CH281901A - Verfahren zur Herstellung eines neuen Tropasäureabkömmlings. - Google Patents
Verfahren zur Herstellung eines neuen Tropasäureabkömmlings.Info
- Publication number
- CH281901A CH281901A CH281901DA CH281901A CH 281901 A CH281901 A CH 281901A CH 281901D A CH281901D A CH 281901DA CH 281901 A CH281901 A CH 281901A
- Authority
- CH
- Switzerland
- Prior art keywords
- tropic acid
- new
- acid derivative
- preparation
- picolyl
- Prior art date
Links
- VBSTXRUAXCTZBQ-UHFFFAOYSA-N 1-hexyl-4-phenylpiperazine Chemical class C1CN(CCCCCC)CCN1C1=CC=CC=C1 VBSTXRUAXCTZBQ-UHFFFAOYSA-N 0.000 title claims description 4
- 238000000034 method Methods 0.000 title claims description 4
- 238000002360 preparation method Methods 0.000 title description 2
- 150000001412 amines Chemical class 0.000 claims description 3
- 239000007859 condensation product Substances 0.000 claims description 3
- OXGQBORIYFGJPM-UHFFFAOYSA-N 3-acetyloxy-2-phenylpropanoic acid Chemical compound CC(=O)OCC(C(O)=O)C1=CC=CC=C1 OXGQBORIYFGJPM-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000000155 melt Substances 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 101150081514 Spef2 gene Proteins 0.000 description 1
- JACRWUWPXAESPB-QMMMGPOBSA-N Tropic acid Natural products OC[C@H](C(O)=O)C1=CC=CC=C1 JACRWUWPXAESPB-QMMMGPOBSA-N 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH281901T | 1950-04-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH281901A true CH281901A (de) | 1952-03-31 |
Family
ID=4483397
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH281901D CH281901A (de) | 1950-04-25 | 1950-04-25 | Verfahren zur Herstellung eines neuen Tropasäureabkömmlings. |
| CH307541D CH307541A (de) | 1950-04-25 | 1952-02-06 | Verfahren zur Herstellung eines Tropasäure-N-(B-picolyl)-N-alkenylamides. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH307541D CH307541A (de) | 1950-04-25 | 1952-02-06 | Verfahren zur Herstellung eines Tropasäure-N-(B-picolyl)-N-alkenylamides. |
Country Status (5)
| Country | Link |
|---|---|
| AT (2) | AT170881B (da) |
| CH (2) | CH281901A (da) |
| DE (1) | DE834102C (da) |
| DK (1) | DK79518C (da) |
| FR (1) | FR1031904A (da) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE961347C (de) * | 1952-02-06 | 1957-04-04 | Hoffmann La Roche | Verfahren zur Herstellung von am Amidstickstoff weiterhin substituierten Tropasaeure-N-(ª‰-picolyl)-amiden |
| DE960634C (de) * | 1952-10-24 | 1957-03-28 | Hoffmann La Roche | Verfahren zur Herstellung von substituierten Tropasaeure-N-(ª†-picolyl)-amiden |
| DE952808C (de) * | 1954-03-05 | 1956-11-22 | Hoffmann La Roche | Verfahren zur Herstellung eines neuen Tropasaeureamides |
| DE965239C (de) * | 1954-04-24 | 1957-06-06 | Hoffmann La Roche | Verfahren zur Herstellung von Tropasaeure-N-alkyl-N-(ª†-picolyl)-amiden |
| DE1058512B (de) * | 1954-09-24 | 1959-06-04 | Hoffmann La Roche | Verfahren zur Herstellung von Methyl-(ª-picolyl)-amin |
| DE1142614B (de) * | 1957-05-31 | 1963-01-24 | Koninklijke Pharma Fab Nv | Verfahren zur Herstellung von Benzhydrylaethern des Tropins, deren Salzen und quaternaeren Ammoniumverbindungen |
| WO2005051894A1 (en) * | 2003-11-25 | 2005-06-09 | Novo Nordisk A/S | Novel salicylic anilides |
-
1950
- 1950-04-25 CH CH281901D patent/CH281901A/de unknown
- 1950-12-29 DE DEH7112A patent/DE834102C/de not_active Expired
-
1951
- 1951-01-03 AT AT170881D patent/AT170881B/de active
- 1951-01-03 DK DK1651A patent/DK79518C/da active
- 1951-01-31 FR FR1031904D patent/FR1031904A/fr not_active Expired
-
1952
- 1952-02-06 CH CH307541D patent/CH307541A/de unknown
- 1952-12-16 AT AT178354D patent/AT178354B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| CH307541A (de) | 1955-05-31 |
| FR1031904A (fr) | 1953-06-29 |
| AT170881B (de) | 1952-04-10 |
| DE834102C (de) | 1952-03-17 |
| DK79518C (da) | 1955-07-11 |
| AT178354B (de) | 1954-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH281901A (de) | Verfahren zur Herstellung eines neuen Tropasäureabkömmlings. | |
| DE1009623B (de) | Verfahren zur Herstellung von ª-oxy-1,2,5,6-tetrahydrobenzylphosphiniger Saeure bzw. deren Alkalisalzen | |
| DE505323C (de) | Verfahren zur Darstellung von N-Oxyaethylderivaten des 2, 4-Diamino-1-oxybenzols und seiner Derivate | |
| DE960634C (de) | Verfahren zur Herstellung von substituierten Tropasaeure-N-(ª†-picolyl)-amiden | |
| CH326012A (de) | Verfahren zur Herstellung eines Tropasäureabkömmlings | |
| AT258910B (de) | Verfahren zur Herstellung von Benzo-dihydro-thiadiazin-Derivaten | |
| DE952808C (de) | Verfahren zur Herstellung eines neuen Tropasaeureamides | |
| AT222648B (de) | Verfahren zur Herstellung von 2-Alkyl-thioisonicotinsäureamiden | |
| DE804324C (de) | Verfahren zur Darstellung von Sulfathioharnstoff | |
| CH304954A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH305317A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH323175A (de) | Verfahren zur Herstellung eines Tropasäureamides | |
| CH306851A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH326362A (de) | Verfahren zur Herstellung von substituierten Tropasäure-N-(y-picolyl)-amiden | |
| CH305328A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH305322A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH306856A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH306843A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH304956A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH306850A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH314571A (de) | Verfahren zur Darstellung eines N-substituierten Tropasäure-N-(y-picolyl)-amides | |
| CH305318A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH306853A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH304940A (de) | Verfahren zur Herstellung eines Kondensationsproduktes. | |
| CH624943A5 (da) |