CH630369A5 - Verfahren zur herstellung von neuen pyrazincarboxamiden. - Google Patents
Verfahren zur herstellung von neuen pyrazincarboxamiden. Download PDFInfo
- Publication number
- CH630369A5 CH630369A5 CH1566076A CH1566076A CH630369A5 CH 630369 A5 CH630369 A5 CH 630369A5 CH 1566076 A CH1566076 A CH 1566076A CH 1566076 A CH1566076 A CH 1566076A CH 630369 A5 CH630369 A5 CH 630369A5
- Authority
- CH
- Switzerland
- Prior art keywords
- amino
- chloro
- pyrazinecarboxamide
- diamino
- carbon atoms
- Prior art date
Links
- -1 PYRAZINE CARBOXAMIDES Chemical class 0.000 title claims description 92
- 238000004519 manufacturing process Methods 0.000 title description 4
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 title 1
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Natural products C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 title 1
- 125000004432 carbon atom Chemical group C* 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 39
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 21
- IPEHBUMCGVEMRF-UHFFFAOYSA-N pyrazinecarboxamide Chemical class NC(=O)C1=CN=CC=N1 IPEHBUMCGVEMRF-UHFFFAOYSA-N 0.000 claims description 18
- 239000007795 chemical reaction product Substances 0.000 claims description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims description 15
- XSDQTOBWRPYKKA-UHFFFAOYSA-N amiloride Chemical compound NC(=N)NC(=O)C1=NC(Cl)=C(N)N=C1N XSDQTOBWRPYKKA-UHFFFAOYSA-N 0.000 claims description 14
- 125000000623 heterocyclic group Chemical group 0.000 claims description 13
- 239000012948 isocyanate Substances 0.000 claims description 13
- 150000002513 isocyanates Chemical class 0.000 claims description 13
- WNBSDCKJFDZMHT-UHFFFAOYSA-N n-(diaminomethylidene)pyrazine-2-carboxamide Chemical compound NC(N)=NC(=O)C1=CN=CC=N1 WNBSDCKJFDZMHT-UHFFFAOYSA-N 0.000 claims description 13
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- NMKJMKOMFOZUCX-UHFFFAOYSA-N 3,5-diamino-6-chloro-n-[[2-(propan-2-ylcarbamoyl)hydrazinyl]methylidene]pyrazine-2-carboxamide;hydrate;hydrochloride Chemical compound O.Cl.CC(C)NC(=O)NNC=NC(=O)C1=NC(Cl)=C(N)N=C1N NMKJMKOMFOZUCX-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- FNVBLSOUJCZJFT-UHFFFAOYSA-N isocyanatoethane;isocyanic acid Chemical compound N=C=O.CCN=C=O FNVBLSOUJCZJFT-UHFFFAOYSA-N 0.000 claims 1
- 239000000460 chlorine Substances 0.000 description 74
- 229960005206 pyrazinamide Drugs 0.000 description 35
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 34
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 24
- 229910001868 water Inorganic materials 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- 125000006295 amino methylene group Chemical group [H]N(*)C([H])([H])* 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 239000000155 melt Substances 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 239000002934 diuretic Substances 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 230000029142 excretion Effects 0.000 description 5
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 5
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 4
- BCUDNASLJXDEOF-UHFFFAOYSA-N 3,5-diamino-6-chloro-n-[[2-(1h-imidazole-2-carbonyl)hydrazinyl]methylidene]pyrazine-2-carboxamide Chemical compound N1=C(Cl)C(N)=NC(N)=C1C(=O)N=CNNC(=O)C1=NC=CN1 BCUDNASLJXDEOF-UHFFFAOYSA-N 0.000 description 4
- GFQGFCQPJNOHTH-UHFFFAOYSA-N 3-amino-6-chloro-N-[(ethylcarbamoylhydrazinylidene)methyl]-5-(propan-2-ylamino)pyrazine-2-carboxamide Chemical compound CCNC(=O)NNC=NC(=O)C1=NC(Cl)=C(NC(C)C)N=C1N GFQGFCQPJNOHTH-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 4
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 4
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- WTYJBGQERCCGAD-UHFFFAOYSA-N 1-Methylguanidine sulfate (2:1) Chemical compound CN=C(N)N.CN=C(N)N.OS(O)(=O)=O WTYJBGQERCCGAD-UHFFFAOYSA-N 0.000 description 3
- YQXKDJWEGPPBQG-UHFFFAOYSA-N 3,5-diamino-6-fluoro-n-[[2-(propan-2-ylcarbamoyl)hydrazinyl]methylidene]pyrazine-2-carboxamide Chemical compound CC(C)NC(=O)NNC=NC(=O)C1=NC(F)=C(N)N=C1N YQXKDJWEGPPBQG-UHFFFAOYSA-N 0.000 description 3
- BGTYSUDOPGYISC-UHFFFAOYSA-N 3,5-diamino-n-[(2-carbamoylhydrazinyl)methylidene]-6-chloropyrazine-2-carboxamide Chemical compound NC(=O)NNC=NC(=O)C1=NC(Cl)=C(N)N=C1N BGTYSUDOPGYISC-UHFFFAOYSA-N 0.000 description 3
- CXOPDHSCEWAWCF-UHFFFAOYSA-N 3-amino-6-chloro-5-(cyclopentylamino)-n-(n'-methylcarbamimidoyl)pyrazine-2-carboxamide Chemical compound N1=C(N)C(C(=O)NC(=N)NC)=NC(Cl)=C1NC1CCCC1 CXOPDHSCEWAWCF-UHFFFAOYSA-N 0.000 description 3
- KDLDEMPCWHRIJE-UHFFFAOYSA-N 3-amino-6-chloro-n-(diaminomethylidene)-5-(propan-2-ylamino)pyrazine-2-carboxamide Chemical compound CC(C)NC1=NC(N)=C(C(=O)NC(N)=N)N=C1Cl KDLDEMPCWHRIJE-UHFFFAOYSA-N 0.000 description 3
- UJOKUCGWFOUBBJ-UHFFFAOYSA-N 3-amino-6-chloro-n-(n'-methylcarbamimidoyl)-5-pyrrolidin-1-ylpyrazine-2-carboxamide Chemical compound N1=C(N)C(C(=O)NC(=N)NC)=NC(Cl)=C1N1CCCC1 UJOKUCGWFOUBBJ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 230000001882 diuretic effect Effects 0.000 description 3
- 229940030606 diuretics Drugs 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 3
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 3
- MHOHOJSGPDDHAO-UHFFFAOYSA-N methyl 3,5-diamino-6-fluoropyrazine-2-carboxylate Chemical compound COC(=O)C1=NC(F)=C(N)N=C1N MHOHOJSGPDDHAO-UHFFFAOYSA-N 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 150000004682 monohydrates Chemical class 0.000 description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-Dimethyhydrazine Chemical compound CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- MOSBQESRVBZPFW-UHFFFAOYSA-N 2-[[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylideneamino]carbamoylamino]acetic acid hydrate dihydrochloride Chemical compound O.Cl.Cl.NC1=NC(N)=C(C(=O)N=CNNC(=O)NCC(O)=O)N=C1Cl MOSBQESRVBZPFW-UHFFFAOYSA-N 0.000 description 2
- MGOLNIXAPIAKFM-UHFFFAOYSA-N 2-isocyanato-2-methylpropane Chemical compound CC(C)(C)N=C=O MGOLNIXAPIAKFM-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- XSAWWWZAPBGQEF-UHFFFAOYSA-N 3,5-diamino-6-chloro-n-(4,5-dihydro-1h-imidazol-2-yl)pyrazine-2-carboxamide Chemical compound N1=C(Cl)C(N)=NC(N)=C1C(=O)N=C1NCCN1 XSAWWWZAPBGQEF-UHFFFAOYSA-N 0.000 description 2
- NEZIXHJJWOFFOA-UHFFFAOYSA-N 3,5-diamino-6-chloropyrazine-2-carbohydrazide Chemical compound NNC(=O)C1=NC(Cl)=C(N)N=C1N NEZIXHJJWOFFOA-UHFFFAOYSA-N 0.000 description 2
- STZBDPTXYFZWTG-UHFFFAOYSA-N 3,5-diamino-6-fluoro-N-[(E)-(imidazole-1-carbonylhydrazinylidene)methyl]pyrazine-2-carboxamide Chemical compound N1=C(F)C(N)=NC(N)=C1C(=O)N=CNNC(=O)N1C=NC=C1 STZBDPTXYFZWTG-UHFFFAOYSA-N 0.000 description 2
- NEQHYRXOXTYSIC-UHFFFAOYSA-N 3,5-diamino-N-[(E)-(carbamoylhydrazinylidene)methyl]-6-chloropyrazine-2-carboxamide hydrobromide Chemical compound Br.NC(=O)NNC=NC(=O)C1=NC(Cl)=C(N)N=C1N NEQHYRXOXTYSIC-UHFFFAOYSA-N 0.000 description 2
- ZMUHEPFKUZHHBY-UHFFFAOYSA-N 3-amino-6-chloro-5-(cyclopentylamino)-n-[(e)-(ethylcarbamoylamino)methyliminomethyl]pyrazine-2-carboxamide Chemical compound N1=C(N)C(C(=O)N=CNCNC(=O)NCC)=NC(Cl)=C1NC1CCCC1 ZMUHEPFKUZHHBY-UHFFFAOYSA-N 0.000 description 2
- XWAXLDVRMXMEAG-UHFFFAOYSA-N 3-amino-6-chloro-5-(dimethylamino)-n-(n'-methylcarbamimidoyl)pyrazine-2-carboxamide Chemical compound CNC(=N)NC(=O)C1=NC(Cl)=C(N(C)C)N=C1N XWAXLDVRMXMEAG-UHFFFAOYSA-N 0.000 description 2
- PCUBHQZSMXPQRK-UHFFFAOYSA-N 3-amino-6-chloro-5-(propan-2-ylamino)-N-[(propan-2-ylcarbamoylhydrazinylidene)methyl]pyrazine-2-carboxamide Chemical compound CC(C)NC(=O)NNC=NC(=O)C1=NC(Cl)=C(NC(C)C)N=C1N PCUBHQZSMXPQRK-UHFFFAOYSA-N 0.000 description 2
- RXMUPNVSYKGKMY-UHFFFAOYSA-N 3-amino-6-chloro-n-(diaminomethylidene)-5-(dimethylamino)pyrazine-2-carboxamide Chemical compound CN(C)C1=NC(N)=C(C(=O)N=C(N)N)N=C1Cl RXMUPNVSYKGKMY-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- YHPMRHPLAQSPHJ-UHFFFAOYSA-N 3-chloropyrazine-2-carboxamide Chemical compound NC(=O)C1=NC=CN=C1Cl YHPMRHPLAQSPHJ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical class ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000000638 benzylaminocarbonyl group Chemical group C(C1=CC=CC=C1)NC(=O)* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 150000003857 carboxamides Chemical class 0.000 description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
- VCSZKSHWUBFOOE-UHFFFAOYSA-N dioxidanium;sulfate Chemical compound O.O.OS(O)(=O)=O VCSZKSHWUBFOOE-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 229960004198 guanidine Drugs 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 229910001414 potassium ion Inorganic materials 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000000894 saliuretic effect Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- ADAKRBAJFHTIEW-UHFFFAOYSA-N 1-chloro-4-isocyanatobenzene Chemical compound ClC1=CC=C(N=C=O)C=C1 ADAKRBAJFHTIEW-UHFFFAOYSA-N 0.000 description 1
- DSVGFKBFFICWLZ-UHFFFAOYSA-N 1-fluoro-4-isocyanatobenzene Chemical compound FC1=CC=C(N=C=O)C=C1 DSVGFKBFFICWLZ-UHFFFAOYSA-N 0.000 description 1
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 1
- KIPSRYDSZQRPEA-UHFFFAOYSA-N 2,2,2-trifluoroethanamine Chemical compound NCC(F)(F)F KIPSRYDSZQRPEA-UHFFFAOYSA-N 0.000 description 1
- IHXSQPBLWZQFSZ-UHFFFAOYSA-N 2-butyl-6-iodophenol Chemical compound CCCCC1=CC=CC(I)=C1O IHXSQPBLWZQFSZ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- BHMQVZXIGQOCNL-UHFFFAOYSA-N 3,5-diamino-6-bromo-n-(diaminomethylidene)pyrazine-2-carboxamide Chemical compound NC(N)=NC(=O)C1=NC(Br)=C(N)N=C1N BHMQVZXIGQOCNL-UHFFFAOYSA-N 0.000 description 1
- UTGAENZFWHUXCR-UHFFFAOYSA-N 3,5-diamino-6-chloro-N-[(E)-(imidazole-1-carbonylhydrazinylidene)methyl]pyrazine-2-carboxamide Chemical compound N1=C(Cl)C(N)=NC(N)=C1C(=O)N=CNNC(=O)N1C=NC=C1 UTGAENZFWHUXCR-UHFFFAOYSA-N 0.000 description 1
- QTKPGCYGPHZZJE-UHFFFAOYSA-N 3,5-diamino-6-chloro-n-[[2-(4-methylpiperazine-1-carbonyl)hydrazinyl]methylidene]pyrazine-2-carboxamide Chemical compound C1CN(C)CCN1C(=O)NNC=NC(=O)C1=NC(Cl)=C(N)N=C1N QTKPGCYGPHZZJE-UHFFFAOYSA-N 0.000 description 1
- HEGRYJFFBOQZIC-UHFFFAOYSA-N 3,5-diamino-6-chloro-n-[[2-(ethylcarbamoyl)hydrazinyl]methylidene]pyrazine-2-carboxamide Chemical compound CCNC(=O)NNC=NC(=O)C1=NC(Cl)=C(N)N=C1N HEGRYJFFBOQZIC-UHFFFAOYSA-N 0.000 description 1
- ZIRPMRWYAQVFTB-UHFFFAOYSA-N 3,5-diamino-6-chloro-n-[n-(ethylcarbamoyl)-n'-methylcarbamimidoyl]pyrazine-2-carboxamide Chemical compound CCNC(=O)NC(=NC)NC(=O)C1=NC(Cl)=C(N)N=C1N ZIRPMRWYAQVFTB-UHFFFAOYSA-N 0.000 description 1
- OCSQJDAUOOHJEI-UHFFFAOYSA-N 3,5-diamino-6-chloropyrazine-2-carboxylic acid Chemical compound NC1=NC(N)=C(C(O)=O)N=C1Cl OCSQJDAUOOHJEI-UHFFFAOYSA-N 0.000 description 1
- JCTCHAXGGYRWOS-UHFFFAOYSA-N 3,5-diamino-6-fluoro-n-[[2-(1h-imidazole-2-carbonyl)hydrazinyl]methylidene]pyrazine-2-carboxamide Chemical compound N1=C(F)C(N)=NC(N)=C1C(=O)N=CNNC(=O)C1=NC=CN1 JCTCHAXGGYRWOS-UHFFFAOYSA-N 0.000 description 1
- CXZYKVWMHCBUCM-UHFFFAOYSA-N 3,5-diamino-n-(diaminomethylidene)-6-fluoropyrazine-2-carboxamide Chemical compound NC(N)=NC(=O)C1=NC(F)=C(N)N=C1N CXZYKVWMHCBUCM-UHFFFAOYSA-N 0.000 description 1
- MMOLCBQUDLFRPK-UHFFFAOYSA-N 3,5-diamino-n-(n-carbamoyl-n'-methylcarbamimidoyl)-6-chloropyrazine-2-carboxamide;hydrate;hydrochloride Chemical compound O.Cl.NC(=O)NC(NC)=NC(=O)C1=NC(Cl)=C(N)N=C1N MMOLCBQUDLFRPK-UHFFFAOYSA-N 0.000 description 1
- PMNKLJHNJWJYOV-UHFFFAOYSA-N 3,5-diamino-n-[[2-(benzylcarbamoyl)hydrazinyl]methylidene]-6-chloropyrazine-2-carboxamide Chemical compound N1=C(Cl)C(N)=NC(N)=C1C(=O)N=CNNC(=O)NCC1=CC=CC=C1 PMNKLJHNJWJYOV-UHFFFAOYSA-N 0.000 description 1
- NMHKTSKIEZNRHE-UHFFFAOYSA-N 3,5-diamino-n-[[2-(tert-butylcarbamoyl)hydrazinyl]methylidene]-6-chloropyrazine-2-carboxamide Chemical compound CC(C)(C)NC(=O)NNC=NC(=O)C1=NC(Cl)=C(N)N=C1N NMHKTSKIEZNRHE-UHFFFAOYSA-N 0.000 description 1
- AVNNZRNWTBZOLI-UHFFFAOYSA-N 3,5-diamino-n-[amino-(cyanoamino)methylidene]-6-chloropyrazine-2-carboxamide Chemical compound N#CNC(N)=NC(=O)C1=NC(Cl)=C(N)N=C1N AVNNZRNWTBZOLI-UHFFFAOYSA-N 0.000 description 1
- LEIBSPJCNYPBAC-UHFFFAOYSA-N 3-amino-6-chloro-N-(N,N-dimethylcarbamimidoyl)-5-(propan-2-ylamino)pyrazine-2-carboxamide Chemical compound NC=1C(=NC(=C(N1)NC(C)C)Cl)C(=O)NC(=N)N(C)C LEIBSPJCNYPBAC-UHFFFAOYSA-N 0.000 description 1
- GRGNDDBMFJMMKH-UHFFFAOYSA-N 3-amino-6-chloro-n-[[2-(imidazole-1-carbonyl)hydrazinyl]methylidene]-5-(propan-2-ylamino)pyrazine-2-carboxamide Chemical compound N1=C(Cl)C(NC(C)C)=NC(N)=C1C(=O)N=CNNC(=O)N1C=NC=C1 GRGNDDBMFJMMKH-UHFFFAOYSA-N 0.000 description 1
- OAINVJZWPCLNFV-UHFFFAOYSA-N 3-amino-6-chloro-n-[n-(ethylcarbamoyl)-n'-methylcarbamimidoyl]-5-(propan-2-ylamino)pyrazine-2-carboxamide Chemical compound CCNC(=O)NC(NC)=NC(=O)C1=NC(Cl)=C(NC(C)C)N=C1N OAINVJZWPCLNFV-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- CNBGRHVRTPTJME-UHFFFAOYSA-N 4,5-dihydro-1h-imidazol-3-ium-2-amine;4-methylbenzenesulfonate Chemical compound NC1=NCCN1.CC1=CC=C(S(O)(=O)=O)C=C1 CNBGRHVRTPTJME-UHFFFAOYSA-N 0.000 description 1
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- CBAMQAQYNXLLAI-UHFFFAOYSA-N 6-chloro-5-(dimethylamino)pyrazine-2-carboxylic acid Chemical compound CN(C)C1=NC=C(C(O)=O)N=C1Cl CBAMQAQYNXLLAI-UHFFFAOYSA-N 0.000 description 1
- YFZBRRWHLXJIMF-UHFFFAOYSA-N 6-chloropyrazine-2-carboxamide hydrochloride Chemical compound Cl.NC(=O)c1cncc(Cl)n1 YFZBRRWHLXJIMF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000010428 Muscle Weakness Diseases 0.000 description 1
- 206010028372 Muscular weakness Diseases 0.000 description 1
- ORXVESBYXRXENP-UHFFFAOYSA-N N-[(tert-butylcarbamoylhydrazinylidene)methyl]pyrazine-2-carboxamide Chemical compound CC(C)(C)NC(=O)NNC=NC(=O)C1=CN=CC=N1 ORXVESBYXRXENP-UHFFFAOYSA-N 0.000 description 1
- VKEXMIHMAKPRAC-UHFFFAOYSA-N N1=C(N)C(C(=O)N/C=N/CNC(=O)NCC)=NC(Cl)=C1N1CCCC1 Chemical compound N1=C(N)C(C(=O)N/C=N/CNC(=O)NCC)=NC(Cl)=C1N1CCCC1 VKEXMIHMAKPRAC-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- KWEKFYKKCAGWAL-WAYWQWQTSA-N [(z)-4-(tert-butylamino)-4-oxobut-2-en-2-yl] 3,5-diamino-6-chloropyrazine-2-carboxylate Chemical compound CC(C)(C)NC(=O)/C=C(/C)OC(=O)C1=NC(Cl)=C(N)N=C1N KWEKFYKKCAGWAL-WAYWQWQTSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- BZKPWHYZMXOIDC-UHFFFAOYSA-N acetazolamide Chemical compound CC(=O)NC1=NN=C(S(N)(=O)=O)S1 BZKPWHYZMXOIDC-UHFFFAOYSA-N 0.000 description 1
- 229960000571 acetazolamide Drugs 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- JIVPVXMEBJLZRO-UHFFFAOYSA-N chlorthalidone Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C2(O)C3=CC=CC=C3C(=O)N2)=C1 JIVPVXMEBJLZRO-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- NFAZOGXQOWEWBM-UHFFFAOYSA-N cyclobutanamine;hydrochloride Chemical compound Cl.NC1CCC1 NFAZOGXQOWEWBM-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- HXSNGAHNYZBZTH-UHFFFAOYSA-N cyclopropylmethanamine;hydrochloride Chemical compound Cl.NCC1CC1 HXSNGAHNYZBZTH-UHFFFAOYSA-N 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- 229960004979 fampridine Drugs 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000002425 furfuryl group Chemical group C(C1=CC=CO1)* 0.000 description 1
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229960000789 guanidine hydrochloride Drugs 0.000 description 1
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- ANJPRQPHZGHVQB-UHFFFAOYSA-N hexyl isocyanate Chemical compound CCCCCCN=C=O ANJPRQPHZGHVQB-UHFFFAOYSA-N 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 1
- IKXNIQJDNKPPCH-UHFFFAOYSA-N hydron;prop-2-yn-1-amine;chloride Chemical compound [Cl-].[NH3+]CC#C IKXNIQJDNKPPCH-UHFFFAOYSA-N 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- LMGVITOFKPGSPZ-UHFFFAOYSA-N methyl 3,5-diaminopyrazine-2-carboxylate Chemical compound COC(=O)C1=NC=C(N)N=C1N LMGVITOFKPGSPZ-UHFFFAOYSA-N 0.000 description 1
- XWFBDHHUSDNXNJ-UHFFFAOYSA-N methyl 3-amino-6-chloro-5-pyrrolidin-1-ylpyrazine-2-carboxylate Chemical compound N1=C(N)C(C(=O)OC)=NC(Cl)=C1N1CCCC1 XWFBDHHUSDNXNJ-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 230000001452 natriuretic effect Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- LMHHRCOWPQNFTF-UHFFFAOYSA-N s-propan-2-yl azepane-1-carbothioate Chemical compound CC(C)SC(=O)N1CCCCCC1 LMHHRCOWPQNFTF-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- SAQCINKAOMBKPW-UHFFFAOYSA-N tert-butyl 2-[[(Z)-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylideneamino]carbamoylamino]acetate Chemical compound CC(C)(C)OC(=O)CNC(=O)NNC=NC(=O)C1=NC(Cl)=C(N)N=C1N SAQCINKAOMBKPW-UHFFFAOYSA-N 0.000 description 1
- SJMDMGHPMLKLHQ-UHFFFAOYSA-N tert-butyl 2-aminoacetate Chemical compound CC(C)(C)OC(=O)CN SJMDMGHPMLKLHQ-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D241/26—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with nitrogen atoms directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/10—Antioedematous agents; Diuretics
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Hematology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64080375A | 1975-12-15 | 1975-12-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH630369A5 true CH630369A5 (de) | 1982-06-15 |
Family
ID=24569755
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1566076A CH630369A5 (de) | 1975-12-15 | 1976-12-13 | Verfahren zur herstellung von neuen pyrazincarboxamiden. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4085211A (enExample) |
| JP (1) | JPS52106877A (enExample) |
| AU (1) | AU511429B2 (enExample) |
| BE (1) | BE849379A (enExample) |
| CH (1) | CH630369A5 (enExample) |
| DE (1) | DE2656374A1 (enExample) |
| DK (1) | DK531476A (enExample) |
| ES (2) | ES454160A1 (enExample) |
| FR (1) | FR2335226A1 (enExample) |
| GB (1) | GB1527297A (enExample) |
| HU (1) | HU175504B (enExample) |
| NL (1) | NL7613276A (enExample) |
| SE (1) | SE431452B (enExample) |
| ZA (1) | ZA767431B (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4208413A (en) * | 1977-03-04 | 1980-06-17 | Merck & Co., Inc. | N-Pyrazinecarbonyl-N'-alkoxycarbonyl and N',N"-bis(alkoxycarbonyl)guanidines and processes for preparing same |
| US4163781A (en) * | 1978-04-17 | 1979-08-07 | Merck & Co., Inc. | 3-Amino-N-[(phosphonoamino)iminomethyl]-6-halopyrazinecarboxamide compounds, compositions and methods of use |
| EP0009054A1 (en) * | 1978-09-19 | 1980-04-02 | Merck & Co. Inc. | N-Pyrazinecarbonyl-N'-substituted-sulfamoyl-guanidine and processes for preparing same |
| US4272537A (en) * | 1980-07-02 | 1981-06-09 | Merck & Co., Inc. | 3-Amino-5-substituted-6-halo-N-(4,4-disubstituted-6-substituted-1,3,5-triazin-2-yl)-2-pyrazinecarboxamides |
| US4277602A (en) * | 1980-07-02 | 1981-07-07 | Merck & Co., Inc. | 3-Amino-5-substituted-6-halo-N-(3,4-dihydro-6-substituted-1,3,5-truazin-2-yl)2-pyrazinecarboxamides |
| IE52345B1 (en) * | 1981-02-02 | 1987-09-16 | Ici Plc | Alkanolamine derivatives |
| US4594349A (en) * | 1982-01-04 | 1986-06-10 | Beyer Jr Karl H | Hyperuretic agents |
| JPS62291361A (ja) * | 1986-06-09 | 1987-12-18 | 株式会社ブリヂストン | 床支持装置 |
| JPS6342741U (enExample) * | 1986-09-04 | 1988-03-22 | ||
| GB8810934D0 (en) * | 1987-05-26 | 1988-06-15 | Ici America Inc | Amides |
| GB8810933D0 (en) * | 1987-05-26 | 1988-06-15 | Ici America Inc | Heterocyclic compounds |
| GB8812343D0 (en) * | 1988-05-25 | 1988-06-29 | Ici America Inc | Amino compounds |
| GB8812342D0 (en) * | 1988-05-25 | 1988-06-29 | Ici America Inc | Bicyclic compounds |
| JPH02101937U (enExample) * | 1989-01-31 | 1990-08-14 | ||
| AUPP646498A0 (en) * | 1998-10-12 | 1998-11-05 | Australian National University, The | A method of modulating ion channel functional activity |
| US6858615B2 (en) * | 2002-02-19 | 2005-02-22 | Parion Sciences, Inc. | Phenyl guanidine sodium channel blockers |
| US6858614B2 (en) * | 2002-02-19 | 2005-02-22 | Parion Sciences, Inc. | Phenolic guanidine sodium channel blockers |
| US6903105B2 (en) * | 2003-02-19 | 2005-06-07 | Parion Sciences, Inc. | Sodium channel blockers |
| US20050090505A1 (en) * | 2003-08-18 | 2005-04-28 | Johnson Michael R. | Methods of reducing risk of infection from pathogens |
| US7745442B2 (en) | 2003-08-20 | 2010-06-29 | Parion Sciences, Inc. | Methods of reducing risk of infection from pathogens |
| US20090253714A1 (en) * | 2003-08-20 | 2009-10-08 | Johnson Michael R | Methods of reducing risk of infection from pathogens |
| WO2006023617A2 (en) * | 2004-08-18 | 2006-03-02 | Johnson Michael R | Cyclic amide & ester pyrazinoylguanidine sodium channel blockers |
| US20070021439A1 (en) * | 2005-07-25 | 2007-01-25 | Parion Sciences, Inc. | Methods of reducing risk of infection from pathogens with soluble amide and ester pyrazinoylguanidine sodium channel blockers |
| GB0526244D0 (en) * | 2005-12-22 | 2006-02-01 | Novartis Ag | Organic compounds |
| CL2008003651A1 (es) * | 2007-12-10 | 2009-06-19 | Novartis Ag | Compuestos derivados de 3,5-diamino-6-cloropirazinamida sustituida; composicion farmaceutica; combinacion farmaceutica; y uso en el tratamiento de una condición inflamatoria o alergica, en particular una enfermedad inflamatoria u obstructiva de las vias respiratorias. |
| DE102008053024B4 (de) | 2008-10-24 | 2015-04-30 | RUHR-UNIVERSITäT BOCHUM | Verwendung von Amilorid-Derivaten zur Bekämpfung von Insekten und Milben |
| AR086745A1 (es) | 2011-06-27 | 2014-01-22 | Parion Sciences Inc | 3,5-diamino-6-cloro-n-(n-(4-(4-(2-(hexil(2,3,4,5,6-pentahidroxihexil)amino)etoxi)fenil)butil)carbamimidoil)pirazina-2-carboxamida |
| RU2018138195A (ru) | 2012-12-17 | 2018-12-18 | Пэрион Сайенсиз, Инк. | Соединения 3,5-диамино-6-хлор-n-(n-(4- фенилбутил)карбамимидоил)пиразин-2-карбоксамида |
| SG10201708931XA (en) | 2012-12-17 | 2017-12-28 | Parion Sciences Inc | Chloro-pyrazine carboxamide derivatives useful for the treatment of diseases favoured by insufficient mucosal hydration |
| US9102633B2 (en) | 2013-12-13 | 2015-08-11 | Parion Sciences, Inc. | Arylalkyl- and aryloxyalkyl-substituted epithelial sodium channel blocking compounds |
| KR102367765B1 (ko) * | 2014-09-18 | 2022-02-24 | 닛산 가가쿠 가부시키가이샤 | 액정 배향제, 액정 배향막, 및 액정 표시 소자 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE639393A (enExample) * | 1962-10-30 | |||
| BE639386A (enExample) * | 1962-10-30 |
-
1976
- 1976-09-13 US US05/722,442 patent/US4085211A/en not_active Expired - Lifetime
- 1976-11-25 DK DK531476A patent/DK531476A/da not_active Application Discontinuation
- 1976-11-26 SE SE7613289A patent/SE431452B/xx not_active IP Right Cessation
- 1976-11-29 NL NL7613276A patent/NL7613276A/xx not_active Application Discontinuation
- 1976-12-02 AU AU20181/76A patent/AU511429B2/en not_active Expired
- 1976-12-10 ES ES454160A patent/ES454160A1/es not_active Expired
- 1976-12-13 FR FR7637459A patent/FR2335226A1/fr active Granted
- 1976-12-13 HU HU76ME2034A patent/HU175504B/hu unknown
- 1976-12-13 GB GB51940/76A patent/GB1527297A/en not_active Expired
- 1976-12-13 DE DE19762656374 patent/DE2656374A1/de active Granted
- 1976-12-13 CH CH1566076A patent/CH630369A5/de not_active IP Right Cessation
- 1976-12-14 ZA ZA00767431A patent/ZA767431B/xx unknown
- 1976-12-14 BE BE173235A patent/BE849379A/xx not_active IP Right Cessation
- 1976-12-15 JP JP14988976A patent/JPS52106877A/ja active Granted
-
1978
- 1978-01-03 ES ES465742A patent/ES465742A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU2018176A (en) | 1978-06-08 |
| JPS6238350B2 (enExample) | 1987-08-17 |
| DK531476A (da) | 1977-06-16 |
| DE2656374A1 (de) | 1977-06-16 |
| ES465742A1 (es) | 1978-10-01 |
| BE849379A (fr) | 1977-06-14 |
| SE7613289L (sv) | 1977-06-16 |
| NL7613276A (nl) | 1977-06-17 |
| US4085211A (en) | 1978-04-18 |
| ES454160A1 (es) | 1978-03-01 |
| FR2335226A1 (fr) | 1977-07-15 |
| SE431452B (sv) | 1984-02-06 |
| FR2335226B1 (enExample) | 1979-03-09 |
| GB1527297A (en) | 1978-10-04 |
| AU511429B2 (en) | 1980-08-21 |
| DE2656374C2 (enExample) | 1989-08-10 |
| ZA767431B (en) | 1978-07-26 |
| HU175504B (hu) | 1980-08-28 |
| JPS52106877A (en) | 1977-09-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH630369A5 (de) | Verfahren zur herstellung von neuen pyrazincarboxamiden. | |
| DE3781845T2 (de) | Benzimidazol-derivate. | |
| DE2936705A1 (de) | Neue 4-anilinochinazolinderivate, verfahren zu deren herstellung und diese enthaltende arzneimittel | |
| DE2322880C2 (de) | 4-(Imidazolin-2-ylamino)-2,1,3-benzothiadiazole und Verfahren zu deren Herstellung | |
| DE2205815A1 (de) | Piperazinderivate und verfahren zu ihrer herstellung | |
| DE2433625A1 (de) | Harnstoff-derivate, verfahren zu ihrer herstellung und arzneimittel | |
| CH623581A5 (enExample) | ||
| DE2012138C3 (de) | N{4-(ß-Pyrazin- 2-carboxyamido-äthyl)benzolsulphonyl] -N' - cycloalkylharnstoffe und diese enthaltende pharmazeutische Präparate | |
| DE2847792C2 (enExample) | ||
| DE2849537A1 (de) | Substituierte 5-(2-imidazolin-2-yl)- aminopyrimidine und verfahren zu deren herstellung | |
| DE2504794A1 (de) | Alpha, omega-diamino- oder -dithioalkylenverbindungen | |
| DE69728180T2 (de) | Verfahren zur herstellung von carbamoylsubstituierten imidazolderivaten | |
| DE3524635A1 (de) | Isoindolinyl-alkyl-piperazinverbindungen, verfahren zu ihrer herstellung und pharmazeutische mittel | |
| DE2233458A1 (de) | Neue chinolinderivate | |
| DE1956891A1 (de) | Chemische Verfahren und Produkte | |
| DE2138331A1 (de) | Thioacetamidverbindungen, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DD209828A5 (de) | Verfahren zur herstellung von 2-guanidino-4-(2-subst.-amino-4-imidazolyl)thiazolen | |
| DE1445675B2 (de) | Pyridylharnstoffe und verfahren zu ihrer herstellung | |
| EP0072954B1 (de) | Isoindolin-2-yl-amino-imidazoline und Isoindolin-2-yl-guanidine, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| DE1445505B2 (de) | Im phenylkern substituierte 2-phenylamino-1,3-diazacyclopentene-(2) | |
| DE2139072B2 (de) | N-(4-Sulfamoylphenyl)-pyrrolidin-2-one, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen | |
| DE69719210T2 (de) | Verfahren zur herstellung von 2-amino-2-imidazolinen, guanidinen, und 2-amino-3,4,5,6-tetrahydropyrimidinen | |
| DE2733951A1 (de) | Alpha, omega-diaminoalkylenverbindungen | |
| DE2243789A1 (de) | 1-aminoisochinolinderivate, ihre salze mit saeuren und quartaeren ammoniumsalze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2619110A1 (de) | Organische verbindungen, ihre verwendung und herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |