CH563980A5 - Hydroxypyridone derivatives azo dye coup - ling components - Google Patents
Hydroxypyridone derivatives azo dye coup - ling componentsInfo
- Publication number
- CH563980A5 CH563980A5 CH1084273A CH1084273A CH563980A5 CH 563980 A5 CH563980 A5 CH 563980A5 CH 1084273 A CH1084273 A CH 1084273A CH 1084273 A CH1084273 A CH 1084273A CH 563980 A5 CH563980 A5 CH 563980A5
- Authority
- CH
- Switzerland
- Prior art keywords
- compounds
- hydroxypyrid
- phenyl
- methyl
- radical
- Prior art date
Links
- 239000000987 azo dye Substances 0.000 title claims abstract description 4
- 230000008878 coupling Effects 0.000 title claims abstract description 4
- 238000010168 coupling process Methods 0.000 title claims abstract description 4
- 238000005859 coupling reaction Methods 0.000 title claims abstract description 4
- GGOZGYRTNQBSSA-UHFFFAOYSA-N pyridine-2,3-diol Chemical class OC1=CC=CN=C1O GGOZGYRTNQBSSA-UHFFFAOYSA-N 0.000 title claims abstract description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims abstract description 13
- 238000004519 manufacturing process Methods 0.000 claims abstract description 9
- 230000007062 hydrolysis Effects 0.000 claims abstract description 8
- 238000006460 hydrolysis reaction Methods 0.000 claims abstract description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 8
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- WLFXSECCHULRRO-UHFFFAOYSA-N pyridine-2,6-diol Chemical compound OC1=CC=CC(O)=N1 WLFXSECCHULRRO-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000005023 xylyl group Chemical group 0.000 claims abstract description 5
- 239000000985 reactive dye Substances 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 14
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 8
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 125000003944 tolyl group Chemical group 0.000 claims description 3
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 claims description 2
- JIIMOVYMGNFUEF-UHFFFAOYSA-N 1-cyclohexyl-6-hydroxy-4-methylpyridin-2-one Chemical compound O=C1C=C(C)C=C(O)N1C1CCCCC1 JIIMOVYMGNFUEF-UHFFFAOYSA-N 0.000 claims description 2
- RWBLSVPYDPODTR-UHFFFAOYSA-N 1-ethyl-6-hydroxy-4-methylpyridin-2-one Chemical compound CCN1C(O)=CC(C)=CC1=O RWBLSVPYDPODTR-UHFFFAOYSA-N 0.000 claims description 2
- UCMWKAYZFDLVIT-UHFFFAOYSA-N 1-ethyl-6-hydroxy-4-phenylpyridin-2-one Chemical compound O=C1N(CC)C(O)=CC(C=2C=CC=CC=2)=C1 UCMWKAYZFDLVIT-UHFFFAOYSA-N 0.000 claims description 2
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 claims description 2
- BFHKYHMCIAMQIN-UHFFFAOYSA-N 2-hydroxy-6-oxo-1h-pyridine-3-carbonitrile Chemical class OC=1NC(=O)C=CC=1C#N BFHKYHMCIAMQIN-UHFFFAOYSA-N 0.000 claims description 2
- UYYJYLJAFBVFJW-UHFFFAOYSA-N 2-hydroxy-6-oxo-1h-pyridine-3-carboxamide Chemical class NC(=O)C=1C=CC(=O)NC=1O UYYJYLJAFBVFJW-UHFFFAOYSA-N 0.000 claims description 2
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 claims description 2
- CKCXMGHYGSKDBF-UHFFFAOYSA-N 6-hydroxy-4-methyl-1-phenylpyridin-2-one Chemical compound O=C1C=C(C)C=C(O)N1C1=CC=CC=C1 CKCXMGHYGSKDBF-UHFFFAOYSA-N 0.000 claims description 2
- 229920002972 Acrylic fiber Polymers 0.000 claims description 2
- KQSNUGQWKSCCFF-UHFFFAOYSA-N C(CCCCCCCCCCCCCCCC)N1C(C=C(C=C1O)C)=O Chemical compound C(CCCCCCCCCCCCCCCC)N1C(C=C(C=C1O)C)=O KQSNUGQWKSCCFF-UHFFFAOYSA-N 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 229910021529 ammonia Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- ZSUMNJYQUKCOBV-UHFFFAOYSA-N chembl1469934 Chemical compound CCN1C(O)=CC(C)=C(C#N)C1=O ZSUMNJYQUKCOBV-UHFFFAOYSA-N 0.000 claims description 2
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 claims description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical class OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 claims description 2
- 150000002168 ethanoic acid esters Chemical class 0.000 claims description 2
- 125000000623 heterocyclic group Chemical class 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 239000000155 melt Substances 0.000 claims description 2
- 238000002844 melting Methods 0.000 claims description 2
- 230000008018 melting Effects 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 229920000728 polyester Polymers 0.000 claims description 2
- 239000002244 precipitate Substances 0.000 claims description 2
- 239000000047 product Substances 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 2
- 235000013312 flour Nutrition 0.000 claims 1
- 235000011149 sulphuric acid Nutrition 0.000 abstract 3
- -1 nitro- Chemical class 0.000 abstract 2
- 125000005425 toluyl group Chemical group 0.000 abstract 2
- 238000005903 acid hydrolysis reaction Methods 0.000 abstract 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1043070 | 1970-03-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH563980A5 true CH563980A5 (en) | 1975-07-15 |
Family
ID=9967693
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1084273A CH563980A5 (en) | 1970-03-04 | 1970-09-15 | Hydroxypyridone derivatives azo dye coup - ling components |
Country Status (2)
| Country | Link |
|---|---|
| CH (1) | CH563980A5 (enExample) |
| CS (1) | CS164873B2 (enExample) |
-
1970
- 1970-09-02 CS CS601170A patent/CS164873B2/cs unknown
- 1970-09-15 CH CH1084273A patent/CH563980A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CS164873B2 (enExample) | 1975-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH563980A5 (en) | Hydroxypyridone derivatives azo dye coup - ling components | |
| DE658114C (de) | Verfahren zur Darstellung von Abkoemmlingen des im Pyridonring phenylierten 1, 9-N-Methylanthrapyridons oder seiner 4-Brom- bzw. 4-Chlorverbindung | |
| DE1644192A1 (de) | Chrom-Mischkomplex-Azofarbstoffe | |
| DE946170C (de) | Verfahren zur Herstellung kobalthaltiger Azofarbstoffe der Acylacetylaminoalkanreihe | |
| DE1101659B (de) | Verfahren zur Herstellung von metallhaltigen Monoazofarbstoffen | |
| DE1147701B (de) | Verfahren zur Herstellung von Metallkomplexverbindungen von Monoazofarbstoffen | |
| AT375638B (de) | Verfahren zur herstellung von neuen 2-amino-3 -(alkylthiobenzoyl)-phenylessigsaeuren, ihren alkylestern und metallsalzen | |
| AT165310B (de) | Verfahren zur Herstellung neuer Monoazofarbstoffe der Pyrazolonreihe | |
| AT200688B (de) | Verfahren zur Herstellung von neuen Küpenfarbstoffender Anthrachinon-naphthcarbazolreihe und deren Halogenierungsprodukten | |
| DE878687C (de) | Verfahren zur Herstellung von Phthalocyaninfarbstoffen | |
| DE936350C (de) | Verfahren zur Herstellung von Mono- oder Polyazofarbstoffen | |
| AT43882B (de) | Verfahren zur Darstellung der Alkylpseudoisatine. | |
| AT211830B (de) | Verfahren zur Herstellung von Thiophencarbonsäuren und deren Derivaten | |
| DE2320062A1 (de) | Verfahren zur herstellung von 1,4diaminoanthrachinon-2,3-dicarbonsaeureimid | |
| CH292677A (de) | Verfahren zur Herstellung eines neuen Monoazofarbstoffes. | |
| CH292676A (de) | Verfahren zur Herstellung eines neuen Monoazofarbstoffes. | |
| CH299928A (de) | Verfahren zur Herstellung eines Isoindoleninderivates. | |
| CH204849A (de) | Verfahren zur Herstellung eines kupferkomplexhaltigen Stilbenazofarbstoffes. | |
| CH330000A (de) | Verfahren zur Herstellung chromhaltiger Azofarbstoffe der Pyrazolonreihe | |
| CH266371A (de) | Verfahren zur Herstellung einer Oxyverbindung der Benzoxanthenreihe. | |
| CH166226A (de) | Verfahren zur Herstellung eines neuen indigoiden Farbstoffes. | |
| CH312571A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes | |
| CH320132A (de) | Verfahren zur Herstellung neuer Ester | |
| DE1139225B (de) | Verfahren zur Herstellung von Phthalocyaninfarbstoffen | |
| CH329621A (de) | Verfahren zur Herstellung chromhaltiger Azofarbstoffe der Pyrazolonreihe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |