CH580910A5 - - Google Patents
Info
- Publication number
- CH580910A5 CH580910A5 CH924373A CH924373A CH580910A5 CH 580910 A5 CH580910 A5 CH 580910A5 CH 924373 A CH924373 A CH 924373A CH 924373 A CH924373 A CH 924373A CH 580910 A5 CH580910 A5 CH 580910A5
- Authority
- CH
- Switzerland
- Prior art keywords
- test
- larvae
- alkyl
- parts
- hydrogen
- Prior art date
Links
- 239000004480 active ingredient Substances 0.000 claims description 27
- 150000001875 compounds Chemical class 0.000 claims description 24
- 238000012360 testing method Methods 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 241000244206 Nematoda Species 0.000 claims description 9
- 241000196324 Embryophyta Species 0.000 claims description 8
- 230000000694 effects Effects 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- 239000002689 soil Substances 0.000 claims description 8
- 239000000839 emulsion Substances 0.000 claims description 7
- 239000007921 spray Substances 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- 230000000895 acaricidal effect Effects 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 239000000575 pesticide Substances 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 235000007688 Lycopersicon esculentum Nutrition 0.000 claims description 4
- 241000243784 Meloidogyne arenaria Species 0.000 claims description 4
- 241001465754 Metazoa Species 0.000 claims description 4
- 241000238680 Rhipicephalus microplus Species 0.000 claims description 4
- 241001454293 Tetranychus urticae Species 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 238000010790 dilution Methods 0.000 claims description 4
- 239000012895 dilution Substances 0.000 claims description 4
- 235000013601 eggs Nutrition 0.000 claims description 4
- 238000002474 experimental method Methods 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 230000003032 phytopathogenic effect Effects 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 claims description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 3
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 claims description 3
- 241000238631 Hexapoda Species 0.000 claims description 3
- 244000046052 Phaseolus vulgaris Species 0.000 claims description 3
- 241000949016 Rhipicephalus bursa Species 0.000 claims description 3
- 240000003768 Solanum lycopersicum Species 0.000 claims description 3
- 241000607479 Yersinia pestis Species 0.000 claims description 3
- HLSFBFYQBSVXBS-UHFFFAOYSA-N n-(aminomethylidene)methanimidamide Chemical compound N=CNC=N HLSFBFYQBSVXBS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 2
- 229920000742 Cotton Polymers 0.000 claims description 2
- 235000009161 Espostoa lanata Nutrition 0.000 claims description 2
- 240000001624 Espostoa lanata Species 0.000 claims description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 claims description 2
- 238000004587 chromatography analysis Methods 0.000 claims description 2
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 claims description 2
- 238000011156 evaluation Methods 0.000 claims description 2
- 230000001418 larval effect Effects 0.000 claims description 2
- 230000001069 nematicidal effect Effects 0.000 claims description 2
- 238000009331 sowing Methods 0.000 claims description 2
- 241000227653 Lycopersicon Species 0.000 claims 1
- 235000013311 vegetables Nutrition 0.000 claims 1
- 239000008187 granular material Substances 0.000 description 9
- -1 cyano, hydroxy Chemical group 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000005995 Aluminium silicate Substances 0.000 description 5
- 235000012211 aluminium silicate Nutrition 0.000 description 5
- 230000000749 insecticidal effect Effects 0.000 description 5
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000426497 Chilo suppressalis Species 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241000233866 Fungi Species 0.000 description 3
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 235000019993 champagne Nutrition 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 241000238876 Acari Species 0.000 description 2
- 241001124076 Aphididae Species 0.000 description 2
- 241001425390 Aphis fabae Species 0.000 description 2
- 240000002024 Gossypium herbaceum Species 0.000 description 2
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000002574 poison Substances 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000254032 Acrididae Species 0.000 description 1
- 241000238888 Argasidae Species 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 241000238660 Blattidae Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000257161 Calliphoridae Species 0.000 description 1
- 241001414835 Cimicidae Species 0.000 description 1
- HWHJHZYGGDZHNC-UHFFFAOYSA-N ClC1=CC(=C(C=C1)N=CN(C=NC)C)C Chemical compound ClC1=CC(=C(C=C1)N=CN(C=NC)C)C HWHJHZYGGDZHNC-UHFFFAOYSA-N 0.000 description 1
- 241000256113 Culicidae Species 0.000 description 1
- 241001466044 Delphacidae Species 0.000 description 1
- 241001481702 Dermanyssidae Species 0.000 description 1
- 241001414830 Diaspididae Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 241000238816 Gryllidae Species 0.000 description 1
- 241001243087 Gryllotalpidae Species 0.000 description 1
- 241000256257 Heliothis Species 0.000 description 1
- 241000256244 Heliothis virescens Species 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 241000238889 Ixodidae Species 0.000 description 1
- 241001124557 Lymantriidae Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 241000256259 Noctuidae Species 0.000 description 1
- 241000233654 Oomycetes Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 241001415279 Pseudococcidae Species 0.000 description 1
- 241000258921 Pulicidae Species 0.000 description 1
- 241000255893 Pyralidae Species 0.000 description 1
- 241001510071 Pyrrhocoridae Species 0.000 description 1
- 241001124072 Reduviidae Species 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- 241000256250 Spodoptera littoralis Species 0.000 description 1
- 241000255588 Tephritidae Species 0.000 description 1
- 241001454295 Tetranychidae Species 0.000 description 1
- 241000896028 Tettigoniidae Species 0.000 description 1
- 241000131339 Tipulidae Species 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000002464 fungitoxic effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- CRMWDHWPEFVLOU-UHFFFAOYSA-N n,n'-dimethylmethanimidamide Chemical compound CNC=NC CRMWDHWPEFVLOU-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- RBXVOQPAMPBADW-UHFFFAOYSA-N nitrous acid;phenol Chemical class ON=O.OC1=CC=CC=C1 RBXVOQPAMPBADW-UHFFFAOYSA-N 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- KZOJQMWTKJDSQJ-UHFFFAOYSA-M sodium;2,3-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S([O-])(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 KZOJQMWTKJDSQJ-UHFFFAOYSA-M 0.000 description 1
- SRAWNDFHGTVUNZ-UHFFFAOYSA-M sodium;3,6-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(CCCC)=CC2=CC(CCCC)=CC=C21 SRAWNDFHGTVUNZ-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (22)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH924373A CH580910A5 (enExample) | 1973-06-25 | 1973-06-25 | |
| IL44905A IL44905A (en) | 1973-06-25 | 1974-05-28 | N-alkyl-n-(n-alkylformimidoyl)-n'-phenylformamidine derivatives their preparation and use in pest control |
| AU69500/74A AU484017B2 (en) | 1973-06-25 | 1974-05-29 | PESTICIDAL 1, 3, 5-TRIAZAPENTA-l, 4-DIENES |
| NL7407738A NL7407738A (enExample) | 1973-06-25 | 1974-06-10 | |
| US478679A US3875230A (en) | 1973-06-25 | 1974-06-12 | Pesticidal 1,3,5-triazapenta-1,4-dienes |
| FR7421291A FR2234275B1 (enExample) | 1973-06-25 | 1974-06-19 | |
| OA55224A OA04723A (fr) | 1973-06-25 | 1974-06-21 | Nouveaux 1,3,5-triazapenta-1,4-diènes utiles à la lutte contre les parasites. |
| CA203,058A CA1042461A (en) | 1973-06-25 | 1974-06-21 | Pesticidal 1,3,5-triazapenta-1,4-dienes |
| DD179367A DD114211A5 (enExample) | 1973-06-25 | 1974-06-21 | |
| DE2429747A DE2429747A1 (de) | 1973-06-25 | 1974-06-21 | 1,3,5-triazapenta-1,4-diene, verfahren zu ihrer herstellung und ihre verwendung |
| TR1831874A TR18318A (tr) | 1973-06-25 | 1974-06-24 | Yeni kondansasyon mahsulleri |
| BR5131/74A BR7405131D0 (pt) | 1973-06-25 | 1974-06-24 | Processo para a obtencao de 1 3 5-triazapenta-1 4-dieno e composicoes praguicidas a base deste |
| SU742038071A SU603314A3 (ru) | 1973-06-25 | 1974-06-24 | Средство дл борьбы с насекомыми и клещами |
| GB2795474A GB1471044A (en) | 1973-06-25 | 1974-06-24 | Pesticidal 1,3,5-triazapenta-1,4-dienes |
| BG027057A BG21833A3 (bg) | 1973-06-25 | 1974-06-24 | Средство за борба с вредители |
| ES427587A ES427587A1 (es) | 1973-06-25 | 1974-06-24 | Procedimiento para la preparacion de 01,3,5-triazapenta-1,4-dienos. |
| ZA00744045A ZA744045B (en) | 1973-06-25 | 1974-06-24 | New condensation products |
| AR254344A AR213823A1 (es) | 1973-06-25 | 1974-06-24 | Nuevos compuestos 1,3,5-triazapenta-1,4dieno derivados utiles como insecticidas y acaricidas,procedimiento para su preparacion y composiciones que los contienen |
| AT521374A AT332169B (de) | 1973-06-25 | 1974-06-24 | Insektizide und akarizide mittel |
| BE145796A BE816760A (fr) | 1973-06-25 | 1974-06-24 | Nouveaux 1,3,5-triazapenta-1,4-dienes utiles a la lutte contre les parasites. |
| JP49072730A JPS5035331A (enExample) | 1973-06-25 | 1974-06-25 | |
| KE3005A KE3005A (en) | 1973-06-25 | 1979-11-23 | Pesticidal 1,3,5-triazapenta-1,4-dienes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH924373A CH580910A5 (enExample) | 1973-06-25 | 1973-06-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH580910A5 true CH580910A5 (enExample) | 1976-10-29 |
Family
ID=4349893
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH924373A CH580910A5 (enExample) | 1973-06-25 | 1973-06-25 |
Country Status (7)
| Country | Link |
|---|---|
| AT (1) | AT332169B (enExample) |
| BE (1) | BE816760A (enExample) |
| CH (1) | CH580910A5 (enExample) |
| ES (1) | ES427587A1 (enExample) |
| SU (1) | SU603314A3 (enExample) |
| TR (1) | TR18318A (enExample) |
| ZA (1) | ZA744045B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1448165A (en) * | 1974-08-23 | 1976-09-02 | Pfizer Ltd | 1-substituted-5-substituted phenyl-3-methyl-1,3,5-triazapenta- 1,4-dienes and acaricidal and insecticidal compositions containing them |
| US4186264A (en) * | 1976-04-20 | 1980-01-29 | Pfizer Inc. | Triazapentadienes as acaricides |
| US4128652A (en) * | 1976-04-20 | 1978-12-05 | Pfizer Inc. | Triazapentadienes as acaricides |
-
1973
- 1973-06-25 CH CH924373A patent/CH580910A5/de not_active IP Right Cessation
-
1974
- 1974-06-24 SU SU742038071A patent/SU603314A3/ru active
- 1974-06-24 AT AT521374A patent/AT332169B/de not_active IP Right Cessation
- 1974-06-24 TR TR1831874A patent/TR18318A/xx unknown
- 1974-06-24 ES ES427587A patent/ES427587A1/es not_active Expired
- 1974-06-24 BE BE145796A patent/BE816760A/xx unknown
- 1974-06-24 ZA ZA00744045A patent/ZA744045B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA744045B (en) | 1975-06-25 |
| TR18318A (tr) | 1977-01-06 |
| ATA521374A (de) | 1975-12-15 |
| ES427587A1 (es) | 1976-11-16 |
| AT332169B (de) | 1976-09-10 |
| BE816760A (fr) | 1974-12-24 |
| SU603314A3 (ru) | 1978-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2360631A1 (de) | 1,2,4-triazolylphosphorsaeure- bzw. phosphonsaeureester, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2303185C2 (de) | Thiophosphorsäurephenylester, Verfahren zu ihrer Herstellung sowie diese enthaltende Schädlingsbekämpfungsmittel | |
| DE2412564A1 (de) | N,n-dimethylcarbamoyl-1,2,4-triazolyl(3)-ester, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2429747A1 (de) | 1,3,5-triazapenta-1,4-diene, verfahren zu ihrer herstellung und ihre verwendung | |
| CH580910A5 (enExample) | ||
| DE2304128C2 (de) | Thiolphosphorsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung in der Schädlingsbekämpfung | |
| DE2330089C2 (de) | 1.2.4-Triazolyl-(thiono)-phosphor(phosphon)-säurederivate, Verfahren zu ihrer Herstellung sowie diese enthaltende Schädlingsbekämpfungsmittel | |
| DE2422324C2 (de) | Diphenyläther-phosphorverbindungen, Verfahren zu ihrer Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| AT328795B (de) | Schadlingsbekampfungsmittel | |
| DE2350696A1 (de) | Neue ester | |
| DE2418363A1 (de) | 1,2,4-thiadiazolyl-phosphorverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2430758A1 (de) | Oxadiazolylverbindungen, verfahren zu ihrer herstellung und ihre verwendung zur schaedlingsbekaempfung | |
| CH573206A5 (en) | Pesticidal 5-halo-1,2,4-triazol-3-yl carbamates - e.g. 1-isopropyl-5-chloro-1,2,4-triazol-3-yl dimethylcarbamate | |
| CH579873A5 (en) | Oxadiazolyls from hydroxydiazoles and phosphoric acid halides - with wide biocidal activity | |
| DE2405190A1 (de) | S-diphenylmethyl-dithiophosphate, verfahren zu ihrer herstellung und ihre verwendung | |
| CH571308A5 (en) | Biocidal triazolyl dithio phosphates - prepd from dithio phosphoric acid halides and 3-hydroxy triazoles | |
| CH571817A5 (en) | Pesticidal 1,2,4-triazol-3-yl phosph(on)ates - e.g. O,O-diethyl-O-(1-methyl-5-(alpha-carbethoxybenzyl)-1,2,4-triazol-- 3-yl)-phosphate | |
| CH571810A5 (en) | N,N-dimethyl-N'-subst. formamidines - prepd. by reacting subst. S-methyl formamidinates with dimethylformamide dialkyl acetals | |
| DE2401957A1 (de) | Phosphorverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2401941A1 (de) | Phosphorverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| CH570766A5 (en) | Biocidal triazolyl dithio phosphates - prepd from dithiophosphoric acid halides and 3-hydroxy triazoles | |
| DE2401975A1 (de) | Phosphorverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2347223A1 (de) | Neue ester | |
| DE2439663A1 (de) | Diphenylaetherphosphate, verfahren zu ihrer herstellung und ihre verwendung | |
| CH571816A5 (en) | O-Triazolyl O-alkyl (thio)phosph(on)ates - with biocidal (esp insecticidal) activity |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |