CH446309A - Verfahren zur Herstellung von Dibenzo-cycloheptenen - Google Patents
Verfahren zur Herstellung von Dibenzo-cycloheptenenInfo
- Publication number
- CH446309A CH446309A CH490863A CH490863A CH446309A CH 446309 A CH446309 A CH 446309A CH 490863 A CH490863 A CH 490863A CH 490863 A CH490863 A CH 490863A CH 446309 A CH446309 A CH 446309A
- Authority
- CH
- Switzerland
- Prior art keywords
- dibenzo
- cycloheptenes
- cycloheptene
- dihydro
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000008508 dibenzocycloheptenes Chemical class 0.000 title description 2
- -1 γ-aminopropylidene Chemical group 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 150000001933 cycloheptenes Chemical class 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 230000008707 rearrangement Effects 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 2
- BZYQZWMEHOOTGM-UHFFFAOYSA-N 11-(3-chloropropylidene)-5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulene Chemical compound C1CC2=CC=CC=C2C(=CCCCl)C2=CC=CC=C21 BZYQZWMEHOOTGM-UHFFFAOYSA-N 0.000 claims 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 1
- 230000031709 bromination Effects 0.000 claims 1
- 238000005893 bromination reaction Methods 0.000 claims 1
- 238000005660 chlorination reaction Methods 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 36
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical compound OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000005576 amination reaction Methods 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- XLBRQXMETXPTTL-UHFFFAOYSA-N 2-(3-chloropropylidene)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene Chemical compound ClCCC=C1C2=C(C=CC3=C1C=CC=C3)C=CC=C2 XLBRQXMETXPTTL-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000007818 Grignard reagent Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000002178 crystalline material Substances 0.000 description 3
- SNVTZAIYUGUKNI-UHFFFAOYSA-N dibenzo[1,2-a:1',2'-e][7]annulen-11-one Chemical compound C1=CC2=CC=CC=C2C(=O)C2=CC=CC=C21 SNVTZAIYUGUKNI-UHFFFAOYSA-N 0.000 description 3
- 150000004795 grignard reagents Chemical class 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 238000001665 trituration Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- GNKCQOOXORIZGS-UHFFFAOYSA-N 11-(3-bromopropylidene)dibenzo[1,2-a:1',2'-e][7]annulene Chemical compound C1=CC2=CC=CC=C2C(=CCCBr)C2=CC=CC=C21 GNKCQOOXORIZGS-UHFFFAOYSA-N 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- LKXYJYDRLBPHRS-UHFFFAOYSA-N bromocyclopropane Chemical compound BrC1CC1 LKXYJYDRLBPHRS-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- ZXIJMRYMVAMXQP-UHFFFAOYSA-N cycloheptene Chemical compound C1CCC=CCC1 ZXIJMRYMVAMXQP-UHFFFAOYSA-N 0.000 description 2
- QPJORFLSOJAUNL-UHFFFAOYSA-N dibenzo[a,d][7]annulene Chemical class C1=CC2=CC=CC=C2CC2=CC=CC=C21 QPJORFLSOJAUNL-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- VFZXMEQGIIWBFJ-UHFFFAOYSA-M magnesium;cyclopropane;bromide Chemical compound [Mg+2].[Br-].C1C[CH-]1 VFZXMEQGIIWBFJ-UHFFFAOYSA-M 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000005297 pyrex Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- BWDWSCGQEMSUQL-UHFFFAOYSA-N 1-ethoxy-4-[2-(4-ethylphenyl)ethynyl]benzene Chemical compound C1=CC(OCC)=CC=C1C#CC1=CC=C(CC)C=C1 BWDWSCGQEMSUQL-UHFFFAOYSA-N 0.000 description 1
- UZMPCPFDZYTEJG-UHFFFAOYSA-N 3-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)propyl-methylazanium;chloride Chemical compound Cl.C1=CC2=CC=CC=C2C(=CCCNC)C2=CC=CC=C21 UZMPCPFDZYTEJG-UHFFFAOYSA-N 0.000 description 1
- MGGVALXERJRIRO-UHFFFAOYSA-N 4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-2-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-1H-pyrazol-5-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)O MGGVALXERJRIRO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical class [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101100129500 Caenorhabditis elegans max-2 gene Proteins 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- VXEAYBOGHINOKW-UHFFFAOYSA-N cyclobenzaprine hydrochloride Chemical compound Cl.C1=CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 VXEAYBOGHINOKW-UHFFFAOYSA-N 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- WJFOWHGZSALYEC-UHFFFAOYSA-N dibenzo[1,2-d:1',2'-g][7]annulen-5-one Chemical class O=C1C=CC2=CC=CC=C2C2=CC=CC=C12 WJFOWHGZSALYEC-UHFFFAOYSA-N 0.000 description 1
- ZJULYDCRWUEPTK-UHFFFAOYSA-N dichloromethyl Chemical compound Cl[CH]Cl ZJULYDCRWUEPTK-UHFFFAOYSA-N 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002496 iodine Chemical class 0.000 description 1
- 206010025482 malaise Diseases 0.000 description 1
- 230000003340 mental effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US188873A US3272864A (en) | 1962-04-19 | 1962-04-19 | Process for preparing 5-(3-aminopropylidene)-5h-dibenzo [a, d] cycloheptene and 5h-dibenzo [a, d]-10, 11-dihydro-cycloheptene derivatives |
