nutrition 0.000 description 2
- VXPLXMJHHKHSOA-UHFFFAOYSA-N propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 229940080818 propionamide Drugs 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004546 suspension concentrate Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- 229960004319 trichloroacetic acid Drugs 0.000 description 2
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical compound OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-SSDOTTSWSA-N (R)-mecoprop Chemical compound OC(=O)[C@@H](C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-SSDOTTSWSA-N 0.000 description 1
- MTQKMPGBALVEDL-ZPCKWCKBSA-N (z,12r)-12-hydroxy-2-sulfooctadec-9-enoic acid Chemical class CCCCCC[C@@H](O)C\C=C/CCCCCCC(C(O)=O)S(O)(=O)=O MTQKMPGBALVEDL-ZPCKWCKBSA-N 0.000 description 1
- PXQTZCYVTTZYFY-UHFFFAOYSA-N 1,2-dibromo-4-(1-chloroethyl)benzene Chemical compound CC(Cl)C1=CC=C(Br)C(Br)=C1 PXQTZCYVTTZYFY-UHFFFAOYSA-N 0.000 description 1
- DXBPDAOUIWQAGE-UHFFFAOYSA-N 1,2-dichloro-4-(1-chlorobutyl)benzene Chemical compound CCCC(Cl)C1=CC=C(Cl)C(Cl)=C1 DXBPDAOUIWQAGE-UHFFFAOYSA-N 0.000 description 1
- RLEJFAVDYJGNCV-UHFFFAOYSA-N 1,2-dichloro-4-(1-chlorononyl)benzene Chemical compound CCCCCCCCC(Cl)C1=CC=C(Cl)C(Cl)=C1 RLEJFAVDYJGNCV-UHFFFAOYSA-N 0.000 description 1
- FMLVOCILLTZUSX-UHFFFAOYSA-N 1,2-diiodo-4-methylbenzene Chemical compound CC1=CC=C(I)C(I)=C1 FMLVOCILLTZUSX-UHFFFAOYSA-N 0.000 description 1
- ZFLRKAMKGYNFPH-UHFFFAOYSA-N 1,3-dichloro-5-(chloromethyl)benzene Chemical compound ClCC1=CC(Cl)=CC(Cl)=C1 ZFLRKAMKGYNFPH-UHFFFAOYSA-N 0.000 description 1
- RNXABUQTPSAAJW-UHFFFAOYSA-N 1-(1-bromoethyl)-4-(trifluoromethoxy)benzene Chemical compound CC(Br)C1=CC=C(OC(F)(F)F)C=C1 RNXABUQTPSAAJW-UHFFFAOYSA-N 0.000 description 1
- VWPMBVBOSDEYQU-UHFFFAOYSA-N 1-(1-bromoethyl)-4-(trifluoromethyl)benzene Chemical compound CC(Br)C1=CC=C(C(F)(F)F)C=C1 VWPMBVBOSDEYQU-UHFFFAOYSA-N 0.000 description 1
- WNWURTVMKCYRSM-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)heptan-1-one Chemical compound CCCCCCC(=O)C1=CC=C(Cl)C(Cl)=C1 WNWURTVMKCYRSM-UHFFFAOYSA-N 0.000 description 1
- CNELHOHMJKBWBR-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)hexan-1-ol Chemical compound CCCCCC(O)C1=CC=C(Cl)C(Cl)=C1 CNELHOHMJKBWBR-UHFFFAOYSA-N 0.000 description 1
- BJXYZJPNMFXWLM-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)nonan-1-ol Chemical compound CCCCCCCCC(O)C1=CC=C(Cl)C(Cl)=C1 BJXYZJPNMFXWLM-UHFFFAOYSA-N 0.000 description 1
- PJYGECCAJOYJMK-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)propan-1-ol Chemical compound CCC(O)C1=CC=C(Cl)C(Cl)=C1 PJYGECCAJOYJMK-UHFFFAOYSA-N 0.000 description 1
- BUZYGTVTZYSBCU-UHFFFAOYSA-N 1-(4-chlorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C=C1 BUZYGTVTZYSBCU-UHFFFAOYSA-N 0.000 description 1
- JZJWCDQGIPQBAO-UHFFFAOYSA-N 1-(4-iodophenyl)ethanone Chemical compound CC(=O)C1=CC=C(I)C=C1 JZJWCDQGIPQBAO-UHFFFAOYSA-N 0.000 description 1
- BACZSVQZBSCWIG-UHFFFAOYSA-N 1-(bromomethyl)-3-iodobenzene Chemical compound BrCC1=CC=CC(I)=C1 BACZSVQZBSCWIG-UHFFFAOYSA-N 0.000 description 1
- BQTRMYJYYNQQGK-UHFFFAOYSA-N 1-(bromomethyl)-4-iodobenzene Chemical compound BrCC1=CC=C(I)C=C1 BQTRMYJYYNQQGK-UHFFFAOYSA-N 0.000 description 1
- XGASTRVQNVVYIZ-UHFFFAOYSA-N 1-(chloromethyl)-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CCl)=C1 XGASTRVQNVVYIZ-UHFFFAOYSA-N 0.000 description 1
- XBDXMDVEZLOGMC-UHFFFAOYSA-N 1-(chloromethyl)-3-fluorobenzene Chemical compound FC1=CC=CC(CCl)=C1 XBDXMDVEZLOGMC-UHFFFAOYSA-N 0.000 description 1
- LZBOHNCMCCSTJX-UHFFFAOYSA-N 1-(chloromethyl)-3-methylbenzene Chemical compound CC1=CC=CC(CCl)=C1 LZBOHNCMCCSTJX-UHFFFAOYSA-N 0.000 description 1
- MCHDHQVROPEJJT-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CCl)C=C1 MCHDHQVROPEJJT-UHFFFAOYSA-N 0.000 description 1
- DUBCVXSYZVTCOC-UHFFFAOYSA-N 1-(chloromethyl)-4-ethylbenzene Chemical compound CCC1=CC=C(CCl)C=C1 DUBCVXSYZVTCOC-UHFFFAOYSA-N 0.000 description 1
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 1
- DMHZDOTYAVHSEH-UHFFFAOYSA-N 1-(chloromethyl)-4-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1 DMHZDOTYAVHSEH-UHFFFAOYSA-N 0.000 description 1
- CYAKWEQUWJAHLW-UHFFFAOYSA-N 1-(chloromethyl)-4-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(CCl)C=C1 CYAKWEQUWJAHLW-UHFFFAOYSA-N 0.000 description 1
- FZTQXHGGBGVTGO-UHFFFAOYSA-N 1-[(3,4-dibromophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(Br)C(Br)=C1 FZTQXHGGBGVTGO-UHFFFAOYSA-N 0.000 description 1
- OAEZHYFDCHQVEG-UHFFFAOYSA-N 1-[(3,4-dimethylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(C)C(C)=CC=C1CN1C(C#N)=C(C#N)N=C1 OAEZHYFDCHQVEG-UHFFFAOYSA-N 0.000 description 1
- LFNWHYXBFKUGOQ-UHFFFAOYSA-N 1-[(3,4-dimethylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(C)C(C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 LFNWHYXBFKUGOQ-UHFFFAOYSA-N 0.000 description 1
- VMAWTAARMCGBOW-UHFFFAOYSA-N 1-[(3-bromo-4-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Br)C(C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 VMAWTAARMCGBOW-UHFFFAOYSA-N 0.000 description 1
- NKKZAXBEEMWFTP-UHFFFAOYSA-N 1-[(3-chloro-4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(OC)=CC=C1CN1C(C#N)=C(C#N)N=C1 NKKZAXBEEMWFTP-UHFFFAOYSA-N 0.000 description 1
- IGOXWALFLCBKOO-UHFFFAOYSA-N 1-[(3-chloro-4-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Cl)C(C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 IGOXWALFLCBKOO-UHFFFAOYSA-N 0.000 description 1
- STBBEWFYPQAJFP-UHFFFAOYSA-N 1-[(3-chlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound ClC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 STBBEWFYPQAJFP-UHFFFAOYSA-N 0.000 description 1
- TVKRDBQEICMHMX-UHFFFAOYSA-N 1-[(3-fluorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound FC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 TVKRDBQEICMHMX-UHFFFAOYSA-N 0.000 description 1
- MTXKJAQTJWQAAH-UHFFFAOYSA-N 1-[(3-iodophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound IC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 MTXKJAQTJWQAAH-UHFFFAOYSA-N 0.000 description 1
- ZWYQKKKJTIPGMO-UHFFFAOYSA-N 1-[(4-bromophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(Br)=CC=C1CN1C(C#N)=C(C#N)N=C1 ZWYQKKKJTIPGMO-UHFFFAOYSA-N 0.000 description 1
- NFJGFKYUTHTGAJ-UHFFFAOYSA-N 1-[(4-chloro-3-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Cl)C(C)=CC(CN2C(=C(C(O)=O)N=C2)C(O)=O)=C1 NFJGFKYUTHTGAJ-UHFFFAOYSA-N 0.000 description 1
- KLTKNOWTXOBRKU-UHFFFAOYSA-N 1-[(4-ethylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(CC)=CC=C1CN1C(C#N)=C(C#N)N=C1 KLTKNOWTXOBRKU-UHFFFAOYSA-N 0.000 description 1
- WFOMPSUTFQXJIY-UHFFFAOYSA-N 1-[(4-ethylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=CC(CC)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 WFOMPSUTFQXJIY-UHFFFAOYSA-N 0.000 description 1
- VYGDTDSGKLVAKK-UHFFFAOYSA-N 1-[(4-iodophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(I)=CC=C1CN1C(C#N)=C(C#N)N=C1 VYGDTDSGKLVAKK-UHFFFAOYSA-N 0.000 description 1
- AYPWALVHPDEFFW-UHFFFAOYSA-N 1-[(4-propan-2-ylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(C(C)C)=CC=C1CN1C(C#N)=C(C#N)N=C1 AYPWALVHPDEFFW-UHFFFAOYSA-N 0.000 description 1
- VNLDYWMXBMNPQQ-UHFFFAOYSA-N 1-[1-(3,4-dibromophenyl)ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=C(Br)C(Br)=C1 VNLDYWMXBMNPQQ-UHFFFAOYSA-N 0.000 description 1
- ZXHWLEHAXIWKHW-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)butyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(CCC)C1=CC=C(Cl)C(Cl)=C1 ZXHWLEHAXIWKHW-UHFFFAOYSA-N 0.000 description 1
- UPEYWGJBRLRKGU-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=C(Cl)C(Cl)=C1 UPEYWGJBRLRKGU-UHFFFAOYSA-N 0.000 description 1
- FROZNGWBPQFKEK-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=C(Cl)C(Cl)=C1 FROZNGWBPQFKEK-UHFFFAOYSA-N 0.000 description 1
- HOYAZPXGFHBNNX-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)propyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(CC)C1=CC=C(Cl)C(Cl)=C1 HOYAZPXGFHBNNX-UHFFFAOYSA-N 0.000 description 1
- OHEAWXLIEYOAMS-UHFFFAOYSA-N 1-[1-(3-chlorophenyl)ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=CC(Cl)=C1 OHEAWXLIEYOAMS-UHFFFAOYSA-N 0.000 description 1
- WUZOAAGVQISERA-UHFFFAOYSA-N 1-[1-[3-(trifluoromethyl)phenyl]ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=CC(C(F)(F)F)=C1 WUZOAAGVQISERA-UHFFFAOYSA-N 0.000 description 1
- QWXPMUHNVUUDOE-UHFFFAOYSA-N 1-[1-[4-(trifluoromethyl)phenyl]ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=C(C(F)(F)F)C=C1 QWXPMUHNVUUDOE-UHFFFAOYSA-N 0.000 description 1
- YMXIDIAEXNLCFT-UHFFFAOYSA-N 1-[4-(trifluoromethyl)phenyl]ethanol Chemical compound CC(O)C1=CC=C(C(F)(F)F)C=C1 YMXIDIAEXNLCFT-UHFFFAOYSA-N 0.000 description 1
- ZDTBFCFVANNUPR-UHFFFAOYSA-N 1-[[4-(trifluoromethoxy)phenyl]methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(OC(F)(F)F)C=C1 ZDTBFCFVANNUPR-UHFFFAOYSA-N 0.000 description 1
- NDVMXJKODFZPSW-UHFFFAOYSA-N 1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(C(F)(F)F)C=C1 NDVMXJKODFZPSW-UHFFFAOYSA-N 0.000 description 1
- KKKDZZRICRFGSD-UHFFFAOYSA-N 1-benzylimidazole Chemical class C1=CN=CN1CC1=CC=CC=C1 KKKDZZRICRFGSD-UHFFFAOYSA-N 0.000 description 1
- UDKGXKYEWBGQCG-UHFFFAOYSA-N 1-bromo-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Br)=C1 UDKGXKYEWBGQCG-UHFFFAOYSA-N 0.000 description 1
- BSIIGUGKOPPTPZ-UHFFFAOYSA-N 1-bromo-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Br)C=C1 BSIIGUGKOPPTPZ-UHFFFAOYSA-N 0.000 description 1
- DDGRAFHHXYIQQR-UHFFFAOYSA-N 1-chloro-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Cl)=C1 DDGRAFHHXYIQQR-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 1
- YTOPFCCWCSOHFV-UHFFFAOYSA-N 2,6-dimethyl-4-tridecylmorpholine Chemical compound CCCCCCCCCCCCCN1CC(C)OC(C)C1 YTOPFCCWCSOHFV-UHFFFAOYSA-N 0.000 description 1
- MZHCENGPTKEIGP-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- JAXSPAXDDROBLQ-UHFFFAOYSA-N 2-chloro-4-(chloromethyl)-1-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1Cl JAXSPAXDDROBLQ-UHFFFAOYSA-N 0.000 description 1
- JTMYLQKKQFLIGV-UHFFFAOYSA-N 2-chloro-4-(chloromethyl)-1-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1Cl JTMYLQKKQFLIGV-UHFFFAOYSA-N 0.000 description 1
- IRCMYGHHKLLGHV-UHFFFAOYSA-N 2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl methanesulfonate Chemical compound C1=C(OS(C)(=O)=O)C=C2C(C)(C)C(OCC)OC2=C1 IRCMYGHHKLLGHV-UHFFFAOYSA-N 0.000 description 1
- XRZPMHVRPUGCAY-UHFFFAOYSA-N 3,4-dichloro-1-phenylpentan-1-one Chemical compound CC(Cl)C(Cl)CC(=O)C1=CC=CC=C1 XRZPMHVRPUGCAY-UHFFFAOYSA-N 0.000 description 1
- DXBQEHHOGRVYFF-UHFFFAOYSA-N 3-pyridin-4-ylpentane-2,4-dione Chemical group CC(=O)C(C(C)=O)C1=CC=NC=C1 DXBQEHHOGRVYFF-UHFFFAOYSA-N 0.000 description 1
- WJHUTGKETRBTLJ-UHFFFAOYSA-N 4-(1-bromohexyl)-1,2-dichlorobenzene Chemical compound CCCCCC(Br)C1=CC=C(Cl)C(Cl)=C1 WJHUTGKETRBTLJ-UHFFFAOYSA-N 0.000 description 1
- UBQRAAXAHIKWRI-UHFFFAOYSA-N 4-(chloromethyl)-1,2-dimethylbenzene Chemical compound CC1=CC=C(CCl)C=C1C UBQRAAXAHIKWRI-UHFFFAOYSA-N 0.000 description 1
- XQNVDQZWOBPLQZ-UHFFFAOYSA-N 4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1 XQNVDQZWOBPLQZ-UHFFFAOYSA-N 0.000 description 1
- RATSANVPHHXDCT-UHFFFAOYSA-N 4-(trifluoromethoxy)benzoic acid Chemical compound OC(=O)C1=CC=C(OC(F)(F)F)C=C1 RATSANVPHHXDCT-UHFFFAOYSA-N 0.000 description 1
- OPHVSASGPNDWOP-UHFFFAOYSA-N 4-amino-2-(dimethylamino)-4-oxobutanoic acid Chemical compound CN(C)C(C(O)=O)CC(N)=O OPHVSASGPNDWOP-UHFFFAOYSA-N 0.000 description 1
- 240000007241 Agrostis stolonifera Species 0.000 description 1
- XKJMBINCVNINCA-UHFFFAOYSA-N Alfalone Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- 244000186140 Asperula odorata Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 239000005489 Bromoxynil Substances 0.000 description 1
- 241000195940 Bryophyta Species 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 239000005490 Carbetamide Substances 0.000 description 1
- 241001049165 Caria Species 0.000 description 1
- 239000005493 Chloridazon (aka pyrazone) Substances 0.000 description 1
- 239000005647 Chlorpropham Substances 0.000 description 1
- 235000005918 Cirsium arvense Nutrition 0.000 description 1
- 240000001579 Cirsium arvense Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- DFCAFRGABIXSDS-UHFFFAOYSA-N Cycloate Chemical compound CCSC(=O)N(CC)C1CCCCC1 DFCAFRGABIXSDS-UHFFFAOYSA-N 0.000 description 1
- 241000234646 Cyperaceae Species 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-N Dalapon Chemical compound CC(Cl)(Cl)C(O)=O NDUPDOJHUQKPAG-UHFFFAOYSA-N 0.000 description 1
- 239000005503 Desmedipham Substances 0.000 description 1
- SPANOECCGNXGNR-UITAMQMPSA-N Diallat Chemical compound CC(C)N(C(C)C)C(=O)SC\C(Cl)=C\Cl SPANOECCGNXGNR-UITAMQMPSA-N 0.000 description 1
- 239000005504 Dicamba Substances 0.000 description 1
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- DHWRNDJOGMTCPB-UHFFFAOYSA-N Dimefuron Chemical compound ClC1=CC(NC(=O)N(C)C)=CC=C1N1C(=O)OC(C(C)(C)C)=N1 DHWRNDJOGMTCPB-UHFFFAOYSA-N 0.000 description 1
- 239000005510 Diuron Substances 0.000 description 1
- 241001057636 Dracaena deremensis Species 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- 241000380130 Ehrharta erecta Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 244000025670 Eleusine indica Species 0.000 description 1
- 241000309579 Erysimum cheiranthoides Species 0.000 description 1
- 239000005512 Ethofumesate Substances 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 235000008526 Galium odoratum Nutrition 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 239000005573 Linuron Substances 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- 239000005575 MCPB Substances 0.000 description 1
- 101150039283 MCPB gene Proteins 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 239000005983 Maleic hydrazide Substances 0.000 description 1
- BGRDGMRNKXEXQD-UHFFFAOYSA-N Maleic hydrazide Chemical compound OC1=CC=C(O)N=N1 BGRDGMRNKXEXQD-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 239000005579 Metamitron Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- RRVIAQKBTUQODI-UHFFFAOYSA-N Methabenzthiazuron Chemical compound C1=CC=C2SC(N(C)C(=O)NC)=NC2=C1 RRVIAQKBTUQODI-UHFFFAOYSA-N 0.000 description 1
- 239000005583 Metribuzin Substances 0.000 description 1
- 235000003990 Monochoria hastata Nutrition 0.000 description 1
- 241000218231 Moraceae Species 0.000 description 1
- 235000008708 Morus alba Nutrition 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 101150101537 Olah gene Proteins 0.000 description 1
- 239000005588 Oxadiazon Substances 0.000 description 1
- CHNUNORXWHYHNE-UHFFFAOYSA-N Oxadiazon Chemical compound C1=C(Cl)C(OC(C)C)=CC(N2C(OC(=N2)C(C)(C)C)=O)=C1Cl CHNUNORXWHYHNE-UHFFFAOYSA-N 0.000 description 1
- SGEJQUSYQTVSIU-UHFFFAOYSA-N Pebulate Chemical compound CCCCN(CC)C(=O)SCCC SGEJQUSYQTVSIU-UHFFFAOYSA-N 0.000 description 1
- 244000037751 Persicaria maculosa Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 239000005594 Phenmedipham Substances 0.000 description 1
- 244000064622 Physalis edulis Species 0.000 description 1
- 244000292693 Poa annua Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 235000006386 Polygonum aviculare Nutrition 0.000 description 1
- 244000292697 Polygonum aviculare Species 0.000 description 1
- 235000004442 Polygonum persicaria Nutrition 0.000 description 1
- 235000001537 Ribes X gardonianum Nutrition 0.000 description 1
- 235000001535 Ribes X utile Nutrition 0.000 description 1
- 235000016954 Ribes hudsonianum Nutrition 0.000 description 1
- 240000001890 Ribes hudsonianum Species 0.000 description 1
- 235000001466 Ribes nigrum Nutrition 0.000 description 1
- 235000016919 Ribes petraeum Nutrition 0.000 description 1
- 244000281247 Ribes rubrum Species 0.000 description 1
- 235000002355 Ribes spicatum Nutrition 0.000 description 1
- 240000007651 Rubus glaucus Species 0.000 description 1
- 235000009422 Rumex obtusifolius Nutrition 0.000 description 1
- 240000007113 Rumex obtusifolius Species 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 239000005625 Tri-allate Substances 0.000 description 1
- MWBPRDONLNQCFV-UHFFFAOYSA-N Tri-allate Chemical compound CC(C)N(C(C)C)C(=O)SCC(Cl)=C(Cl)Cl MWBPRDONLNQCFV-UHFFFAOYSA-N 0.000 description 1
- 235000004869 Tussilago farfara Nutrition 0.000 description 1
- 240000000377 Tussilago farfara Species 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 241001166549 Veronica hederifolia Species 0.000 description 1
- 241000990144 Veronica persica Species 0.000 description 1
- 241000282485 Vulpes vulpes Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- AMRQXHFXNZFDCH-SECBINFHSA-N [(2r)-1-(ethylamino)-1-oxopropan-2-yl] n-phenylcarbamate Chemical compound CCNC(=O)[C@@H](C)OC(=O)NC1=CC=CC=C1 AMRQXHFXNZFDCH-SECBINFHSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- DXNQLZJOTVNBOZ-UHFFFAOYSA-N [O]C(=O)Nc1ccccc1 Chemical group [O]C(=O)Nc1ccccc1 DXNQLZJOTVNBOZ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- VGPYEHKOIGNJKV-UHFFFAOYSA-N asulam Chemical compound COC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VGPYEHKOIGNJKV-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 239000003738 black carbon Substances 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- JXCGFZXSOMJFOA-UHFFFAOYSA-N chlorotoluron Chemical compound CN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 JXCGFZXSOMJFOA-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- WZJZMXBKUWKXTQ-UHFFFAOYSA-N desmedipham Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=CC=CC=2)=C1 WZJZMXBKUWKXTQ-UHFFFAOYSA-N 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- NQKKUSLBNWTXQI-UHFFFAOYSA-N diethyl 1h-imidazole-4,5-dicarboxylate Chemical compound CCOC(=O)C=1N=CNC=1C(=O)OCC NQKKUSLBNWTXQI-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000006627 ethoxycarbonylamino group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229940107029 ferrous sulfate,dried Drugs 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000012812 general test Methods 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- UCVODTZQZHMTPN-UHFFFAOYSA-N heptanoyl chloride Chemical compound CCCCCCC(Cl)=O UCVODTZQZHMTPN-UHFFFAOYSA-N 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 1
- RBNIGDFIUWJJEV-UHFFFAOYSA-N methyl 2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N(C(C)C(=O)OC)C(=O)C1=CC=CC=C1 RBNIGDFIUWJJEV-UHFFFAOYSA-N 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- NTQYXUJLILNTFH-UHFFFAOYSA-N nonanoyl chloride Chemical compound CCCCCCCCC(Cl)=O NTQYXUJLILNTFH-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- IDOWTHOLJBTAFI-UHFFFAOYSA-N phenmedipham Chemical compound COC(=O)NC1=CC=CC(OC(=O)NC=2C=C(C)C=CC=2)=C1 IDOWTHOLJBTAFI-UHFFFAOYSA-N 0.000 description 1
- IZTYAOFWKLCNPQ-UHFFFAOYSA-N phenyl n-(3-methylphenyl)carbamate Chemical compound CC1=CC=CC(NC(=O)OC=2C=CC=CC=2)=C1 IZTYAOFWKLCNPQ-UHFFFAOYSA-N 0.000 description 1
- XVNKRRXASPPECQ-UHFFFAOYSA-N phenyl n-phenylcarbamate Chemical compound C=1C=CC=CC=1OC(=O)NC1=CC=CC=C1 XVNKRRXASPPECQ-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- IKVXBIIHQGXQRQ-UHFFFAOYSA-N propan-2-yl 2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N(C(C)C(=O)OC(C)C)C(=O)C1=CC=CC=C1 IKVXBIIHQGXQRQ-UHFFFAOYSA-N 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 235000021013 raspberries Nutrition 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- VPAYJEUHKVESSD-UHFFFAOYSA-N trifluoroiodomethane Chemical compound FC(F)(F)I VPAYJEUHKVESSD-UHFFFAOYSA-N 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 150000005199 trimethylbenzenes Chemical class 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/50—1,3-Diazoles; Hydrogenated 1,3-diazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/147—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/807—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen all halogen atoms bound to the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Wood Science & Technology (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Plant Pathology (AREA)
- Zoology (AREA)
- Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agronomy & Crop Science (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9277/77A GB1599032A (en) | 1977-03-04 | 1977-03-04 | Imidazole derivatives having herbicidal activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH630615A5 true CH630615A5 (fr) | 1982-06-30 |
Family
ID=9868874
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH234478A CH630615A5 (fr) | 1977-03-04 | 1978-03-03 | Derives d'imidazole a proprietes herbicides. |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4185992A (OSRAM) |
| JP (1) | JPS53111068A (OSRAM) |
| AR (1) | AR223314A1 (OSRAM) |
| AU (1) | AU513393B2 (OSRAM) |
| BE (1) | BE864614A (OSRAM) |
| BR (1) | BR7801257A (OSRAM) |
| CA (1) | CA1092131A (OSRAM) |
| CH (1) | CH630615A5 (OSRAM) |
| CS (1) | CS207657B2 (OSRAM) |
| DD (1) | DD135346A5 (OSRAM) |
| DE (1) | DE2809022A1 (OSRAM) |
| DK (1) | DK95478A (OSRAM) |
| ES (2) | ES467496A1 (OSRAM) |
| GB (1) | GB1599032A (OSRAM) |
| IE (1) | IE46502B1 (OSRAM) |
| IT (1) | IT1095472B (OSRAM) |
| LU (1) | LU79162A1 (OSRAM) |
| NL (1) | NL7802316A (OSRAM) |
| NZ (1) | NZ186608A (OSRAM) |
| PH (1) | PH14020A (OSRAM) |
| PL (3) | PL115964B1 (OSRAM) |
| PT (1) | PT67731A (OSRAM) |
| SE (1) | SE7802394L (OSRAM) |
| SU (2) | SU805946A3 (OSRAM) |
| ZA (1) | ZA781229B (OSRAM) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT377514B (de) * | 1978-08-08 | 1985-03-25 | Wellcome Found | Verfahren zur herstellung von neuen imidazolderivaten und deren salzen |
| IT1207229B (it) * | 1978-08-25 | 1989-05-17 | May & Baker Ltd | Derivati immidazolici particolarmente utili quali erbicidi |
| DK45381A (da) * | 1980-02-05 | 1981-08-06 | May & Baker Ltd | Herbicide midler omfattende 1-(3,4-dichlorbenzyl)-imidazol-n,n!-dimethyl-4,5-dicarboxamid |
| DE3217094A1 (de) * | 1982-05-07 | 1983-11-10 | Hoechst Ag, 6230 Frankfurt | 1-substituierte imidazol-5-carbonsaeurederivate, ihre herstellung sowie ihre verwendung als biozide |
| US4851424A (en) * | 1986-06-06 | 1989-07-25 | Ciba-Geigy Corporation | 1-Phenyl-lower alkyl-imidazole 4- or 5-carboxamide compounds which are useful in the treatment of epilepsy |
| DE3723621A1 (de) * | 1987-07-17 | 1989-02-02 | Bayer Ag | Schaedlingsbekaempfungsmittel auf basis von derivaten des 2,3-diaminomaleinsaeurenitrils |
| DE19814092A1 (de) * | 1997-04-15 | 1998-10-22 | Stefes Agro Gmbh | Pflanzenschutzmittel |
| WO2002064538A1 (en) * | 2001-02-16 | 2002-08-22 | Ube Industries, Ltd. | Process for producing 4-trifluoromethoxybenzyl halide compound |
| DE102009043862A1 (de) * | 2009-08-26 | 2011-08-04 | Karlsruher Institut für Technologie, 76131 | Acylierte Phthalocyanine |
| CA2860810A1 (en) | 2012-04-25 | 2013-10-31 | F. Hoffmann-La Roche Ag | (3,4-dichloro-phenyl)-((s)-3-propyl-pyrrolidin-3-yl)-methanone hydrochloride and manufacturing processes |
| NO2944633T3 (OSRAM) * | 2012-11-14 | 2018-06-30 | ||
| CN104326939B (zh) * | 2014-09-30 | 2016-06-22 | 广东工业大学 | 一种二氨基马来腈衍生物及其制备方法和应用 |
| WO2023235376A1 (en) | 2022-06-01 | 2023-12-07 | Zoetis Services Llc | Process for preparing 1-(4-chlorobenzyl)-1h-imidazole-4,5-dicarboxamide |
| CN119707818A (zh) * | 2024-12-11 | 2025-03-28 | 河北农业大学 | 一类新型甲基吡唑丙酰胺衍生物及其制备方法和用途 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2897205A (en) * | 1958-06-27 | 1959-07-28 | Merck & Co Inc | 1-etherified oxyalkyl imidazole-4,5-dicarboxamides, intermediates and process |
| US3914246A (en) * | 1972-05-05 | 1975-10-21 | Merck & Co Inc | Tri-substituted imidazoles |
| JPS5320990B2 (OSRAM) * | 1973-02-26 | 1978-06-29 |
-
1977
- 1977-03-04 GB GB9277/77A patent/GB1599032A/en not_active Expired
-
1978
- 1978-03-01 IT IT7820800A patent/IT1095472B/it active
- 1978-03-02 PL PL1978211646A patent/PL115964B1/pl unknown
- 1978-03-02 JP JP2403778A patent/JPS53111068A/ja active Granted
- 1978-03-02 CA CA298,042A patent/CA1092131A/en not_active Expired
- 1978-03-02 PL PL1978211647A patent/PL115974B1/pl unknown
- 1978-03-02 DD DD78203943A patent/DD135346A5/xx unknown
- 1978-03-02 BR BR7801257A patent/BR7801257A/pt unknown
- 1978-03-02 PL PL1978205025A patent/PL116646B1/pl unknown
- 1978-03-02 ES ES467496A patent/ES467496A1/es not_active Expired
- 1978-03-02 AR AR271292A patent/AR223314A1/es active
- 1978-03-02 SE SE7802394A patent/SE7802394L/xx unknown
- 1978-03-02 DE DE19782809022 patent/DE2809022A1/de not_active Withdrawn
- 1978-03-02 PT PT67731A patent/PT67731A/pt unknown
- 1978-03-02 NZ NZ186608A patent/NZ186608A/xx unknown
- 1978-03-02 IE IE431/78A patent/IE46502B1/en unknown
- 1978-03-02 CS CS781338A patent/CS207657B2/cs unknown
- 1978-03-02 AU AU33747/78A patent/AU513393B2/en not_active Expired
- 1978-03-02 NL NL7802316A patent/NL7802316A/xx not_active Application Discontinuation
- 1978-03-02 DK DK95478A patent/DK95478A/da not_active Application Discontinuation
- 1978-03-02 ZA ZA00781229A patent/ZA781229B/xx unknown
- 1978-03-02 US US05/882,857 patent/US4185992A/en not_active Expired - Lifetime
- 1978-03-03 PH PH20844A patent/PH14020A/en unknown
- 1978-03-03 CH CH234478A patent/CH630615A5/fr not_active IP Right Cessation
- 1978-03-03 LU LU79162A patent/LU79162A1/xx unknown
- 1978-03-06 BE BE185709A patent/BE864614A/xx not_active IP Right Cessation
- 1978-10-12 SU SU782672299A patent/SU805946A3/ru active
- 1978-12-01 ES ES475635A patent/ES475635A1/es not_active Expired
-
1980
- 1980-01-04 SU SU802864114A patent/SU908249A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| NZ186608A (en) | 1980-05-08 |
| CA1092131A (en) | 1980-12-23 |
| PL115974B1 (en) | 1981-05-30 |
| PL211647A1 (pl) | 1979-10-22 |
| CS207657B2 (en) | 1981-08-31 |
| PL205025A1 (pl) | 1979-04-09 |
| SU908249A3 (ru) | 1982-02-23 |
| PT67731A (en) | 1978-04-01 |
| SU805946A3 (ru) | 1981-02-15 |
| BE864614A (fr) | 1978-09-06 |
| AU3374778A (en) | 1979-09-06 |
| PH14020A (en) | 1980-12-08 |
| IT7820800A0 (it) | 1978-03-01 |
| GB1599032A (en) | 1981-09-30 |
| PL116646B1 (en) | 1981-06-30 |
| LU79162A1 (fr) | 1979-10-29 |
| US4185992A (en) | 1980-01-29 |
| PL115964B1 (en) | 1981-05-30 |
| AU513393B2 (en) | 1980-11-27 |
| ES467496A1 (es) | 1979-08-01 |
| IE46502B1 (en) | 1983-06-29 |
| NL7802316A (nl) | 1978-09-06 |
| ZA781229B (en) | 1979-02-28 |
| DD135346A5 (de) | 1979-05-02 |
| JPS53111068A (en) | 1978-09-28 |
| AR223314A1 (es) | 1981-08-14 |
| DK95478A (da) | 1978-09-05 |
| SE7802394L (sv) | 1978-09-05 |
| IE780431L (en) | 1978-09-04 |
| ES475635A1 (es) | 1979-04-16 |
| IT1095472B (it) | 1985-08-10 |
| JPS6129344B2 (OSRAM) | 1986-07-05 |
| BR7801257A (pt) | 1979-01-02 |
| DE2809022A1 (de) | 1978-09-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4452628A (en) | Herbicidal sulfonamides | |
| DE69027823T2 (de) | Isoxazolderivate als Herbizide | |
| RU2055072C1 (ru) | Производные 4-бензилизоксазола, гербицидная композиция и способ подавления роста сорняков | |
| EP0120814B1 (de) | N-Phenylsulfonyl-N'-pyrimidinyl- und -triazinylharnstoffe | |
| US5438033A (en) | Substituted pyridine herbicides | |
| DD215461A5 (de) | Herbizides und den pflanzenwuchs hemmendes mittel | |
| CH655310A5 (fr) | Derives acylamino du n-phenylpyrazole, compositions les contenant et leur utilisation comme herbicides. | |
| EP0085028A2 (de) | N-Phenylsulfonyl-N'-pyrimidinyl- und -triazinylharnstoffe | |
| DE69118070T2 (de) | Benzofuranyl- und Benzothiophenyl-substituierte Uracilderivate, ihre Herstellung und ihre Verwendung als Herbizide | |
| CH630615A5 (fr) | Derives d'imidazole a proprietes herbicides. | |
| DE69011040T2 (de) | Pyrimidinderivate, ihre Produktion und Verwendung. | |
| US4552585A (en) | Herbicidal 2-(aminophenyl)methyl derivatives of 3-isoxazolidinones or 3-oxazinones | |
| KR0160307B1 (ko) | 이미노티아졸린, 그의 제조방법 및 제초제로서의 용도, 및 그의 제조용 중간체 | |
| CH660006A5 (fr) | Derives du n-phenylpyrazole. | |
| EP0125205A1 (de) | N-Phenylsulfonyl-N'-pyrimidinyl- und -triazinylharnstoffe | |
| DE3788737T2 (de) | Indazol-Verbindungen, Verfahren zu deren Herstellung, deren Anwendung und Zwischenprodukte. | |
| RU2056413C1 (ru) | Иминотиазолины, способы их получения, гербицидная композиция, способ уничтожения нежелательных сорняков | |
| DE68910423T2 (de) | 5-Substituierte-2,4-Diphenylpyrimidin-Derivate, deren Herstellung und herbizide Verwendung. | |
| CH657360A5 (fr) | Derives du n-phenylpyrazole utilises dans des compositions herbicides et procede pour leur preparation. | |
| DE3750029T2 (de) | Cinnolin-Derivate, Verfahren zu deren Herstellung und diese enthaltende herbizide Zusammenstellung. | |
| GB1596224A (en) | Substituted benzene-1,3-diurethanes and their use as herbicides and fungicides | |
| EP0260228A2 (de) | N-Phenyl-maleinimide und N-Phenyl-succinimide mit herbizider und pflanzenwuchsregulierender Wirkung | |
| DE2845996A1 (de) | Herbizide mittel, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von unkraeutern | |
| US5698495A (en) | Herbicidal substituted pyrazole compounds | |
| US5147445A (en) | Herbicidal triazole compounds and herbicidal compositions containing the same |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |