CH616149A5 - - Google Patents
Download PDFInfo
- Publication number
- CH616149A5 CH616149A5 CH1643475A CH1643475A CH616149A5 CH 616149 A5 CH616149 A5 CH 616149A5 CH 1643475 A CH1643475 A CH 1643475A CH 1643475 A CH1643475 A CH 1643475A CH 616149 A5 CH616149 A5 CH 616149A5
- Authority
- CH
- Switzerland
- Prior art keywords
- copper
- reaction
- cyanformamide
- dicyan
- weight
- Prior art date
Links
- 238000006243 chemical reaction Methods 0.000 claims description 21
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 17
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical compound N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 239000003054 catalyst Substances 0.000 claims description 13
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 5
- 150000001735 carboxylic acids Chemical class 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 229910001431 copper ion Inorganic materials 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims description 2
- 238000007254 oxidation reaction Methods 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 229910001882 dioxygen Inorganic materials 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 9
- 229910052760 oxygen Inorganic materials 0.000 description 9
- 239000001301 oxygen Substances 0.000 description 9
- 239000010949 copper Substances 0.000 description 8
- 239000007789 gas Substances 0.000 description 8
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical group NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- -1 aliphatic ethers Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- HJMZMZRCABDKKV-UHFFFAOYSA-N carbonocyanidic acid Chemical compound OC(=O)C#N HJMZMZRCABDKKV-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000001879 copper Chemical class 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- YDVJBLJCSLVMSY-UHFFFAOYSA-N carbamoyl cyanide Chemical compound NC(=O)C#N YDVJBLJCSLVMSY-UHFFFAOYSA-N 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical class CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- OMZSGWSJDCOLKM-UHFFFAOYSA-N copper(II) sulfide Chemical compound [S-2].[Cu+2] OMZSGWSJDCOLKM-UHFFFAOYSA-N 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- IJCCOEGCVILSMZ-UHFFFAOYSA-L copper;dichlorate Chemical compound [Cu+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O IJCCOEGCVILSMZ-UHFFFAOYSA-L 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002912 oxalic acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2460779A DE2460779C2 (de) | 1974-12-21 | 1974-12-21 | Verfahren zur Herstellung von Cyanformamid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH616149A5 true CH616149A5 (enExample) | 1980-03-14 |
Family
ID=5934203
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1643475A CH616149A5 (enExample) | 1974-12-21 | 1975-12-18 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4082796A (enExample) |
| JP (1) | JPS51110518A (enExample) |
| AT (1) | AT350041B (enExample) |
| BE (1) | BE836948A (enExample) |
| CA (1) | CA1055524A (enExample) |
| CH (1) | CH616149A5 (enExample) |
| DE (1) | DE2460779C2 (enExample) |
| FR (1) | FR2295018A1 (enExample) |
| GB (1) | GB1517709A (enExample) |
| IT (1) | IT1051848B (enExample) |
| NL (1) | NL7514653A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3564939D1 (en) * | 1984-07-17 | 1988-10-20 | Allied Colloids Ltd | Process for hydrolysing nitriles |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1120443B (de) * | 1956-01-27 | 1961-12-28 | American Cyanamid Co | Verfahren zur Herstellung von Cyanformamid |
| US2804471A (en) * | 1956-01-27 | 1957-08-27 | American Cyanamid Co | Manufacture of cyanoformamide |
| US2804470A (en) * | 1956-01-27 | 1957-08-27 | American Cyanamid Co | Preparation of cyanoformamide |
| DE1197075B (de) * | 1961-09-16 | 1965-07-22 | Roehm & Haas Gmbh | Verfahren zur Herstellung von Cyanformamid |
| US3637843A (en) * | 1967-11-24 | 1972-01-25 | Exxon Research Engineering Co | Synthesis of dicyanoformamides having an aromatic organic moiety |
| US3950416A (en) * | 1967-11-24 | 1976-04-13 | Exxon Research And Engineering Company | Synthesis of dicyanoformamides |
| DE1910463A1 (de) | 1969-03-01 | 1970-09-17 | Roehm & Haas Gmbh | Verfahren zur Herstellung von Carbonsaeureanhydriden |
-
1974
- 1974-12-21 DE DE2460779A patent/DE2460779C2/de not_active Expired
-
1975
- 1975-12-16 NL NL7514653A patent/NL7514653A/xx not_active Application Discontinuation
- 1975-12-18 CH CH1643475A patent/CH616149A5/de not_active IP Right Cessation
- 1975-12-19 US US05/642,398 patent/US4082796A/en not_active Expired - Lifetime
- 1975-12-19 JP JP50150677A patent/JPS51110518A/ja active Pending
- 1975-12-19 AT AT966375A patent/AT350041B/de not_active IP Right Cessation
- 1975-12-19 IT IT30573/75A patent/IT1051848B/it active
- 1975-12-19 GB GB52077/75A patent/GB1517709A/en not_active Expired
- 1975-12-22 BE BE163011A patent/BE836948A/xx unknown
- 1975-12-22 CA CA242,277A patent/CA1055524A/en not_active Expired
- 1975-12-22 FR FR7539268A patent/FR2295018A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ATA966375A (de) | 1978-10-15 |
| NL7514653A (nl) | 1976-06-23 |
| CA1055524A (en) | 1979-05-29 |
| JPS51110518A (enExample) | 1976-09-30 |
| FR2295018B1 (enExample) | 1980-06-27 |
| BE836948A (fr) | 1976-06-22 |
| AT350041B (de) | 1979-05-10 |
| GB1517709A (en) | 1978-07-12 |
| IT1051848B (it) | 1981-05-20 |
| DE2460779A1 (de) | 1976-07-01 |
| FR2295018A1 (fr) | 1976-07-16 |
| US4082796A (en) | 1978-04-04 |
| DE2460779C2 (de) | 1982-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3125662A1 (de) | Verfahren und katalysator zur herstellung von cyclischen iminen | |
| DE2433408C3 (de) | Verfahren zur Herstellung von w -Formylalkensäuren | |
| DE2805760A1 (de) | Verfahren zur herstellung von organischen nitrilen | |
| DE2436651A1 (de) | Verfahren zur herstellung von betaaminopropionitril | |
| CH616149A5 (enExample) | ||
| DE2245892B2 (de) | Verfahren zur Herstellung von Citronensäure | |
| EP1199302B1 (de) | Kontinuierliches Verfahren zur Cyanalkylierung von Verbindungen mit einer oder mehreren NH-Funktionen | |
| DE3221239C2 (de) | Verfahren zur Herstellung von Methylformiat | |
| DE2228641A1 (de) | Verfahren und vorrichtung zur kontinuierlichen herstellung von dl-alphahydroxy-ss,ss-dimethyl-gamma-butyrolakton (pantolakton) | |
| EP0036131B1 (de) | Verfahren zur Herstellung von Butyrolactonen | |
| AT352097B (de) | Verfahren zur herstellung von cyanformamid aus cyanwasserstoff und sauerstoff | |
| EP0006140B1 (de) | Verfahren zur Herstellung von alpha-Hydroxycarbonsäureamiden | |
| DE2409195B2 (de) | Verfahren zur herstellung von imidazol-4,5-dicarboxamid | |
| AT232984B (de) | Verfahren zur katalytischen Di- bzw. Trimerisation von 1, 3-Diolefinen | |
| DE3007530C2 (enExample) | ||
| DE1965004C3 (de) | Verfahren zur Herstellung von N-Acyl-aminocyclohexancarbonsäurenitrilen | |
| DE1812371C3 (de) | Verfahren zur Herstellung von Orthoameisensäurealkylestern | |
| DE2402354C2 (de) | Verfahren zur Herstellung von Oxamid | |
| DE1245355B (de) | Verfahren zur Herstellung von Alkalisalzen von Perhalogenaceton-cyanhydrinen | |
| DE2308941C3 (de) | Verfahren zur Herstellung von Oxamid | |
| AT319195B (de) | Verfahren zur Herstellung von Penicillamin | |
| DE2320061C3 (de) | Verfahren zur Herstellung einer acrylnitrilhaltigen, konzentrierten, wäßrigen Acrylamidlösung durch katalytische Wasseranlagerung an Acrylnitril | |
| DE2156601A1 (de) | Verfahren zur herstellung von penicillamin | |
| DE2001903C3 (de) | Verfahren zur Herstellung eines Amids durch Umsetzen des entsprechenden Nitrils mit Wasser | |
| DE1270026B (de) | Verfahren zur Herstellung von Adipinsaeuredinitril durch reduktive Dimerisierung vonAcrylnitril |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |