CH620869A5 - - Google Patents
Download PDFInfo
- Publication number
- CH620869A5 CH620869A5 CH1429477A CH1429477A CH620869A5 CH 620869 A5 CH620869 A5 CH 620869A5 CH 1429477 A CH1429477 A CH 1429477A CH 1429477 A CH1429477 A CH 1429477A CH 620869 A5 CH620869 A5 CH 620869A5
- Authority
- CH
- Switzerland
- Prior art keywords
- brake
- rim
- brake according
- guide housing
- rim brake
- Prior art date
Links
- 239000000969 carrier Substances 0.000 claims description 12
- 230000006835 compression Effects 0.000 claims description 6
- 238000007906 compression Methods 0.000 claims description 6
- DOSMHBDKKKMIEF-UHFFFAOYSA-N 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[3-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propylsulfamoyl]benzenesulfonate Chemical compound C1=CC(=[N+](CC)CC)C=C2OC3=CC(N(CC)CC)=CC=C3C(C=3C(=CC(=CC=3)S(=O)(=O)NCCCN3C4=CC=CC=C4C(C=4C(NC(=O)C=4C=4C5=CC=CC=C5N(C)C=4)=O)=C3)S([O-])(=O)=O)=C21 DOSMHBDKKKMIEF-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 2
- 230000004308 accommodation Effects 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000009420 retrofitting Methods 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B62—LAND VEHICLES FOR TRAVELLING OTHERWISE THAN ON RAILS
- B62L—BRAKES SPECIALLY ADAPTED FOR CYCLES
- B62L1/00—Brakes; Arrangements thereof
- B62L1/02—Brakes; Arrangements thereof in which cycle wheels are engaged by brake elements
- B62L1/06—Brakes; Arrangements thereof in which cycle wheels are engaged by brake elements the wheel rim being engaged
- B62L1/10—Brakes; Arrangements thereof in which cycle wheels are engaged by brake elements the wheel rim being engaged by the elements moving substantially parallel to the wheel axis
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Braking Arrangements (AREA)
- Transmission Of Braking Force In Braking Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762655699 DE2655699A1 (de) | 1976-12-09 | 1976-12-09 | Zweiradfelgenbremse |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH620869A5 true CH620869A5 (ja�@�@) | 1980-12-31 |
Family
ID=5995020
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1429477A CH620869A5 (ja�@�@) | 1976-12-09 | 1977-11-22 | |
| CH1493877A CH625172A5 (ja�@�@) | 1976-12-09 | 1977-12-06 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1493877A CH625172A5 (ja�@�@) | 1976-12-09 | 1977-12-06 |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US4163481A (ja�@�@) |
| JP (3) | JPS5373745A (ja�@�@) |
| BE (2) | BE861332A (ja�@�@) |
| CH (2) | CH620869A5 (ja�@�@) |
| DE (1) | DE2655699A1 (ja�@�@) |
| FR (2) | FR2373437A1 (ja�@�@) |
| GB (2) | GB1588030A (ja�@�@) |
| IT (2) | IT1089722B (ja�@�@) |
| NL (2) | NL7712574A (ja�@�@) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0080630B1 (de) * | 1981-11-25 | 1985-09-11 | Weinmann GmbH & Co. KG Fahrrad- und Motorrad-Teilefabrik | Zweirad-Felgenbremse |
| JPS5926093U (ja) * | 1982-08-11 | 1984-02-17 | 株式会社シマノ | カンテイレバ−ブレ−キ |
| DE3310152A1 (de) * | 1983-03-21 | 1984-10-04 | GIRO Radsport GmbH i. Gr., 5276 Wiehl | Felgenbremse fuer fahrraeder, insbesondere rennraeder |
| DE3317770A1 (de) * | 1983-05-16 | 1984-11-22 | Weinmann Gmbh & Co Kg Fahrrad- Und Motorrad-Teilefabrik, 7700 Singen | Zweirad-felgenbremse |
| DE3320532A1 (de) * | 1983-06-07 | 1984-12-13 | Weinmann Gmbh & Co Kg Fahrrad- Und Motorrad-Teilefabrik, 7700 Singen | Halterung einer fahrrad-felgenbremse |
| DE3336123A1 (de) * | 1983-10-05 | 1985-05-02 | Gustav Magenwirth Gmbh & Co, 7432 Urach | Hydraulische felgenbremse fuer fahrraeder |
| JPS60218156A (ja) * | 1984-04-13 | 1985-10-31 | Morita:Kk | 経理デ−タ処理装置 |
| US5782323A (en) * | 1995-11-21 | 1998-07-21 | Mills; Rutledge A. | Caliper disc brake having a low thermal conductivity extension element |
| US5775466A (en) * | 1996-10-04 | 1998-07-07 | Banyas; Michael | Bicycle braking system |
| FR2778625B1 (fr) * | 1998-05-14 | 2000-07-21 | Yves Albert Bouillie | Dispositif de freinage notamment pour bicyclette particulierement adapte aux bicyclettes dites tout terrain |
| US5913386A (en) * | 1998-09-10 | 1999-06-22 | Industrial Technology Research Institute | Cushion mechanism for a brake of a bicycle |
| SE521854C2 (sv) * | 2001-01-25 | 2003-12-16 | Haldex Brake Prod Ab | Modulformad skivbroms |
| US6575271B2 (en) * | 2001-03-02 | 2003-06-10 | S.C. Wheel, Llc | Brake mechanism for resilient wheel |
| EP1518786A1 (en) * | 2003-09-25 | 2005-03-30 | Giorgio Soglia | Bicycle brake |
| ITTO20050137U1 (it) * | 2005-09-16 | 2007-03-17 | Fioravanti Srl | Forcella di bicicletta con freno idraulico integrato. |
| CA2596762C (en) | 2006-08-10 | 2014-06-10 | Philip White | Fork with integrated braking system |
| DE102006039432A1 (de) * | 2006-08-23 | 2008-03-13 | Canyon Bicycles Gmbh | Felgenbremse |
| US7614634B2 (en) * | 2007-04-13 | 2009-11-10 | Felt Racing, Llc | Aerodynamic time trial bike |
| US8127896B2 (en) * | 2008-03-17 | 2012-03-06 | Bikebiz Iii, Inc. | Cantilever brake device |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR961677A (ja�@�@) * | 1950-05-17 | |||
| FR336236A (fr) * | 1903-10-24 | 1904-03-02 | Antoine Brossard | Système de frein |
| FR638614A (fr) * | 1926-09-16 | 1928-05-30 | Frein pour bicyclettes et autres cycles | |
| FR682582A (fr) * | 1929-02-04 | 1930-05-30 | Resilion Company Ltd | Perfectionnements aux freins de cycles et à leur mécanisme de commande |
| CH180566A (fr) * | 1934-11-15 | 1935-10-31 | Thomas Marr Louis | Frein mécanique pour bicyclettes et autres véhicules. |
| FR882643A (fr) * | 1941-07-09 | 1943-06-09 | Perfectionnement aux freins de cycles | |
| CH237541A (de) * | 1943-02-05 | 1945-04-30 | Egger Siegfried | Bremseinrichtung für Fahrräder. |
| FR902979A (fr) * | 1943-10-29 | 1945-09-18 | Frein pour cycles et motocycles | |
| FR916858A (fr) * | 1945-06-26 | 1946-12-18 | Perfectionnements aux freins pour cycles | |
| FR914449A (fr) * | 1945-09-13 | 1946-10-08 | Frein pour bicyclette et véhicules similaires | |
| FR1005066A (fr) * | 1947-05-29 | 1952-04-07 | Perfectionnements apportés aux dispositifs du genre des freins, pour cycles et analogues | |
| FR57872E (fr) * | 1947-12-16 | 1953-09-18 | Frein pour bicyclette et véhicules similaires | |
| FR76617E (fr) * | 1959-11-13 | 1961-11-10 | Manuf Arvernoise De Freins Et | Dispositif pour la commande d'un frein du type <cantilever> pour cycles, cyclomoteurs et analogues |
| US3342291A (en) * | 1965-06-28 | 1967-09-19 | Gen Motors Corp | Manually actuated spot-type disc brake and adjusting means |
| US3809187A (en) * | 1972-10-20 | 1974-05-07 | R Grieve | Brake assembly for vehicle wheel |
| FR2265603B1 (ja�@�@) * | 1974-03-29 | 1976-10-08 | Ramond Louis | |
| FR2304508A1 (fr) * | 1975-03-21 | 1976-10-15 | Ramond Louis | Machoire de frein pour cycles et frein en faisant application |
| US4009768A (en) * | 1976-02-19 | 1977-03-01 | Shimano Industrial Company, Limited | Caliper brake for a bicycle |
-
1976
- 1976-12-09 DE DE19762655699 patent/DE2655699A1/de not_active Withdrawn
-
1977
- 1977-11-04 GB GB45988/77A patent/GB1588030A/en not_active Expired
- 1977-11-08 GB GB46343/77A patent/GB1590883A/en not_active Expired
- 1977-11-15 NL NL7712574A patent/NL7712574A/xx not_active Application Discontinuation
- 1977-11-18 NL NL7712739A patent/NL7712739A/xx not_active Application Discontinuation
- 1977-11-22 CH CH1429477A patent/CH620869A5/de not_active IP Right Cessation
- 1977-11-30 US US05/855,991 patent/US4163481A/en not_active Expired - Lifetime
- 1977-11-30 BE BE2056475A patent/BE861332A/xx unknown
- 1977-11-30 BE BE2056476A patent/BE861333A/xx unknown
- 1977-11-30 US US05/856,018 patent/US4136759A/en not_active Expired - Lifetime
- 1977-12-06 IT IT30494/77A patent/IT1089722B/it active
- 1977-12-06 CH CH1493877A patent/CH625172A5/de not_active IP Right Cessation
- 1977-12-06 IT IT30495/77A patent/IT1110351B/it active
- 1977-12-09 FR FR7737258A patent/FR2373437A1/fr not_active Withdrawn
- 1977-12-09 FR FR7737259A patent/FR2373438A1/fr active Granted
- 1977-12-09 JP JP14869877A patent/JPS5373745A/ja active Pending
- 1977-12-09 JP JP14869777A patent/JPS5373744A/ja active Granted
-
1981
- 1981-04-20 JP JP1981057826U patent/JPS573085U/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2373438A1 (fr) | 1978-07-07 |
| JPS5618431B2 (ja�@�@) | 1981-04-28 |
| GB1588030A (en) | 1981-04-15 |
| CH625172A5 (ja�@�@) | 1981-09-15 |
| IT1089722B (it) | 1985-06-18 |
| IT1110351B (it) | 1985-12-23 |
| FR2373437A1 (fr) | 1978-07-07 |
| GB1590883A (en) | 1981-06-10 |
| FR2373438B1 (ja�@�@) | 1983-11-04 |
| BE861332A (fr) | 1978-03-16 |
| DE2655699A1 (de) | 1978-06-15 |
| NL7712739A (nl) | 1978-06-13 |
| US4163481A (en) | 1979-08-07 |
| NL7712574A (nl) | 1978-06-13 |
| US4136759A (en) | 1979-01-30 |
| JPS573085U (ja�@�@) | 1982-01-08 |
| BE861333A (fr) | 1978-03-16 |
| JPS5373744A (en) | 1978-06-30 |
| JPS5373745A (en) | 1978-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH620869A5 (ja�@�@) | ||
| DE2558141C3 (de) | Ratterschutz-Federanordnung an einem Bremsbacken einer Teilbelag-Scheibenbremse | |
| DE60003262T2 (de) | Bremsvorrichtung mit Bremsnachstellungsvorrichtung | |
| DE4020287A1 (de) | Belaghalterung in scheibenbremsen fuer strassenfahrzeuge, insbesondere nutzfahrzeuge | |
| DE3004421A1 (de) | Befestigungsvorrichtung fuer einen bremsschlauch | |
| DE9405849U1 (de) | Feststellbremse für Kraftfahrzeuge, Fahrzeuganhänger o.dgl. | |
| DE1750026C3 (de) | Selbsttätigte Nachstellvorrichtung für Innenbackenbremsen | |
| DE2653846B2 (de) | Fahrrad-Felgenbremse | |
| DE6950432U (de) | Mechanisch betaetigte scheibenbremse. | |
| DE2931071C2 (de) | Kombinierte Niederhalte-Spreizfeder | |
| DE2845688A1 (de) | Schaltvorrichtung fuer fahrraeder | |
| DE102009030414B4 (de) | Bremsbelag für eine Scheibenbremse | |
| DE10253642A1 (de) | Scheibenbremse, insbesondere für ein Nutzfahrzeug | |
| EP0633845A1 (de) | Sitz, insbesondere fahrzeugsitz. | |
| WO2023052323A1 (de) | Scheibenbremse für ein nutzfahrzeug | |
| EP0137431B1 (de) | Klotzbremse für Schienenfahrzeuge | |
| DE102012110461B4 (de) | Bremsbelag für eine Scheibenbremse | |
| DE3131813C1 (de) | Betaetigungs- und Nachstellvorrichtung fuer eine Teilbelag-Scheibenbremse | |
| DE2449853B2 (de) | Scheibenbremse fuer schienenfahrzeuge | |
| DE1475354A1 (de) | Automatische Nachstellvorrichtung fuer Trommel- und Backenbremsen | |
| DE2416187C2 (de) | Selbsttätige Nachstellvorrichtung für eine Innenbacken-Trommelbremse | |
| DE2910118C3 (de) | Mechanische Betätigungsvorrichtung für eine Teilbelag-Scheibenbremse | |
| DE19604403A1 (de) | Spreizschloß für eine Duo-Servo-Topfhandbremse | |
| DE2532103A1 (de) | Teilbelagscheibenbremse | |
| DE29802846U1 (de) | Bremse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |