CH615340A5 - - Google Patents
Download PDFInfo
- Publication number
- CH615340A5 CH615340A5 CH522077A CH522077A CH615340A5 CH 615340 A5 CH615340 A5 CH 615340A5 CH 522077 A CH522077 A CH 522077A CH 522077 A CH522077 A CH 522077A CH 615340 A5 CH615340 A5 CH 615340A5
- Authority
- CH
- Switzerland
- Prior art keywords
- shaft
- dental implant
- implant according
- lacunae
- axis
- Prior art date
Links
- 239000004053 dental implant Substances 0.000 claims description 39
- 241001484259 Lacuna Species 0.000 claims description 8
- 229910000831 Steel Inorganic materials 0.000 claims description 8
- 230000000975 bioactive effect Effects 0.000 claims description 8
- 238000000576 coating method Methods 0.000 claims description 8
- 239000010959 steel Substances 0.000 claims description 8
- 239000011248 coating agent Substances 0.000 claims description 6
- 150000002500 ions Chemical class 0.000 claims description 6
- 239000000463 material Substances 0.000 claims description 6
- 239000000919 ceramic Substances 0.000 claims description 5
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 2
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 2
- 239000000560 biocompatible material Substances 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- 229910001424 calcium ion Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000002241 glass-ceramic Substances 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 229910052710 silicon Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 230000003247 decreasing effect Effects 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 230000008467 tissue growth Effects 0.000 claims 1
- 210000000988 bone and bone Anatomy 0.000 description 24
- 239000007943 implant Substances 0.000 description 16
- 210000003128 head Anatomy 0.000 description 15
- 210000001519 tissue Anatomy 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 8
- 210000000981 epithelium Anatomy 0.000 description 6
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 5
- 238000004873 anchoring Methods 0.000 description 4
- 230000011164 ossification Effects 0.000 description 4
- 102000008186 Collagen Human genes 0.000 description 3
- 108010035532 Collagen Proteins 0.000 description 3
- 230000001055 chewing effect Effects 0.000 description 3
- 229920001436 collagen Polymers 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000011224 oxide ceramic Substances 0.000 description 3
- 229910052574 oxide ceramic Inorganic materials 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 210000004872 soft tissue Anatomy 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- 238000013461 design Methods 0.000 description 2
- 238000005553 drilling Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000002513 implantation Methods 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 241000208125 Nicotiana Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 238000005842 biochemical reaction Methods 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 210000000887 face Anatomy 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010285 flame spraying Methods 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 230000037323 metabolic rate Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 210000000214 mouth Anatomy 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61C—DENTISTRY; APPARATUS OR METHODS FOR ORAL OR DENTAL HYGIENE
- A61C8/00—Means to be fixed to the jaw-bone for consolidating natural teeth or for fixing dental prostheses thereon; Dental implants; Implanting tools
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61C—DENTISTRY; APPARATUS OR METHODS FOR ORAL OR DENTAL HYGIENE
- A61C8/00—Means to be fixed to the jaw-bone for consolidating natural teeth or for fixing dental prostheses thereon; Dental implants; Implanting tools
- A61C8/0018—Means to be fixed to the jaw-bone for consolidating natural teeth or for fixing dental prostheses thereon; Dental implants; Implanting tools characterised by the shape
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61C—DENTISTRY; APPARATUS OR METHODS FOR ORAL OR DENTAL HYGIENE
- A61C8/00—Means to be fixed to the jaw-bone for consolidating natural teeth or for fixing dental prostheses thereon; Dental implants; Implanting tools
- A61C8/0018—Means to be fixed to the jaw-bone for consolidating natural teeth or for fixing dental prostheses thereon; Dental implants; Implanting tools characterised by the shape
- A61C8/0037—Details of the shape
- A61C8/0045—Details of the shape with a stepped body
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61C—DENTISTRY; APPARATUS OR METHODS FOR ORAL OR DENTAL HYGIENE
- A61C8/00—Means to be fixed to the jaw-bone for consolidating natural teeth or for fixing dental prostheses thereon; Dental implants; Implanting tools
- A61C8/0089—Implanting tools or instruments
Landscapes
- Health & Medical Sciences (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Dentistry (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Dental Prosthetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2619650A DE2619650C3 (de) | 1976-05-04 | 1976-05-04 | Dentalimplantat |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH615340A5 true CH615340A5 (cs) | 1980-01-31 |
Family
ID=5977030
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH522077A CH615340A5 (cs) | 1976-05-04 | 1977-04-27 |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4185383A (cs) |
| JP (1) | JPS52151292A (cs) |
| AT (1) | AT349130B (cs) |
| BE (1) | BE854136A (cs) |
| CH (1) | CH615340A5 (cs) |
| DE (1) | DE2619650C3 (cs) |
| DK (1) | DK145606C (cs) |
| ES (1) | ES228214Y (cs) |
| FR (1) | FR2350090A1 (cs) |
| GB (1) | GB1544784A (cs) |
| GR (1) | GR70336B (cs) |
| IE (1) | IE44928B1 (cs) |
| IT (1) | IT1115291B (cs) |
| LU (1) | LU77247A1 (cs) |
| NL (1) | NL181256C (cs) |
| PT (1) | PT66478B (cs) |
| TR (1) | TR19849A (cs) |
Families Citing this family (94)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH630251A5 (de) * | 1978-05-19 | 1982-06-15 | Sulzer Ag | Oberflaechenstruktur an verankerungselement eines knochenimplantates. |
| CH634220A5 (fr) * | 1979-11-05 | 1983-01-31 | Borle Jean Pierre | Vis d'ancrage pour obturation dentaire et outil pour la formation d'une creusure permettant la mise en place de cette vis. |
| CH642838A5 (de) * | 1979-11-21 | 1984-05-15 | Osteo Ag | Kieferimplantat. |
| US4293302A (en) * | 1980-03-26 | 1981-10-06 | Scientific Advances, Inc. | Tooth implants |
| USD265246S (en) | 1980-04-10 | 1982-06-29 | Young Dental Mfg. Co., Inc. | Denture retainer implant |
| DE3213434C1 (de) * | 1982-04-10 | 1983-10-27 | Günther Dr.med. 7400 Tübingen Aldinger | Verfahren zur Herstellung individuell gestalteter Endoprothesen oder Implantate |
| US4431416A (en) * | 1982-04-29 | 1984-02-14 | A & L Investment Company | Endosseous dental implant system for overdenture retention, crown and bridge support |
| DE3226831C2 (de) * | 1982-07-17 | 1984-07-26 | Friedrichsfeld Gmbh, Steinzeug- Und Kunststoffwerke, 6800 Mannheim | Zahnimplantat |
| DE3230374C2 (de) * | 1982-08-14 | 1984-08-30 | Friedrichsfeld Gmbh, Steinzeug- Und Kunststoffwerke, 6800 Mannheim | Zahnimplantat aus Metall |
| DE3302968C2 (de) * | 1983-01-29 | 1986-08-14 | Friedrichsfeld GmbH Keramik- und Kunststoffwerke, 6800 Mannheim | Dentalimplantat |
| USD296362S (en) | 1985-02-15 | 1988-06-21 | The Institute For Applied Biotechnology | Dental implant |
| US4622012A (en) * | 1985-03-27 | 1986-11-11 | Smoler Lewis S | Dental post system |
| DE3643416A1 (de) * | 1986-01-27 | 1987-09-24 | Jenaer Glaswerk Veb | Bioaktive dauerimplantate |
| US4744755A (en) * | 1986-08-13 | 1988-05-17 | Ross Systems Corporation | Dental implant and method for installing same |
| US4744754A (en) * | 1986-08-13 | 1988-05-17 | Ross Systems Corporation | Dental implant and method for installing same into bone tissue |
| GB2199626B (en) * | 1987-01-08 | 1991-09-04 | Core Vent Corp | Screw-type dental implant anchor |
| US5078607A (en) * | 1987-01-08 | 1992-01-07 | Core-Vent Corporation | Dental implant including plural anchoring means |
| US4758161A (en) * | 1987-01-28 | 1988-07-19 | Core-Vent Corporation | Coping insert for use with a dental implant |
| USRE33796E (en) * | 1987-01-28 | 1992-01-14 | Core-Vent Corporation | Coping insert for use with a dental implant |
| FR2610819A1 (fr) * | 1987-02-13 | 1988-08-19 | Longere Bernard | Implant dentaire " etoile " et son dispositif de mise en place |
| US4850870C1 (en) * | 1987-10-23 | 2001-07-24 | Implant Innovations Inc | Prosthodontic restoration components |
| US5015247A (en) * | 1988-06-13 | 1991-05-14 | Michelson Gary K | Threaded spinal implant |
| US7452359B1 (en) * | 1988-06-13 | 2008-11-18 | Warsaw Orthopedic, Inc. | Apparatus for inserting spinal implants |
| US4932870A (en) * | 1988-08-18 | 1990-06-12 | Ipco Corporation | Dental post and method for making the same |
| FR2635964A1 (fr) * | 1988-09-02 | 1990-03-09 | Poulmaire Francis | Systeme implantable avec ou sans resilience, dispositif rotatif pour conception de loge implantaire et procede d'utilisation du systeme implantable |
| DE3841705C2 (de) * | 1988-12-10 | 1995-08-24 | Imz Fertigung Vertrieb | Enossales Implantat |
| US5205745A (en) * | 1989-08-30 | 1993-04-27 | Tdk Corporation | Artificial dental root |
| DE59101624D1 (de) * | 1990-01-15 | 1994-06-23 | Friatec Keramik Kunststoff | Dentalimplantat. |
| US5439381A (en) * | 1992-09-28 | 1995-08-08 | Cohen; Howard | Dental implant apparatus and method |
| US5310343A (en) * | 1992-10-14 | 1994-05-10 | Jiro Hasegawa | Endo-osseous implant |
| FR2703581A1 (fr) * | 1993-04-06 | 1994-10-14 | Bordes Sylvain | Dispositif de montage d'un implant dentaire. |
| US5527183A (en) * | 1993-08-18 | 1996-06-18 | Collaborative Enterprises, Inc. | Endosseous implant system |
| US5427526A (en) * | 1993-12-13 | 1995-06-27 | Fernandes; Americo | Dental implant and dentistry implant method |
| US5755574A (en) * | 1994-04-21 | 1998-05-26 | D'alise; James V. | Endosseous dental implant and method of manufacture |
| US5538424A (en) * | 1994-05-18 | 1996-07-23 | Gelb; David A. | Radiographic depth and prosthetic positioning guide |
| JP3457675B2 (ja) | 1994-05-24 | 2003-10-20 | テクノロジィ ファイナンス コーポレイション (プロプライエタリー)リミテッド | 骨修復と置換のための生体適合材料と骨インプラント |
| USD380047S (en) * | 1994-07-27 | 1997-06-17 | Gelb David A | Combined radiographic depth gauge and prosthetic positioning apparatus |
| WO1996008205A1 (en) * | 1994-09-15 | 1996-03-21 | Surgical Dynamics, Inc. | Conically-shaped anterior fusion cage and method of implantation |
| US5885299A (en) * | 1994-09-15 | 1999-03-23 | Surgical Dynamics, Inc. | Apparatus and method for implant insertion |
| US5927979A (en) | 1994-12-15 | 1999-07-27 | Biohorizons Implants Systems, Inc. | Abutment-mount system for dental implants |
| US5628630A (en) * | 1994-12-15 | 1997-05-13 | Univ. Of Alabama At Birmingham | Design process for skeletal implants to optimize cellular response |
| US5782919A (en) * | 1995-03-27 | 1998-07-21 | Sdgi Holdings, Inc. | Interbody fusion device and method for restoration of normal spinal anatomy |
| FR2734707B1 (fr) * | 1995-05-30 | 1997-08-29 | Guedj Leon | Equipement chirurgical d'implantologie dentaire et elements, implant dentaire et instruments de forage, constitutifs |
| US5639237A (en) * | 1995-06-08 | 1997-06-17 | Fontenot; Mark G | Dental prosthesis having indentations |
| US5816809A (en) * | 1995-09-20 | 1998-10-06 | Genetic Implant Systems, Inc. | Dental prosthesis support device and method of using same |
| DE19613743C2 (de) * | 1996-04-01 | 1999-11-18 | Marcus Nowak | Satz von kieferchirurgischen Instrumenten zur Schaffung von Öffnungen im Kieferknochen zum Einsetzen von Implantaten |
| ES2216160T3 (es) | 1996-07-18 | 2004-10-16 | Implant Innovations, Inc. | Utiles de osteotomia provistos de motor de compactacion de tejido oseo. |
| US6068480A (en) | 1996-07-18 | 2000-05-30 | Biohorizons Implant Systems, Inc. | Abutment-mount with square driving surface |
| US5895426A (en) | 1996-09-06 | 1999-04-20 | Osteotech, Inc. | Fusion implant device and method of use |
| US5795160A (en) * | 1997-02-06 | 1998-08-18 | Hahn; Jack A. | Tapered dental implant in a stepped orifice |
| US5954504A (en) * | 1997-03-31 | 1999-09-21 | Biohorizons Implants Systems | Design process for skeletal implants to optimize cellular response |
| SE9701582D0 (sv) * | 1997-04-28 | 1997-04-28 | Astra Ab | Implant system |
| US5897319A (en) * | 1997-09-12 | 1999-04-27 | Sulzer Calcitek Inc. | Self-tapping implant with helical flutes |
| US5842865A (en) * | 1997-09-12 | 1998-12-01 | Sulzer Calcitek Inc. | Self-tapping implant with multiple concave tapping channels |
| US6039568A (en) * | 1998-06-02 | 2000-03-21 | Hinds; Kenneth F. | Tooth shaped dental implants |
| US20040267349A1 (en) * | 2003-06-27 | 2004-12-30 | Kobi Richter | Amorphous metal alloy medical devices |
| US20060178727A1 (en) * | 1998-12-03 | 2006-08-10 | Jacob Richter | Hybrid amorphous metal alloy stent |
| US20060122691A1 (en) * | 1998-12-03 | 2006-06-08 | Jacob Richter | Hybrid stent |
| US20070219642A1 (en) * | 1998-12-03 | 2007-09-20 | Jacob Richter | Hybrid stent having a fiber or wire backbone |
| US8382821B2 (en) * | 1998-12-03 | 2013-02-26 | Medinol Ltd. | Helical hybrid stent |
| ATE197389T1 (de) * | 1998-12-11 | 2000-11-11 | Dinkelacker Wolfgang | Zahnimplantat und verfahren zu seiner herstellung |
| AU2624801A (en) * | 1999-12-30 | 2001-07-16 | Osteotech, Inc. | Intervertebral implants |
| US20030120274A1 (en) * | 2000-10-20 | 2003-06-26 | Morris John W. | Implant retaining device |
| US6887077B2 (en) * | 2001-08-17 | 2005-05-03 | Implant Innovations, Inc. | Immediate load dental implant system and method of use |
| US6855167B2 (en) * | 2001-12-05 | 2005-02-15 | Osteotech, Inc. | Spinal intervertebral implant, interconnections for such implant and processes for making |
| JP4420423B2 (ja) * | 2002-09-26 | 2010-02-24 | 株式会社ジーシー | セルフタップ付き歯科用スクリュー型インプラントフィクスチャー用ドリルセット |
| IL190642A (en) | 2002-11-13 | 2011-06-30 | Biomet 3I Llc | Dental implant system |
| US20040170947A1 (en) * | 2003-02-27 | 2004-09-02 | Milne Robert H. | Dental implant and bone regeneration device and method of implementation |
| US9039755B2 (en) | 2003-06-27 | 2015-05-26 | Medinol Ltd. | Helical hybrid stent |
| US9155639B2 (en) * | 2009-04-22 | 2015-10-13 | Medinol Ltd. | Helical hybrid stent |
| EP1529497B1 (en) * | 2003-11-04 | 2009-10-28 | Friadent GmbH | Dental implant component |
| ES2501940T3 (es) | 2003-11-05 | 2014-10-02 | Dentsply Implants Manufacturing Gmbh | Implante no metálico de múltiples piezas |
| US8333985B2 (en) | 2004-01-27 | 2012-12-18 | Warsaw Orthopedic, Inc. | Non-glycerol stabilized bone graft |
| US7850452B2 (en) | 2005-04-27 | 2010-12-14 | Biomet 3I, Llc | Pre-stressed implant component and assembly |
| FR2885029B1 (fr) * | 2005-04-29 | 2007-06-15 | Gerard Scortecci | Dispositif pour l'implantologie dentaire |
| AU2008216371B2 (en) * | 2007-02-12 | 2014-04-10 | Warsaw Orthopedic, Inc. | Joint revision implant |
| US7758643B2 (en) * | 2007-02-26 | 2010-07-20 | Biomet Sports Medicine, Llc | Stable cartilage defect repair plug |
| FR2922751A1 (fr) * | 2007-10-31 | 2009-05-01 | Tekka Sa | Implant dentaire et outil pour la preparation de la zone d'implantation. |
| GR1006227B (el) * | 2007-11-16 | 2009-01-13 | - | Ενιαιο ενδοστικο οδοντικο εμφυτευμα τιτανιου ή ζιρκονιας σε συνδυασμο με κεραμικο ή υαλοκεραμικο διαβλενογονιο προσαρτημα |
| WO2012173577A1 (en) * | 2011-06-13 | 2012-12-20 | Haydar Imad | Oval section dental implant |
| US10201405B2 (en) | 2011-06-28 | 2019-02-12 | Biomet 3I, Llc | System and method of dental implant and interface to abutment for restoration |
| US9572631B2 (en) * | 2014-03-05 | 2017-02-21 | Form And Function Dental Services, P.C. | Asymmetrical dental tool with cooling channels |
| US10980617B2 (en) * | 2015-02-23 | 2021-04-20 | Maurice Valen | Implantable surgical screw for bone reconstruction |
| US10314610B2 (en) | 2015-03-25 | 2019-06-11 | Medtronic Ps Medical, Inc. | Slanted drive axis rotary surgical cutting tools and powered handpieces |
| USD782042S1 (en) | 2015-03-25 | 2017-03-21 | Medtronic Ps Medical, Inc. | Surgical tool |
| USD800907S1 (en) | 2015-03-25 | 2017-10-24 | Medtronic Ps Medical, Inc. | Surgical tool |
| US10080579B2 (en) | 2015-03-25 | 2018-09-25 | Medtronic Ps Medical, Inc. | Pin drive rotary surgical cutting tools and powered handpieces |
| USD800906S1 (en) | 2015-03-25 | 2017-10-24 | Medtronic Ps Medical, Inc. | Surgical tool |
| USD790699S1 (en) | 2015-03-25 | 2017-06-27 | Medtronic Ps Medical, Inc. | Surgical tool |
| USD800903S1 (en) | 2016-02-09 | 2017-10-24 | Medtronic Ps Medical, Inc. | Surgical tool |
| US10849634B2 (en) | 2018-06-20 | 2020-12-01 | Medtronic Xomed, Inc. | Coupling portion for rotary surgical cutting systems |
| RU2711546C1 (ru) * | 2019-04-19 | 2020-01-17 | Александр Васильевич Потапов | Базальный имплантат |
| US12478488B2 (en) | 2020-02-19 | 2025-11-25 | Medinol Ltd. | Helical stent with enhanced crimping |
| US12167951B1 (en) * | 2022-01-20 | 2024-12-17 | Gary Bram | Osteotomy drill bit to produce an optimally shaped jawbone opening for a dental implant and abutment |
Family Cites Families (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE583421C (de) * | 1933-09-02 | Eugen Brill Dr | Zahnwurzelprothese aus gebrannter keramischer Masse in Gestalt einer natuerlichen Zahnwurzel | |
| FR700397A (fr) * | 1930-02-19 | 1931-02-27 | Broche permettant de fixer des dents artificielles à des racines | |
| DE550952C (de) * | 1930-02-20 | 1932-05-23 | Heinz Hollmann Dr | Zahnwurzelstift |
| DE579504C (de) * | 1931-08-18 | 1933-06-28 | Dresdner Gold U Silber Scheide | Zylindrisch gestufter Zahnwurzelstift fuer den unmittelbaren verschweissenden Anguss des Metallaufbaues einer Zahnkrone |
| FR1030690A (fr) * | 1950-12-02 | 1953-06-16 | Pièces et outillage de prothèse dentaire notamment cheville-alvéolaire | |
| DE1042835B (de) * | 1953-11-03 | 1958-11-06 | Wolfdietrich Rauscher Dr Med D | Kuenstlicher Zahn |
| FR1228362A (fr) * | 1959-03-16 | 1960-08-29 | Armature support pour implantation osseuse | |
| FR1429392A (fr) * | 1965-01-13 | 1966-02-18 | Perfectionnement aux implants endo-osseux | |
| SE332486B (cs) * | 1968-12-09 | 1971-02-08 | Aga Ab | |
| US3524255A (en) * | 1969-04-11 | 1970-08-18 | Peter Frank Kurer | Method of attaching a tooth crown to a tooth root |
| US3514858A (en) * | 1969-04-14 | 1970-06-02 | Ralph H Silverman | Denture securing apparatus |
| US3797113A (en) * | 1970-06-01 | 1974-03-19 | Vitredent Corp | Dental implant |
| GB1302789A (cs) * | 1970-11-25 | 1973-01-10 | ||
| US3740769A (en) * | 1971-02-11 | 1973-06-26 | E Haboush | Prosthesis for hip joints |
| DE2115682C3 (de) * | 1971-03-31 | 1975-07-10 | Walter Dr. 7160 Gaildorf Haefner | Verfahren zur Herstellung eines Arbeitsmodells eines Kiefers, in den zumindest ein Kieferimplantat eingesetzt ist, sowie Kieferimplantat, Kappe und Übertragungsstift zur Durchführung des Verfahrens |
| CH551201A (de) * | 1971-04-06 | 1974-07-15 | Kraus Werner | Geraet zur anregung und/oder beschleunigung der bildung von knochensubstanz. |
| US3729825A (en) * | 1971-08-02 | 1973-05-01 | Oratronics Inc | Oral implant |
| DE2242867C3 (de) * | 1972-08-31 | 1975-09-25 | Battelle-Institut E.V., 6000 Frankfurt | Verfahren zur Herstellung implantierbarer, keramischer Knochenersatz-, Knochenverbund- oder Prothesenverankerung swerkstoffe |
| US3909854A (en) * | 1973-05-03 | 1975-10-07 | Ysidore M Martinez | Knee implant prosthesis |
| GB1461154A (en) * | 1973-09-28 | 1977-01-13 | Miller E H | Metacarpophalangeal or interphalangeal joint prosthesis |
| GB1488247A (en) * | 1973-10-15 | 1977-10-12 | Nat Res Dev | Endoprosthetic devices |
| SU517194A1 (ru) * | 1973-11-19 | 1977-03-05 | Саратовский Научно-Исследовательский Институт Травматологии И Ортопедии Министерства Здравоохранения Рсфср | Искусственный тазобедренный сустав |
| US3950850A (en) * | 1974-02-25 | 1976-04-20 | Miter, Inc. | Dental prosthetic implants |
| DE2419080A1 (de) * | 1974-04-20 | 1975-11-06 | Kirschner Horst Prof Dr Med De | Implantat zum implantieren in knochen, insbesondere fuer die verwendung in der zahnheilkunde |
| DE2421951A1 (de) * | 1974-05-07 | 1975-11-20 | Degussa | Verbundwerkstoff fuer zahnaerztliche implantate |
| DE2455828C3 (de) * | 1974-11-26 | 1985-07-18 | Grafelmann, Hans, 2800 Bremen | Blattimplantat aus Metall zur Befestigung von Zahnprothesen |
| US3952334A (en) * | 1974-11-29 | 1976-04-27 | General Atomic Company | Biocompatible carbon prosthetic devices |
| DE2517702C3 (de) * | 1975-04-22 | 1978-11-02 | Friedrichsfeld Gmbh, Steinzeug- Und Kunststoffwerke, 6800 Mannheim | Femurteil einer Hüftgelenktotalendoprothese |
| US3934347A (en) * | 1975-01-14 | 1976-01-27 | Lash Oral Implants | Dental prosthetic structure and method |
| US4050157A (en) * | 1975-05-27 | 1977-09-27 | Fagan Jr Maurice J | Dental implant |
| DE2546824C2 (de) * | 1975-10-18 | 1986-05-07 | Ernst Leitz Wetzlar Gmbh, 6330 Wetzlar | Beschichtete Endoprothese und Verfahren zu ihrer Herstellung |
| DE2549114C3 (de) * | 1975-11-03 | 1981-09-03 | Friedrichsfeld Gmbh, Steinzeug- Und Kunststoffwerke, 6800 Mannheim | Dentalimplantat aus Aluminiumoxid-Keramik zur Befestigung einer Suprastruktur |
| SE416443B (sv) * | 1975-12-30 | 1981-01-05 | Sumitomo Chemical Co | Implantat for ben, leder eller tandrotter |
-
1976
- 1976-05-04 DE DE2619650A patent/DE2619650C3/de not_active Expired
-
1977
- 1977-04-05 GR GR53162A patent/GR70336B/el unknown
- 1977-04-13 NL NLAANVRAGE7704014,A patent/NL181256C/xx not_active IP Right Cessation
- 1977-04-20 GB GB16463/77A patent/GB1544784A/en not_active Expired
- 1977-04-22 AT AT285977A patent/AT349130B/de not_active IP Right Cessation
- 1977-04-26 PT PT66478A patent/PT66478B/pt unknown
- 1977-04-27 CH CH522077A patent/CH615340A5/de not_active IP Right Cessation
- 1977-04-29 FR FR7713067A patent/FR2350090A1/fr active Granted
- 1977-04-29 BE BE177161A patent/BE854136A/xx not_active IP Right Cessation
- 1977-04-29 US US05/792,116 patent/US4185383A/en not_active Expired - Lifetime
- 1977-04-29 IT IT23008/77A patent/IT1115291B/it active
- 1977-04-30 ES ES1977228214U patent/ES228214Y/es not_active Expired
- 1977-05-03 TR TR19849A patent/TR19849A/xx unknown
- 1977-05-03 IE IE893/77A patent/IE44928B1/en unknown
- 1977-05-03 LU LU77247A patent/LU77247A1/xx unknown
- 1977-05-04 DK DK196377A patent/DK145606C/da not_active IP Right Cessation
- 1977-05-04 JP JP5083777A patent/JPS52151292A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ES228214U (es) | 1977-07-01 |
| IT1115291B (it) | 1986-02-03 |
| GR70336B (cs) | 1982-09-20 |
| DE2619650C3 (de) | 1985-06-05 |
| DK145606C (da) | 1983-06-13 |
| AT349130B (de) | 1979-03-26 |
| NL181256B (nl) | 1987-02-16 |
| DE2619650A1 (de) | 1977-11-10 |
| IE44928L (en) | 1977-11-04 |
| NL181256C (nl) | 1987-07-16 |
| PT66478A (de) | 1977-05-01 |
| LU77247A1 (cs) | 1977-08-22 |
| TR19849A (tr) | 1980-02-11 |
| JPS567412B2 (cs) | 1981-02-18 |
| PT66478B (de) | 1978-09-28 |
| DE2619650B2 (de) | 1980-09-04 |
| IE44928B1 (en) | 1982-05-19 |
| JPS52151292A (en) | 1977-12-15 |
| DK196377A (da) | 1977-11-05 |
| NL7704014A (nl) | 1977-11-08 |
| FR2350090A1 (fr) | 1977-12-02 |
| GB1544784A (en) | 1979-04-25 |
| ATA285977A (de) | 1978-08-15 |
| FR2350090B1 (cs) | 1982-07-02 |
| ES228214Y (es) | 1977-12-01 |
| BE854136A (fr) | 1977-08-16 |
| US4185383A (en) | 1980-01-29 |
| DK145606B (da) | 1982-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH615340A5 (cs) | ||
| EP0438048B1 (de) | Dentalimplantat | |
| DE69934313T2 (de) | Dentalimplantat | |
| DE69323596T2 (de) | Befestigungselement für Knochengewebe | |
| DE602005005452T2 (de) | Verankerungselement zur verwendung in knochen | |
| DE69209592T2 (de) | Element zum Verankern | |
| EP0396519B1 (de) | Verankerungselement zum Halten eines Gelenkteils eines Fingers oder anderer künstlicher Gelenke | |
| EP2688512A1 (de) | Zahnimplantat mit einem ersten konischen und einem zweiten zylindrischen schraubteil | |
| DE69833559T2 (de) | Implantat mit gewinde womit eine sichere verankerung im knochen erzielt wird | |
| WO2004041111A1 (de) | Zahnimplantat | |
| DE69832701T2 (de) | Abstandselement für eine zementierte superstruktur | |
| EP0139253A1 (de) | Implantat zur Befestigung eines künstlichen Zahnersatzes | |
| CH618870A5 (cs) | ||
| DE2205808B2 (de) | Schaft für Knochenimplantate | |
| EP2654603A1 (de) | Crestales implantat und verfahren zu dessen bearbeitung | |
| DE4130891A1 (de) | Zahnimplantat | |
| EP3638148A1 (de) | Dentalimplantatsystem umfassend ein zahnimplantat und ein separates abutment | |
| EP1006926A2 (de) | Implantatsysteme sowie verfahren und werkzeuge zum implantieren im zahnlosen kiefer | |
| WO2005112816A1 (de) | Zahnimplantat | |
| DE3034086C2 (de) | Verankerungsvorrichtung für die Befestigung von Zähnen oder Zahnprothesen | |
| DE10356920B4 (de) | In einen menschlichen Kiefer endostal einschraubbares Dentalimplantat zur Aufnahme und Fixierung eines Zahnersatzes | |
| DE29716883U1 (de) | Kieferimplantat und Suprastruktur für zahnmedizinische Zwecke zur Halterung eines Zahnersatzes am menschlichen Kiefer | |
| WO2007073743A1 (de) | Implantat zur verankerung in knochen | |
| DE3302968C2 (de) | Dentalimplantat | |
| DE69829970T2 (de) | Implantsystem |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |