CH268061A - Fernsehempfänger. - Google Patents
Fernsehempfänger.Info
- Publication number
- CH268061A CH268061A CH268061DA CH268061A CH 268061 A CH268061 A CH 268061A CH 268061D A CH268061D A CH 268061DA CH 268061 A CH268061 A CH 268061A
- Authority
- CH
- Switzerland
- Prior art keywords
- dye
- solution
- azo
- water
- remainder
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 12
- 230000008878 coupling Effects 0.000 claims description 10
- 238000010168 coupling process Methods 0.000 claims description 10
- 238000005859 coupling reaction Methods 0.000 claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 9
- 229910052804 chromium Inorganic materials 0.000 claims description 8
- 239000011651 chromium Substances 0.000 claims description 8
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 7
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 7
- 238000004043 dyeing Methods 0.000 claims description 7
- -1 cobalt complex compounds Chemical class 0.000 claims description 6
- 150000002790 naphthalenes Chemical class 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 4
- 239000000987 azo dye Substances 0.000 claims description 4
- 150000008049 diazo compounds Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 239000004753 textile Substances 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 48
- 239000000975 dye Substances 0.000 description 46
- 239000000243 solution Substances 0.000 description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- 235000011121 sodium hydroxide Nutrition 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 229920000742 Cotton Polymers 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 8
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- 241000219422 Urtica Species 0.000 description 7
- 235000009108 Urtica dioica Nutrition 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 239000004202 carbamide Substances 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 6
- 235000002639 sodium chloride Nutrition 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 5
- 150000004700 cobalt complex Chemical class 0.000 description 5
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 239000002562 thickening agent Substances 0.000 description 5
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 229940072056 alginate Drugs 0.000 description 4
- 235000010443 alginic acid Nutrition 0.000 description 4
- 229920000615 alginic acid Polymers 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000001103 potassium chloride Substances 0.000 description 4
- 235000011164 potassium chloride Nutrition 0.000 description 4
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 3
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Natural products CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229920000297 Rayon Polymers 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229940044175 cobalt sulfate Drugs 0.000 description 3
- 229910000361 cobalt sulfate Inorganic materials 0.000 description 3
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000002964 rayon Substances 0.000 description 3
- 239000012266 salt solution Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000002791 soaking Methods 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- HTYRTGGIOAMLRR-UHFFFAOYSA-N 5-amino-4-hydroxybenzene-1,3-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1O HTYRTGGIOAMLRR-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- TUSJRDBEWGCRLN-UHFFFAOYSA-N 1-aminoethanol;sulfuric acid Chemical compound [H+].CC([NH3+])O.[O-]S([O-])(=O)=O TUSJRDBEWGCRLN-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- FMKMKBLHMONXJM-UHFFFAOYSA-N 5-methyl-2-phenylpyrazol-3-amine Chemical compound N1=C(C)C=C(N)N1C1=CC=CC=C1 FMKMKBLHMONXJM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000001049 brown dye Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- WSYUEVRAMDSJKL-UHFFFAOYSA-N ethanolamine-o-sulfate Chemical compound NCCOS(O)(=O)=O WSYUEVRAMDSJKL-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 239000000434 metal complex dye Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- UFWWAKOWSBGGCP-UHFFFAOYSA-N pyridine;sulfurochloridic acid Chemical compound OS(Cl)(=O)=O.C1=CC=NC=C1 UFWWAKOWSBGGCP-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229940032147 starch Drugs 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N11/00—Colour television systems
- H04N11/06—Transmission systems characterised by the manner in which the individual colour picture signal components are combined
- H04N11/08—Transmission systems characterised by the manner in which the individual colour picture signal components are combined using sequential signals only
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/04—Synchronising
- H04N5/06—Generation of synchronising signals
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/04—Synchronising
- H04N5/06—Generation of synchronising signals
- H04N5/067—Arrangements or circuits at the transmitter end
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Color Television Systems (AREA)
- Closed-Circuit Television Systems (AREA)
- Image Analysis (AREA)
- Measurement Of Predetermined Time Intervals (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US572696A US2465371A (en) | 1945-01-13 | 1945-01-13 | Color television |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH268061A true CH268061A (de) | 1950-04-30 |
Family
ID=24288960
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH268061D CH268061A (de) | 1945-01-13 | 1946-01-11 | Fernsehempfänger. |
| CH268060D CH268060A (de) | 1945-01-13 | 1946-01-11 | Fernsehsender. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH268060D CH268060A (de) | 1945-01-13 | 1946-01-11 | Fernsehsender. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2465371A (enExample) |
| BE (1) | BE469506A (enExample) |
| CH (2) | CH268061A (enExample) |
| ES (1) | ES172125A1 (enExample) |
| FR (1) | FR924944A (enExample) |
| GB (1) | GB650666A (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2543015A (en) * | 1945-09-27 | 1951-02-27 | Standard Telephones Cables Ltd | Receiver circuit |
| BE469699A (enExample) * | 1945-09-27 | |||
| GB621479A (en) * | 1945-10-12 | 1949-04-11 | Dennis Illingworth Lawson | Improvements in or relating to television systems |
| US2516972A (en) * | 1947-11-12 | 1950-08-01 | Belmont Radio Corp | Video signal generator |
| US2527967A (en) * | 1947-11-12 | 1950-10-31 | Rca Corp | Multiplex transmission of television signals |
| US2680152A (en) * | 1949-01-14 | 1954-06-01 | Philco Corp | Pulse communication system |
| US2632046A (en) * | 1950-01-12 | 1953-03-17 | Rca Corp | Electronic switch |
| US2683768A (en) * | 1950-02-01 | 1954-07-13 | Rca Corp | Multiplexing system synchronization |
| US2728812A (en) * | 1950-02-11 | 1955-12-27 | Rca Corp | Synchronizing system |
| US2757227A (en) * | 1950-04-20 | 1956-07-31 | Rca Corp | Color television system |
| US2759433A (en) * | 1951-12-13 | 1956-08-21 | Henry E Szadziewicz | Apparatus for making dumplings |
| US2824908A (en) * | 1952-08-07 | 1958-02-25 | Du Mont Allen B Lab Inc | Television system method and apparatus for multiplex signaling |
| US2751431A (en) * | 1953-06-16 | 1956-06-19 | Rca Corp | Color television signalling apparatus |
| US3087011A (en) * | 1960-02-29 | 1963-04-23 | Philco Corp | Color television system |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2109540A (en) * | 1931-06-06 | 1938-03-01 | Le Roy J Leishman | Means and method of coloring lightformed images |
| US2261762A (en) * | 1937-04-02 | 1941-11-04 | Hazeltine Corproation | Interlaced scanning system |
| BE475931A (enExample) * | 1939-04-03 | |||
| US2406760A (en) * | 1940-09-17 | 1946-09-03 | Columbia Broadcasting Syst Inc | Color television |
| US2309506A (en) * | 1941-03-07 | 1943-01-26 | Farnsworth Television & Radio | Color television system |
| US2306386A (en) * | 1941-04-30 | 1942-12-29 | Columbia Broadcasting Syst Inc | Electronic apparatus |
| US2301521A (en) * | 1941-07-17 | 1942-11-10 | Farnsworth Television & Radio | Color television system |
| US2319789A (en) * | 1941-10-03 | 1943-05-25 | Chambers Torrcnce Harrison | Television |
-
0
- BE BE469506D patent/BE469506A/xx unknown
-
1945
- 1945-01-13 US US572696A patent/US2465371A/en not_active Expired - Lifetime
- 1945-11-26 GB GB31820/45A patent/GB650666A/en not_active Expired
-
1946
- 1946-01-10 ES ES0172125A patent/ES172125A1/es not_active Expired
- 1946-01-11 CH CH268061D patent/CH268061A/de unknown
- 1946-01-11 CH CH268060D patent/CH268060A/de unknown
- 1946-01-12 FR FR924944D patent/FR924944A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB650666A (en) | 1951-02-28 |
| US2465371A (en) | 1949-03-29 |
| ES172125A1 (es) | 1946-02-16 |
| BE469506A (enExample) | |
| FR924944A (fr) | 1947-08-20 |
| CH268060A (de) | 1950-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH268061A (de) | Fernsehempfänger. | |
| CH338660A (de) | Elastische Abdichtung an Wälzlager | |
| DE1444667C3 (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE2729011A1 (de) | Reaktivfarbstoffe | |
| DE1046220B (de) | Verfahren zur Herstellung von Monoazofarbstoffen und deren Metallkomplexverbindungen | |
| DE1292271B (de) | Verfahren zur Herstellung von chrom- oder kobalthaltigen Azofarbstoffen | |
| DE1795175A1 (de) | Verfahren zur Herstellung von wasserloeslichen Disazofarbstoffen | |
| DE1058467B (de) | Verfahren zum Faerben von Fasermaterial aus nativer oder regenerierter Cellulose undPraeparate dazu | |
| DE1419808A1 (de) | Farbstoffe,Verfahren zu ihrer Herstellung und Verwendung | |
| DE1644366B1 (de) | Verfahren zur Herstellung von metallhaltigen wasserloeslichen Pyrimidinreaktiv-Azofarbstoffen | |
| DE1544454A1 (de) | Verfahren zur Herstellung neuer Azofarbstoffe | |
| DE1127322C2 (de) | Verfahren zum Faerben und Bedrucken von Cellulosetextilmaterialien | |
| DE1904112C3 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben oder Bedrucken von Textilmaterial | |
| DE1289211B (de) | Verfahren zur Herstellung metallhaltiger Azofarbstoffe | |
| CH495564A (de) | Filmprojektor mit einem Filmschaltwerk | |
| DE1242553B (de) | Verfahren zur Herstellung von echten Faerbungen oder Drucken auf Fasern oder Geweben aus natuerlicher oder regenerierter Cellulose | |
| DE1544543C3 (de) | Wasserlösliche Metallkomplexazofarbstoffe, Verfahren zu ihrer Herstellung und ihrer Verwendung | |
| DE1444640C3 (de) | Verfahren zur Herstellung von Azoreaktivfarbstoffen | |
| AT220739B (de) | Verfahren zur Herstellung von neuen Farbstoffen | |
| DE1085987B (de) | Verfahren zur Herstellung metallhaltiger Monoazofarbstoffe | |
| AT219553B (de) | Verfahren zum Färben und Bedrucken Hydroxylgruppen bzw. Amidgruppen enthaltender Materialien | |
| DE1469698C (de) | Verfahren zum Färben und Bedrucken hydroxylgruppenhaltiger Materialien. Ausscheidung aus: 1186160 | |
| DE2060081C3 (de) | Kupferhaltige Monoazofarbstoffe, Verfahren zu ihrer Herstellung und hre Verwendung | |
| AT162618B (de) | Verfahren zur Herstellung neuer Tetrakisazofarbstoffe | |
| AT202103B (de) | Verfahren zum Färben und Drucken von aus Cellulose bestehenden Textilmaterialien |