| US356346A US3329728A (en) | 1962-04-19 | 1964-02-10 | Process and intermediates for the preparation of dibenzo[a, d] cycloheptenes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH446309A true CH446309A (de) | 1967-11-15 |
Family
ID=26884535
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH490863A CH446309A (de) | 1962-04-19 | 1963-04-19 | Verfahren zur Herstellung von Dibenzo-cycloheptenen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3329728A (cg-RX-API-DMAC10.html) |
| BR (1) | BR6348552D0 (cg-RX-API-DMAC10.html) |
| CH (1) | CH446309A (cg-RX-API-DMAC10.html) |
| DK (2) | DK112654B (cg-RX-API-DMAC10.html) |
| FI (1) | FI41019B (cg-RX-API-DMAC10.html) |
| GB (3) | GB1039374A (cg-RX-API-DMAC10.html) |
| NL (1) | NL291744A (cg-RX-API-DMAC10.html) |
| NO (1) | NO118106B (cg-RX-API-DMAC10.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3832405A (en) * | 1970-05-18 | 1974-08-27 | American Home Prod | 5-cycloalkylidene dibenzocycloheptene derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL270132A (cg-RX-API-DMAC10.html) * | 1960-10-12 | |||
| US3189657A (en) * | 1960-11-03 | 1965-06-15 | Lilly Co Eli | 5-(3-bromopropylidene) dibenzo-[a, d] cyclohepta (1.4)diene |
-
0
- NL NL291744D patent/NL291744A/xx unknown
-
1963
- 1963-04-17 GB GB31825/65A patent/GB1039374A/en not_active Expired
- 1963-04-17 GB GB31826/65A patent/GB1039375A/en not_active Expired
- 1963-04-17 GB GB15086/63A patent/GB1039373A/en not_active Expired
- 1963-04-18 DK DK182163AA patent/DK112654B/da unknown
- 1963-04-18 FI FI0770/63A patent/FI41019B/fi active
- 1963-04-18 NO NO148342A patent/NO118106B/no unknown
- 1963-04-19 CH CH490863A patent/CH446309A/de unknown
- 1963-04-19 BR BR148552/63A patent/BR6348552D0/pt unknown
-
1964
- 1964-02-10 US US356346A patent/US3329728A/en not_active Expired - Lifetime
- 1964-09-29 DK DK478664AA patent/DK112167B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK112167B (da) | 1968-11-18 |
| US3329728A (en) | 1967-07-04 |
| FI41019B (cg-RX-API-DMAC10.html) | 1969-04-30 |
| GB1039373A (en) | 1966-08-17 |
| NL291744A (cg-RX-API-DMAC10.html) | |
| NO118106B (cg-RX-API-DMAC10.html) | 1969-11-10 |
| GB1039375A (en) | 1966-08-17 |
| BR6348552D0 (pt) | 1973-07-17 |
| GB1039374A (en) | 1966-08-17 |
| DK112654B (da) | 1969-01-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2635853C2 (de) | Pyrrolidin-2-on-Derivate und diese enthaltende Arzneimittel | |
| DE1620024C3 (de) | 3'-Pyridylmethyl-2-(4-chlorphenoxy)-2-methylpropionat | |
| DE1795744A1 (de) | 5-substituierte azadibenzocycloheptene und verfahren zu ihrer herstellung | |
| DE2011806A1 (de) | Neue trieyclisehe Verbindungen | |
| DE2310031B2 (de) | 1 -Benzyl-1 H-indazol-3-carbonsäuren, -amide und -ester | |
| DE1906527B2 (de) | Thioninderivate, Verfahren zu deren Herstellung und pharmazeutische Präparate, welche diese enthalten | |
| DE3103372A1 (de) | Neue indanyl-derivate, ihre herstellung und verwendung | |
| CH637405A5 (de) | Verfahren zur herstellung von 17-alpha-pregnanderivaten. | |
| DE1804691A1 (de) | Sulfonsaeure-Produkte | |
| DE2624352C3 (de) | Dibenzo [bfl thiepine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende entzündungshemmende Zubereitungen | |
| CH446309A (de) | Verfahren zur Herstellung von Dibenzo-cycloheptenen | |
| DE2446100A1 (de) | Phenoxyalkancarbonsaeureamide von substituierten thiazolidincarbonsaeuren, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln | |
| DE1695410A1 (de) | Verfahren zur Herstellung von 1-(Thiazolyl-5-alkyl)-4-(pyridyl-2)-piperazinen | |
| DE1158082B (de) | Verfahren zur Herstellung von Alkylendiaminderivaten und deren Salzen | |
| AT252897B (de) | Verfahren zur Herstellung von-5-(γ-Aminopropyliden)-5H-dibenzo[a, d] cycloheptaenverbindungen und ihren Salzen | |
| CH456577A (de) | Verfahren zur Herstellung von Dibenzo-cycloheptenen | |
| DE2302744A1 (de) | Verfahren zur reinigung von roher chenodesoxycholsaeure | |
| DE2410853A1 (de) | Reinigung und trennung von steroidlactonen | |
| DE2821226A1 (de) | Neue 5,6-dihydro-imidazo (5,1-a) isochinolin derivate und verfahren zu deren herstellung | |
| CH513806A (de) | Verfahren zur Herstellung von tricyclischen Verbindungen | |
| DE2639935A1 (de) | Benzoesaeuren und verfahren zu ihrer herstellung | |
| DE938017C (de) | Verfahren zur Herstellung von quaternaeren Ammoniumsalzen von 4-Amino-2-(tert.-amino-alkoxy)-benzoesaeurealkylestern | |
| DE1470160C (de) | 2-Chlor-9-piperazinopropyliden-thioxanthene und ein Verfahren zu ihrer Herstellung | |
| DE1543181C (de) | (Phenox y)-4-chlor-phenylessigsäuren, deren Ester, Amide und Salze und Verfahren zu deren Herstellung | |
| AT359479B (de) | Verfahren zur herstellung von neuen benzoe- saeuren und deren estern und salzen |