CH493535A - Verfahren zur Herstellung von Pyrazinoylguanidinen und Pyrazinamidoguanidinen - Google Patents
Verfahren zur Herstellung von Pyrazinoylguanidinen und PyrazinamidoguanidinenInfo
- Publication number
- CH493535A CH493535A CH803467A CH803467A CH493535A CH 493535 A CH493535 A CH 493535A CH 803467 A CH803467 A CH 803467A CH 803467 A CH803467 A CH 803467A CH 493535 A CH493535 A CH 493535A
- Authority
- CH
- Switzerland
- Prior art keywords
- sep
- diamino
- lower alkyl
- guanidine
- guanidines
- Prior art date
Links
- -1 pyrazinamido Chemical group 0.000 title claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 38
- 238000000034 method Methods 0.000 claims abstract description 27
- 239000002253 acid Substances 0.000 claims abstract description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 7
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 5
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 3
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 34
- 239000000460 chlorine Substances 0.000 claims description 29
- 239000000047 product Substances 0.000 claims description 18
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 17
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 17
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 13
- 239000003153 chemical reaction reagent Substances 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 8
- 239000011707 mineral Substances 0.000 claims description 8
- 150000002357 guanidines Chemical class 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- XSDQTOBWRPYKKA-UHFFFAOYSA-N amiloride Chemical compound NC(=N)NC(=O)C1=NC(Cl)=C(N)N=C1N XSDQTOBWRPYKKA-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000003368 amide group Chemical group 0.000 claims 2
- RXMUPNVSYKGKMY-UHFFFAOYSA-N 3-amino-6-chloro-n-(diaminomethylidene)-5-(dimethylamino)pyrazine-2-carboxamide Chemical compound CN(C)C1=NC(N)=C(C(=O)N=C(N)N)N=C1Cl RXMUPNVSYKGKMY-UHFFFAOYSA-N 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 230000001419 dependent effect Effects 0.000 claims 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims 1
- 239000013067 intermediate product Substances 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 abstract description 5
- 150000002367 halogens Chemical class 0.000 abstract description 4
- 150000003839 salts Chemical class 0.000 abstract description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 abstract description 2
- 206010030113 Oedema Diseases 0.000 abstract description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract description 2
- 230000029142 excretion Effects 0.000 abstract description 2
- 229910052731 fluorine Inorganic materials 0.000 abstract description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 abstract 1
- 239000002934 diuretic Substances 0.000 abstract 1
- 229940030606 diuretics Drugs 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 abstract 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 229960004198 guanidine Drugs 0.000 description 13
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- KOOBYHRLTYIPTH-UHFFFAOYSA-N methyl 3,5-diamino-6-chloropyrazine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(N)N=C1N KOOBYHRLTYIPTH-UHFFFAOYSA-N 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- UYTQEWLAYXCJEC-UHFFFAOYSA-N 3,5-diamino-6-chloropyrazine-2-carboxamide Chemical compound NC(=O)C1=NC(Cl)=C(N)N=C1N UYTQEWLAYXCJEC-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- AQENTCJPUUSHCK-UHFFFAOYSA-N 3,5-diamino-6-chloropyrazine-2-carbonitrile Chemical compound NC1=NC(N)=C(C#N)N=C1Cl AQENTCJPUUSHCK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- IPEHBUMCGVEMRF-UHFFFAOYSA-N pyrazinecarboxamide Chemical compound NC(=O)C1=CN=CC=N1 IPEHBUMCGVEMRF-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- MFXRQLFBZQMTDP-UHFFFAOYSA-N 3-amino-6-chloro-N-(diaminomethylideneamino)-5-(dimethylamino)pyrazine-2-carboxamide Chemical compound NC=1C(=NC(=C(N1)N(C)C)Cl)C(=O)NNC(=N)N MFXRQLFBZQMTDP-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- KDVNUUWRTDFDHO-UHFFFAOYSA-N ethyl 3,5-diamino-6-chloropyrazine-2-carboximidate hydrochloride Chemical compound Cl.CCOC(=N)c1nc(Cl)c(N)nc1N KDVNUUWRTDFDHO-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- LOGZKMIWSHHDMT-UHFFFAOYSA-N 2-amino-1,1-dimethylguanidine Chemical compound CN(C)C(=N)NN LOGZKMIWSHHDMT-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- FCNLCNVTMZJSTA-UHFFFAOYSA-N 3,5-diamino-6-bromo-N-(diaminomethylideneamino)pyrazine-2-carboxamide Chemical compound NC=1C(=NC(=C(N1)N)Br)C(=O)NNC(=N)N FCNLCNVTMZJSTA-UHFFFAOYSA-N 0.000 description 1
- BHMQVZXIGQOCNL-UHFFFAOYSA-N 3,5-diamino-6-bromo-n-(diaminomethylidene)pyrazine-2-carboxamide Chemical compound NC(N)=NC(=O)C1=NC(Br)=C(N)N=C1N BHMQVZXIGQOCNL-UHFFFAOYSA-N 0.000 description 1
- VXRFHWLUADQJNC-UHFFFAOYSA-N 3,5-diamino-6-bromo-n-(diaminomethylidene)pyrazine-2-carboxamide;hydrochloride Chemical compound Cl.NC(=N)NC(=O)C1=NC(Br)=C(N)N=C1N VXRFHWLUADQJNC-UHFFFAOYSA-N 0.000 description 1
- CVHZLHNTGDMEQJ-UHFFFAOYSA-N 3,5-diamino-6-chloro-n-(diaminomethylideneamino)pyrazine-2-carboxamide Chemical compound NC(N)=NNC(=O)C1=NC(Cl)=C(N)N=C1N CVHZLHNTGDMEQJ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical group CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- ACHKKGDWZVCSNH-UHFFFAOYSA-N amiloride hydrochloride Chemical compound Cl.NC(N)=NC(=O)C1=NC(Cl)=C(N)N=C1N ACHKKGDWZVCSNH-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- IVDQNAQLYWSLTG-UHFFFAOYSA-N methyl 3,5-diamino-6-bromopyrazine-2-carboxylate Chemical compound COC(=O)C1=NC(Br)=C(N)N=C1N IVDQNAQLYWSLTG-UHFFFAOYSA-N 0.000 description 1
- CIJAOZNANCPBRB-UHFFFAOYSA-N methyl 3-amino-6-chloro-5-(dimethylamino)pyrazine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(N(C)C)N=C1N CIJAOZNANCPBRB-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- WNBSDCKJFDZMHT-UHFFFAOYSA-N n-(diaminomethylidene)pyrazine-2-carboxamide Chemical class NC(N)=NC(=O)C1=CN=CC=N1 WNBSDCKJFDZMHT-UHFFFAOYSA-N 0.000 description 1
- USVSPZQIBAJOIQ-UHFFFAOYSA-N n-(diaminomethylideneamino)pyrazine-2-carboxamide Chemical class NC(=N)NNC(=O)C1=CN=CC=N1 USVSPZQIBAJOIQ-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D241/26—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with nitrogen atoms directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Selective Calling Equipment (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US574904A US3328404A (en) | 1966-08-25 | 1966-08-25 | Derivatives of pyrazine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH493535A true CH493535A (de) | 1970-07-15 |
Family
ID=24298126
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH803467A CH493535A (de) | 1966-08-25 | 1967-06-07 | Verfahren zur Herstellung von Pyrazinoylguanidinen und Pyrazinamidoguanidinen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3328404A (enExample) |
| CH (1) | CH493535A (enExample) |
| ES (1) | ES341318A1 (enExample) |
| GB (1) | GB1173342A (enExample) |
| NL (1) | NL6707562A (enExample) |
| NO (1) | NO118108B (enExample) |
| SE (1) | SE324368B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4208413A (en) * | 1977-03-04 | 1980-06-17 | Merck & Co., Inc. | N-Pyrazinecarbonyl-N'-alkoxycarbonyl and N',N"-bis(alkoxycarbonyl)guanidines and processes for preparing same |
| US4246406A (en) * | 1979-03-27 | 1981-01-20 | Merck & Co., Inc. | Heterocyclic substituted pyrazinoylguanidines |
| US4604394A (en) * | 1984-10-01 | 1986-08-05 | Merck & Co., Inc. | Antiarrhythmic compositions and method |
| EP2444120B1 (en) * | 2007-12-10 | 2017-09-27 | Novartis AG | Spirocyclic amiloride analogues as ENac blockers |
-
1966
- 1966-08-25 US US574904A patent/US3328404A/en not_active Expired - Lifetime
-
1967
- 1967-05-31 NL NL6707562A patent/NL6707562A/xx unknown
- 1967-06-01 NO NO168410A patent/NO118108B/no unknown
- 1967-06-02 ES ES341318A patent/ES341318A1/es not_active Expired
- 1967-06-07 CH CH803467A patent/CH493535A/de not_active IP Right Cessation
- 1967-06-07 GB GB26215/67A patent/GB1173342A/en not_active Expired
- 1967-06-09 SE SE8126/67A patent/SE324368B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6707562A (enExample) | 1968-02-26 |
| SE324368B (enExample) | 1970-06-01 |
| GB1173342A (en) | 1969-12-10 |
| US3328404A (en) | 1967-06-27 |
| NO118108B (enExample) | 1969-11-10 |
| ES341318A1 (es) | 1968-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1620035A1 (de) | 3-Amino-5-X-6-halogenpyrazinonitrile und Verfahren zu deren Herstellung | |
| DE69626682T2 (de) | Verfahren zur herstellung von guanidinderivaten, zwischenprodukte dafür und ihre herstellung | |
| CH646156A5 (de) | Schwefelhaltige benzimidazol-derivate und verfahren zu ihrer herstellung. | |
| CH621772A5 (enExample) | ||
| CH493535A (de) | Verfahren zur Herstellung von Pyrazinoylguanidinen und Pyrazinamidoguanidinen | |
| DE2124907A1 (de) | 3 Amino 1,2,4 oxadiazole, Verfahren zu ihrer Herstellung und Arzneipraparate | |
| DE1470070B1 (de) | Verfahren zur Herstellung von Benzimidazolderivaten | |
| DE1695421A1 (de) | Verfahren zur Herstellung von Pyrazinoylguanidinen und Pyrazinamidoguanidinen | |
| DE1618317B2 (de) | Naphthyl- bzw. tetrahydronaphthylformamidine, verfahren zu deren herstellung und diese enthaltende mittel mit anthelmintischer wirksamkeit | |
| DE1545842C3 (de) | Verfahren zur Herstellung von N-substituierten 3-Halogen-benzisothiazoliumhalogeniden | |
| CH529766A (de) | Verfahren zur Herstellung von Aryloxy-isoalkyl- 2-imidazolinen | |
| CH493536A (de) | Verfahren zur Herstellung von 6-Halogenpyrazinoylguanidinen | |
| CH513158A (de) | Verfahren zur Herstellung von Pyrrolinverbindungen | |
| DE862602C (de) | Verfahren zur Herstellung von Halogendiamidinen und ihren Salzen | |
| CH616914A5 (enExample) | ||
| AT252258B (de) | Verfahren zur Herstellung neuer 2-Aryl-alkyl-1-piperazine | |
| DE3702282A1 (de) | 2-cyan-2-oximino-acetamide | |
| AT360007B (de) | Verfahren zur herstellung von 2-(phenylamino)- imidazolin-(2)derivaten und deren salzen | |
| AT258916B (de) | Verfahren zur Herstellung von neuen Alkyl-3-amino-5-chlor-6-X-pyrazinoaten | |
| AT256825B (de) | Verfahren zur Herstellung von neuen heterocyclischen Benzamidoverbindungen und ihren Salzen | |
| DE2427503A1 (de) | Halogenfusarsaeureamide, verfahren zur herstellung derselben und mittel mit einem gehalt derselben | |
| DE2201673C3 (de) | Verfahren zur Herstellung von 3.5- Dinitro-2-amino-benzonitril | |
| AT296316B (de) | Verfahren zur Herstellung von neuen Benzodiazepin-Derivaten und deren N-4-Oxyden | |
| DE2557651A1 (de) | N-aryl-(beta,beta-dihalogen)-acetamidine und verfahren zu ihrer herstellung | |
| DE1944789C3 (de) | Verfahren zur Herstellung von 4-Chlorderivaten der Phenylformamidine und deren Salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |