CH622541A5 - - Google Patents
Download PDFInfo
- Publication number
- CH622541A5 CH622541A5 CH890476A CH890476A CH622541A5 CH 622541 A5 CH622541 A5 CH 622541A5 CH 890476 A CH890476 A CH 890476A CH 890476 A CH890476 A CH 890476A CH 622541 A5 CH622541 A5 CH 622541A5
- Authority
- CH
- Switzerland
- Prior art keywords
- cha
- formula
- hydrogen
- group
- chlorine
- Prior art date
Links
- 239000000460 chlorine Substances 0.000 description 34
- 239000001257 hydrogen Substances 0.000 description 32
- 229910052739 hydrogen Inorganic materials 0.000 description 32
- -1 phenylaminocarbonyl Chemical group 0.000 description 30
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 23
- 229910052801 chlorine Inorganic materials 0.000 description 23
- 150000002431 hydrogen Chemical class 0.000 description 20
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 19
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 19
- 229910052794 bromium Inorganic materials 0.000 description 19
- 239000000975 dye Substances 0.000 description 17
- 125000004093 cyano group Chemical group *C#N 0.000 description 15
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 13
- 125000001424 substituent group Chemical group 0.000 description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- 238000000034 method Methods 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 229920000728 polyester Polymers 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 125000004958 1,4-naphthylene group Chemical group 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 6
- 238000004043 dyeing Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 150000001989 diazonium salts Chemical class 0.000 description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- NJYFRQQXXXRJHK-UHFFFAOYSA-N (4-aminophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1 NJYFRQQXXXRJHK-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 239000000986 disperse dye Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 241000251730 Chondrichthyes Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000004036 acetal group Chemical group 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000006261 methyl amino sulfonyl group Chemical group [H]N(C([H])([H])[H])S(*)(=O)=O 0.000 description 2
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- CMEPUAROFJSGJN-UHFFFAOYSA-N 1,4-dioxan-2-ylmethanol Chemical compound OCC1COCCO1 CMEPUAROFJSGJN-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- KWMDHCLJYMVBNS-UHFFFAOYSA-N 2-bromo-4,6-dinitroaniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1[N+]([O-])=O KWMDHCLJYMVBNS-UHFFFAOYSA-N 0.000 description 1
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229910004385 CaHg Inorganic materials 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 206010039587 Scarlet Fever Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 125000006263 dimethyl aminosulfonyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- HTHKZOCCOVYKKI-UHFFFAOYSA-N dinaphthalen-1-ylmethanedisulfonic acid;sodium Chemical compound [Na].C1=CC=C2C(C(C=3C4=CC=CC=C4C=CC=3)(S(=O)(=O)O)S(O)(=O)=O)=CC=CC2=C1 HTHKZOCCOVYKKI-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940080236 sodium cetyl sulfate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- GGHPAKFFUZUEKL-UHFFFAOYSA-M sodium;hexadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GGHPAKFFUZUEKL-UHFFFAOYSA-M 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B43/00—Preparation of azo dyes from other azo compounds
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B31/00—Disazo and polyazo dyes of the type A->B->C, A->B->C->D, or the like, prepared by diazotising and coupling
- C09B31/02—Disazo dyes
- C09B31/04—Disazo dyes from a coupling component "C" containing a directive amino group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH890476A CH622541A5 (enEXAMPLES) | 1976-07-12 | 1976-07-12 | |
| DE19772729914 DE2729914A1 (de) | 1976-07-12 | 1977-07-02 | Azo-dispersionsfarbstoffe, ihre herstellung und verwendung |
| US05/813,485 US4439362A (en) | 1976-07-12 | 1977-07-07 | Azo compounds having one or two 1,4-dioxanylmethoxycarbonyl-alkyl or -alkoxyalkyl groups |
| GB28519/77A GB1580536A (en) | 1976-07-12 | 1977-07-07 | Azo compounds containing a dioxane ring |
| JP8207977A JPS538626A (en) | 1976-07-12 | 1977-07-11 | Azo compounds |
| FR7721426A FR2358447A1 (fr) | 1976-07-12 | 1977-07-12 | Nouveaux composes azoiques utilisables comme colorants de dispersion et leur preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH890476A CH622541A5 (enEXAMPLES) | 1976-07-12 | 1976-07-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH622541A5 true CH622541A5 (enEXAMPLES) | 1981-04-15 |
Family
ID=4346091
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH890476A CH622541A5 (enEXAMPLES) | 1976-07-12 | 1976-07-12 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4439362A (enEXAMPLES) |
| JP (1) | JPS538626A (enEXAMPLES) |
| CH (1) | CH622541A5 (enEXAMPLES) |
| DE (1) | DE2729914A1 (enEXAMPLES) |
| FR (1) | FR2358447A1 (enEXAMPLES) |
| GB (1) | GB1580536A (enEXAMPLES) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH644369A5 (de) | 1979-05-03 | 1984-07-31 | Sandoz Ag | 2-amino-4-chlorthiazolverbindungen. |
| CH647253A5 (de) * | 1980-03-13 | 1985-01-15 | Sandoz Ag | Azoverbindungen mit einer diazokomponente der thiazolreihe. |
| JPS5838754A (ja) * | 1981-09-01 | 1983-03-07 | Gosei Senriyou Gijutsu Kenkyu Kumiai | ポリエステル繊維用アゾ染料 |
| JPS58129061A (ja) * | 1982-01-27 | 1983-08-01 | Sumitomo Chem Co Ltd | モノアゾ化合物の製造法 |
| JPS58179268A (ja) * | 1982-04-15 | 1983-10-20 | Gosei Senriyou Gijutsu Kenkyu Kumiai | ポリエステル繊維用モノアゾ染料 |
| CH664762A5 (de) * | 1984-08-30 | 1988-03-31 | Sandoz Ag | Thiophen-azofarbstoffe. |
| DE19500228A1 (de) * | 1994-01-17 | 1995-07-20 | Sandoz Ag | Dispersionsfarbstoffe |
| US5723586A (en) * | 1995-06-19 | 1998-03-03 | Clariant Finance (Bvi) Limited | Disperse dyes |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2139787A (en) * | 1936-01-16 | 1938-12-13 | Gen Aniline Works Inc | Coloring cellulose esters |
| US2183999A (en) * | 1938-10-05 | 1939-12-19 | Eastman Kodak Co | Azo compounds and process for coloring therewith |
| US2227977A (en) * | 1939-08-25 | 1941-01-07 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2373700A (en) * | 1940-06-29 | 1945-04-17 | Eastman Kodak Co | Azo compounds and material colored therewith |
| CH515970A (de) * | 1969-06-19 | 1971-11-30 | Ciba Geigy Ag | Verfahren zur Herstellung von Azofarbstoffen |
| CH523948A (de) * | 1970-04-10 | 1972-06-15 | Sandoz Ag | Verfahren zur Herstellung von Azoverbindungen |
| BE794824A (fr) * | 1972-02-02 | 1973-07-31 | Sandoz Sa | Composes azoiques peu solubles dans l'eau |
| US3970617A (en) * | 1974-03-07 | 1976-07-20 | E. I. Du Pont De Nemours And Company | Navy-blue nitrophenylazonaphthylamino dyes |
-
1976
- 1976-07-12 CH CH890476A patent/CH622541A5/de not_active IP Right Cessation
-
1977
- 1977-07-02 DE DE19772729914 patent/DE2729914A1/de not_active Withdrawn
- 1977-07-07 GB GB28519/77A patent/GB1580536A/en not_active Expired
- 1977-07-07 US US05/813,485 patent/US4439362A/en not_active Expired - Lifetime
- 1977-07-11 JP JP8207977A patent/JPS538626A/ja active Pending
- 1977-07-12 FR FR7721426A patent/FR2358447A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB1580536A (en) | 1980-12-03 |
| US4439362A (en) | 1984-03-27 |
| DE2729914A1 (de) | 1978-01-19 |
| JPS538626A (en) | 1978-01-26 |
| FR2358447B1 (enEXAMPLES) | 1983-01-21 |
| FR2358447A1 (fr) | 1978-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1295115B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| CH622541A5 (enEXAMPLES) | ||
| CH638549A5 (de) | Azoverbindungen. | |
| CH689353A5 (de) | Dispersionsfarbstoffe. | |
| DE2120877B2 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| CH632291A5 (de) | Organische azoverbindungen. | |
| DE2433260B2 (de) | In wasser schwer loesliche monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung zum faerben oder bedrucken | |
| DE2539653A1 (de) | Organische verbindungen | |
| CH676469A5 (enEXAMPLES) | ||
| DE2434207A1 (de) | In wasser schwer loesliche monoazoverbindungen, ihre herstellung und verwendung | |
| DE2035002C3 (de) | Monoazo-Dispersionsf arbstoffe, Verfahren zu deren Herstellung und ihre Verwendung | |
| CH660746A5 (de) | Monoazo-dispersionsfarbstoffe. | |
| DE4121754B4 (de) | Azo-Dispersionsfarbstoffe | |
| DE2304356C3 (de) | Azo-Dispersionsfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2015350C3 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken | |
| CH629520A5 (de) | Verfahren zur herstellung von azofarbstoffen. | |
| CH653354A5 (de) | Rhodanphenyl-azofarbstoffe und ihre herstellung. | |
| DE1770829C3 (de) | Azo-Dispersionsfarbstoffe, ihre Herstellung und Verwendung | |
| DE1644380C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE1943032C (de) | Verfahren zur Herstellung von Azoverbindungen und deren Verwendung | |
| DE1769214C3 (de) | Verfahren zum Färben, Klotzen und Bedrucken von Celluloseacetat-, Polyamid-, Polyurethan- sowie Polyesterfasern und -fasermaterialien | |
| DE2539634C2 (de) | Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1644094C3 (de) | Wasserunlösliche Azofarbstoffe | |
| DE3011178A1 (de) | Wasserunloesliche monoazofarbstoffe, ihre herstellung und ihre verwendung | |
| DE2637884A1 (de) | Organische verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |