CH616665A5 - - Google Patents
Download PDFInfo
- Publication number
- CH616665A5 CH616665A5 CH142476A CH142476A CH616665A5 CH 616665 A5 CH616665 A5 CH 616665A5 CH 142476 A CH142476 A CH 142476A CH 142476 A CH142476 A CH 142476A CH 616665 A5 CH616665 A5 CH 616665A5
- Authority
- CH
- Switzerland
- Prior art keywords
- compounds
- iso
- formula
- neo
- scheme
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 description 22
- 125000004432 carbon atom Chemical group C* 0.000 description 14
- 238000000034 method Methods 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- -1 amino-triazine compound Chemical class 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 description 6
- GNWGCMCOLIJPDN-UHFFFAOYSA-N 4-methylsulfanyltriazine Chemical compound CSC1=CC=NN=N1 GNWGCMCOLIJPDN-UHFFFAOYSA-N 0.000 description 5
- 244000025254 Cannabis sativa Species 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 5
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical class N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 description 5
- 241000196324 Embryophyta Species 0.000 description 4
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- BFGQTWYXWNCTSX-UHFFFAOYSA-N triazine-4,5-dione Chemical class O=C1C=NN=NC1=O BFGQTWYXWNCTSX-UHFFFAOYSA-N 0.000 description 4
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 3
- 244000038559 crop plants Species 0.000 description 3
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 150000002357 guanidines Chemical class 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- HHWBTRFHERTBQG-UHFFFAOYSA-N 6-aminotriazine-4,5-dione Chemical class NC1=NN=NC(=O)C1=O HHWBTRFHERTBQG-UHFFFAOYSA-N 0.000 description 2
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- AKZWRTCWNXHHFR-PDIZUQLASA-N [(3S)-oxolan-3-yl] N-[(2S,3S)-4-[(5S)-5-benzyl-3-[(2R)-2-carbamoyloxy-2,3-dihydro-1H-inden-1-yl]-4-oxo-3H-pyrrol-5-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate Chemical compound NC(=O)O[C@@H]1Cc2ccccc2C1C1C=N[C@](C[C@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCOC2)(Cc2ccccc2)C1=O AKZWRTCWNXHHFR-PDIZUQLASA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- DFZLOSJVNQSHSO-UHFFFAOYSA-N n-carbonochloridoylcarbamoyl chloride Chemical compound ClC(=O)NC(Cl)=O DFZLOSJVNQSHSO-UHFFFAOYSA-N 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- XJPGYVQTGHUTFZ-UHFFFAOYSA-N 5-methyl-1h-triazine-6-thione Chemical compound CC1=CN=NNC1=S XJPGYVQTGHUTFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- LZEPOJMTQYNFTR-UHFFFAOYSA-N cyclopropanecarbonyl cyclopropanecarboxylate Chemical compound C1CC1C(=O)OC(=O)C1CC1 LZEPOJMTQYNFTR-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/46—One nitrogen atom with oxygen or sulfur atoms attached to the two other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4885/75A GB1543037A (en) | 1975-02-05 | 1975-02-05 | Selective herbicidal triazine-diones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH616665A5 true CH616665A5 (cs) | 1980-04-15 |
Family
ID=9785684
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH142476A CH616665A5 (cs) | 1975-02-05 | 1976-02-05 |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4105433A (cs) |
| JP (1) | JPS51104032A (cs) |
| AU (1) | AU498498B2 (cs) |
| BE (1) | BE838305A (cs) |
| BR (1) | BR7600699A (cs) |
| CA (1) | CA1047496A (cs) |
| CH (1) | CH616665A5 (cs) |
| CS (1) | CS195720B2 (cs) |
| DD (1) | DD124576A5 (cs) |
| DE (1) | DE2603180A1 (cs) |
| DK (1) | DK144271C (cs) |
| ES (1) | ES444930A1 (cs) |
| FR (1) | FR2299809A1 (cs) |
| GB (1) | GB1543037A (cs) |
| IE (1) | IE42942B1 (cs) |
| IL (1) | IL48900A (cs) |
| IT (1) | IT1055000B (cs) |
| NL (1) | NL7601115A (cs) |
| OA (1) | OA05237A (cs) |
| PH (1) | PH10920A (cs) |
| ZA (1) | ZA76316B (cs) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1599518A (en) * | 1977-02-21 | 1981-10-07 | Ici Ltd | 1,3,5-triazine-2,6-diones and pharmaceutical compositions thereof |
| ATE698T1 (de) * | 1978-05-26 | 1982-03-15 | Imperial Chemical Industries Plc | Analgetische 6-acylaminot etrahydro-1,3,5-triazin-2,4-dion-derivate, sie enthaltende pharmazeutische zusammensetzungen und verfahren zu ihrer herstellung. |
| DE4141721A1 (de) * | 1991-12-18 | 1993-06-24 | Bayer Ag | Substituierte heterocyclyltriazindione |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3218148A (en) * | 1958-11-05 | 1965-11-16 | Geigy Ag J R | Method of eliminating annual weeds |
| BE584305A (cs) * | 1958-11-05 | |||
| US3244712A (en) * | 1960-02-19 | 1966-04-05 | Geigy Ag J R | Acylamino symmetrical triazines |
| ZA732906B (en) | 1972-05-24 | 1974-11-27 | Du Pont | Herbicidal triazines |
| IL42103A (en) * | 1972-05-24 | 1976-05-31 | Du Pont | 6-amino-s-triazine-2,4-(1h,3h)-diones and corresponding 4-thio compounds,their preparation and their use as herbicides |
| DE2254200C2 (de) * | 1972-11-06 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide |
| US3902887A (en) * | 1973-04-05 | 1975-09-02 | Du Pont | Herbicidal 6-amino-s-triazinediones |
| US4035365A (en) * | 1973-11-01 | 1977-07-12 | Imperial Chemical Industries Limited | Triazinediones |
| US4226990A (en) * | 1973-11-01 | 1980-10-07 | Imperial Chemical Industries Limited | Triazine-diones |
-
1975
- 1975-02-05 GB GB4885/75A patent/GB1543037A/en not_active Expired
-
1976
- 1976-01-16 IE IE92/76A patent/IE42942B1/en unknown
- 1976-01-20 US US05/650,754 patent/US4105433A/en not_active Expired - Lifetime
- 1976-01-20 ZA ZA316A patent/ZA76316B/xx unknown
- 1976-01-23 AU AU10541/76A patent/AU498498B2/en not_active Expired
- 1976-01-26 IL IL48900A patent/IL48900A/xx unknown
- 1976-01-26 PH PH18012A patent/PH10920A/en unknown
- 1976-01-27 IT IT19644/76A patent/IT1055000B/it active
- 1976-01-28 DE DE19762603180 patent/DE2603180A1/de not_active Ceased
- 1976-02-04 DD DD191096A patent/DD124576A5/xx unknown
- 1976-02-04 FR FR7603122A patent/FR2299809A1/fr active Granted
- 1976-02-04 BR BR7600699A patent/BR7600699A/pt unknown
- 1976-02-04 NL NL7601115A patent/NL7601115A/xx unknown
- 1976-02-05 OA OA55731A patent/OA05237A/xx unknown
- 1976-02-05 DK DK47776A patent/DK144271C/da not_active IP Right Cessation
- 1976-02-05 CH CH142476A patent/CH616665A5/de not_active IP Right Cessation
- 1976-02-05 BE BE164124A patent/BE838305A/xx not_active IP Right Cessation
- 1976-02-05 CS CS76754A patent/CS195720B2/cs unknown
- 1976-02-05 CA CA245,144A patent/CA1047496A/en not_active Expired
- 1976-02-05 JP JP51010907A patent/JPS51104032A/ja active Pending
- 1976-02-05 ES ES444930A patent/ES444930A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1047496A (en) | 1979-01-30 |
| FR2299809A1 (fr) | 1976-09-03 |
| ES444930A1 (es) | 1977-04-16 |
| OA05237A (fr) | 1981-02-28 |
| BE838305A (fr) | 1976-08-05 |
| DK144271B (da) | 1982-02-01 |
| FR2299809B1 (cs) | 1980-01-11 |
| ZA76316B (en) | 1977-01-26 |
| IE42942B1 (en) | 1980-11-19 |
| CS195720B2 (en) | 1980-02-29 |
| GB1543037A (en) | 1979-03-28 |
| IT1055000B (it) | 1981-11-30 |
| IE42942L (en) | 1976-08-05 |
| IL48900A0 (en) | 1976-04-30 |
| AU1054176A (en) | 1977-07-28 |
| DD124576A5 (cs) | 1977-03-02 |
| DK144271C (da) | 1982-07-12 |
| DK47776A (da) | 1976-08-06 |
| IL48900A (en) | 1979-03-12 |
| US4105433A (en) | 1978-08-08 |
| NL7601115A (nl) | 1976-08-09 |
| AU498498B2 (en) | 1979-03-15 |
| BR7600699A (pt) | 1976-08-31 |
| DE2603180A1 (de) | 1976-08-19 |
| JPS51104032A (cs) | 1976-09-14 |
| PH10920A (en) | 1977-10-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0070804B1 (de) | Fluoralkoxy-aminopyrimidine und -triazine | |
| DE3151685A1 (de) | Verfahren und komposition zur herstellung von substituierten harnstoffderivaten | |
| DE1817879A1 (de) | 1-(n-aethoxycarbonyl-n'-thioureido)-2(n-methoxycarbonyl-n'-thioureido)benzol, seine herstellung und seine verwendung als fungicid | |
| EP0172515B1 (de) | Alpha-(o-chlorphenyl)-aminomethylen-beta-formylaminopropionitril, Verfahren zu seiner Herstellung sowie Verwendung zur Herstellung von 2-Methyl-4-amino-5-formylaminomethylpyrimidin | |
| DE1118789B (de) | Verfahren zur Herstellung von 1, 3, 5-Triazinderivaten | |
| CH564551A5 (cs) | ||
| CH616665A5 (cs) | ||
| DE3341343A1 (de) | Neue pyrimidin-4-one, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| US4035365A (en) | Triazinediones | |
| DD239792A5 (de) | Verfahren zur herstellung von substituierten und unsubstituierten 2-carbamoyl-nikotin- und 3-chinolincarbocyclischen saeuren | |
| HU188074B (en) | Process for the preparation of cimetidin | |
| DE1217963B (de) | Verfahren zur Herstellung von substituierten Imidazolidinen | |
| DE3411202C2 (de) | Verfahren zur Herstellung von 2-Amino-s-triazinen | |
| EP0139135B1 (de) | 4-Alkylimidazol-Derivate, ihre Herstellung und Verwendung | |
| EP0209779A2 (de) | Verfahren zur Herstellung von 2-Cyanamino-pyrimidin-Derivaten | |
| DE3431932A1 (de) | Verfahren zur herstellung von 1-(2-oxyaminosulfonylphenylsulfonyl)-3- heteroaryl-harnstoffen | |
| CH529766A (de) | Verfahren zur Herstellung von Aryloxy-isoalkyl- 2-imidazolinen | |
| DD262359A5 (de) | Gyanoacetamidderivate mit fungizider wirksamkeit | |
| EP0358018A2 (de) | Verfahren zur Herstellung von Oxyguanidinen | |
| EP0137355B1 (de) | 2,2-Dichloro-3,3-dimethylcyclopropylmethylamin | |
| DE3629441A1 (de) | Neue phenoxycarbonsaeurederivate, ihre herstellung und verwendung | |
| EP0158248A2 (de) | Verfahren zur Herstellung von Biphenylylsulfonylharnstoff- Derivaten, Zwischenprodukte für diese sowie Verfahren für die Herstellung der Zwischenprodukte | |
| EP0148755B1 (de) | 2-Phenoxy-phenylsulfonylisocyanat | |
| EP0087048B1 (de) | Substituierte Oximinoacetanilide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Schädlingsbekämpfungsmittel | |
| DE1812966C (de) | 2-Amino-azacyclotridecene und ihre Verwendung als Fungizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |