CA3001014A1 - Mrna cap analogs and methods of mrna capping - Google Patents
Mrna cap analogs and methods of mrna capping Download PDFInfo
- Publication number
- CA3001014A1 CA3001014A1 CA3001014A CA3001014A CA3001014A1 CA 3001014 A1 CA3001014 A1 CA 3001014A1 CA 3001014 A CA3001014 A CA 3001014A CA 3001014 A CA3001014 A CA 3001014A CA 3001014 A1 CA3001014 A1 CA 3001014A1
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- compound
- halo
- optionally substituted
- independently
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 238000000034 method Methods 0.000 title claims abstract description 81
- 108020004999 messenger RNA Proteins 0.000 title abstract description 44
- 238000013518 transcription Methods 0.000 claims abstract description 18
- 230000035897 transcription Effects 0.000 claims abstract description 18
- 102000040430 polynucleotide Human genes 0.000 claims description 264
- 108091033319 polynucleotide Proteins 0.000 claims description 264
- 239000002157 polynucleotide Substances 0.000 claims description 261
- -1 and T1 is H Chemical group 0.000 claims description 208
- 150000001875 compounds Chemical class 0.000 claims description 205
- 125000003729 nucleotide group Chemical group 0.000 claims description 198
- 239000002773 nucleotide Substances 0.000 claims description 187
- 229910052757 nitrogen Inorganic materials 0.000 claims description 175
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 160
- 125000005843 halogen group Chemical group 0.000 claims description 125
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 124
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 79
- 125000003545 alkoxy group Chemical group 0.000 claims description 73
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical class O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 claims description 73
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 60
- 125000001424 substituent group Chemical group 0.000 claims description 54
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 51
- 150000003839 salts Chemical class 0.000 claims description 46
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 39
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 36
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 36
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 35
- 230000027455 binding Effects 0.000 claims description 32
- 229910052799 carbon Inorganic materials 0.000 claims description 32
- 125000000623 heterocyclic group Chemical group 0.000 claims description 32
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 27
- 108060002636 Eukaryotic Initiation Factor-4E Proteins 0.000 claims description 25
- 102000005233 Eukaryotic Initiation Factor-4E Human genes 0.000 claims description 24
- 125000001072 heteroaryl group Chemical group 0.000 claims description 24
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 23
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 22
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 22
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 19
- 125000000041 C6-C10 aryl group Chemical group 0.000 claims description 17
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 15
- 238000000338 in vitro Methods 0.000 claims description 14
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 13
- 125000006242 amine protecting group Chemical group 0.000 claims description 13
- 125000004043 oxo group Chemical group O=* 0.000 claims description 13
- 229910052760 oxygen Inorganic materials 0.000 claims description 13
- 108090000626 DNA-directed RNA polymerases Proteins 0.000 claims description 11
- 102000004163 DNA-directed RNA polymerases Human genes 0.000 claims description 11
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 7
- 239000000872 buffer Substances 0.000 claims description 7
- 125000005545 phthalimidyl group Chemical group 0.000 claims description 7
- 238000002198 surface plasmon resonance spectroscopy Methods 0.000 claims description 7
- 230000002194 synthesizing effect Effects 0.000 claims description 7
- 125000004104 aryloxy group Chemical group 0.000 claims description 5
- 230000001413 cellular effect Effects 0.000 claims description 5
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical group O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 claims description 5
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 4
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 4
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims description 4
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 4
- 239000003161 ribonuclease inhibitor Substances 0.000 claims description 4
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 claims description 3
- XCUAIINAJCDIPM-XVFCMESISA-N N(4)-hydroxycytidine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=NO)C=C1 XCUAIINAJCDIPM-XVFCMESISA-N 0.000 claims description 3
- 101710141795 Ribonuclease inhibitor Proteins 0.000 claims description 3
- 229940122208 Ribonuclease inhibitor Drugs 0.000 claims description 3
- 102100037968 Ribonuclease inhibitor Human genes 0.000 claims description 3
- 239000011800 void material Substances 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 9
- 238000013519 translation Methods 0.000 abstract description 28
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 183
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 117
- 210000004027 cell Anatomy 0.000 description 106
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 74
- OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical class NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 68
- 239000002777 nucleoside Substances 0.000 description 60
- 125000000217 alkyl group Chemical group 0.000 description 55
- 108090000623 proteins and genes Proteins 0.000 description 53
- 125000003118 aryl group Chemical group 0.000 description 50
- 102000004169 proteins and genes Human genes 0.000 description 48
- 239000000203 mixture Substances 0.000 description 47
- 230000014616 translation Effects 0.000 description 46
- 229940035893 uracil Drugs 0.000 description 44
- 108091034117 Oligonucleotide Proteins 0.000 description 42
- 235000018102 proteins Nutrition 0.000 description 42
- 102000039446 nucleic acids Human genes 0.000 description 39
- 108020004707 nucleic acids Proteins 0.000 description 39
- 235000002639 sodium chloride Nutrition 0.000 description 38
- 108090000765 processed proteins & peptides Proteins 0.000 description 37
- 108020003589 5' Untranslated Regions Proteins 0.000 description 36
- 229960000643 adenine Drugs 0.000 description 35
- 230000004048 modification Effects 0.000 description 35
- 238000012986 modification Methods 0.000 description 35
- 150000007523 nucleic acids Chemical class 0.000 description 35
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 34
- 229940104302 cytosine Drugs 0.000 description 34
- 102000004196 processed proteins & peptides Human genes 0.000 description 31
- 229930024421 Adenine Natural products 0.000 description 30
- 125000003835 nucleoside group Chemical group 0.000 description 30
- 229920001184 polypeptide Polymers 0.000 description 30
- 150000003833 nucleoside derivatives Chemical class 0.000 description 29
- 235000000346 sugar Nutrition 0.000 description 29
- 125000000304 alkynyl group Chemical group 0.000 description 28
- 125000003342 alkenyl group Chemical group 0.000 description 26
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 26
- 230000015556 catabolic process Effects 0.000 description 26
- 238000006731 degradation reaction Methods 0.000 description 26
- PTJWIQPHWPFNBW-GBNDHIKLSA-N pseudouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CNC(=O)NC1=O PTJWIQPHWPFNBW-GBNDHIKLSA-N 0.000 description 26
- 229930185560 Pseudouridine Natural products 0.000 description 25
- PTJWIQPHWPFNBW-UHFFFAOYSA-N Pseudouridine C Natural products OC1C(O)C(CO)OC1C1=CNC(=O)NC1=O PTJWIQPHWPFNBW-UHFFFAOYSA-N 0.000 description 25
- WGDUUQDYDIIBKT-UHFFFAOYSA-N beta-Pseudouridine Natural products OC1OC(CN2C=CC(=O)NC2=O)C(O)C1O WGDUUQDYDIIBKT-UHFFFAOYSA-N 0.000 description 25
- 229920002477 rna polymer Polymers 0.000 description 25
- 125000003282 alkyl amino group Chemical group 0.000 description 24
- DRTQHJPVMGBUCF-XVFCMESISA-N Uridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-XVFCMESISA-N 0.000 description 23
- 125000004429 atom Chemical group 0.000 description 21
- 229940029575 guanosine Drugs 0.000 description 21
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 21
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 21
- NYHBQMYGNKIUIF-UUOKFMHZSA-N Guanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NYHBQMYGNKIUIF-UUOKFMHZSA-N 0.000 description 20
- 229910019142 PO4 Inorganic materials 0.000 description 20
- 230000001965 increasing effect Effects 0.000 description 20
- 230000000670 limiting effect Effects 0.000 description 20
- 239000010452 phosphate Substances 0.000 description 20
- 235000021317 phosphate Nutrition 0.000 description 20
- 108060002716 Exonuclease Proteins 0.000 description 19
- KDCGOANMDULRCW-UHFFFAOYSA-N Purine Natural products N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 19
- 102000013165 exonuclease Human genes 0.000 description 19
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 19
- 229940045145 uridine Drugs 0.000 description 19
- 230000014509 gene expression Effects 0.000 description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 18
- 108091070501 miRNA Proteins 0.000 description 18
- 230000004075 alteration Effects 0.000 description 17
- 238000007385 chemical modification Methods 0.000 description 17
- 108020004414 DNA Proteins 0.000 description 16
- 102000053602 DNA Human genes 0.000 description 16
- HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 description 16
- 229940096913 pseudoisocytidine Drugs 0.000 description 16
- 229910052717 sulfur Inorganic materials 0.000 description 16
- RWQNBRDOKXIBIV-UHFFFAOYSA-N thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 description 16
- 108020005345 3' Untranslated Regions Proteins 0.000 description 15
- 108010033040 Histones Proteins 0.000 description 15
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 15
- 230000008569 process Effects 0.000 description 15
- 238000003786 synthesis reaction Methods 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 14
- HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 description 14
- PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 description 14
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 14
- 230000000295 complement effect Effects 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- 239000008194 pharmaceutical composition Substances 0.000 description 14
- 125000006239 protecting group Chemical group 0.000 description 14
- UVBYMVOUBXYSFV-XUTVFYLZSA-N 1-methylpseudouridine Chemical compound O=C1NC(=O)N(C)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 UVBYMVOUBXYSFV-XUTVFYLZSA-N 0.000 description 13
- ZAYHVCMSTBRABG-UHFFFAOYSA-N 5-Methylcytidine Natural products O=C1N=C(N)C(C)=CN1C1C(O)C(O)C(CO)O1 ZAYHVCMSTBRABG-UHFFFAOYSA-N 0.000 description 13
- ZAYHVCMSTBRABG-JXOAFFINSA-N 5-methylcytidine Chemical compound O=C1N=C(N)C(C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 ZAYHVCMSTBRABG-JXOAFFINSA-N 0.000 description 13
- 108020004684 Internal Ribosome Entry Sites Proteins 0.000 description 13
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 13
- PEHVGBZKEYRQSX-UHFFFAOYSA-N 7-deaza-adenine Chemical compound NC1=NC=NC2=C1C=CN2 PEHVGBZKEYRQSX-UHFFFAOYSA-N 0.000 description 12
- OIRDTQYFTABQOQ-KQYNXXCUSA-N Adenosine Natural products C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 12
- JLCPHMBAVCMARE-UHFFFAOYSA-N [3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate Polymers Cc1cn(C2CC(OP(O)(=O)OCC3OC(CC3OP(O)(=O)OCC3OC(CC3O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c3nc(N)[nH]c4=O)C(COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3CO)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cc(C)c(=O)[nH]c3=O)n3cc(C)c(=O)[nH]c3=O)n3ccc(N)nc3=O)n3cc(C)c(=O)[nH]c3=O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)O2)c(=O)[nH]c1=O JLCPHMBAVCMARE-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- 239000012634 fragment Substances 0.000 description 12
- 125000005842 heteroatom Chemical group 0.000 description 12
- 238000001727 in vivo Methods 0.000 description 12
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 12
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 12
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 12
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 12
- 230000001225 therapeutic effect Effects 0.000 description 12
- UVBYMVOUBXYSFV-UHFFFAOYSA-N 1-methylpseudouridine Natural products O=C1NC(=O)N(C)C=C1C1C(O)C(O)C(CO)O1 UVBYMVOUBXYSFV-UHFFFAOYSA-N 0.000 description 11
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 11
- 238000007792 addition Methods 0.000 description 11
- 229960005305 adenosine Drugs 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 229910052731 fluorine Inorganic materials 0.000 description 11
- 230000008488 polyadenylation Effects 0.000 description 11
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 11
- GJTBSTBJLVYKAU-XVFCMESISA-N 2-thiouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=S)NC(=O)C=C1 GJTBSTBJLVYKAU-XVFCMESISA-N 0.000 description 10
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 10
- 238000003556 assay Methods 0.000 description 10
- DRTQHJPVMGBUCF-PSQAKQOGSA-N beta-L-uridine Natural products O[C@H]1[C@@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-PSQAKQOGSA-N 0.000 description 10
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 10
- 229910000085 borane Inorganic materials 0.000 description 10
- 239000000460 chlorine Substances 0.000 description 10
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 10
- FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical compound O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 description 10
- 229910052740 iodine Inorganic materials 0.000 description 10
- 230000001404 mediated effect Effects 0.000 description 10
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 10
- 102000028499 poly(A) binding Human genes 0.000 description 10
- 108091023021 poly(A) binding Proteins 0.000 description 10
- 239000012453 solvate Substances 0.000 description 10
- 125000006850 spacer group Chemical group 0.000 description 10
- 239000001226 triphosphate Substances 0.000 description 10
- DRTQHJPVMGBUCF-UHFFFAOYSA-N uracil arabinoside Natural products OC1C(O)C(CO)OC1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UHFFFAOYSA-N 0.000 description 10
- AMMRPAYSYYGRKP-BGZDPUMWSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-ethylpyrimidine-2,4-dione Chemical compound O=C1NC(=O)N(CC)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 AMMRPAYSYYGRKP-BGZDPUMWSA-N 0.000 description 9
- ZXIATBNUWJBBGT-JXOAFFINSA-N 5-methoxyuridine Chemical compound O=C1NC(=O)C(OC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 ZXIATBNUWJBBGT-JXOAFFINSA-N 0.000 description 9
- MSSXOMSJDRHRMC-UHFFFAOYSA-N 9H-purine-2,6-diamine Chemical compound NC1=NC(N)=C2NC=NC2=N1 MSSXOMSJDRHRMC-UHFFFAOYSA-N 0.000 description 9
- 102000004190 Enzymes Human genes 0.000 description 9
- 108090000790 Enzymes Proteins 0.000 description 9
- 125000004442 acylamino group Chemical group 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 9
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 9
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 9
- 125000004663 dialkyl amino group Chemical group 0.000 description 9
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 9
- 201000010099 disease Diseases 0.000 description 9
- 229940088598 enzyme Drugs 0.000 description 9
- 125000000524 functional group Chemical group 0.000 description 9
- 229910052736 halogen Inorganic materials 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 238000006467 substitution reaction Methods 0.000 description 9
- ZEMGGZBWXRYJHK-UHFFFAOYSA-N thiouracil Chemical compound O=C1C=CNC(=S)N1 ZEMGGZBWXRYJHK-UHFFFAOYSA-N 0.000 description 9
- HCGHYQLFMPXSDU-UHFFFAOYSA-N 7-methyladenine Chemical compound C1=NC(N)=C2N(C)C=NC2=N1 HCGHYQLFMPXSDU-UHFFFAOYSA-N 0.000 description 8
- DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 8
- 108020004705 Codon Proteins 0.000 description 8
- MIKUYHXYGGJMLM-GIMIYPNGSA-N Crotonoside Natural products C1=NC2=C(N)NC(=O)N=C2N1[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O MIKUYHXYGGJMLM-GIMIYPNGSA-N 0.000 description 8
- NYHBQMYGNKIUIF-UHFFFAOYSA-N D-guanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1OC(CO)C(O)C1O NYHBQMYGNKIUIF-UHFFFAOYSA-N 0.000 description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 8
- 108700026244 Open Reading Frames Proteins 0.000 description 8
- 125000001931 aliphatic group Chemical group 0.000 description 8
- 125000004947 alkyl aryl amino group Chemical group 0.000 description 8
- 125000002877 alkyl aryl group Chemical group 0.000 description 8
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 8
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 8
- 125000001769 aryl amino group Chemical group 0.000 description 8
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 8
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 8
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 8
- 150000007942 carboxylates Chemical class 0.000 description 8
- 125000004986 diarylamino group Chemical group 0.000 description 8
- 150000002367 halogens Chemical class 0.000 description 8
- 230000015788 innate immune response Effects 0.000 description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 8
- 238000003419 tautomerization reaction Methods 0.000 description 8
- 210000001519 tissue Anatomy 0.000 description 8
- FZWGECJQACGGTI-UHFFFAOYSA-N 2-amino-7-methyl-1,7-dihydro-6H-purin-6-one Chemical compound NC1=NC(O)=C2N(C)C=NC2=N1 FZWGECJQACGGTI-UHFFFAOYSA-N 0.000 description 7
- 108091023045 Untranslated Region Proteins 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 7
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 7
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 7
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 7
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 7
- 125000004691 alkyl thio carbonyl group Chemical group 0.000 description 7
- 125000004414 alkyl thio group Chemical group 0.000 description 7
- 125000002947 alkylene group Chemical group 0.000 description 7
- 125000005129 aryl carbonyl group Chemical group 0.000 description 7
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 7
- 125000005110 aryl thio group Chemical group 0.000 description 7
- 125000005200 aryloxy carbonyloxy group Chemical group 0.000 description 7
- 125000002619 bicyclic group Chemical group 0.000 description 7
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 7
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 230000006870 function Effects 0.000 description 7
- 125000002632 imidazolidinyl group Chemical group 0.000 description 7
- 229960003786 inosine Drugs 0.000 description 7
- 125000002757 morpholinyl group Chemical group 0.000 description 7
- 125000000160 oxazolidinyl group Chemical group 0.000 description 7
- 150000004713 phosphodiesters Chemical class 0.000 description 7
- 125000004193 piperazinyl group Chemical group 0.000 description 7
- 125000003386 piperidinyl group Chemical group 0.000 description 7
- 238000012545 processing Methods 0.000 description 7
- 230000004952 protein activity Effects 0.000 description 7
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 7
- 125000004076 pyridyl group Chemical group 0.000 description 7
- 125000000714 pyrimidinyl group Chemical group 0.000 description 7
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 7
- 125000000168 pyrrolyl group Chemical group 0.000 description 7
- 210000003705 ribosome Anatomy 0.000 description 7
- 125000000547 substituted alkyl group Chemical group 0.000 description 7
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 7
- 125000004434 sulfur atom Chemical group 0.000 description 7
- 150000003467 sulfuric acid derivatives Chemical group 0.000 description 7
- 230000008685 targeting Effects 0.000 description 7
- 229940113082 thymine Drugs 0.000 description 7
- 238000001890 transfection Methods 0.000 description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 7
- UJBCLAXPPIDQEE-UHFFFAOYSA-N 5-prop-1-ynyl-1h-pyrimidine-2,4-dione Chemical compound CC#CC1=CNC(=O)NC1=O UJBCLAXPPIDQEE-UHFFFAOYSA-N 0.000 description 6
- LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical compound O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 6
- 108091026890 Coding region Proteins 0.000 description 6
- 241000282412 Homo Species 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- VQAYFKKCNSOZKM-IOSLPCCCSA-N N(6)-methyladenosine Chemical compound C1=NC=2C(NC)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O VQAYFKKCNSOZKM-IOSLPCCCSA-N 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 6
- PYMYPHUHKUWMLA-UHFFFAOYSA-N arabinose Natural products OCC(O)C(O)C(O)C=O PYMYPHUHKUWMLA-UHFFFAOYSA-N 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 238000013461 design Methods 0.000 description 6
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 6
- 125000002883 imidazolyl group Chemical group 0.000 description 6
- 238000010348 incorporation Methods 0.000 description 6
- 125000001786 isothiazolyl group Chemical group 0.000 description 6
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 6
- 125000000842 isoxazolyl group Chemical group 0.000 description 6
- 238000007069 methylation reaction Methods 0.000 description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 6
- 125000002971 oxazolyl group Chemical group 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 125000004430 oxygen atom Chemical group O* 0.000 description 6
- 239000000546 pharmaceutical excipient Substances 0.000 description 6
- 150000008300 phosphoramidites Chemical class 0.000 description 6
- 125000003373 pyrazinyl group Chemical group 0.000 description 6
- 125000003226 pyrazolyl group Chemical group 0.000 description 6
- 125000002098 pyridazinyl group Chemical group 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- 125000000548 ribosyl group Chemical group C1([C@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 6
- RHFUOMFWUGWKKO-UHFFFAOYSA-N s2C Natural products S=C1N=C(N)C=CN1C1C(O)C(O)C(CO)O1 RHFUOMFWUGWKKO-UHFFFAOYSA-N 0.000 description 6
- 125000003831 tetrazolyl group Chemical group 0.000 description 6
- 125000000335 thiazolyl group Chemical group 0.000 description 6
- 125000005310 triazolidinyl group Chemical group N1(NNCC1)* 0.000 description 6
- 235000011178 triphosphate Nutrition 0.000 description 6
- 239000013598 vector Substances 0.000 description 6
- GFYLSDSUCHVORB-IOSLPCCCSA-N 1-methyladenosine Chemical compound C1=NC=2C(=N)N(C)C=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O GFYLSDSUCHVORB-IOSLPCCCSA-N 0.000 description 5
- UTAIYTHAJQNQDW-KQYNXXCUSA-N 1-methylguanosine Chemical compound C1=NC=2C(=O)N(C)C(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O UTAIYTHAJQNQDW-KQYNXXCUSA-N 0.000 description 5
- WJNGQIYEQLPJMN-IOSLPCCCSA-N 1-methylinosine Chemical compound C1=NC=2C(=O)N(C)C=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O WJNGQIYEQLPJMN-IOSLPCCCSA-N 0.000 description 5
- MWBWWFOAEOYUST-UHFFFAOYSA-N 2-aminopurine Chemical compound NC1=NC=C2N=CNC2=N1 MWBWWFOAEOYUST-UHFFFAOYSA-N 0.000 description 5
- SMADWRYCYBUIKH-UHFFFAOYSA-N 2-methyl-7h-purin-6-amine Chemical compound CC1=NC(N)=C2NC=NC2=N1 SMADWRYCYBUIKH-UHFFFAOYSA-N 0.000 description 5
- VZQXUWKZDSEQRR-SDBHATRESA-N 2-methylthio-N(6)-(Delta(2)-isopentenyl)adenosine Chemical compound C12=NC(SC)=NC(NCC=C(C)C)=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O VZQXUWKZDSEQRR-SDBHATRESA-N 0.000 description 5
- HOEIPINIBKBXTJ-IDTAVKCVSA-N 3-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,6,7-trimethylimidazo[1,2-a]purin-9-one Chemical compound C1=NC=2C(=O)N3C(C)=C(C)N=C3N(C)C=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O HOEIPINIBKBXTJ-IDTAVKCVSA-N 0.000 description 5
- BINGDNLMMYSZFR-QYVSTXNMSA-N 3-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,7-dimethyl-5h-imidazo[1,2-a]purin-9-one Chemical compound C1=NC=2C(=O)N3C(C)=C(C)N=C3NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O BINGDNLMMYSZFR-QYVSTXNMSA-N 0.000 description 5
- QUZQVVNSDQCAOL-WOUKDFQISA-N 4-demethylwyosine Chemical compound N1C(C)=CN(C(C=2N=C3)=O)C1=NC=2N3[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O QUZQVVNSDQCAOL-WOUKDFQISA-N 0.000 description 5
- VSCNRXVDHRNJOA-PNHWDRBUSA-N 5-(carboxymethylaminomethyl)uridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(CNCC(O)=O)=C1 VSCNRXVDHRNJOA-PNHWDRBUSA-N 0.000 description 5
- LRSASMSXMSNRBT-UHFFFAOYSA-N 5-methylcytosine Chemical compound CC1=CNC(=O)N=C1N LRSASMSXMSNRBT-UHFFFAOYSA-N 0.000 description 5
- FMKSMYDYKXQYRV-UHFFFAOYSA-N 7-cyano-7-deazaguanine Chemical compound O=C1NC(N)=NC2=C1C(C#N)=CN2 FMKSMYDYKXQYRV-UHFFFAOYSA-N 0.000 description 5
- OGHAROSJZRTIOK-KQYNXXCUSA-O 7-methylguanosine Chemical compound C1=2N=C(N)NC(=O)C=2[N+](C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OGHAROSJZRTIOK-KQYNXXCUSA-O 0.000 description 5
- 241000282414 Homo sapiens Species 0.000 description 5
- UGQMRVRMYYASKQ-UHFFFAOYSA-N Hypoxanthine nucleoside Natural products OC1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 UGQMRVRMYYASKQ-UHFFFAOYSA-N 0.000 description 5
- UGQMRVRMYYASKQ-KQYNXXCUSA-N Inosine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(O)=C2N=C1 UGQMRVRMYYASKQ-KQYNXXCUSA-N 0.000 description 5
- 229930010555 Inosine Natural products 0.000 description 5
- SGSSKEDGVONRGC-UHFFFAOYSA-N N(2)-methylguanine Chemical compound O=C1NC(NC)=NC2=C1N=CN2 SGSSKEDGVONRGC-UHFFFAOYSA-N 0.000 description 5
- 108091093037 Peptide nucleic acid Proteins 0.000 description 5
- JCZSFCLRSONYLH-UHFFFAOYSA-N Wyosine Natural products N=1C(C)=CN(C(C=2N=C3)=O)C=1N(C)C=2N3C1OC(CO)C(O)C1O JCZSFCLRSONYLH-UHFFFAOYSA-N 0.000 description 5
- YXNIEZJFCGTDKV-UHFFFAOYSA-N X-Nucleosid Natural products O=C1N(CCC(N)C(O)=O)C(=O)C=CN1C1C(O)C(O)C(CO)O1 YXNIEZJFCGTDKV-UHFFFAOYSA-N 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- MVCRZALXJBDOKF-JPZHCBQBSA-N beta-hydroxywybutosine 5'-monophosphate Chemical compound C1=NC=2C(=O)N3C(CC(O)[C@H](NC(=O)OC)C(=O)OC)=C(C)N=C3N(C)C=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O MVCRZALXJBDOKF-JPZHCBQBSA-N 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 125000004474 heteroalkylene group Chemical group 0.000 description 5
- 230000014759 maintenance of location Effects 0.000 description 5
- 125000002950 monocyclic group Chemical group 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 230000001105 regulatory effect Effects 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 150000003457 sulfones Chemical class 0.000 description 5
- 150000003462 sulfoxides Chemical group 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 229940104230 thymidine Drugs 0.000 description 5
- 125000001425 triazolyl group Chemical group 0.000 description 5
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 5
- JCZSFCLRSONYLH-QYVSTXNMSA-N wyosin Chemical compound N=1C(C)=CN(C(C=2N=C3)=O)C=1N(C)C=2N3[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O JCZSFCLRSONYLH-QYVSTXNMSA-N 0.000 description 5
- MIXBUOXRHTZHKR-XUTVFYLZSA-N 1-Methylpseudoisocytidine Chemical compound CN1C=C(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O MIXBUOXRHTZHKR-XUTVFYLZSA-N 0.000 description 4
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 4
- BVLGKOVALHRKNM-XUTVFYLZSA-N 2-Thio-1-methylpseudouridine Chemical compound CN1C=C(C(=O)NC1=S)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O BVLGKOVALHRKNM-XUTVFYLZSA-N 0.000 description 4
- CWXIOHYALLRNSZ-JWMKEVCDSA-N 2-Thiodihydropseudouridine Chemical compound C1C(C(=O)NC(=S)N1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O CWXIOHYALLRNSZ-JWMKEVCDSA-N 0.000 description 4
- MPDKOGQMQLSNOF-GBNDHIKLSA-N 2-amino-5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1h-pyrimidin-6-one Chemical compound O=C1NC(N)=NC=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 MPDKOGQMQLSNOF-GBNDHIKLSA-N 0.000 description 4
- JRYMOPZHXMVHTA-DAGMQNCNSA-N 2-amino-7-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1h-pyrrolo[2,3-d]pyrimidin-4-one Chemical compound C1=CC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O JRYMOPZHXMVHTA-DAGMQNCNSA-N 0.000 description 4
- BIRQNXWAXWLATA-IOSLPCCCSA-N 2-amino-7-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxo-1h-pyrrolo[2,3-d]pyrimidine-5-carbonitrile Chemical compound C1=C(C#N)C=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O BIRQNXWAXWLATA-IOSLPCCCSA-N 0.000 description 4
- DXEJZRDJXRVUPN-XUTVFYLZSA-N 3-Methylpseudouridine Chemical compound O=C1N(C)C(=O)NC=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 DXEJZRDJXRVUPN-XUTVFYLZSA-N 0.000 description 4
- FGFVODMBKZRMMW-XUTVFYLZSA-N 4-Methoxy-2-thiopseudouridine Chemical compound COC1=C(C=NC(=S)N1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O FGFVODMBKZRMMW-XUTVFYLZSA-N 0.000 description 4
- HOCJTJWYMOSXMU-XUTVFYLZSA-N 4-Methoxypseudouridine Chemical compound COC1=C(C=NC(=O)N1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O HOCJTJWYMOSXMU-XUTVFYLZSA-N 0.000 description 4
- VTGBLFNEDHVUQA-XUTVFYLZSA-N 4-Thio-1-methyl-pseudouridine Chemical compound S=C1NC(=O)N(C)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 VTGBLFNEDHVUQA-XUTVFYLZSA-N 0.000 description 4
- OIVLITBTBDPEFK-UHFFFAOYSA-N 5,6-dihydrouracil Chemical compound O=C1CCNC(=O)N1 OIVLITBTBDPEFK-UHFFFAOYSA-N 0.000 description 4
- RYVNIFSIEDRLSJ-UHFFFAOYSA-N 5-(hydroxymethyl)cytosine Chemical compound NC=1NC(=O)N=CC=1CO RYVNIFSIEDRLSJ-UHFFFAOYSA-N 0.000 description 4
- DDHOXEOVAJVODV-GBNDHIKLSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CNC(=S)NC1=O DDHOXEOVAJVODV-GBNDHIKLSA-N 0.000 description 4
- BNAWMJKJLNJZFU-GBNDHIKLSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidene-1h-pyrimidin-2-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CNC(=O)NC1=S BNAWMJKJLNJZFU-GBNDHIKLSA-N 0.000 description 4
- QXDXBKZJFLRLCM-UAKXSSHOSA-N 5-hydroxyuridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(O)=C1 QXDXBKZJFLRLCM-UAKXSSHOSA-N 0.000 description 4
- YIZYCHKPHCPKHZ-PNHWDRBUSA-N 5-methoxycarbonylmethyluridine Chemical compound O=C1NC(=O)C(CC(=O)OC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 YIZYCHKPHCPKHZ-PNHWDRBUSA-N 0.000 description 4
- YVVMIGRXQRPSIY-UHFFFAOYSA-N 7-deaza-2-aminopurine Chemical compound N1C(N)=NC=C2C=CN=C21 YVVMIGRXQRPSIY-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- 229960005508 8-azaguanine Drugs 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 102000012605 Cystic Fibrosis Transmembrane Conductance Regulator Human genes 0.000 description 4
- 108010079245 Cystic Fibrosis Transmembrane Conductance Regulator Proteins 0.000 description 4
- YKWUPFSEFXSGRT-JWMKEVCDSA-N Dihydropseudouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1C(=O)NC(=O)NC1 YKWUPFSEFXSGRT-JWMKEVCDSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- 238000008214 LDL Cholesterol Methods 0.000 description 4
- 108091026898 Leader sequence (mRNA) Proteins 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 108091036066 Three prime untranslated region Proteins 0.000 description 4
- 230000001594 aberrant effect Effects 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000000427 antigen Substances 0.000 description 4
- 125000002393 azetidinyl group Chemical group 0.000 description 4
- SRBFZHDQGSBBOR-UHFFFAOYSA-N beta-D-Pyranose-Lyxose Natural products OC1COC(O)C(O)C1O SRBFZHDQGSBBOR-UHFFFAOYSA-N 0.000 description 4
- IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 4
- 229960000684 cytarabine Drugs 0.000 description 4
- 150000001989 diazonium salts Chemical class 0.000 description 4
- ZPTBLXKRQACLCR-XVFCMESISA-N dihydrouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)CC1 ZPTBLXKRQACLCR-XVFCMESISA-N 0.000 description 4
- 150000002009 diols Chemical class 0.000 description 4
- 239000003623 enhancer Substances 0.000 description 4
- 125000001153 fluoro group Chemical group F* 0.000 description 4
- 230000002068 genetic effect Effects 0.000 description 4
- 210000003494 hepatocyte Anatomy 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- GWKIZNPISGBQGY-GNLDREGESA-N methyl (2S)-4-[4,6-dimethyl-9-oxo-3-[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazo[1,2-a]purin-7-yl]-2-(methoxycarbonylamino)butanoate Chemical class O[C@@]1([C@H](O)[C@H](O)[C@@H](CO)O1)N1C=NC=2C(=O)N3C(CC[C@@H](C(=O)OC)NC(=O)OC)=C(C)N=C3N(C)C21 GWKIZNPISGBQGY-GNLDREGESA-N 0.000 description 4
- 101150084874 mimG gene Proteins 0.000 description 4
- 125000003566 oxetanyl group Chemical group 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- 150000003230 pyrimidines Chemical class 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- DWRXFEITVBNRMK-JXOAFFINSA-N ribothymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 DWRXFEITVBNRMK-JXOAFFINSA-N 0.000 description 4
- 241000894007 species Species 0.000 description 4
- 125000003003 spiro group Chemical group 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 125000005415 substituted alkoxy group Chemical group 0.000 description 4
- 230000000153 supplemental effect Effects 0.000 description 4
- 238000010189 synthetic method Methods 0.000 description 4
- 150000003536 tetrazoles Chemical group 0.000 description 4
- 229940124597 therapeutic agent Drugs 0.000 description 4
- 125000002053 thietanyl group Chemical group 0.000 description 4
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 4
- 150000003573 thiols Chemical class 0.000 description 4
- 229960003087 tioguanine Drugs 0.000 description 4
- 230000014621 translational initiation Effects 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- KYJLJOJCMUFWDY-UUOKFMHZSA-N (2r,3r,4s,5r)-2-(6-amino-8-azidopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound [N-]=[N+]=NC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O KYJLJOJCMUFWDY-UUOKFMHZSA-N 0.000 description 3
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 3
- KYEKLQMDNZPEFU-KVTDHHQDSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)N=C1 KYEKLQMDNZPEFU-KVTDHHQDSA-N 0.000 description 3
- MUSPKJVFRAYWAR-XVFCMESISA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)S[C@H]1N1C(=O)NC(=O)C=C1 MUSPKJVFRAYWAR-XVFCMESISA-N 0.000 description 3
- QPHRQMAYYMYWFW-FJGDRVTGSA-N 1-[(2r,3s,4r,5r)-3-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@]1(F)[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 QPHRQMAYYMYWFW-FJGDRVTGSA-N 0.000 description 3
- ZEQIWKHCJWRNTH-UHFFFAOYSA-N 1h-pyrimidine-2,4-dithione Chemical compound S=C1C=CNC(=S)N1 ZEQIWKHCJWRNTH-UHFFFAOYSA-N 0.000 description 3
- NUBJGTNGKODGGX-YYNOVJQHSA-N 2-[5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-1-yl]acetic acid Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CN(CC(O)=O)C(=O)NC1=O NUBJGTNGKODGGX-YYNOVJQHSA-N 0.000 description 3
- LCKIHCRZXREOJU-KYXWUPHJSA-N 2-[[5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-1-yl]methylamino]ethanesulfonic acid Chemical compound C(NCCS(=O)(=O)O)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O LCKIHCRZXREOJU-KYXWUPHJSA-N 0.000 description 3
- TUDKBZAMOFJOSO-UHFFFAOYSA-N 2-methoxy-7h-purin-6-amine Chemical compound COC1=NC(N)=C2NC=NC2=N1 TUDKBZAMOFJOSO-UHFFFAOYSA-N 0.000 description 3
- VWSLLSXLURJCDF-UHFFFAOYSA-N 2-methyl-4,5-dihydro-1h-imidazole Chemical compound CC1=NCCN1 VWSLLSXLURJCDF-UHFFFAOYSA-N 0.000 description 3
- FXGXEFXCWDTSQK-UHFFFAOYSA-N 2-methylsulfanyl-7h-purin-6-amine Chemical compound CSC1=NC(N)=C2NC=NC2=N1 FXGXEFXCWDTSQK-UHFFFAOYSA-N 0.000 description 3
- JUMHLCXWYQVTLL-KVTDHHQDSA-N 2-thio-5-aza-uridine Chemical compound [C@@H]1([C@H](O)[C@H](O)[C@@H](CO)O1)N1C(=S)NC(=O)N=C1 JUMHLCXWYQVTLL-KVTDHHQDSA-N 0.000 description 3
- VRVXMIJPUBNPGH-XVFCMESISA-N 2-thio-dihydrouridine Chemical compound OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1CCC(=O)NC1=S VRVXMIJPUBNPGH-XVFCMESISA-N 0.000 description 3
- ZVGONGHIVBJXFC-WCTZXXKLSA-N 2-thio-zebularine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=S)N=CC=C1 ZVGONGHIVBJXFC-WCTZXXKLSA-N 0.000 description 3
- RHFUOMFWUGWKKO-XVFCMESISA-N 2-thiocytidine Chemical compound S=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 RHFUOMFWUGWKKO-XVFCMESISA-N 0.000 description 3
- YXNIEZJFCGTDKV-JANFQQFMSA-N 3-(3-amino-3-carboxypropyl)uridine Chemical compound O=C1N(CCC(N)C(O)=O)C(=O)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 YXNIEZJFCGTDKV-JANFQQFMSA-N 0.000 description 3
- RDPUKVRQKWBSPK-ZOQUXTDFSA-N 3-methylcytidine Chemical compound O=C1N(C)C(=N)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 RDPUKVRQKWBSPK-ZOQUXTDFSA-N 0.000 description 3
- LQQGJDJXUSAEMZ-UAKXSSHOSA-N 4-amino-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one Chemical compound C1=C(I)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 LQQGJDJXUSAEMZ-UAKXSSHOSA-N 0.000 description 3
- OZHIJZYBTCTDQC-JXOAFFINSA-N 4-amino-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2-thione Chemical compound S=C1N=C(N)C(C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 OZHIJZYBTCTDQC-JXOAFFINSA-N 0.000 description 3
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical compound OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 description 3
- LOICBOXHPCURMU-UHFFFAOYSA-N 4-methoxy-pseudoisocytidine Chemical compound COC1NC(N)=NC=C1C(C1O)OC(CO)C1O LOICBOXHPCURMU-UHFFFAOYSA-N 0.000 description 3
- OVONXEQGWXGFJD-UHFFFAOYSA-N 4-sulfanylidene-1h-pyrimidin-2-one Chemical compound SC=1C=CNC(=O)N=1 OVONXEQGWXGFJD-UHFFFAOYSA-N 0.000 description 3
- SJVVKUMXGIKAAI-UHFFFAOYSA-N 4-thio-pseudoisocytidine Chemical compound NC(N1)=NC=C(C(C2O)OC(CO)C2O)C1=S SJVVKUMXGIKAAI-UHFFFAOYSA-N 0.000 description 3
- NFEXJLMYXXIWPI-JXOAFFINSA-N 5-Hydroxymethylcytidine Chemical compound C1=C(CO)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NFEXJLMYXXIWPI-JXOAFFINSA-N 0.000 description 3
- ZYEWPVTXYBLWRT-UHFFFAOYSA-N 5-Uridinacetamid Natural products O=C1NC(=O)C(CC(=O)N)=CN1C1C(O)C(O)C(CO)O1 ZYEWPVTXYBLWRT-UHFFFAOYSA-N 0.000 description 3
- XUNBIDXYAUXNKD-DBRKOABJSA-N 5-aza-2-thio-zebularine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=S)N=CN=C1 XUNBIDXYAUXNKD-DBRKOABJSA-N 0.000 description 3
- OSLBPVOJTCDNEF-DBRKOABJSA-N 5-aza-zebularine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)N=CN=C1 OSLBPVOJTCDNEF-DBRKOABJSA-N 0.000 description 3
- MFEFTTYGMZOIKO-UHFFFAOYSA-N 5-azacytosine Chemical compound NC1=NC=NC(=O)N1 MFEFTTYGMZOIKO-UHFFFAOYSA-N 0.000 description 3
- ZYEWPVTXYBLWRT-VPCXQMTMSA-N 5-carbamoylmethyluridine Chemical compound O=C1NC(=O)C(CC(=O)N)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 ZYEWPVTXYBLWRT-VPCXQMTMSA-N 0.000 description 3
- RPQQZHJQUBDHHG-FNCVBFRFSA-N 5-methyl-zebularine Chemical compound C1=C(C)C=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 RPQQZHJQUBDHHG-FNCVBFRFSA-N 0.000 description 3
- USVMJSALORZVDV-UHFFFAOYSA-N 6-(gamma,gamma-dimethylallylamino)purine riboside Natural products C1=NC=2C(NCC=C(C)C)=NC=NC=2N1C1OC(CO)C(O)C1O USVMJSALORZVDV-UHFFFAOYSA-N 0.000 description 3
- ZKBQDFAWXLTYKS-UHFFFAOYSA-N 6-Chloro-1H-purine Chemical compound ClC1=NC=NC2=C1NC=N2 ZKBQDFAWXLTYKS-UHFFFAOYSA-N 0.000 description 3
- RYYIULNRIVUMTQ-UHFFFAOYSA-N 6-chloroguanine Chemical compound NC1=NC(Cl)=C2N=CNC2=N1 RYYIULNRIVUMTQ-UHFFFAOYSA-N 0.000 description 3
- MEYMBLGOKYDGLZ-UHFFFAOYSA-N 7-aminomethyl-7-deazaguanine Chemical compound N1=C(N)NC(=O)C2=C1NC=C2CN MEYMBLGOKYDGLZ-UHFFFAOYSA-N 0.000 description 3
- ISSMDAFGDCTNDV-UHFFFAOYSA-N 7-deaza-2,6-diaminopurine Chemical compound NC1=NC(N)=C2NC=CC2=N1 ISSMDAFGDCTNDV-UHFFFAOYSA-N 0.000 description 3
- ZTAWTRPFJHKMRU-UHFFFAOYSA-N 7-deaza-8-aza-2,6-diaminopurine Chemical compound NC1=NC(N)=C2NN=CC2=N1 ZTAWTRPFJHKMRU-UHFFFAOYSA-N 0.000 description 3
- SMXRCJBCWRHDJE-UHFFFAOYSA-N 7-deaza-8-aza-2-aminopurine Chemical compound NC1=NC=C2C=NNC2=N1 SMXRCJBCWRHDJE-UHFFFAOYSA-N 0.000 description 3
- LHCPRYRLDOSKHK-UHFFFAOYSA-N 7-deaza-8-aza-adenine Chemical compound NC1=NC=NC2=C1C=NN2 LHCPRYRLDOSKHK-UHFFFAOYSA-N 0.000 description 3
- VJNXUFOTKNTNPG-IOSLPCCCSA-O 7-methylinosine Chemical compound C1=2NC=NC(=O)C=2N(C)C=[N+]1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O VJNXUFOTKNTNPG-IOSLPCCCSA-O 0.000 description 3
- HCAJQHYUCKICQH-VPENINKCSA-N 8-Oxo-7,8-dihydro-2'-deoxyguanosine Chemical compound C1=2NC(N)=NC(=O)C=2NC(=O)N1[C@H]1C[C@H](O)[C@@H](CO)O1 HCAJQHYUCKICQH-VPENINKCSA-N 0.000 description 3
- 108700028369 Alleles Proteins 0.000 description 3
- 102100030988 Angiotensin-converting enzyme Human genes 0.000 description 3
- 241000180579 Arca Species 0.000 description 3
- PEMQXWCOMFJRLS-UHFFFAOYSA-N Archaeosine Natural products C1=2NC(N)=NC(=O)C=2C(C(=N)N)=CN1C1OC(CO)C(O)C1O PEMQXWCOMFJRLS-UHFFFAOYSA-N 0.000 description 3
- 201000003883 Cystic fibrosis Diseases 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 241000710198 Foot-and-mouth disease virus Species 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 108700028146 Genetic Enhancer Elements Proteins 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 108010007622 LDL Lipoproteins Proteins 0.000 description 3
- 102000007330 LDL Lipoproteins Human genes 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 241000699666 Mus <mouse, genus> Species 0.000 description 3
- NIDVTARKFBZMOT-PEBGCTIMSA-N N(4)-acetylcytidine Chemical compound O=C1N=C(NC(=O)C)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NIDVTARKFBZMOT-PEBGCTIMSA-N 0.000 description 3
- PJKKQFAEFWCNAQ-UHFFFAOYSA-N N(4)-methylcytosine Chemical compound CNC=1C=CNC(=O)N=1 PJKKQFAEFWCNAQ-UHFFFAOYSA-N 0.000 description 3
- BVIAOQMSVZHOJM-UHFFFAOYSA-N N(6),N(6)-dimethyladenine Chemical compound CN(C)C1=NC=NC2=C1N=CN2 BVIAOQMSVZHOJM-UHFFFAOYSA-N 0.000 description 3
- USVMJSALORZVDV-SDBHATRESA-N N(6)-(Delta(2)-isopentenyl)adenosine Chemical compound C1=NC=2C(NCC=C(C)C)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O USVMJSALORZVDV-SDBHATRESA-N 0.000 description 3
- UNUYMBPXEFMLNW-DWVDDHQFSA-N N-[(9-beta-D-ribofuranosylpurin-6-yl)carbamoyl]threonine Chemical compound C1=NC=2C(NC(=O)N[C@@H]([C@H](O)C)C(O)=O)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O UNUYMBPXEFMLNW-DWVDDHQFSA-N 0.000 description 3
- 108091028043 Nucleic acid sequence Proteins 0.000 description 3
- VZQXUWKZDSEQRR-UHFFFAOYSA-N Nucleosid Natural products C12=NC(SC)=NC(NCC=C(C)C)=C2N=CN1C1OC(CO)C(O)C1O VZQXUWKZDSEQRR-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 108091028664 Ribonucleotide Proteins 0.000 description 3
- 108091081024 Start codon Proteins 0.000 description 3
- 238000002441 X-ray diffraction Methods 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 3
- 229940024606 amino acid Drugs 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 125000004103 aminoalkyl group Chemical group 0.000 description 3
- 108091007433 antigens Proteins 0.000 description 3
- 102000036639 antigens Human genes 0.000 description 3
- PYMYPHUHKUWMLA-WDCZJNDASA-N arabinose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-WDCZJNDASA-N 0.000 description 3
- DRTQHJPVMGBUCF-CCXZUQQUSA-N arauridine Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-CCXZUQQUSA-N 0.000 description 3
- PEMQXWCOMFJRLS-RPKMEZRRSA-N archaeosine Chemical compound C1=2NC(N)=NC(=O)C=2C(C(=N)N)=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O PEMQXWCOMFJRLS-RPKMEZRRSA-N 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 201000003639 autosomal recessive cerebellar ataxia Diseases 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 3
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 3
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 3
- 210000000805 cytoplasm Anatomy 0.000 description 3
- 230000003247 decreasing effect Effects 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- 108010083141 dipeptidyl carboxypeptidase Proteins 0.000 description 3
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 description 3
- 230000007515 enzymatic degradation Effects 0.000 description 3
- RRCFLRBBBFZLSB-XIFYLAFSSA-N epoxyqueuosine Chemical compound C1=C(CN[C@@H]2[C@H]([C@@H](O)[C@@H]3O[C@@H]32)O)C=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O RRCFLRBBBFZLSB-XIFYLAFSSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- RQFCJASXJCIDSX-UUOKFMHZSA-N guanosine 5'-monophosphate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O RQFCJASXJCIDSX-UUOKFMHZSA-N 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Chemical group C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000001939 inductive effect Effects 0.000 description 3
- 230000003834 intracellular effect Effects 0.000 description 3
- 230000004807 localization Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- DJLUSNAYRNFVSM-UHFFFAOYSA-N methyl 2-(2,4-dioxo-1h-pyrimidin-5-yl)acetate Chemical compound COC(=O)CC1=CNC(=O)NC1=O DJLUSNAYRNFVSM-UHFFFAOYSA-N 0.000 description 3
- WCNMEQDMUYVWMJ-UHFFFAOYSA-N methyl 4-[3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4,6-dimethyl-9-oxoimidazo[1,2-a]purin-7-yl]-3-hydroperoxy-2-(methoxycarbonylamino)butanoate Chemical compound C1=NC=2C(=O)N3C(CC(C(NC(=O)OC)C(=O)OC)OO)=C(C)N=C3N(C)C=2N1C1OC(CO)C(O)C1O WCNMEQDMUYVWMJ-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 150000002972 pentoses Chemical class 0.000 description 3
- AFDMODCXODAXLC-UHFFFAOYSA-N phenylmethanimine Chemical compound N=CC1=CC=CC=C1 AFDMODCXODAXLC-UHFFFAOYSA-N 0.000 description 3
- 238000001243 protein synthesis Methods 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 150000003212 purines Chemical class 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- QQXQGKSPIMGUIZ-AEZJAUAXSA-N queuosine Chemical compound C1=2C(=O)NC(N)=NC=2N([C@H]2[C@@H]([C@H](O)[C@@H](CO)O2)O)C=C1CN[C@H]1C=C[C@H](O)[C@@H]1O QQXQGKSPIMGUIZ-AEZJAUAXSA-N 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 238000004007 reversed phase HPLC Methods 0.000 description 3
- 239000002342 ribonucleoside Substances 0.000 description 3
- 239000002336 ribonucleotide Substances 0.000 description 3
- 125000002652 ribonucleotide group Chemical group 0.000 description 3
- 229910052711 selenium Inorganic materials 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- 125000005017 substituted alkenyl group Chemical group 0.000 description 3
- 125000004426 substituted alkynyl group Chemical group 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 125000004001 thioalkyl group Chemical group 0.000 description 3
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 3
- 238000004448 titration Methods 0.000 description 3
- 125000002264 triphosphate group Chemical group [H]OP(=O)(O[H])OP(=O)(O[H])OP(=O)(O[H])O* 0.000 description 3
- 229960003636 vidarabine Drugs 0.000 description 3
- QAOHCFGKCWTBGC-QHOAOGIMSA-N wybutosine Chemical compound C1=NC=2C(=O)N3C(CC[C@H](NC(=O)OC)C(=O)OC)=C(C)N=C3N(C)C=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O QAOHCFGKCWTBGC-QHOAOGIMSA-N 0.000 description 3
- QAOHCFGKCWTBGC-UHFFFAOYSA-N wybutosine Natural products C1=NC=2C(=O)N3C(CCC(NC(=O)OC)C(=O)OC)=C(C)N=C3N(C)C=2N1C1OC(CO)C(O)C1O QAOHCFGKCWTBGC-UHFFFAOYSA-N 0.000 description 3
- 229940075420 xanthine Drugs 0.000 description 3
- RPQZTTQVRYEKCR-WCTZXXKLSA-N zebularine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)N=CC=C1 RPQZTTQVRYEKCR-WCTZXXKLSA-N 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- YZSZLBRBVWAXFW-LNYQSQCFSA-N (2R,3R,4S,5R)-2-(2-amino-6-hydroxy-6-methoxy-3H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound COC1(O)NC(N)=NC2=C1N=CN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YZSZLBRBVWAXFW-LNYQSQCFSA-N 0.000 description 2
- PHFMCMDFWSZKGD-IOSLPCCCSA-N (2r,3s,4r,5r)-2-(hydroxymethyl)-5-[6-(methylamino)-2-methylsulfanylpurin-9-yl]oxolane-3,4-diol Chemical compound C1=NC=2C(NC)=NC(SC)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O PHFMCMDFWSZKGD-IOSLPCCCSA-N 0.000 description 2
- MYUOTPIQBPUQQU-CKTDUXNWSA-N (2s,3r)-2-amino-n-[[9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylsulfanylpurin-6-yl]carbamoyl]-3-hydroxybutanamide Chemical compound C12=NC(SC)=NC(NC(=O)NC(=O)[C@@H](N)[C@@H](C)O)=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O MYUOTPIQBPUQQU-CKTDUXNWSA-N 0.000 description 2
- GPTUGCGYEMEAOC-IBZYUGMLSA-N (2s,3r)-2-amino-n-[[9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]-methylcarbamoyl]-3-hydroxybutanamide Chemical compound C1=NC=2C(N(C)C(=O)NC(=O)[C@@H](N)[C@H](O)C)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O GPTUGCGYEMEAOC-IBZYUGMLSA-N 0.000 description 2
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 2
- 125000001376 1,2,4-triazolyl group Chemical class N1N=C(N=C1)* 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- VGHXKGWSRNEDEP-OJKLQORTSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxylic acid Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)N1C(=O)NC(=O)C(C(O)=O)=C1 VGHXKGWSRNEDEP-OJKLQORTSA-N 0.000 description 2
- VIVLFSUDRCCWEF-JXOAFFINSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carbonitrile Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(C#N)=C1 VIVLFSUDRCCWEF-JXOAFFINSA-N 0.000 description 2
- UTQUILVPBZEHTK-ZOQUXTDFSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4-dione Chemical compound O=C1N(C)C(=O)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 UTQUILVPBZEHTK-ZOQUXTDFSA-N 0.000 description 2
- HXVKEKIORVUWDR-FDDDBJFASA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(methylaminomethyl)-2-sulfanylidenepyrimidin-4-one Chemical compound S=C1NC(=O)C(CNC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 HXVKEKIORVUWDR-FDDDBJFASA-N 0.000 description 2
- BTFXIEGOSDSOGN-KWCDMSRLSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,3-diazinane-2,4-dione Chemical compound O=C1NC(=O)C(C)CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 BTFXIEGOSDSOGN-KWCDMSRLSA-N 0.000 description 2
- QOXJRLADYHZRGC-SHYZEUOFSA-N 1-[(2r,3r,5s)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O1[C@H](CO)C[C@@H](O)[C@@H]1N1C(=O)NC(=O)C=C1 QOXJRLADYHZRGC-SHYZEUOFSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- UHDGCWIWMRVCDJ-UHFFFAOYSA-N 1-beta-D-Xylofuranosyl-NH-Cytosine Natural products O=C1N=C(N)C=CN1C1C(O)C(O)C(CO)O1 UHDGCWIWMRVCDJ-UHFFFAOYSA-N 0.000 description 2
- HPZMWTNATZPBIH-UHFFFAOYSA-N 1-methyladenine Chemical compound CN1C=NC2=NC=NC2=C1N HPZMWTNATZPBIH-UHFFFAOYSA-N 0.000 description 2
- RFLVMTUMFYRZCB-UHFFFAOYSA-N 1-methylguanine Chemical compound O=C1N(C)C(N)=NC2=C1N=CN2 RFLVMTUMFYRZCB-UHFFFAOYSA-N 0.000 description 2
- WVXRAFOPTSTNLL-NKWVEPMBSA-N 2',3'-dideoxyadenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@H]1CC[C@@H](CO)O1 WVXRAFOPTSTNLL-NKWVEPMBSA-N 0.000 description 2
- MXHRCPNRJAMMIM-BBVRLYRLSA-N 2'-deoxyuridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 MXHRCPNRJAMMIM-BBVRLYRLSA-N 0.000 description 2
- BTOTXLJHDSNXMW-POYBYMJQSA-N 2,3-dideoxyuridine Chemical compound O1[C@H](CO)CC[C@@H]1N1C(=O)NC(=O)C=C1 BTOTXLJHDSNXMW-POYBYMJQSA-N 0.000 description 2
- FDZGOVDEFRJXFT-UHFFFAOYSA-N 2-(3-aminopropyl)-7h-purin-6-amine Chemical compound NCCCC1=NC(N)=C2NC=NC2=N1 FDZGOVDEFRJXFT-UHFFFAOYSA-N 0.000 description 2
- OFEZSBMBBKLLBJ-UHFFFAOYSA-N 2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol Chemical compound C1=NC=2C(N)=NC=NC=2N1C1OC(CO)CC1O OFEZSBMBBKLLBJ-UHFFFAOYSA-N 0.000 description 2
- IQZWKGWOBPJWMX-UHFFFAOYSA-N 2-Methyladenosine Natural products C12=NC(C)=NC(N)=C2N=CN1C1OC(CO)C(O)C1O IQZWKGWOBPJWMX-UHFFFAOYSA-N 0.000 description 2
- VJKJOPUEUOTEBX-TURQNECASA-N 2-[[1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methylamino]ethanesulfonic acid Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(CNCCS(O)(=O)=O)=C1 VJKJOPUEUOTEBX-TURQNECASA-N 0.000 description 2
- OTDJAMXESTUWLO-UUOKFMHZSA-N 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-oxolanyl]-3H-purine-6-thione Chemical compound C12=NC(N)=NC(S)=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OTDJAMXESTUWLO-UUOKFMHZSA-N 0.000 description 2
- HPKQEMIXSLRGJU-UUOKFMHZSA-N 2-amino-9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-3h-purine-6,8-dione Chemical compound O=C1N(C)C(C(NC(N)=N2)=O)=C2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O HPKQEMIXSLRGJU-UUOKFMHZSA-N 0.000 description 2
- OCLZPNCLRLDXJC-NTSWFWBYSA-N 2-amino-9-[(2r,5s)-5-(hydroxymethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@H]1CC[C@@H](CO)O1 OCLZPNCLRLDXJC-NTSWFWBYSA-N 0.000 description 2
- PBFLIOAJBULBHI-JJNLEZRASA-N 2-amino-n-[[9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]carbamoyl]acetamide Chemical compound C1=NC=2C(NC(=O)NC(=O)CN)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O PBFLIOAJBULBHI-JJNLEZRASA-N 0.000 description 2
- RLZMYTZDQAVNIN-ZOQUXTDFSA-N 2-methoxy-4-thio-uridine Chemical compound COC1=NC(=S)C=CN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O RLZMYTZDQAVNIN-ZOQUXTDFSA-N 0.000 description 2
- QCPQCJVQJKOKMS-VLSMUFELSA-N 2-methoxy-5-methyl-cytidine Chemical compound CC(C(N)=N1)=CN([C@@H]([C@@H]2O)O[C@H](CO)[C@H]2O)C1OC QCPQCJVQJKOKMS-VLSMUFELSA-N 0.000 description 2
- STISOQJGVFEOFJ-MEVVYUPBSA-N 2-methoxy-cytidine Chemical compound COC(N([C@@H]([C@@H]1O)O[C@H](CO)[C@H]1O)C=C1)N=C1N STISOQJGVFEOFJ-MEVVYUPBSA-N 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- WBVPJIKOWUQTSD-ZOQUXTDFSA-N 2-methoxyuridine Chemical compound COC1=NC(=O)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 WBVPJIKOWUQTSD-ZOQUXTDFSA-N 0.000 description 2
- IQZWKGWOBPJWMX-IOSLPCCCSA-N 2-methyladenosine Chemical compound C12=NC(C)=NC(N)=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O IQZWKGWOBPJWMX-IOSLPCCCSA-N 0.000 description 2
- QEWSGVMSLPHELX-UHFFFAOYSA-N 2-methylthio-N6-(cis-hydroxyisopentenyl) adenosine Chemical compound C12=NC(SC)=NC(NCC=C(C)CO)=C2N=CN1C1OC(CO)C(O)C1O QEWSGVMSLPHELX-UHFFFAOYSA-N 0.000 description 2
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 2
- RDPUKVRQKWBSPK-UHFFFAOYSA-N 3-Methylcytidine Natural products O=C1N(C)C(=N)C=CN1C1C(O)C(O)C(CO)O1 RDPUKVRQKWBSPK-UHFFFAOYSA-N 0.000 description 2
- UTQUILVPBZEHTK-UHFFFAOYSA-N 3-Methyluridine Natural products O=C1N(C)C(=O)C=CN1C1C(O)C(O)C(CO)O1 UTQUILVPBZEHTK-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- VPLZGVOSFFCKFC-UHFFFAOYSA-N 3-methyluracil Chemical compound CN1C(=O)C=CNC1=O VPLZGVOSFFCKFC-UHFFFAOYSA-N 0.000 description 2
- ZSIINYPBPQCZKU-BQNZPOLKSA-O 4-Methoxy-1-methylpseudoisocytidine Chemical compound C[N+](CC1[C@H]([C@H]2O)O[C@@H](CO)[C@@H]2O)=C(N)N=C1OC ZSIINYPBPQCZKU-BQNZPOLKSA-O 0.000 description 2
- ZLOIGESWDJYCTF-UHFFFAOYSA-N 4-Thiouridine Natural products OC1C(O)C(CO)OC1N1C(=O)NC(=S)C=C1 ZLOIGESWDJYCTF-UHFFFAOYSA-N 0.000 description 2
- OCMSXKMNYAHJMU-JXOAFFINSA-N 4-amino-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidine-5-carbaldehyde Chemical compound C1=C(C=O)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 OCMSXKMNYAHJMU-JXOAFFINSA-N 0.000 description 2
- ZLOIGESWDJYCTF-XVFCMESISA-N 4-thiouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=S)C=C1 ZLOIGESWDJYCTF-XVFCMESISA-N 0.000 description 2
- WPQLFQWYPPALOX-UHFFFAOYSA-N 5-(2-aminopropyl)-1h-pyrimidine-2,4-dione Chemical compound CC(N)CC1=CNC(=O)NC1=O WPQLFQWYPPALOX-UHFFFAOYSA-N 0.000 description 2
- FAWQJBLSWXIJLA-VPCXQMTMSA-N 5-(carboxymethyl)uridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(CC(O)=O)=C1 FAWQJBLSWXIJLA-VPCXQMTMSA-N 0.000 description 2
- LMNPKIOZMGYQIU-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-pyrimidine-2,4-dione Chemical compound FC(F)(F)C1=CNC(=O)NC1=O LMNPKIOZMGYQIU-UHFFFAOYSA-N 0.000 description 2
- NMUSYJAQQFHJEW-UHFFFAOYSA-N 5-Azacytidine Natural products O=C1N=C(N)N=CN1C1C(O)C(O)C(CO)O1 NMUSYJAQQFHJEW-UHFFFAOYSA-N 0.000 description 2
- ITGWEVGJUSMCEA-KYXWUPHJSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-prop-1-ynylpyrimidine-2,4-dione Chemical compound O=C1NC(=O)N(C#CC)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 ITGWEVGJUSMCEA-KYXWUPHJSA-N 0.000 description 2
- OZQDLJNDRVBCST-SHUUEZRQSA-N 5-amino-2-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazin-3-one Chemical compound O=C1N=C(N)C=NN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 OZQDLJNDRVBCST-SHUUEZRQSA-N 0.000 description 2
- NMUSYJAQQFHJEW-KVTDHHQDSA-N 5-azacytidine Chemical compound O=C1N=C(N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NMUSYJAQQFHJEW-KVTDHHQDSA-N 0.000 description 2
- LQLQRFGHAALLLE-UHFFFAOYSA-N 5-bromouracil Chemical compound BrC1=CNC(=O)NC1=O LQLQRFGHAALLLE-UHFFFAOYSA-N 0.000 description 2
- AGFIRQJZCNVMCW-UAKXSSHOSA-N 5-bromouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(Br)=C1 AGFIRQJZCNVMCW-UAKXSSHOSA-N 0.000 description 2
- VKLFQTYNHLDMDP-PNHWDRBUSA-N 5-carboxymethylaminomethyl-2-thiouridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=S)NC(=O)C(CNCC(O)=O)=C1 VKLFQTYNHLDMDP-PNHWDRBUSA-N 0.000 description 2
- KSNXJLQDQOIRIP-UHFFFAOYSA-N 5-iodouracil Chemical compound IC1=CNC(=O)NC1=O KSNXJLQDQOIRIP-UHFFFAOYSA-N 0.000 description 2
- KELXHQACBIUYSE-UHFFFAOYSA-N 5-methoxy-1h-pyrimidine-2,4-dione Chemical compound COC1=CNC(=O)NC1=O KELXHQACBIUYSE-UHFFFAOYSA-N 0.000 description 2
- HLZXTFWTDIBXDF-PNHWDRBUSA-N 5-methoxycarbonylmethyl-2-thiouridine Chemical compound S=C1NC(=O)C(CC(=O)OC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 HLZXTFWTDIBXDF-PNHWDRBUSA-N 0.000 description 2
- KBDWGFZSICOZSJ-UHFFFAOYSA-N 5-methyl-2,3-dihydro-1H-pyrimidin-4-one Chemical compound N1CNC=C(C1=O)C KBDWGFZSICOZSJ-UHFFFAOYSA-N 0.000 description 2
- ZLAQATDNGLKIEV-UHFFFAOYSA-N 5-methyl-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound CC1=CNC(=S)NC1=O ZLAQATDNGLKIEV-UHFFFAOYSA-N 0.000 description 2
- SNNBPMAXGYBMHM-JXOAFFINSA-N 5-methyl-2-thiouridine Chemical compound S=C1NC(=O)C(C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 SNNBPMAXGYBMHM-JXOAFFINSA-N 0.000 description 2
- ZXQHKBUIXRFZBV-FDDDBJFASA-N 5-methylaminomethyluridine Chemical compound O=C1NC(=O)C(CNC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 ZXQHKBUIXRFZBV-FDDDBJFASA-N 0.000 description 2
- OZFPSOBLQZPIAV-UHFFFAOYSA-N 5-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2NC=CC2=C1 OZFPSOBLQZPIAV-UHFFFAOYSA-N 0.000 description 2
- OZTOEARQSSIFOG-MWKIOEHESA-N 6-Thio-7-deaza-8-azaguanosine Chemical compound Nc1nc(=S)c2cnn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2[nH]1 OZTOEARQSSIFOG-MWKIOEHESA-N 0.000 description 2
- DCPSTSVLRXOYGS-UHFFFAOYSA-N 6-amino-1h-pyrimidine-2-thione Chemical compound NC1=CC=NC(S)=N1 DCPSTSVLRXOYGS-UHFFFAOYSA-N 0.000 description 2
- OHILKUISCGPRMQ-UHFFFAOYSA-N 6-amino-5-(trifluoromethyl)-1h-pyrimidin-2-one Chemical compound NC1=NC(=O)NC=C1C(F)(F)F OHILKUISCGPRMQ-UHFFFAOYSA-N 0.000 description 2
- QNNARSZPGNJZIX-UHFFFAOYSA-N 6-amino-5-prop-1-ynyl-1h-pyrimidin-2-one Chemical compound CC#CC1=CNC(=O)N=C1N QNNARSZPGNJZIX-UHFFFAOYSA-N 0.000 description 2
- SSPYSWLZOPCOLO-UHFFFAOYSA-N 6-azauracil Chemical compound O=C1C=NNC(=O)N1 SSPYSWLZOPCOLO-UHFFFAOYSA-N 0.000 description 2
- WYXSYVWAUAUWLD-SHUUEZRQSA-N 6-azauridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=N1 WYXSYVWAUAUWLD-SHUUEZRQSA-N 0.000 description 2
- AFWWNHLDHNSVSD-UHFFFAOYSA-N 6-methyl-7h-purin-2-amine Chemical compound CC1=NC(N)=NC2=C1NC=N2 AFWWNHLDHNSVSD-UHFFFAOYSA-N 0.000 description 2
- CKOMXBHMKXXTNW-UHFFFAOYSA-N 6-methyladenine Chemical compound CNC1=NC=NC2=C1N=CN2 CKOMXBHMKXXTNW-UHFFFAOYSA-N 0.000 description 2
- CBNRZZNSRJQZNT-IOSLPCCCSA-O 6-thio-7-deaza-guanosine Chemical compound CC1=C[NH+]([C@@H]([C@@H]2O)O[C@H](CO)[C@H]2O)C(NC(N)=N2)=C1C2=S CBNRZZNSRJQZNT-IOSLPCCCSA-O 0.000 description 2
- RFHIWBUKNJIBSE-KQYNXXCUSA-O 6-thio-7-methyl-guanosine Chemical compound C1=2NC(N)=NC(=S)C=2N(C)C=[N+]1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O RFHIWBUKNJIBSE-KQYNXXCUSA-O 0.000 description 2
- CLGFIVUFZRGQRP-UHFFFAOYSA-N 7,8-dihydro-8-oxoguanine Chemical compound O=C1NC(N)=NC2=C1NC(=O)N2 CLGFIVUFZRGQRP-UHFFFAOYSA-N 0.000 description 2
- MJJUWOIBPREHRU-MWKIOEHESA-N 7-Deaza-8-azaguanosine Chemical compound NC=1NC(C2=C(N=1)N(N=C2)[C@H]1[C@H](O)[C@H](O)[C@H](O1)CO)=O MJJUWOIBPREHRU-MWKIOEHESA-N 0.000 description 2
- LOSIULRWFAEMFL-UHFFFAOYSA-N 7-deazaguanine Chemical compound O=C1NC(N)=NC2=C1CC=N2 LOSIULRWFAEMFL-UHFFFAOYSA-N 0.000 description 2
- GTEYCWLUHNVBCI-UHFFFAOYSA-N 7-methyl-2-(methylamino)-3h-purin-6-one Chemical compound N1C(NC)=NC(=O)C2=C1N=CN2C GTEYCWLUHNVBCI-UHFFFAOYSA-N 0.000 description 2
- LPXQRXLUHJKZIE-UHFFFAOYSA-N 8-azaguanine Chemical compound NC1=NC(O)=C2NN=NC2=N1 LPXQRXLUHJKZIE-UHFFFAOYSA-N 0.000 description 2
- ZTWYAIASAJSBMA-UHFFFAOYSA-N 8-azido-7h-purin-6-amine Chemical compound NC1=NC=NC2=C1NC(N=[N+]=[N-])=N2 ZTWYAIASAJSBMA-UHFFFAOYSA-N 0.000 description 2
- ADPMAYFIIFNDMT-KQYNXXCUSA-N 9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(methylamino)-3h-purine-6-thione Chemical compound C1=NC=2C(=S)NC(NC)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O ADPMAYFIIFNDMT-KQYNXXCUSA-N 0.000 description 2
- HDZZVAMISRMYHH-UHFFFAOYSA-N 9beta-Ribofuranosyl-7-deazaadenin Natural products C1=CC=2C(N)=NC=NC=2N1C1OC(CO)C(O)C1O HDZZVAMISRMYHH-UHFFFAOYSA-N 0.000 description 2
- 241000272517 Anseriformes Species 0.000 description 2
- 241000271566 Aves Species 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- QWOJMRHUQHTCJG-UHFFFAOYSA-N CC([CH2-])=O Chemical class CC([CH2-])=O QWOJMRHUQHTCJG-UHFFFAOYSA-N 0.000 description 2
- 108091028075 Circular RNA Proteins 0.000 description 2
- 241000710777 Classical swine fever virus Species 0.000 description 2
- 241000710127 Cricket paralysis virus Species 0.000 description 2
- UHDGCWIWMRVCDJ-PSQAKQOGSA-N Cytidine Natural products O=C1N=C(N)C=CN1[C@@H]1[C@@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-PSQAKQOGSA-N 0.000 description 2
- SRBFZHDQGSBBOR-IOVATXLUSA-N D-xylopyranose Chemical compound O[C@@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-IOVATXLUSA-N 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 2
- ZNZYKNKBJPZETN-WELNAUFTSA-N Dialdehyde 11678 Chemical compound N1C2=CC=CC=C2C2=C1[C@H](C[C@H](/C(=C/O)C(=O)OC)[C@@H](C=C)C=O)NCC2 ZNZYKNKBJPZETN-WELNAUFTSA-N 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 108010016626 Dipeptides Proteins 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 241000710188 Encephalomyocarditis virus Species 0.000 description 2
- 108010042407 Endonucleases Proteins 0.000 description 2
- 102000004533 Endonucleases Human genes 0.000 description 2
- 241000991587 Enterovirus C Species 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 108091093094 Glycol nucleic acid Proteins 0.000 description 2
- 241000711557 Hepacivirus Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 208000031226 Hyperlipidaemia Diseases 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 108091027974 Mature messenger RNA Proteins 0.000 description 2
- 108091062170 Mir-22 Proteins 0.000 description 2
- 108091028049 Mir-221 microRNA Proteins 0.000 description 2
- 241000714177 Murine leukemia virus Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- RSPURTUNRHNVGF-IOSLPCCCSA-N N(2),N(2)-dimethylguanosine Chemical compound C1=NC=2C(=O)NC(N(C)C)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O RSPURTUNRHNVGF-IOSLPCCCSA-N 0.000 description 2
- ZBYRSRLCXTUFLJ-IOSLPCCCSA-O N(2),N(7)-dimethylguanosine Chemical compound CNC=1NC(C=2[N+](=CN([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C=2N=1)C)=O ZBYRSRLCXTUFLJ-IOSLPCCCSA-O 0.000 description 2
- SLEHROROQDYRAW-KQYNXXCUSA-N N(2)-methylguanosine Chemical compound C1=NC=2C(=O)NC(NC)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O SLEHROROQDYRAW-KQYNXXCUSA-N 0.000 description 2
- IJCKBIINTQEGLY-UHFFFAOYSA-N N(4)-acetylcytosine Chemical compound CC(=O)NC1=CC=NC(=O)N1 IJCKBIINTQEGLY-UHFFFAOYSA-N 0.000 description 2
- WVGPGNPCZPYCLK-WOUKDFQISA-N N(6),N(6)-dimethyladenosine Chemical compound C1=NC=2C(N(C)C)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O WVGPGNPCZPYCLK-WOUKDFQISA-N 0.000 description 2
- HYVABZIGRDEKCD-UHFFFAOYSA-N N(6)-dimethylallyladenine Chemical compound CC(C)=CCNC1=NC=NC2=C1N=CN2 HYVABZIGRDEKCD-UHFFFAOYSA-N 0.000 description 2
- WVGPGNPCZPYCLK-UHFFFAOYSA-N N-Dimethyladenosine Natural products C1=NC=2C(N(C)C)=NC=NC=2N1C1OC(CO)C(O)C1O WVGPGNPCZPYCLK-UHFFFAOYSA-N 0.000 description 2
- SLLVJTURCPWLTP-UHFFFAOYSA-N N-[9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]acetamide Chemical compound C1=NC=2C(NC(=O)C)=NC=NC=2N1C1OC(CO)C(O)C1O SLLVJTURCPWLTP-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- LZCNWAXLJWBRJE-ZOQUXTDFSA-N N4-Methylcytidine Chemical compound O=C1N=C(NC)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 LZCNWAXLJWBRJE-ZOQUXTDFSA-N 0.000 description 2
- GOSWTRUMMSCNCW-UHFFFAOYSA-N N6-(cis-hydroxyisopentenyl)adenosine Chemical compound C1=NC=2C(NCC=C(CO)C)=NC=NC=2N1C1OC(CO)C(O)C1O GOSWTRUMMSCNCW-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- 101710163270 Nuclease Proteins 0.000 description 2
- JXNORPPTKDEAIZ-QOCRDCMYSA-N O-4''-alpha-D-mannosylqueuosine Chemical compound NC(N1)=NC(N([C@@H]([C@@H]2O)O[C@H](CO)[C@H]2O)C=C2CN[C@H]([C@H]3O)C=C[C@@H]3O[C@H]([C@H]([C@H]3O)O)O[C@H](CO)[C@H]3O)=C2C1=O JXNORPPTKDEAIZ-QOCRDCMYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical group C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- 229910004856 P—O—P Inorganic materials 0.000 description 2
- 108020005161 RNA Caps Proteins 0.000 description 2
- 108091030071 RNAI Proteins 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 102100032889 Sortilin Human genes 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical class OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 2
- 108700009124 Transcription Initiation Site Proteins 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- 108010062497 VLDL Lipoproteins Proteins 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- FXUOBUITIFDTDA-GWTDSMLYSA-N [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate 1H-imidazole Chemical compound C1=CNC=N1.C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O FXUOBUITIFDTDA-GWTDSMLYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000003838 adenosines Chemical class 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000003302 alkenyloxy group Chemical group 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 2
- 125000005133 alkynyloxy group Chemical group 0.000 description 2
- 125000002431 aminoalkoxy group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 125000003435 aroyl group Chemical group 0.000 description 2
- 229960002756 azacitidine Drugs 0.000 description 2
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 125000002680 canonical nucleotide group Chemical group 0.000 description 2
- 125000004452 carbocyclyl group Chemical group 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 235000012000 cholesterol Nutrition 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- NLUNLVTVUDIHFE-UHFFFAOYSA-N cyclooctylcyclooctane Chemical compound C1CCCCCCC1C1CCCCCCC1 NLUNLVTVUDIHFE-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- UHDGCWIWMRVCDJ-ZAKLUEHWSA-N cytidine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-ZAKLUEHWSA-N 0.000 description 2
- 230000002939 deleterious effect Effects 0.000 description 2
- 239000005547 deoxyribonucleotide Substances 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- MXHRCPNRJAMMIM-UHFFFAOYSA-N desoxyuridine Natural products C1C(O)C(CO)OC1N1C(=O)NC(=O)C=C1 MXHRCPNRJAMMIM-UHFFFAOYSA-N 0.000 description 2
- 229910052805 deuterium Inorganic materials 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 229960001484 edetic acid Drugs 0.000 description 2
- 230000003028 elevating effect Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 210000003527 eukaryotic cell Anatomy 0.000 description 2
- 230000005714 functional activity Effects 0.000 description 2
- 230000009368 gene silencing by RNA Effects 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 235000013928 guanylic acid Nutrition 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000004255 ion exchange chromatography Methods 0.000 description 2
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 125000005647 linker group Chemical group 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- XOTXNXXJZCFUOA-UGKPPGOTSA-N methyl 2-[1-[(2r,3r,4r,5r)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]acetate Chemical compound CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(CC(=O)OC)=C1 XOTXNXXJZCFUOA-UGKPPGOTSA-N 0.000 description 2
- WZRYXYRWFAPPBJ-PNHWDRBUSA-N methyl uridin-5-yloxyacetate Chemical compound O=C1NC(=O)C(OCC(=O)OC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 WZRYXYRWFAPPBJ-PNHWDRBUSA-N 0.000 description 2
- 230000011987 methylation Effects 0.000 description 2
- 108091061917 miR-221 stem-loop Proteins 0.000 description 2
- 108091063489 miR-221-1 stem-loop Proteins 0.000 description 2
- 108091055391 miR-221-2 stem-loop Proteins 0.000 description 2
- 108091031076 miR-221-3 stem-loop Proteins 0.000 description 2
- 230000035772 mutation Effects 0.000 description 2
- 208000010125 myocardial infarction Diseases 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 230000008520 organization Effects 0.000 description 2
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 2
- 150000008298 phosphoramidates Chemical class 0.000 description 2
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 230000001124 posttranscriptional effect Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 2
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- JRPHGDYSKGJTKZ-UHFFFAOYSA-N selenophosphoric acid Chemical compound OP(O)([SeH])=O JRPHGDYSKGJTKZ-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 108010014657 sortilin Proteins 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- WYWHKKSPHMUBEB-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 210000003412 trans-golgi network Anatomy 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- 230000005945 translocation Effects 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- HDZZVAMISRMYHH-KCGFPETGSA-N tubercidin Chemical compound C1=CC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O HDZZVAMISRMYHH-KCGFPETGSA-N 0.000 description 2
- RVCNQQGZJWVLIP-VPCXQMTMSA-N uridin-5-yloxyacetic acid Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(OCC(O)=O)=C1 RVCNQQGZJWVLIP-VPCXQMTMSA-N 0.000 description 2
- YIZYCHKPHCPKHZ-UHFFFAOYSA-N uridine-5-acetic acid methyl ester Natural products COC(=O)Cc1cn(C2OC(CO)C(O)C2O)c(=O)[nH]c1=O YIZYCHKPHCPKHZ-UHFFFAOYSA-N 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- IRBSRWVXPGHGGK-LNYQSQCFSA-N (2R,3R,4S,5R)-2-(2-amino-6-hydroxy-6-methyl-3H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound CC1(O)NC(N)=NC2=C1N=CN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O IRBSRWVXPGHGGK-LNYQSQCFSA-N 0.000 description 1
- FGMBEEFIKCGALL-WOUKDFQISA-N (2R,3R,4S,5R)-2-(6-amino-2,8-dimethylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound CC1=NC2=C(N)N=C(C)N=C2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O FGMBEEFIKCGALL-WOUKDFQISA-N 0.000 description 1
- BIXYYZIIJIXVFW-UUOKFMHZSA-N (2R,3R,4S,5R)-2-(6-amino-2-chloro-9-purinyl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O BIXYYZIIJIXVFW-UUOKFMHZSA-N 0.000 description 1
- QHHGGTROQDKGBG-CRKDRTNXSA-N (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-2-sulfanyloxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@]1(S)O[C@H](CO)[C@@H](O)[C@H]1O QHHGGTROQDKGBG-CRKDRTNXSA-N 0.000 description 1
- DBZQFUNLCALWDY-PNHWDRBUSA-N (2r,3r,4s,5r)-2-(4-aminoimidazo[4,5-c]pyridin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC=CC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O DBZQFUNLCALWDY-PNHWDRBUSA-N 0.000 description 1
- BSZZPOARGMTJKQ-UUOKFMHZSA-N (2r,3r,4s,5r)-2-(6-amino-2-azidopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC(N=[N+]=[N-])=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O BSZZPOARGMTJKQ-UUOKFMHZSA-N 0.000 description 1
- PGHYIISMDPKFKH-UUOKFMHZSA-N (2r,3r,4s,5r)-2-(6-amino-2-bromopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC(Br)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O PGHYIISMDPKFKH-UUOKFMHZSA-N 0.000 description 1
- MGEBVSZZNFOIRB-UUOKFMHZSA-N (2r,3r,4s,5r)-2-(6-amino-2-iodopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC(I)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O MGEBVSZZNFOIRB-UUOKFMHZSA-N 0.000 description 1
- NVUDDRWKCUAERS-PNHWDRBUSA-N (2r,3r,4s,5r)-2-(7-aminoimidazo[4,5-b]pyridin-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=CC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NVUDDRWKCUAERS-PNHWDRBUSA-N 0.000 description 1
- MQECTKDGEQSNNL-UMCMBGNQSA-N (2r,3r,4s,5r)-2-[6-(14-aminotetradecoxyperoxyperoxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(NOOOOOCCCCCCCCCCCCCCN)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O MQECTKDGEQSNNL-UMCMBGNQSA-N 0.000 description 1
- XZAXKLMYAMKNFC-UUOKFMHZSA-N (2r,3r,4s,5r)-2-[6-amino-2-(trifluoromethyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC(C(F)(F)F)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O XZAXKLMYAMKNFC-UUOKFMHZSA-N 0.000 description 1
- HQKJJDQNHQUFLL-UUOKFMHZSA-N (2r,3r,4s,5r)-2-[6-amino-8-(trifluoromethyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound FC(F)(F)C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O HQKJJDQNHQUFLL-UUOKFMHZSA-N 0.000 description 1
- CHTZUQHTKOSZKY-NVMQTXNBSA-N (2r,3r,5r)-5-(6-aminopurin-9-yl)-4,4-difluoro-2-(hydroxymethyl)oxolan-3-ol Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)C1(F)F CHTZUQHTKOSZKY-NVMQTXNBSA-N 0.000 description 1
- UUDVSZSQPFXQQM-GIWSHQQXSA-N (2r,3s,4r,5r)-2-(6-aminopurin-9-yl)-3-fluoro-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@]1(O)F UUDVSZSQPFXQQM-GIWSHQQXSA-N 0.000 description 1
- ZDSMLAYSJRQEGM-IOSLPCCCSA-N (2r,3s,4r,5r)-2-(hydroxymethyl)-5-[6-(hydroxymethylamino)purin-9-yl]oxolane-3,4-diol Chemical compound C1=NC=2C(NCO)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O ZDSMLAYSJRQEGM-IOSLPCCCSA-N 0.000 description 1
- BRBOLMMFGHVQNH-MLTZYSBQSA-N (2r,3s,4r,5r)-5-(6-aminopurin-9-yl)-2-azido-2-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@@](CO)(N=[N+]=[N-])[C@@H](O)[C@H]1O BRBOLMMFGHVQNH-MLTZYSBQSA-N 0.000 description 1
- ZHUBMCMWNICRIP-IWXIMVSXSA-N (2r,3s,4r,5r)-5-(6-aminopurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@@](CO)(C#C)[C@@H](O)[C@H]1O ZHUBMCMWNICRIP-IWXIMVSXSA-N 0.000 description 1
- NLFKSRZGFBFEQK-UHNVWZDZSA-N (2s,3r)-2-amino-3-hydroxy-n-(7h-purin-6-ylcarbamoyl)butanamide Chemical compound C[C@@H](O)[C@H](N)C(=O)NC(=O)NC1=NC=NC2=C1NC=N2 NLFKSRZGFBFEQK-UHNVWZDZSA-N 0.000 description 1
- WDWXALXJMJNVSG-UHNVWZDZSA-N (2s,3r)-2-amino-3-hydroxy-n-[(2-methylsulfanyl-7h-purin-6-yl)carbamoyl]butanamide Chemical compound CSC1=NC(NC(=O)NC(=O)[C@@H](N)[C@@H](C)O)=C2NC=NC2=N1 WDWXALXJMJNVSG-UHNVWZDZSA-N 0.000 description 1
- VPSQUSXHBDEMCA-RITPCOANSA-N (2s,3r)-2-amino-3-hydroxy-n-[methyl(7h-purin-6-yl)carbamoyl]butanamide Chemical compound C[C@@H](O)[C@H](N)C(=O)NC(=O)N(C)C1=NC=NC2=C1NC=N2 VPSQUSXHBDEMCA-RITPCOANSA-N 0.000 description 1
- KEHFJRVBOUROMM-KBHCAIDQSA-N (2s,3r,4s,5r)-2-(4-amino-5h-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1NC=2C(N)=NC=NC=2C=1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O KEHFJRVBOUROMM-KBHCAIDQSA-N 0.000 description 1
- JZSSTKLEXRQFEA-HEIFUQTGSA-N (2s,3r,4s,5r)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carboxamide Chemical compound C1=NC2=C(N)N=CN=C2N1[C@]1(C(=O)N)O[C@H](CO)[C@@H](O)[C@H]1O JZSSTKLEXRQFEA-HEIFUQTGSA-N 0.000 description 1
- MGAXYKDBRBNWKT-UHFFFAOYSA-N (5-oxooxolan-2-yl)methyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1OC(=O)CC1 MGAXYKDBRBNWKT-UHFFFAOYSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- FYADHXFMURLYQI-UHFFFAOYSA-N 1,2,4-triazine Chemical compound C1=CN=NC=N1 FYADHXFMURLYQI-UHFFFAOYSA-N 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- 125000005960 1,4-diazepanyl group Chemical group 0.000 description 1
- 125000005962 1,4-oxazepanyl group Chemical group 0.000 description 1
- YAXPTXKKVKGOED-JHEVNIALSA-N 1-(2,2-diethoxyethyl)-5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O=C1NC(=O)N(CC(OCC)OCC)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 YAXPTXKKVKGOED-JHEVNIALSA-N 0.000 description 1
- GIGNOIUAJMOQIK-OJKLQORTSA-N 1-[(2R,3R,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxamide Chemical compound C(N)(=O)C=1C(NC(N([C@]2([C@H](O)[C@H](O)[C@@H](CO)O2)CO)C=1)=O)=O GIGNOIUAJMOQIK-OJKLQORTSA-N 0.000 description 1
- NQCGFLGDDGUFGX-FDDDBJFASA-N 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(dimethylamino)pyrimidine-2,4-dione Chemical compound CN(C=1C(NC(N([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C1)=O)=O)C NQCGFLGDDGUFGX-FDDDBJFASA-N 0.000 description 1
- JVVKYRGUYXZMCY-HKUMRIAESA-N 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(3-methylbut-1-enylamino)methyl]-2-sulfanylidenepyrimidin-4-one Chemical compound S=C1NC(=O)C(CNC=CC(C)C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 JVVKYRGUYXZMCY-HKUMRIAESA-N 0.000 description 1
- FEUDNSHXOOLCEY-XVFCMESISA-N 1-[(2r,3r,4r,5r)-3-bromo-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound Br[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 FEUDNSHXOOLCEY-XVFCMESISA-N 0.000 description 1
- IPVFGAYTKQKGBM-UAKXSSHOSA-N 1-[(2r,3r,4r,5r)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione Chemical compound F[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 IPVFGAYTKQKGBM-UAKXSSHOSA-N 0.000 description 1
- JGSQPOVKUOMQGQ-VPCXQMTMSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)-2-methoxyoxolan-2-yl]pyrimidine-2,4-dione Chemical compound C1=CC(=O)NC(=O)N1[C@]1(OC)O[C@H](CO)[C@@H](O)[C@H]1O JGSQPOVKUOMQGQ-VPCXQMTMSA-N 0.000 description 1
- ODDDVFDZBGTKDX-VPCXQMTMSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)-2-methyloxolan-2-yl]pyrimidine-2,4-dione Chemical compound C1=CC(=O)NC(=O)N1[C@]1(C)O[C@H](CO)[C@@H](O)[C@H]1O ODDDVFDZBGTKDX-VPCXQMTMSA-N 0.000 description 1
- KFZLIRUEFHTLEW-ZGFVZBPKSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(2e)-3,7-dimethylocta-2,6-dienyl]sulfanylpyrimidin-4-one Chemical compound CC(C)=CCC\C(C)=C\CSC1=NC(=O)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 KFZLIRUEFHTLEW-ZGFVZBPKSA-N 0.000 description 1
- GFCDNWCHLZESES-PEBGCTIMSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(dimethylamino)pyrimidin-2-one Chemical compound O=C1N=C(N(C)C)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 GFCDNWCHLZESES-PEBGCTIMSA-N 0.000 description 1
- RSSRMDMJEZIUJX-XVFCMESISA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydrazinylpyrimidin-2-one Chemical compound O=C1N=C(NN)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 RSSRMDMJEZIUJX-XVFCMESISA-N 0.000 description 1
- YEFAYVNQPIXISW-IXYNUQLISA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-phenylethynyl)pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(C#CC=2C=CC=CC=2)=C1 YEFAYVNQPIXISW-IXYNUQLISA-N 0.000 description 1
- PXIJVFXEJNEEIO-DNRKLUKYSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(furan-2-yl)pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(C=2OC=CC=2)=C1 PXIJVFXEJNEEIO-DNRKLUKYSA-N 0.000 description 1
- UEJHQHNFRZXWRD-UAKXSSHOSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(C(F)(F)F)=C1 UEJHQHNFRZXWRD-UAKXSSHOSA-N 0.000 description 1
- KJLRIEFCMSGNSI-HKUMRIAESA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(3-methylbut-3-enylamino)methyl]-2-sulfanylidenepyrimidin-4-one Chemical compound S=C1NC(=O)C(CNCCC(=C)C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 KJLRIEFCMSGNSI-HKUMRIAESA-N 0.000 description 1
- HLBIEOQUEHEDCR-HKUMRIAESA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(3-methylbut-3-enylamino)methyl]pyrimidine-2,4-dione Chemical compound O=C1NC(=O)C(CNCCC(=C)C)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 HLBIEOQUEHEDCR-HKUMRIAESA-N 0.000 description 1
- RKSLVDIXBGWPIS-UAKXSSHOSA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 RKSLVDIXBGWPIS-UAKXSSHOSA-N 0.000 description 1
- QLOCVMVCRJOTTM-TURQNECASA-N 1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-prop-1-ynylpyrimidine-2,4-dione Chemical compound O=C1NC(=O)C(C#CC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 QLOCVMVCRJOTTM-TURQNECASA-N 0.000 description 1
- MRUKYOQQKHNMFI-XVFCMESISA-N 1-[(2r,3r,4s,5r)-3-azido-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound [N-]=[N+]=N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 MRUKYOQQKHNMFI-XVFCMESISA-N 0.000 description 1
- FHPJZSIIXUQGQE-JVZYCSMKSA-N 1-[(2r,3r,4s,5r)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@](CO)(N=[N+]=[N-])O[C@H]1N1C(=O)NC(=O)C=C1 FHPJZSIIXUQGQE-JVZYCSMKSA-N 0.000 description 1
- WRJWRPFBIXAXCQ-PKIKSRDPSA-N 1-[(2r,3r,4s,5r)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@](CO)(C#C)O[C@H]1N1C(=O)NC(=O)C=C1 WRJWRPFBIXAXCQ-PKIKSRDPSA-N 0.000 description 1
- DZLIOKRVKHPLJD-OGVRULDESA-N 1-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl]-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)(=O)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O DZLIOKRVKHPLJD-OGVRULDESA-N 0.000 description 1
- QLVIOZLWKBJWMS-SYQHCUMBSA-N 1-[[3,4-bis(trifluoromethoxy)phenyl]methyl]-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound FC(OC=1C=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=CC1OC(F)(F)F)(F)F QLVIOZLWKBJWMS-SYQHCUMBSA-N 0.000 description 1
- SATCOUWSAZBIJO-UHFFFAOYSA-N 1-methyladenine Natural products N=C1N(C)C=NC2=C1NC=N2 SATCOUWSAZBIJO-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- GEWRKGDRYZIFNP-UHFFFAOYSA-N 1h-1,3,5-triazine-2,4-dione Chemical compound OC1=NC=NC(O)=N1 GEWRKGDRYZIFNP-UHFFFAOYSA-N 0.000 description 1
- UHUHBFMZVCOEOV-UHFFFAOYSA-N 1h-imidazo[4,5-c]pyridin-4-amine Chemical compound NC1=NC=CC2=C1N=CN2 UHUHBFMZVCOEOV-UHFFFAOYSA-N 0.000 description 1
- HUTNOYOBQPAKIA-UHFFFAOYSA-N 1h-pyrazin-2-one Chemical class OC1=CN=CC=N1 HUTNOYOBQPAKIA-UHFFFAOYSA-N 0.000 description 1
- FIRDBEQIJQERSE-QPPQHZFASA-N 2',2'-Difluorodeoxyuridine Chemical compound FC1(F)[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 FIRDBEQIJQERSE-QPPQHZFASA-N 0.000 description 1
- WYDKPTZGVLTYPG-UHFFFAOYSA-N 2,8-diamino-3,7-dihydropurin-6-one Chemical compound N1C(N)=NC(=O)C2=C1N=C(N)N2 WYDKPTZGVLTYPG-UHFFFAOYSA-N 0.000 description 1
- OGDNTMNMWKPKBD-UHFFFAOYSA-N 2,8-dimethyl-7h-purin-6-amine Chemical compound CC1=NC(N)=C2NC(C)=NC2=N1 OGDNTMNMWKPKBD-UHFFFAOYSA-N 0.000 description 1
- ZORMBPAMZBSDFY-UHFFFAOYSA-N 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-hydroxyacetamide Chemical compound C(N)(=O)C(C=1C(NC(NC=1)=O)=O)O ZORMBPAMZBSDFY-UHFFFAOYSA-N 0.000 description 1
- QKUOFCILOCWJNI-UHFFFAOYSA-N 2-(2,4-dioxo-1H-pyrimidin-5-yl)acetonitrile Chemical compound O=C1NC=C(CC#N)C(=O)N1 QKUOFCILOCWJNI-UHFFFAOYSA-N 0.000 description 1
- IJAHNLRUFAXOBY-UHFFFAOYSA-N 2-(2,4-dioxo-1h-pyrimidin-5-yl)acetamide Chemical compound NC(=O)CC1=CNC(=O)NC1=O IJAHNLRUFAXOBY-UHFFFAOYSA-N 0.000 description 1
- ZVGODTQUYAKZMK-UHFFFAOYSA-N 2-(2,4-dioxo-1h-pyrimidin-5-yl)acetic acid Chemical compound OC(=O)CC1=CNC(=O)NC1=O ZVGODTQUYAKZMK-UHFFFAOYSA-N 0.000 description 1
- PIINGYXNCHTJTF-UHFFFAOYSA-N 2-(2-azaniumylethylamino)acetate Chemical compound NCCNCC(O)=O PIINGYXNCHTJTF-UHFFFAOYSA-N 0.000 description 1
- MLAPNFDQBBHIQC-UHFFFAOYSA-N 2-(methylamino)-3,7-dihydropurine-6-thione Chemical compound N1C(NC)=NC(=S)C2=C1N=CN2 MLAPNFDQBBHIQC-UHFFFAOYSA-N 0.000 description 1
- MSCDPPZMQRATKR-UHFFFAOYSA-N 2-(propylamino)-3,7-dihydropurin-6-one Chemical compound N1C(NCCC)=NC(=O)C2=C1N=CN2 MSCDPPZMQRATKR-UHFFFAOYSA-N 0.000 description 1
- ZDTFMPXQUSBYRL-UUOKFMHZSA-N 2-Aminoadenosine Chemical compound C12=NC(N)=NC(N)=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O ZDTFMPXQUSBYRL-UUOKFMHZSA-N 0.000 description 1
- CIKSWTPEROTOAS-UHFFFAOYSA-N 2-[(2,4-dioxo-1H-pyrimidin-5-yl)methylamino]ethanesulfonic acid Chemical compound C(NCCS(=O)(=O)O)C=1C(NC(NC=1)=O)=O CIKSWTPEROTOAS-UHFFFAOYSA-N 0.000 description 1
- SGAKLDIYNFXTCK-UHFFFAOYSA-N 2-[(2,4-dioxo-1h-pyrimidin-5-yl)methylamino]acetic acid Chemical compound OC(=O)CNCC1=CNC(=O)NC1=O SGAKLDIYNFXTCK-UHFFFAOYSA-N 0.000 description 1
- PCNJJZGTFWYSCJ-FDDDBJFASA-N 2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]acetonitrile Chemical compound C(#N)CC=1C(NC(N([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C=1)=O)=O PCNJJZGTFWYSCJ-FDDDBJFASA-N 0.000 description 1
- NOIRDLRUNWIUMX-UHFFFAOYSA-N 2-amino-3,7-dihydropurin-6-one;6-amino-1h-pyrimidin-2-one Chemical compound NC=1C=CNC(=O)N=1.O=C1NC(N)=NC2=C1NC=N2 NOIRDLRUNWIUMX-UHFFFAOYSA-N 0.000 description 1
- VKRFXNXJOJJPAO-UHFFFAOYSA-N 2-amino-4-(2,4-dioxo-1h-pyrimidin-3-yl)butanoic acid Chemical compound OC(=O)C(N)CCN1C(=O)C=CNC1=O VKRFXNXJOJJPAO-UHFFFAOYSA-N 0.000 description 1
- WWJMLJDSGOGNFJ-UHFFFAOYSA-N 2-amino-4-(2,4-dioxo-1h-pyrimidin-5-yl)butanoic acid Chemical compound OC(=O)C(N)CCC1=CNC(=O)NC1=O WWJMLJDSGOGNFJ-UHFFFAOYSA-N 0.000 description 1
- ZHENYVBBFCVMEV-BKLVVQOLSA-N 2-amino-4-[5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxo-1h-pyrimidin-3-yl]butanoic acid Chemical compound O=C1N(CCC(N)C(O)=O)C(=O)NC=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 ZHENYVBBFCVMEV-BKLVVQOLSA-N 0.000 description 1
- RBYIXGAYDLAKCC-GXTPVXIHSA-N 2-amino-7-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O RBYIXGAYDLAKCC-GXTPVXIHSA-N 0.000 description 1
- AJOUMKDWEVWIEU-UHFFFAOYSA-N 2-amino-7-methyl-3h-purine-6-thione Chemical compound N1C(N)=NC(=S)C2=C1N=CN2C AJOUMKDWEVWIEU-UHFFFAOYSA-N 0.000 description 1
- PYNVSZMFFVWFQA-NOMGDLSISA-N 2-amino-9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound O[C@@H]1[C@H](O)[C@@H](C(O)C)O[C@H]1N1C(NC(N)=NC2=O)=C2N=C1 PYNVSZMFFVWFQA-NOMGDLSISA-N 0.000 description 1
- BOCKWHCDQIFZHA-LRXXKQTNSA-N 2-amino-9-[(2r,3r,4s,5r)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@@](CO)(N=[N+]=[N-])[C@@H](O)[C@H]1O BOCKWHCDQIFZHA-LRXXKQTNSA-N 0.000 description 1
- ZEFNGPRHMTZOFU-BQIHAETKSA-N 2-amino-9-[(2r,3r,4s,5r)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@@](CO)(C#C)[C@@H](O)[C@H]1O ZEFNGPRHMTZOFU-BQIHAETKSA-N 0.000 description 1
- BGTXMQUSDNMLDW-AEHJODJJSA-N 2-amino-9-[(2r,3s,4r,5r)-3-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@]1(O)F BGTXMQUSDNMLDW-AEHJODJJSA-N 0.000 description 1
- RQIYMUKKPIEAMB-TWOGKDBTSA-N 2-amino-9-[(2r,4r,5r)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1(F)F RQIYMUKKPIEAMB-TWOGKDBTSA-N 0.000 description 1
- DHAVVWZXZKCMSZ-UHFFFAOYSA-N 2-amino-n-(7h-purin-6-ylcarbamoyl)acetamide Chemical compound NCC(=O)NC(=O)NC1=NC=NC2=C1NC=N2 DHAVVWZXZKCMSZ-UHFFFAOYSA-N 0.000 description 1
- HDSVERFJVLXGJP-UHFFFAOYSA-N 2-amino-n-pyridin-2-ylethanesulfonamide;hydrochloride Chemical compound Cl.NCCS(=O)(=O)NC1=CC=CC=N1 HDSVERFJVLXGJP-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- XMSMHKMPBNTBOD-UHFFFAOYSA-N 2-dimethylamino-6-hydroxypurine Chemical compound N1C(N(C)C)=NC(=O)C2=C1N=CN2 XMSMHKMPBNTBOD-UHFFFAOYSA-N 0.000 description 1
- HBUBKKRHXORPQB-UUOKFMHZSA-N 2-fluoroadenosine Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O HBUBKKRHXORPQB-UUOKFMHZSA-N 0.000 description 1
- FZIIBDOXPQOKBP-UHFFFAOYSA-N 2-methyloxetane Chemical compound CC1CCO1 FZIIBDOXPQOKBP-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- USCCECGPGBGFOM-UHFFFAOYSA-N 2-propyl-7h-purin-6-amine Chemical compound CCCC1=NC(N)=C2NC=NC2=N1 USCCECGPGBGFOM-UHFFFAOYSA-N 0.000 description 1
- PCJFEVUKVKQSSL-UHFFFAOYSA-N 2h-1,2,4-oxadiazol-5-one Chemical compound O=C1N=CNO1 PCJFEVUKVKQSSL-UHFFFAOYSA-N 0.000 description 1
- OROIAVZITJBGSM-OBXARNEKSA-N 3'-deoxyguanosine Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](CO)C[C@H]1O OROIAVZITJBGSM-OBXARNEKSA-N 0.000 description 1
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 description 1
- KOLPWZCZXAMXKS-UHFFFAOYSA-N 3-methylcytosine Chemical compound CN1C(N)=CC=NC1=O KOLPWZCZXAMXKS-UHFFFAOYSA-N 0.000 description 1
- LOJNBPNACKZWAI-UHFFFAOYSA-N 3-nitro-1h-pyrrole Chemical compound [O-][N+](=O)C=1C=CNC=1 LOJNBPNACKZWAI-UHFFFAOYSA-N 0.000 description 1
- PEPBFCOIJRULGJ-UHFFFAOYSA-N 3h-1,2,3-benzodioxazole Chemical compound C1=CC=C2NOOC2=C1 PEPBFCOIJRULGJ-UHFFFAOYSA-N 0.000 description 1
- DMUQOPXCCOBPID-XUTVFYLZSA-N 4-Thio-1-methylpseudoisocytidine Chemical compound CN1C=C(C(=S)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O DMUQOPXCCOBPID-XUTVFYLZSA-N 0.000 description 1
- MDWFCNXLWFANLX-JXOAFFINSA-N 4-amino-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidine-5-carbonitrile Chemical compound C1=C(C#N)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 MDWFCNXLWFANLX-JXOAFFINSA-N 0.000 description 1
- GTPDEYWPIGFRQM-UAKXSSHOSA-N 4-amino-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(trifluoromethyl)pyrimidin-2-one Chemical compound C1=C(C(F)(F)F)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 GTPDEYWPIGFRQM-UAKXSSHOSA-N 0.000 description 1
- NCZFDEBKMUJQQO-FDDDBJFASA-N 4-amino-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-ethynylpyrimidin-2-one Chemical compound C1=C(C#C)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NCZFDEBKMUJQQO-FDDDBJFASA-N 0.000 description 1
- MPPUDRFYDKDPBN-UAKXSSHOSA-N 4-amino-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxypyrimidin-2-one Chemical compound C1=C(O)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 MPPUDRFYDKDPBN-UAKXSSHOSA-N 0.000 description 1
- IZFJAICCKKWWNM-JXOAFFINSA-N 4-amino-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidin-2-one Chemical compound O=C1N=C(N)C(OC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 IZFJAICCKKWWNM-JXOAFFINSA-N 0.000 description 1
- JFIWEPHGRUDAJN-DYUFWOLASA-N 4-amino-1-[(2r,3r,4s,5r)-4-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@@](O)(C#C)[C@@H](CO)O1 JFIWEPHGRUDAJN-DYUFWOLASA-N 0.000 description 1
- ODLGMSQBFONGNG-JVZYCSMKSA-N 4-amino-1-[(2r,3r,4s,5r)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@H](O)[C@](CO)(N=[N+]=[N-])O1 ODLGMSQBFONGNG-JVZYCSMKSA-N 0.000 description 1
- JPVIDVLFVGWECR-PKIKSRDPSA-N 4-amino-1-[(2r,3r,4s,5r)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@H](O)[C@](CO)(C#C)O1 JPVIDVLFVGWECR-PKIKSRDPSA-N 0.000 description 1
- PJWBTAIPBFWVHX-FJGDRVTGSA-N 4-amino-1-[(2r,3s,4r,5r)-3-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@](F)(O)[C@H](O)[C@@H](CO)O1 PJWBTAIPBFWVHX-FJGDRVTGSA-N 0.000 description 1
- GUKBRWDRLHVHPU-HKUMRIAESA-N 4-amino-5-(2-chlorophenyl)-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2-thione Chemical compound NC1=NC(=S)N([C@H]2[C@@H]([C@H](O)[C@@H](CO)O2)O)C=C1C1=CC=CC=C1Cl GUKBRWDRLHVHPU-HKUMRIAESA-N 0.000 description 1
- OWCWIPUTFDHMCR-HKUMRIAESA-N 4-amino-5-(4-aminophenyl)-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2-thione Chemical compound C1=CC(N)=CC=C1C(C(=NC1=S)N)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 OWCWIPUTFDHMCR-HKUMRIAESA-N 0.000 description 1
- FBLNVVJQCGUTHY-YPLKXGEDSA-N 4-amino-5-[(e)-2-bromoethenyl]-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical compound C1=C(\C=C\Br)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 FBLNVVJQCGUTHY-YPLKXGEDSA-N 0.000 description 1
- HRDXGYQCVPZEJE-UAKXSSHOSA-N 4-amino-5-bromo-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one Chemical compound C1=C(Br)C(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 HRDXGYQCVPZEJE-UAKXSSHOSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- PHAFOFIVSNSAPQ-UHFFFAOYSA-N 4-fluoro-6-methyl-1h-benzimidazole Chemical compound CC1=CC(F)=C2NC=NC2=C1 PHAFOFIVSNSAPQ-UHFFFAOYSA-N 0.000 description 1
- QCXGJTGMGJOYDP-UHFFFAOYSA-N 4-methyl-1h-benzimidazole Chemical compound CC1=CC=CC2=C1N=CN2 QCXGJTGMGJOYDP-UHFFFAOYSA-N 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
- 125000004032 5'-inosinyl group Chemical group 0.000 description 1
- NBAKTGXDIBVZOO-UHFFFAOYSA-N 5,6-dihydrothymine Chemical compound CC1CNC(=O)NC1=O NBAKTGXDIBVZOO-UHFFFAOYSA-N 0.000 description 1
- ZQVNMALZHZYKQM-JXOAFFINSA-N 5-(aminomethyl)-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O=C1NC(=O)C(CN)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 ZQVNMALZHZYKQM-JXOAFFINSA-N 0.000 description 1
- UVGCZRPOXXYZKH-QADQDURISA-N 5-(carboxyhydroxymethyl)uridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(C(O)C(O)=O)=C1 UVGCZRPOXXYZKH-QADQDURISA-N 0.000 description 1
- MQJSSLBGAQJNER-UHFFFAOYSA-N 5-(methylaminomethyl)-1h-pyrimidine-2,4-dione Chemical compound CNCC1=CNC(=O)NC1=O MQJSSLBGAQJNER-UHFFFAOYSA-N 0.000 description 1
- DGCFDETWIXOSIF-UHFFFAOYSA-N 5-[(2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-1H-pyrimidine-2,4-dione Chemical compound N(=NC=1C(NC(NC=1)=O)=O)C=1C(NC(NC=1)=O)=O DGCFDETWIXOSIF-UHFFFAOYSA-N 0.000 description 1
- YNVLBZKHIGMMQM-GBNDHIKLSA-N 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(2,2,2-trifluoroacetyl)pyrimidine-2,4-dione Chemical compound FC(C(=O)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O)(F)F YNVLBZKHIGMMQM-GBNDHIKLSA-N 0.000 description 1
- DUVALGSKXXIJKY-BIAAXOCRSA-N 5-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)-2-(thiomorpholin-4-ylmethyl)oxolan-2-yl]-1h-pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@]1(C=1C(NC(=O)NC=1)=O)CN1CCSCC1 DUVALGSKXXIJKY-BIAAXOCRSA-N 0.000 description 1
- GRAFFVHEUKBNJJ-XUTVFYLZSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(2,2,3,3,3-pentafluoropropyl)pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CN(CC(F)(F)C(F)(F)F)C(=O)NC1=O GRAFFVHEUKBNJJ-XUTVFYLZSA-N 0.000 description 1
- CESQRRUNQBSZTD-BGZDPUMWSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(2-hydroxyethyl)pyrimidine-2,4-dione Chemical compound O=C1NC(=O)N(CCO)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 CESQRRUNQBSZTD-BGZDPUMWSA-N 0.000 description 1
- CHJFNEZUXCWJNR-KYXWUPHJSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(2-methoxyethyl)pyrimidine-2,4-dione Chemical compound O=C1NC(=O)N(CCOC)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 CHJFNEZUXCWJNR-KYXWUPHJSA-N 0.000 description 1
- GIZXLWBUPHRANC-BGZDPUMWSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(methoxymethyl)pyrimidine-2,4-dione Chemical compound O=C1NC(=O)N(COC)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 GIZXLWBUPHRANC-BGZDPUMWSA-N 0.000 description 1
- IFPCOKHAGCATTD-KKOKHZNYSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(morpholin-4-ylmethyl)pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C(C(NC1=O)=O)=CN1CN1CCOCC1 IFPCOKHAGCATTD-KKOKHZNYSA-N 0.000 description 1
- FORPUOZRFSCGMF-TUVASFSCSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-(phenylmethoxymethyl)pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C(C(NC1=O)=O)=CN1COCC1=CC=CC=C1 FORPUOZRFSCGMF-TUVASFSCSA-N 0.000 description 1
- QFOGVDCZTYOWCR-GRUVDUQJSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(2r)-2-hydroxypropyl]pyrimidine-2,4-dione Chemical compound O=C1NC(=O)N(C[C@H](O)C)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 QFOGVDCZTYOWCR-GRUVDUQJSA-N 0.000 description 1
- QFOGVDCZTYOWCR-HFJFPFSUSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(2s)-2-hydroxypropyl]pyrimidine-2,4-dione Chemical compound O=C1NC(=O)N(C[C@@H](O)C)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 QFOGVDCZTYOWCR-HFJFPFSUSA-N 0.000 description 1
- KMLHIDMUNPEGKF-KYXWUPHJSA-N 5-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-prop-2-ynylpyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=CN(CC#C)C(=O)NC1=O KMLHIDMUNPEGKF-KYXWUPHJSA-N 0.000 description 1
- DAAZSLDIYNYMJM-UHFFFAOYSA-N 5-[(3-methylbut-3-enylamino)methyl]-1h-pyrimidine-2,4-dione Chemical compound CC(=C)CCNCC1=CNC(=O)NC1=O DAAZSLDIYNYMJM-UHFFFAOYSA-N 0.000 description 1
- GCQYYIHYQMVWLT-YPLKXGEDSA-N 5-[(e)-2-bromoethenyl]-1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(\C=C\Br)=C1 GCQYYIHYQMVWLT-YPLKXGEDSA-N 0.000 description 1
- SVXNJCYYMRMXNM-UHFFFAOYSA-N 5-amino-2h-1,2,4-triazin-3-one Chemical compound NC=1C=NNC(=O)N=1 SVXNJCYYMRMXNM-UHFFFAOYSA-N 0.000 description 1
- FHSISDGOVSHJRW-UHFFFAOYSA-N 5-formylcytosine Chemical compound NC1=NC(=O)NC=C1C=O FHSISDGOVSHJRW-UHFFFAOYSA-N 0.000 description 1
- OFJNVANOCZHTMW-UHFFFAOYSA-N 5-hydroxyuracil Chemical compound OC1=CNC(=O)NC1=O OFJNVANOCZHTMW-UHFFFAOYSA-N 0.000 description 1
- CDFYFTSELDPCJA-UHFFFAOYSA-N 5-methoxy-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound COC1=CNC(=S)NC1=O CDFYFTSELDPCJA-UHFFFAOYSA-N 0.000 description 1
- FFKUHGONCHRHPE-UHFFFAOYSA-N 5-methyl-1h-pyrimidine-2,4-dione;7h-purin-6-amine Chemical compound CC1=CNC(=O)NC1=O.NC1=NC=NC2=C1NC=N2 FFKUHGONCHRHPE-UHFFFAOYSA-N 0.000 description 1
- NXIKMPKEFMWWDF-UHFFFAOYSA-N 6-(hydroxymethyl)-2,4-dioxo-1H-pyrimidine-5-carboxylic acid Chemical compound C(=O)(O)C=1C(NC(NC=1CO)=O)=O NXIKMPKEFMWWDF-UHFFFAOYSA-N 0.000 description 1
- MVROVESVSXEPJL-UHFFFAOYSA-N 6-(prop-1-ynylamino)-1h-pyrimidin-2-one Chemical compound CC#CNC1=CC=NC(=O)N1 MVROVESVSXEPJL-UHFFFAOYSA-N 0.000 description 1
- BXJHWYVXLGLDMZ-UHFFFAOYSA-N 6-O-methylguanine Chemical compound COC1=NC(N)=NC2=C1NC=N2 BXJHWYVXLGLDMZ-UHFFFAOYSA-N 0.000 description 1
- KXBCLNRMQPRVTP-UHFFFAOYSA-N 6-amino-1,5-dihydroimidazo[4,5-c]pyridin-4-one Chemical compound O=C1NC(N)=CC2=C1N=CN2 KXBCLNRMQPRVTP-UHFFFAOYSA-N 0.000 description 1
- AFNPRCRBQDBWQO-OXNFMAJFSA-N 6-amino-3-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methyl-1h-pyrimidin-2-one Chemical compound C1=CC(C)(N)NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 AFNPRCRBQDBWQO-OXNFMAJFSA-N 0.000 description 1
- GHSZEASQFPXGMG-UHFFFAOYSA-N 6-amino-5-(2-azidoethyl)-1H-pyrimidin-2-one Chemical compound N(=[N+]=[N-])CCC=1C(=NC(NC=1)=O)N GHSZEASQFPXGMG-UHFFFAOYSA-N 0.000 description 1
- NLLCDONDZDHLCI-UHFFFAOYSA-N 6-amino-5-hydroxy-1h-pyrimidin-2-one Chemical compound NC=1NC(=O)N=CC=1O NLLCDONDZDHLCI-UHFFFAOYSA-N 0.000 description 1
- UFVWJVAMULFOMC-UHFFFAOYSA-N 6-amino-5-iodo-1h-pyrimidin-2-one Chemical compound NC=1NC(=O)N=CC=1I UFVWJVAMULFOMC-UHFFFAOYSA-N 0.000 description 1
- LXHOFEUVCQUXRZ-RRKCRQDMSA-N 6-azathymidine Chemical compound O=C1NC(=O)C(C)=NN1[C@@H]1O[C@H](CO)[C@@H](O)C1 LXHOFEUVCQUXRZ-RRKCRQDMSA-N 0.000 description 1
- KFYZVFUMYFTSNB-UHFFFAOYSA-N 6-hydroxymethyladenine Chemical compound OCNC1=NC=NC2=C1NC=N2 KFYZVFUMYFTSNB-UHFFFAOYSA-N 0.000 description 1
- VVZVRYMWEIFUEN-UHFFFAOYSA-N 6-methylpurin-6-amine Chemical compound CC1(N)N=CN=C2N=CN=C12 VVZVRYMWEIFUEN-UHFFFAOYSA-N 0.000 description 1
- DKVRNHPCAOHRSI-KQYNXXCUSA-N 7-methyl-GTP Chemical compound C1=2N=C(N)NC(=O)C=2[N+](C)=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)([O-])=O)[C@@H](O)[C@H]1O DKVRNHPCAOHRSI-KQYNXXCUSA-N 0.000 description 1
- PFUVOLUPRFCPMN-UHFFFAOYSA-N 7h-purine-6,8-diamine Chemical compound C1=NC(N)=C2NC(N)=NC2=N1 PFUVOLUPRFCPMN-UHFFFAOYSA-N 0.000 description 1
- VJUPMOPLUQHMLE-UUOKFMHZSA-N 8-Bromoadenosine Chemical compound BrC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O VJUPMOPLUQHMLE-UUOKFMHZSA-N 0.000 description 1
- ASUCSHXLTWZYBA-UMMCILCDSA-N 8-Bromoguanosine Chemical compound C1=2NC(N)=NC(=O)C=2N=C(Br)N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O ASUCSHXLTWZYBA-UMMCILCDSA-N 0.000 description 1
- RTGYRFMTJZYXPD-IOSLPCCCSA-N 8-Methyladenosine Chemical compound CC1=NC2=C(N)N=CN=C2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O RTGYRFMTJZYXPD-IOSLPCCCSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- HRYKDUPGBWLLHO-UHFFFAOYSA-N 8-azaadenine Chemical compound NC1=NC=NC2=NNN=C12 HRYKDUPGBWLLHO-UHFFFAOYSA-N 0.000 description 1
- RGKBRPAAQSHTED-UHFFFAOYSA-N 8-oxoadenine Chemical compound NC1=NC=NC2=C1NC(=O)N2 RGKBRPAAQSHTED-UHFFFAOYSA-N 0.000 description 1
- FJNCXZZQNBKEJT-UHFFFAOYSA-N 8beta-hydroxymarrubiin Natural products O1C(=O)C2(C)CCCC3(C)C2C1CC(C)(O)C3(O)CCC=1C=COC=1 FJNCXZZQNBKEJT-UHFFFAOYSA-N 0.000 description 1
- KEHFJRVBOUROMM-UHFFFAOYSA-N 9-Deazaadenosine Natural products C=1NC=2C(N)=NC=NC=2C=1C1OC(CO)C(O)C1O KEHFJRVBOUROMM-UHFFFAOYSA-N 0.000 description 1
- FPALLCXBEIUUQH-QYVSTXNMSA-N 9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(2-methylpropylamino)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(NCC(C)C)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O FPALLCXBEIUUQH-QYVSTXNMSA-N 0.000 description 1
- WPEKUTPQIYMWJA-AMJCQUEASA-N 9-[(2r,3s,4r,5r)-3-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(2-methylpropylamino)-3h-purin-6-one Chemical compound C1=2NC(NCC(C)C)=NC(=O)C=2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@]1(O)F WPEKUTPQIYMWJA-AMJCQUEASA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 208000030090 Acute Disease Diseases 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 108010085443 Anserine Proteins 0.000 description 1
- 108020005544 Antisense RNA Proteins 0.000 description 1
- 102100037435 Antiviral innate immune response receptor RIG-I Human genes 0.000 description 1
- 101710127675 Antiviral innate immune response receptor RIG-I Proteins 0.000 description 1
- 108091023037 Aptamer Proteins 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 208000012566 Autosomal recessive ataxia, Beauce type Diseases 0.000 description 1
- 208000035555 Beauce type autosomal recessive ataxia Diseases 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- MILNNIRLFDRSSE-SYQHCUMBSA-N BrC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 Chemical compound BrC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 MILNNIRLFDRSSE-SYQHCUMBSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- PDPZLWJDCQKTSH-BGZDPUMWSA-N C(=C)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O Chemical compound C(=C)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O PDPZLWJDCQKTSH-BGZDPUMWSA-N 0.000 description 1
- AGEGQODMIVQQBB-KYXWUPHJSA-N C(C(C)(C)C)(=O)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O Chemical compound C(C(C)(C)C)(=O)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O AGEGQODMIVQQBB-KYXWUPHJSA-N 0.000 description 1
- NWNXXBCXOXZWEW-LPWJVIDDSA-N C(C1=CC=CC=C1)(=O)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O Chemical compound C(C1=CC=CC=C1)(=O)N1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O NWNXXBCXOXZWEW-LPWJVIDDSA-N 0.000 description 1
- CJNLMOBIHFNDOC-LPWJVIDDSA-N C1(CC1)C#CCN1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O Chemical compound C1(CC1)C#CCN1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O CJNLMOBIHFNDOC-LPWJVIDDSA-N 0.000 description 1
- LLKYIRMVFSSSKZ-VQHPVUNQSA-N CC1=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C(=CC(=C1)C)C Chemical compound CC1=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C(=CC(=C1)C)C LLKYIRMVFSSSKZ-VQHPVUNQSA-N 0.000 description 1
- PYDGVTARRYJTTD-TUVASFSCSA-N CC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 Chemical compound CC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 PYDGVTARRYJTTD-TUVASFSCSA-N 0.000 description 1
- DWKWYDDTOQQKBI-TUVASFSCSA-N COC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 Chemical compound COC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 DWKWYDDTOQQKBI-TUVASFSCSA-N 0.000 description 1
- BDCUCVYDTRTUFT-FPCVCCKLSA-N COC=1C=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=CC1OC Chemical compound COC=1C=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=CC1OC BDCUCVYDTRTUFT-FPCVCCKLSA-N 0.000 description 1
- YOXALHHCBYVPKF-TUVASFSCSA-N CS(=O)(=O)C1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 Chemical compound CS(=O)(=O)C1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 YOXALHHCBYVPKF-TUVASFSCSA-N 0.000 description 1
- IQRCOXVINNRQGK-BGZDPUMWSA-N CS(=O)(=O)CN1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O Chemical compound CS(=O)(=O)CN1C=C([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C(NC1=O)=O IQRCOXVINNRQGK-BGZDPUMWSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- QRYRORQUOLYVBU-VBKZILBWSA-N Carnosic acid Natural products CC([C@@H]1CC2)(C)CCC[C@]1(C(O)=O)C1=C2C=C(C(C)C)C(O)=C1O QRYRORQUOLYVBU-VBKZILBWSA-N 0.000 description 1
- 108010087806 Carnosine Proteins 0.000 description 1
- 102000014914 Carrier Proteins Human genes 0.000 description 1
- 108090000994 Catalytic RNA Proteins 0.000 description 1
- 102000053642 Catalytic RNA Human genes 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- WXPDGWOAIIXGMD-SYQHCUMBSA-N ClC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 Chemical compound ClC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 WXPDGWOAIIXGMD-SYQHCUMBSA-N 0.000 description 1
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 1
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-KAZBKCHUSA-N D-altritol Chemical compound OC[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KAZBKCHUSA-N 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- 229920002271 DEAE-Sepharose Polymers 0.000 description 1
- 108091027757 Deoxyribozyme Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 238000002965 ELISA Methods 0.000 description 1
- 101710198144 Endopolygalacturonase I Proteins 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000206602 Eukaryota Species 0.000 description 1
- 101710091919 Eukaryotic translation initiation factor 4G Proteins 0.000 description 1
- FTYRZKMRWHLFFV-SYQHCUMBSA-N FC(C1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1)(F)F Chemical compound FC(C1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1)(F)F FTYRZKMRWHLFFV-SYQHCUMBSA-N 0.000 description 1
- TUFKHAHUMYJJEO-SYQHCUMBSA-N FC(OC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1)(F)F Chemical compound FC(OC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1)(F)F TUFKHAHUMYJJEO-SYQHCUMBSA-N 0.000 description 1
- BMTNKOQYNLAWIW-SYQHCUMBSA-N FC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 Chemical compound FC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 BMTNKOQYNLAWIW-SYQHCUMBSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- MTCJZZBQNCXKAP-UHFFFAOYSA-N Formycin B Natural products OC1C(O)C(CO)OC1C1=C(NC=NC2=O)C2=NN1 MTCJZZBQNCXKAP-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- QGWNDRXFNXRZMB-UUOKFMHZSA-N GDP Chemical group C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O QGWNDRXFNXRZMB-UUOKFMHZSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 102000009331 Homeodomain Proteins Human genes 0.000 description 1
- 108010048671 Homeodomain Proteins Proteins 0.000 description 1
- 101001082073 Homo sapiens Interferon-induced helicase C domain-containing protein 1 Proteins 0.000 description 1
- 101000624947 Homo sapiens Nesprin-1 Proteins 0.000 description 1
- 101001106523 Homo sapiens Regulator of G-protein signaling 1 Proteins 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-O Htris Chemical compound OCC([NH3+])(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-O 0.000 description 1
- VTUOLSYWRBEAHU-SYQHCUMBSA-N IC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 Chemical compound IC1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 VTUOLSYWRBEAHU-SYQHCUMBSA-N 0.000 description 1
- 208000026350 Inborn Genetic disease Diseases 0.000 description 1
- 102100027353 Interferon-induced helicase C domain-containing protein 1 Human genes 0.000 description 1
- 108091092195 Intron Proteins 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- SLRNWACWRVGMKD-UHFFFAOYSA-N L-anserine Natural products CN1C=NC(CC(NC(=O)CCN)C(O)=O)=C1 SLRNWACWRVGMKD-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- 125000003376 L-ribosyl group Chemical group C1([C@@H](O)[C@@H](O)[C@@H](O1)CO)* 0.000 description 1
- 108010028554 LDL Cholesterol Proteins 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 102000004895 Lipoproteins Human genes 0.000 description 1
- 108090001030 Lipoproteins Proteins 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 108091007780 MiR-122 Proteins 0.000 description 1
- IYYIBFCJILKPCO-WOUKDFQISA-O N(2),N(2),N(7)-trimethylguanosine Chemical compound C1=2NC(N(C)C)=NC(=O)C=2N(C)C=[N+]1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O IYYIBFCJILKPCO-WOUKDFQISA-O 0.000 description 1
- PDVHDOUKYQSEMW-SYQHCUMBSA-N N(=[N+]=[N-])C1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 Chemical compound N(=[N+]=[N-])C1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 PDVHDOUKYQSEMW-SYQHCUMBSA-N 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- CQOVPNPJLQNMDC-UHFFFAOYSA-N N-beta-alanyl-L-histidine Natural products NCCC(=O)NC(C(O)=O)CC1=CN=CN1 CQOVPNPJLQNMDC-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- VQAYFKKCNSOZKM-UHFFFAOYSA-N NSC 29409 Natural products C1=NC=2C(NC)=NC=NC=2N1C1OC(CO)C(O)C1O VQAYFKKCNSOZKM-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 102100023306 Nesprin-1 Human genes 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 108020004485 Nonsense Codon Proteins 0.000 description 1
- QGSUTLFKTFHNAB-GCMJHUTASA-O O=C1N([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C2=NC(=NC(C2=N1)=O)N.CNC=1NC(C=2[N+](=CN([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C2N1)C)=O Chemical compound O=C1N([C@H]2[C@H](O)[C@H](O)[C@@H](CO)O2)C2=NC(=NC(C2=N1)=O)N.CNC=1NC(C=2[N+](=CN([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C2N1)C)=O QGSUTLFKTFHNAB-GCMJHUTASA-O 0.000 description 1
- CCYZHBYWWVWCDK-BGZDPUMWSA-N O=C1NC(=O)N(C(=O)C)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 Chemical compound O=C1NC(=O)N(C(=O)C)C=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 CCYZHBYWWVWCDK-BGZDPUMWSA-N 0.000 description 1
- RFZIZXWYWPNBGL-XVFCMESISA-N OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1ccc(=O)[nH][c]1=[Se] Chemical compound OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1ccc(=O)[nH][c]1=[Se] RFZIZXWYWPNBGL-XVFCMESISA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical group C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910003873 O—P—O Inorganic materials 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 241000286209 Phasianidae Species 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Chemical group C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- 241000709664 Picornaviridae Species 0.000 description 1
- 108091036407 Polyadenylation Proteins 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 102000015623 Polynucleotide Adenylyltransferase Human genes 0.000 description 1
- 108010024055 Polynucleotide adenylyltransferase Proteins 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- 241000210053 Potentilla elegans Species 0.000 description 1
- 241000288906 Primates Species 0.000 description 1
- 101710191566 Probable endopolygalacturonase I Proteins 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical group C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- NMTRJAKSMWDJSY-UHFFFAOYSA-N Pyrrolosine Natural products C=1OC=2C(N)=NC=NC=2C=1C1OC(CO)C(O)C1O NMTRJAKSMWDJSY-UHFFFAOYSA-N 0.000 description 1
- 108091034057 RNA (poly(A)) Proteins 0.000 description 1
- 238000002123 RNA extraction Methods 0.000 description 1
- 108010012974 RNA triphosphatase Proteins 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 102100021269 Regulator of G-protein signaling 1 Human genes 0.000 description 1
- 108010083644 Ribonucleases Proteins 0.000 description 1
- 102000006382 Ribonucleases Human genes 0.000 description 1
- 108091006629 SLC13A2 Proteins 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 101100401689 Schizosaccharomyces pombe (strain 972 / ATCC 24843) mis4 gene Proteins 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- 108091027967 Small hairpin RNA Proteins 0.000 description 1
- 108020004459 Small interfering RNA Proteins 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 101710137500 T7 RNA polymerase Proteins 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 108091046915 Threose nucleic acid Proteins 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 108020005202 Viral DNA Proteins 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- TVGUROHJABCRTB-MHJQXXNXSA-N [(2r,3s,4r,5s)-5-[(2r,3r,4r,5r)-2-(2-amino-6-oxo-3h-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate Chemical compound O([C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC=2C(=O)N=C(NC=21)N)[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O TVGUROHJABCRTB-MHJQXXNXSA-N 0.000 description 1
- BBAWTPDTGRXPDG-UHFFFAOYSA-N [1,3]thiazolo[4,5-b]pyridine Chemical compound C1=CC=C2SC=NC2=N1 BBAWTPDTGRXPDG-UHFFFAOYSA-N 0.000 description 1
- GWVQBYKXVMJUTC-SYQHCUMBSA-N [N+](=O)([O-])C1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 Chemical compound [N+](=O)([O-])C1=CC=C(CN2C=C([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C(NC2=O)=O)C=C1 GWVQBYKXVMJUTC-SYQHCUMBSA-N 0.000 description 1
- DCMOKHVROIRMGQ-KSYZLYKTSA-N [[(2r,3s,4r,5s)-5-(7-amino-2h-pyrazolo[4,3-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound N1N=C2C(N)=NC=NC2=C1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O DCMOKHVROIRMGQ-KSYZLYKTSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 1
- NHQSDCRALZPVAJ-HJQYOEGKSA-N agmatidine Chemical compound NC(=N)NCCCCNC1=NC(=N)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NHQSDCRALZPVAJ-HJQYOEGKSA-N 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- PYMYPHUHKUWMLA-MROZADKFSA-N aldehydo-L-ribose Chemical compound OC[C@H](O)[C@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-MROZADKFSA-N 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000005089 alkenylaminocarbonyl group Chemical group 0.000 description 1
- 125000005090 alkenylcarbonyl group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 230000002009 allergenic effect Effects 0.000 description 1
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical compound OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229940059260 amidate Drugs 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000005021 aminoalkenyl group Chemical group 0.000 description 1
- 125000005014 aminoalkynyl group Chemical group 0.000 description 1
- 125000005001 aminoaryl group Chemical group 0.000 description 1
- BBDAGFIXKZCXAH-CCXZUQQUSA-N ancitabine Chemical compound N=C1C=CN2[C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3OC2=N1 BBDAGFIXKZCXAH-CCXZUQQUSA-N 0.000 description 1
- MYYIAHXIVFADCU-QMMMGPOBSA-N anserine Chemical compound CN1C=NC=C1C[C@H](NC(=O)CC[NH3+])C([O-])=O MYYIAHXIVFADCU-QMMMGPOBSA-N 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 125000005125 aryl alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 1
- 125000005128 aryl amino alkyl group Chemical group 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- 208000015991 autosomal recessive spinocerebellar ataxia 8 Diseases 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
- 108010028263 bacteriophage T3 RNA polymerase Proteins 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004935 benzoxazolinyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000005512 benztetrazolyl group Chemical group 0.000 description 1
- 108091008324 binding proteins Proteins 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000000090 biomarker Substances 0.000 description 1
- HLXNASHROJCNNO-UHFFFAOYSA-N bis(2-cyanoethyl) hydrogen phosphate Chemical compound N#CCCOP(=O)(O)OCCC#N HLXNASHROJCNNO-UHFFFAOYSA-N 0.000 description 1
- UORVGPXVDQYIDP-BJUDXGSMSA-N borane Chemical group [10BH3] UORVGPXVDQYIDP-BJUDXGSMSA-N 0.000 description 1
- 125000001300 boranyl group Chemical group [H]B([H])[*] 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 210000004899 c-terminal region Anatomy 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000001369 canonical nucleoside group Chemical group 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 125000004623 carbolinyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 229940044199 carnosine Drugs 0.000 description 1
- CQOVPNPJLQNMDC-ZETCQYMHSA-N carnosine Chemical compound [NH3+]CCC(=O)N[C@H](C([O-])=O)CC1=CNC=N1 CQOVPNPJLQNMDC-ZETCQYMHSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 239000013592 cell lysate Substances 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 210000004671 cell-free system Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 238000003759 clinical diagnosis Methods 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 108010011222 cyclo(Arg-Pro) Proteins 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- XSYZCZPCBXYQTE-UHFFFAOYSA-N cyclodecylcyclodecane Chemical compound C1CCCCCCCCC1C1CCCCCCCCC1 XSYZCZPCBXYQTE-UHFFFAOYSA-N 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- UUGITDASWNOAGG-CCXZUQQUSA-N cyclouridine Chemical compound O=C1C=CN2[C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3OC2=N1 UUGITDASWNOAGG-CCXZUQQUSA-N 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005070 decynyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C#C* 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000002716 delivery method Methods 0.000 description 1
- 125000002637 deoxyribonucleotide group Chemical group 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- 239000001177 diphosphate Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- NAGJZTKCGNOGPW-UHFFFAOYSA-N dithiophosphoric acid Chemical class OP(O)(S)=S NAGJZTKCGNOGPW-UHFFFAOYSA-N 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 229940093476 ethylene glycol Drugs 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- NPUKDXXFDDZOKR-LLVKDONJSA-N etomidate Chemical compound CCOC(=O)C1=CN=CN1[C@H](C)C1=CC=CC=C1 NPUKDXXFDDZOKR-LLVKDONJSA-N 0.000 description 1
- 238000013265 extended release Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 125000005519 fluorenylmethyloxycarbonyl group Chemical group 0.000 description 1
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- MTCJZZBQNCXKAP-KSYZLYKTSA-N formycin B Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1C1=NNC2=C1NC=NC2=O MTCJZZBQNCXKAP-KSYZLYKTSA-N 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229930182830 galactose Natural products 0.000 description 1
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 1
- 230000030279 gene silencing Effects 0.000 description 1
- 208000016361 genetic disease Diseases 0.000 description 1
- 229940097042 glucuronate Drugs 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 229940049906 glutamate Drugs 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N glutaric acid Chemical compound OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N glycerol 1-phosphate Chemical compound OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- 125000003827 glycol group Chemical group 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 108010064833 guanylyltransferase Proteins 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- FBPFZTCFMRRESA-UHFFFAOYSA-N hexane-1,2,3,4,5,6-hexol Chemical compound OCC(O)C(O)C(O)C(O)CO FBPFZTCFMRRESA-UHFFFAOYSA-N 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- AFQIYTIJXGTIEY-UHFFFAOYSA-N hydrogen carbonate;triethylazanium Chemical compound OC(O)=O.CCN(CC)CC AFQIYTIJXGTIEY-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000004680 hydrogen peroxides Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000005113 hydroxyalkoxy group Chemical group 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 230000028993 immune response Effects 0.000 description 1
- 230000005847 immunogenicity Effects 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 125000004926 indolenyl group Chemical group 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000004936 isatinoyl group Chemical group N1(C(=O)C(=O)C2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 125000005438 isoindazolyl group Chemical group 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical group C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical group C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229940001447 lactate Drugs 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 210000005228 liver tissue Anatomy 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- 230000031852 maintenance of location in cell Effects 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 229960001855 mannitol Drugs 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 208000030159 metabolic disease Diseases 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- JNVLKTZUCGRYNN-LQGIRWEJSA-N methyl 2-[1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-2-hydroxyacetate Chemical compound O=C1NC(=O)C(C(O)C(=O)OC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 JNVLKTZUCGRYNN-LQGIRWEJSA-N 0.000 description 1
- AHIQDGXXLZVOGZ-UGKPPGOTSA-N methyl 3-[1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enoate Chemical compound O=C1NC(=O)C(C=CC(=O)OC)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 AHIQDGXXLZVOGZ-UGKPPGOTSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 108091051828 miR-122 stem-loop Proteins 0.000 description 1
- 239000002679 microRNA Substances 0.000 description 1
- 238000000520 microinjection Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000004001 molecular interaction Effects 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 150000004712 monophosphates Chemical class 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- XJVXMWNLQRTRGH-UHFFFAOYSA-N n-(3-methylbut-3-enyl)-2-methylsulfanyl-7h-purin-6-amine Chemical compound CSC1=NC(NCCC(C)=C)=C2NC=NC2=N1 XJVXMWNLQRTRGH-UHFFFAOYSA-N 0.000 description 1
- BPRQFDNBWVMLPS-UHFFFAOYSA-N n-(3-methylbut-3-enyl)-7h-purin-6-amine Chemical compound CC(=C)CCNC1=NC=NC2=C1NC=N2 BPRQFDNBWVMLPS-UHFFFAOYSA-N 0.000 description 1
- ZURGFCUYILNMNA-UHFFFAOYSA-N n-(7h-purin-6-yl)acetamide Chemical compound CC(=O)NC1=NC=NC2=C1NC=N2 ZURGFCUYILNMNA-UHFFFAOYSA-N 0.000 description 1
- YHNZVIUHARVGLV-UHFFFAOYSA-N n-(7h-purin-6-yl)formamide Chemical compound O=CNC1=NC=NC2=C1NC=N2 YHNZVIUHARVGLV-UHFFFAOYSA-N 0.000 description 1
- BNXBRFDWSPXODM-BPGGGUHBSA-N n-[1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)N=C(NC(=O)C=2C=CC=CC=2)C=C1 BNXBRFDWSPXODM-BPGGGUHBSA-N 0.000 description 1
- VGVAJQHEAVKOAB-PNHWDRBUSA-N n-[1-[(2r,3s,4r,5r)-3-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide Chemical compound O=C1N=C(NC(=O)C)C=CN1[C@H]1[C@](F)(O)[C@H](O)[C@@H](CO)O1 VGVAJQHEAVKOAB-PNHWDRBUSA-N 0.000 description 1
- BBJXVWOUESNRCD-IOSLPCCCSA-N n-[9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]formamide Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(NC=O)=C2N=C1 BBJXVWOUESNRCD-IOSLPCCCSA-N 0.000 description 1
- MGAXVRDPWFFLTF-UHFFFAOYSA-N n-methyl-2-methylsulfanyl-7h-purin-6-amine Chemical compound CNC1=NC(SC)=NC2=C1NC=N2 MGAXVRDPWFFLTF-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 230000004770 neurodegeneration Effects 0.000 description 1
- 208000015122 neurodegenerative disease Diseases 0.000 description 1
- 125000005187 nonenyl group Chemical group C(=CCCCCCCC)* 0.000 description 1
- 230000002352 nonmutagenic effect Effects 0.000 description 1
- 230000037434 nonsense mutation Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000005071 nonynyl group Chemical group C(#CCCCCCCC)* 0.000 description 1
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 125000005069 octynyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C#C* 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- QNNHQVPFZIFNFK-UHFFFAOYSA-N oxazolo[4,5-b]pyridine Chemical compound C1=CC=C2OC=NC2=N1 QNNHQVPFZIFNFK-UHFFFAOYSA-N 0.000 description 1
- 125000004095 oxindolyl group Chemical group N1(C(CC2=CC=CC=C12)=O)* 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluenecarboxylic acid Natural products CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 102000007863 pattern recognition receptors Human genes 0.000 description 1
- 108010089193 pattern recognition receptors Proteins 0.000 description 1
- 125000003933 pentacenyl group Chemical group C1(=CC=CC2=CC3=CC4=CC5=CC=CC=C5C=C4C=C3C=C12)* 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000004932 phenoxathinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- PTMHPRAIXMAOOB-UHFFFAOYSA-L phosphoramidate Chemical group NP([O-])([O-])=O PTMHPRAIXMAOOB-UHFFFAOYSA-L 0.000 description 1
- 150000008299 phosphorodiamidates Chemical class 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 125000004928 piperidonyl group Chemical group 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 230000000770 proinflammatory effect Effects 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000004853 protein function Effects 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000004219 purine nucleobase group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000001725 pyrenyl group Chemical group 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical group C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- FICMSTTYJICTDM-UHFFFAOYSA-N pyridazine;triazine Chemical compound C1=CC=NN=C1.C1=CN=NN=C1 FICMSTTYJICTDM-UHFFFAOYSA-N 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Chemical group COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 230000007115 recruitment Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000022532 regulation of transcription, DNA-dependent Effects 0.000 description 1
- 230000008844 regulatory mechanism Effects 0.000 description 1
- 230000008672 reprogramming Effects 0.000 description 1
- 210000001995 reticulocyte Anatomy 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- 108091092562 ribozyme Proteins 0.000 description 1
- 238000007157 ring contraction reaction Methods 0.000 description 1
- 238000006049 ring expansion reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 102200073741 rs121909602 Human genes 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 238000006884 silylation reaction Methods 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 210000000130 stem cell Anatomy 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000001935 tetracenyl group Chemical class C1(=CC=CC2=CC3=CC4=CC=CC=C4C=C3C=C12)* 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- 125000005300 thiocarboxy group Chemical group C(=S)(O)* 0.000 description 1
- 229930192474 thiophene Chemical group 0.000 description 1
- IBBLKSWSCDAPIF-UHFFFAOYSA-N thiopyran Chemical compound S1C=CC=C=C1 IBBLKSWSCDAPIF-UHFFFAOYSA-N 0.000 description 1
- 229950000329 thiouracil Drugs 0.000 description 1
- XXYIANZGUOSQHY-XLPZGREQSA-N thymidine 3'-monophosphate Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](OP(O)(O)=O)C1 XXYIANZGUOSQHY-XLPZGREQSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 238000007070 tosylation reaction Methods 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 230000005030 transcription termination Effects 0.000 description 1
- 239000012096 transfection reagent Substances 0.000 description 1
- 108091005703 transmembrane proteins Proteins 0.000 description 1
- 102000035160 transmembrane proteins Human genes 0.000 description 1
- 238000002054 transplantation Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical group 0.000 description 1
- 125000002306 tributylsilyl group Chemical group C(CCC)[Si](CCCC)(CCCC)* 0.000 description 1
- 125000004784 trichloromethoxy group Chemical group ClC(O*)(Cl)Cl 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 108010027510 vaccinia virus capping enzyme Proteins 0.000 description 1
- 230000035899 viability Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 210000005253 yeast cell Anatomy 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H19/00—Compounds containing a hetero ring sharing one ring hetero atom with a saccharide radical; Nucleosides; Mononucleotides; Anhydro-derivatives thereof
- C07H19/02—Compounds containing a hetero ring sharing one ring hetero atom with a saccharide radical; Nucleosides; Mononucleotides; Anhydro-derivatives thereof sharing nitrogen
- C07H19/04—Heterocyclic radicals containing only nitrogen atoms as ring hetero atom
- C07H19/16—Purine radicals
- C07H19/20—Purine radicals with the saccharide radical esterified by phosphoric or polyphosphoric acids
- C07H19/207—Purine radicals with the saccharide radical esterified by phosphoric or polyphosphoric acids the phosphoric or polyphosphoric acids being esterified by a further hydroxylic compound, e.g. flavine adenine dinucleotide or nicotinamide-adenine dinucleotide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H19/00—Compounds containing a hetero ring sharing one ring hetero atom with a saccharide radical; Nucleosides; Mononucleotides; Anhydro-derivatives thereof
- C07H19/02—Compounds containing a hetero ring sharing one ring hetero atom with a saccharide radical; Nucleosides; Mononucleotides; Anhydro-derivatives thereof sharing nitrogen
- C07H19/04—Heterocyclic radicals containing only nitrogen atoms as ring hetero atom
- C07H19/16—Purine radicals
- C07H19/20—Purine radicals with the saccharide radical esterified by phosphoric or polyphosphoric acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H21/00—Compounds containing two or more mononucleotide units having separate phosphate or polyphosphate groups linked by saccharide radicals of nucleoside groups, e.g. nucleic acids
- C07H21/02—Compounds containing two or more mononucleotide units having separate phosphate or polyphosphate groups linked by saccharide radicals of nucleoside groups, e.g. nucleic acids with ribosyl as saccharide radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Biochemistry (AREA)
- Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201562242881P | 2015-10-16 | 2015-10-16 | |
| US62/242,881 | 2015-10-16 | ||
| PCT/US2016/057405 WO2017066793A1 (en) | 2015-10-16 | 2016-10-17 | Mrna cap analogs and methods of mrna capping |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA3001014A1 true CA3001014A1 (en) | 2017-04-20 |
Family
ID=57219027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA3001014A Abandoned CA3001014A1 (en) | 2015-10-16 | 2016-10-17 | Mrna cap analogs and methods of mrna capping |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US20190225644A1 (OSRAM) |
| EP (1) | EP3362460A1 (OSRAM) |
| JP (1) | JP2018530587A (OSRAM) |
| AU (1) | AU2016340183A1 (OSRAM) |
| CA (1) | CA3001014A1 (OSRAM) |
| WO (1) | WO2017066793A1 (OSRAM) |
Families Citing this family (86)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK3362461T3 (da) * | 2015-10-16 | 2022-05-09 | Modernatx Inc | Mrna-cap-analoger med modificeret phosphatbinding |
| US11866754B2 (en) | 2015-10-16 | 2024-01-09 | Modernatx, Inc. | Trinucleotide mRNA cap analogs |
| WO2018075827A1 (en) | 2016-10-19 | 2018-04-26 | Arcturus Therapeutics, Inc. | Trinucleotide mrna cap analogs |
| US11920148B2 (en) | 2017-02-22 | 2024-03-05 | Crispr Therapeutics Ag | Compositions and methods for gene editing |
| US10988754B2 (en) | 2017-07-04 | 2021-04-27 | Cure Vac AG | Nucleic acid molecules |
| EP3673069A1 (en) | 2017-08-22 | 2020-07-01 | CureVac AG | Bunyavirales vaccine |
| JP2021502079A (ja) | 2017-11-08 | 2021-01-28 | キュアバック アーゲー | RNA配列の適合(Adaptation) |
| EP3723796A1 (en) | 2017-12-13 | 2020-10-21 | CureVac AG | Flavivirus vaccine |
| US11897911B2 (en) * | 2018-03-07 | 2024-02-13 | Sanofi | Nucleotide precursors, nucleotide analogs and oligomeric compounds containing the same |
| MX2020010871A (es) * | 2018-03-15 | 2020-11-09 | BioNTech SE | Compuestos de 5'-caperuza-trinucleótidos u oligonucleótidos superiores y sus usos en estabilizar arn, que expresan proteínas y en la terapia. |
| WO2019193183A2 (en) | 2018-04-05 | 2019-10-10 | Curevac Ag | Novel yellow fever nucleic acid molecules for vaccination |
| US11220510B2 (en) | 2018-04-09 | 2022-01-11 | Incyte Corporation | Pyrrole tricyclic compounds as A2A / A2B inhibitors |
| EP4227319B1 (en) | 2018-04-17 | 2025-11-26 | CureVac SE | Novel rsv rna molecules and compositions for vaccination |
| CN108484690B (zh) * | 2018-05-16 | 2021-04-30 | 新乡拓新药业股份有限公司 | 一种1,2,3-三-O-乙酰基-5-脱氧-β-D-核糖的制备方法 |
| US20210260178A1 (en) | 2018-06-27 | 2021-08-26 | Curevac Ag | Novel lassa virus rna molecules and compositions for vaccination |
| GB2592505B (en) * | 2018-09-04 | 2023-05-03 | Univ Texas | Compositions and methods for organ specific delivery of nucleic acids |
| EP3897702A2 (en) | 2018-12-21 | 2021-10-27 | CureVac AG | Rna for malaria vaccines |
| SG11202106666UA (en) | 2018-12-21 | 2021-07-29 | Curevac Ag | Methods for rna analysis |
| WO2020161342A1 (en) | 2019-02-08 | 2020-08-13 | Curevac Ag | Coding rna administered into the suprachoroidal space in the treatment of ophtalmic diseases |
| SG11202110742TA (en) | 2019-04-02 | 2021-10-28 | Aligos Therapeutics Inc | Compounds targeting prmt5 |
| WO2020254535A1 (en) | 2019-06-18 | 2020-12-24 | Curevac Ag | Rotavirus mrna vaccine |
| US20220296628A1 (en) | 2019-08-14 | 2022-09-22 | Curevac Ag | Rna combinations and compositions with decreased immunostimulatory properties |
| CN112390838A (zh) * | 2019-08-14 | 2021-02-23 | 斯微(上海)生物科技有限公司 | 一种改性核苷及其合成方法 |
| EP4028408A4 (en) * | 2019-09-05 | 2023-10-18 | Mitorainbow Therapeutics, Inc. | TREATMENT OF MITOCHONDRIAL DNA DEPUPPERATION DISORDERS |
| AU2020407285A1 (en) | 2019-12-20 | 2022-08-11 | CureVac SE | Lipid nanoparticles for delivery of nucleic acids |
| US12194089B2 (en) | 2020-02-04 | 2025-01-14 | CureVac SE | Coronavirus vaccine |
| KR20220144416A (ko) | 2020-02-04 | 2022-10-26 | 큐어백 아게 | 코로나바이러스 백신 |
| TWI794742B (zh) | 2020-02-18 | 2023-03-01 | 美商基利科學股份有限公司 | 抗病毒化合物 |
| AR121356A1 (es) | 2020-02-18 | 2022-05-11 | Gilead Sciences Inc | Compuestos antivirales |
| TWI775313B (zh) | 2020-02-18 | 2022-08-21 | 美商基利科學股份有限公司 | 抗病毒化合物 |
| JP2023522249A (ja) | 2020-04-22 | 2023-05-29 | ビオンテック・ソシエタス・エウロパエア | コロナウイルスワクチン |
| MX2022015132A (es) | 2020-05-29 | 2023-03-08 | CureVac SE | Vacunas combinadas a base de acidos nucleicos. |
| CA3170741A1 (en) | 2020-07-31 | 2022-02-03 | Curevac Ag | Nucleic acid encoded antibody mixtures |
| US20240066114A1 (en) | 2020-08-31 | 2024-02-29 | CureVac SE | Multivalent nucleic acid based coronavirus vaccines |
| EP4208549A4 (en) * | 2020-09-04 | 2025-04-16 | Verve Therapeutics, Inc. | Compositions and methods for capping RNAs |
| US20240299309A1 (en) | 2020-12-22 | 2024-09-12 | CureVac SE | Pharmaceutical composition comprising lipid-based carriers encapsulating rna for multidose administration |
| MX2023007574A (es) | 2020-12-22 | 2023-09-29 | CureVac SE | "vacuna de arn contra variantes de sars-cov-2. |
| WO2022137133A1 (en) | 2020-12-22 | 2022-06-30 | Curevac Ag | Rna vaccine against sars-cov-2 variants |
| WO2022162027A2 (en) | 2021-01-27 | 2022-08-04 | Curevac Ag | Method of reducing the immunostimulatory properties of in vitro transcribed rna |
| CA3212653A1 (en) | 2021-03-26 | 2022-09-29 | Glaxosmithkline Biologicals Sa | Immunogenic compositions |
| WO2022207862A2 (en) | 2021-03-31 | 2022-10-06 | Curevac Ag | Syringes containing pharmaceutical compositions comprising rna |
| ES3028915T3 (en) | 2021-04-16 | 2025-06-20 | Gilead Sciences Inc | Methods of preparing carbanucleosides using amides |
| WO2022233880A1 (en) | 2021-05-03 | 2022-11-10 | Curevac Ag | Improved nucleic acid sequence for cell type specific expression |
| WO2022266316A1 (en) | 2021-06-18 | 2022-12-22 | Hongene Biotech Corporation | Functionalized n-acetylgalactosamine nucleosides |
| US20240342206A1 (en) | 2021-07-30 | 2024-10-17 | CureVac SE | mRNAS FOR TREATMENT OR PROPHYLAXIS OF LIVER DISEASES |
| US20250002524A1 (en) * | 2021-07-30 | 2025-01-02 | CureVac SE | Cap analogs having an acyclic linker to the guanine derivative nucleobase |
| EP4387977A1 (en) | 2021-08-18 | 2024-06-26 | Gilead Sciences, Inc. | Phospholipid compounds and methods of making and using the same |
| JP2024532271A (ja) | 2021-08-30 | 2024-09-05 | ホンジーン バイオテック コーポレイション | 官能化n-アセチルガラクトサミンアナログ |
| AU2022336664A1 (en) | 2021-09-03 | 2024-01-18 | CureVac SE | Novel lipid nanoparticles for delivery of nucleic acids comprising phosphatidylserine |
| AU2022336209B2 (en) | 2021-09-03 | 2025-10-16 | CureVac SE | Novel lipid nanoparticles for delivery of nucleic acids |
| US20250027108A1 (en) | 2021-10-29 | 2025-01-23 | CureVac SE | Improved circular rna for expressing therapeutic proteins |
| US12186387B2 (en) | 2021-11-29 | 2025-01-07 | BioNTech SE | Coronavirus vaccine |
| WO2023114746A1 (en) | 2021-12-15 | 2023-06-22 | Hongene Biotech Corporation | Functionalized n-acetylgalactosamine analogs |
| US20250099614A1 (en) | 2022-01-28 | 2025-03-27 | CureVac SE | Nucleic acid encoded transcription factor inhibitors |
| AU2023227443A1 (en) | 2022-03-01 | 2024-10-10 | Crispr Therapeutics Ag | Methods and compositions for treating angiopoietin-like 3 (angptl3) related conditions |
| WO2023180904A1 (en) | 2022-03-21 | 2023-09-28 | Crispr Therapeutics Ag | Methods and compositions for treating lipoprotein-related diseases |
| CN114685588B (zh) * | 2022-05-05 | 2024-03-29 | 江苏申基生物科技有限公司 | 一种含开环核苷结构的起始加帽寡核苷酸引物 |
| AU2023274371A1 (en) | 2022-05-25 | 2024-10-31 | CureVac SE | Nucleic acid based vaccine encoding an escherichia coli fimh antigenic polypeptide |
| CN114853836B (zh) * | 2022-06-24 | 2024-05-14 | 江苏申基生物科技有限公司 | 一种含gna结构的起始加帽寡核苷酸引物及其制备方法和应用 |
| WO2023246860A1 (zh) * | 2022-06-22 | 2023-12-28 | 江苏申基生物科技有限公司 | 一种起始加帽寡核苷酸引物及其制备方法和应用 |
| CN115057903B (zh) * | 2022-06-22 | 2024-03-29 | 江苏申基生物科技有限公司 | 一种含吗啉环结构的起始加帽寡核苷酸引物及其制备方法和应用 |
| CN115109110B (zh) * | 2022-06-22 | 2024-07-12 | 江苏申基生物科技有限公司 | 一种含六元糖环结构的起始加帽寡核苷酸引物及其制备方法和应用 |
| US11878055B1 (en) | 2022-06-26 | 2024-01-23 | BioNTech SE | Coronavirus vaccine |
| WO2024068545A1 (en) | 2022-09-26 | 2024-04-04 | Glaxosmithkline Biologicals Sa | Influenza virus vaccines |
| WO2024089229A1 (en) | 2022-10-28 | 2024-05-02 | CureVac SE | Improved formulations comprising lipid-based carriers encapsulating rna |
| WO2024089638A1 (en) | 2022-10-28 | 2024-05-02 | Glaxosmithkline Biologicals Sa | Nucleic acid based vaccine |
| US12116382B2 (en) | 2022-11-28 | 2024-10-15 | Hongene Biotech Corporation | Functionalized N-acetylgalactosamine analogs |
| CN115947759A (zh) * | 2022-12-13 | 2023-04-11 | 安徽大学 | 一种治疗新冠药物瑞德西韦的制备方法 |
| EP4658239A1 (en) | 2023-02-03 | 2025-12-10 | GlaxoSmithKline Biologicals S.A. | Rna formulation |
| GB202302092D0 (en) | 2023-02-14 | 2023-03-29 | Glaxosmithkline Biologicals Sa | Analytical method |
| AU2024233180A1 (en) | 2023-03-08 | 2025-09-25 | CureVac SE | Novel lipid nanoparticle formulations for delivery of nucleic acids |
| WO2024223724A1 (en) | 2023-04-27 | 2024-10-31 | Glaxosmithkline Biologicals Sa | Influenza virus vaccines |
| WO2024223728A1 (en) | 2023-04-27 | 2024-10-31 | Glaxosmithkline Biologicals Sa | Influenza virus vaccines |
| WO2024230934A1 (en) | 2023-05-11 | 2024-11-14 | CureVac SE | Therapeutic nucleic acid for the treatment of ophthalmic diseases |
| WO2024235451A1 (en) | 2023-05-16 | 2024-11-21 | CureVac RNA Printer GmbH | Improved rna in vitro transcription using dna beads |
| AU2024278682A1 (en) | 2023-05-26 | 2025-11-27 | CureVac SE | Cancer antigens |
| WO2024260570A1 (en) | 2023-06-23 | 2024-12-26 | CureVac SE | Nucleic acid encoded antibodies |
| WO2025005647A1 (ko) * | 2023-06-26 | 2025-01-02 | 전북대학교산학협력단 | 새로운 변형 트리뉴클레오티드 캡핑 유도체와 캡핑 유도체가 도입된 mRNA |
| US20250027087A1 (en) | 2023-07-21 | 2025-01-23 | Crispr Therapeutics Ag | Modulating expression of alas1 (5'-aminolevulinate synthase 1) gene |
| CN116987137B (zh) * | 2023-09-26 | 2024-01-02 | 江苏申基生物科技有限公司 | 一种加帽化合物及其在mRNA加帽中的应用 |
| WO2025103803A1 (en) | 2023-11-13 | 2025-05-22 | CureVac SE | Immunotherapy against neuronal and brain tumors |
| WO2025132839A1 (en) | 2023-12-21 | 2025-06-26 | Glaxosmithkline Biologicals Sa | Influenza virus vaccines |
| WO2025141025A2 (en) * | 2023-12-26 | 2025-07-03 | Eleven Therapeutics Ltd | Novel capping strategies for mrna 5'cap |
| US20250269059A1 (en) | 2024-02-27 | 2025-08-28 | Crispr Therapeutics Ag | Rt editing compositions and methods |
| WO2025186726A1 (en) | 2024-03-05 | 2025-09-12 | Crispr Therapeutics Ag | Modulating expression of agt (angiotensinogen) gene |
| GB202404607D0 (en) | 2024-03-29 | 2024-05-15 | Glaxosmithkline Biologicals Sa | RNA formulation |
Family Cites Families (83)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6111095A (en) * | 1995-06-07 | 2000-08-29 | Merck & Co., Inc. | Capped synthetic RNA, analogs, and aptamers |
| US5763263A (en) | 1995-11-27 | 1998-06-09 | Dehlinger; Peter J. | Method and apparatus for producing position addressable combinatorial libraries |
| US5962271A (en) * | 1996-01-03 | 1999-10-05 | Cloutech Laboratories, Inc. | Methods and compositions for generating full-length cDNA having arbitrary nucleotide sequence at the 3'-end |
| KR100414936B1 (ko) | 1997-09-12 | 2004-01-13 | 엑시콘 에이/에스 | 이환 및 삼환 뉴클레오시드, 뉴클레오타이드 및올리고뉴클레오타이드 동족체 |
| CA2309535A1 (en) | 1997-11-12 | 1999-05-20 | Brigham And Women's Hospital, Inc. | The translation enhancer element of the human amyloid precursor protein gene |
| US6429301B1 (en) * | 1998-04-17 | 2002-08-06 | Whitehead Institute For Biomedical Research | Use of a ribozyme to join nucleic acids and peptides |
| EP1073730A1 (en) * | 1998-04-17 | 2001-02-07 | Whitehead For Biomedical Research | Use of a ribozyme to join nucleic acids and peptides |
| AU3120601A (en) | 2000-01-28 | 2001-08-07 | Scripps Research Inst | Methods of identifying synthetic transcriptional and translational regulatory elements, and compositions relating to same |
| US7468275B2 (en) | 2000-01-28 | 2008-12-23 | The Scripps Research Institute | Synthetic internal ribosome entry sites and methods of identifying same |
| US8202979B2 (en) * | 2002-02-20 | 2012-06-19 | Sirna Therapeutics, Inc. | RNA interference mediated inhibition of gene expression using chemically modified short interfering nucleic acid |
| US8273866B2 (en) * | 2002-02-20 | 2012-09-25 | Merck Sharp & Dohme Corp. | RNA interference mediated inhibition of gene expression using chemically modified short interfering nucleic acid (SINA) |
| DE50214201D1 (de) * | 2001-06-05 | 2010-03-25 | Curevac Gmbh | Stabilisierte mRNA mit erhöhtem G/C-Gehalt, enkodierend für ein bakterielles Antigen sowie deren Verwendung |
| DE10162480A1 (de) | 2001-12-19 | 2003-08-07 | Ingmar Hoerr | Die Applikation von mRNA für den Einsatz als Therapeutikum gegen Tumorerkrankungen |
| US20050222064A1 (en) | 2002-02-20 | 2005-10-06 | Sirna Therapeutics, Inc. | Polycationic compositions for cellular delivery of polynucleotides |
| DE10229872A1 (de) | 2002-07-03 | 2004-01-29 | Curevac Gmbh | Immunstimulation durch chemisch modifizierte RNA |
| DE10335833A1 (de) | 2003-08-05 | 2005-03-03 | Curevac Gmbh | Transfektion von Blutzellen mit mRNA zur Immunstimulation und Gentherapie |
| DE102004042546A1 (de) | 2004-09-02 | 2006-03-09 | Curevac Gmbh | Kombinationstherapie zur Immunstimulation |
| DE102005023170A1 (de) | 2005-05-19 | 2006-11-23 | Curevac Gmbh | Optimierte Formulierung für mRNA |
| HUE043492T2 (hu) * | 2005-08-23 | 2019-08-28 | Univ Pennsylvania | Módosított nukleozidokat tartalmazó RNS és eljárások az alkalmazására |
| WO2007025008A2 (en) | 2005-08-24 | 2007-03-01 | The Scripps Research Institute | Translation enhancer-element dependent vector systems |
| DE102005046490A1 (de) * | 2005-09-28 | 2007-03-29 | Johannes-Gutenberg-Universität Mainz | Modifikationen von RNA, die zu einer erhöhten Transkriptstabilität und Translationseffizienz führen |
| DE102006007433A1 (de) | 2006-02-17 | 2007-08-23 | Curevac Gmbh | Adjuvanz in Form einer Lipid-modifizierten Nukleinsäure |
| US8304529B2 (en) * | 2006-07-28 | 2012-11-06 | Life Technologies Corporation | Dinucleotide MRNA cap analogs |
| JP2010507361A (ja) | 2006-07-31 | 2010-03-11 | キュアバック ゲーエムベーハー | 具体的には免疫刺激剤/アジュバントとしての、一般式(I):GlXmGn、または一般式(II):ClXmCnで表される核酸 |
| DE102006051516A1 (de) | 2006-10-31 | 2008-05-08 | Curevac Gmbh | (Basen-)modifizierte RNA zur Expressionssteigerung eines Proteins |
| DE102006061015A1 (de) | 2006-12-22 | 2008-06-26 | Curevac Gmbh | Verfahren zur Reinigung von RNA im präparativen Maßstab mittels HPLC |
| DE102007001370A1 (de) | 2007-01-09 | 2008-07-10 | Curevac Gmbh | RNA-kodierte Antikörper |
| US8859229B2 (en) * | 2007-02-02 | 2014-10-14 | Yale University | Transient transfection with RNA |
| WO2009030254A1 (en) | 2007-09-04 | 2009-03-12 | Curevac Gmbh | Complexes of rna and cationic peptides for transfection and for immunostimulation |
| EP2527439B1 (en) | 2007-12-11 | 2014-03-26 | The Scripps Research Institute | Compositions and methods related to mRNA translational enhancer elements |
| MX2010008468A (es) | 2008-01-31 | 2010-08-30 | Curevac Gmbh | Acidos nucleicos de la formula (i) (nug1xmgnnv)a y derivados de los mismos como un agente/adyuvante inmunoestimulante. |
| EP2271351A4 (en) * | 2008-04-03 | 2016-08-31 | Spring Bank Pharmaceuticals Inc | COMPOSITIONS AND METHODS FOR TREATING VIRAL INFECTIONS |
| WO2009127230A1 (en) | 2008-04-16 | 2009-10-22 | Curevac Gmbh | MODIFIED (m)RNA FOR SUPPRESSING OR AVOIDING AN IMMUNOSTIMULATORY RESPONSE AND IMMUNOSUPPRESSIVE COMPOSITION |
| WO2010037408A1 (en) | 2008-09-30 | 2010-04-08 | Curevac Gmbh | Composition comprising a complexed (m)rna and a naked mrna for providing or enhancing an immunostimulatory response in a mammal and uses thereof |
| WO2010088927A1 (en) | 2009-02-09 | 2010-08-12 | Curevac Gmbh | Use of pei for the improvement of endosomal release and expression of transfected nucleic acids, complexed with cationic or polycationic compounds |
| EP2401365B1 (en) * | 2009-02-24 | 2016-04-27 | The Scripps Research Institute | Reengineering mrna primary structure for enhanced protein production |
| EP2281579A1 (en) * | 2009-08-05 | 2011-02-09 | BioNTech AG | Vaccine composition comprising 5'-Cap modified RNA |
| US20110053829A1 (en) | 2009-09-03 | 2011-03-03 | Curevac Gmbh | Disulfide-linked polyethyleneglycol/peptide conjugates for the transfection of nucleic acids |
| EP3403647A1 (en) * | 2009-12-01 | 2018-11-21 | Translate Bio, Inc. | Delivery of mrna for the augmentation of proteins and enzymes in human genetic diseases |
| WO2011069529A1 (en) | 2009-12-09 | 2011-06-16 | Curevac Gmbh | Mannose-containing solution for lyophilization, transfection and/or injection of nucleic acids |
| WO2011130624A2 (en) * | 2010-04-16 | 2011-10-20 | Immune Disease Institute, Inc. | Sustained polypeptide expression from synthetic, modified rnas and uses thereof |
| EP2387999A1 (en) | 2010-05-21 | 2011-11-23 | CureVac GmbH | Histidine-containing solution for transfection and/or injection of nucleic acids and uses thereof |
| EP2575895A2 (en) | 2010-05-24 | 2013-04-10 | Merck Sharp & Dohme Corp. | Novel amino alcohol cationic lipids for oligonucleotide delivery |
| US9192661B2 (en) * | 2010-07-06 | 2015-11-24 | Novartis Ag | Delivery of self-replicating RNA using biodegradable polymer particles |
| WO2012009644A2 (en) | 2010-07-16 | 2012-01-19 | Arizona Board Of Regents | Methods to identify synthetic and natural rna elements that enhance protein translation |
| CA2801523C (en) | 2010-07-30 | 2021-08-03 | Curevac Gmbh | Complexation of nucleic acids with disulfide-crosslinked cationic components for transfection and immunostimulation |
| WO2012019630A1 (en) | 2010-08-13 | 2012-02-16 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded protein |
| WO2012089225A1 (en) | 2010-12-29 | 2012-07-05 | Curevac Gmbh | Combination of vaccination and inhibition of mhc class i restricted antigen presentation |
| WO2012116715A1 (en) | 2011-03-02 | 2012-09-07 | Curevac Gmbh | Vaccination in newborns and infants |
| WO2012113413A1 (en) | 2011-02-21 | 2012-08-30 | Curevac Gmbh | Vaccine composition comprising complexed immunostimulatory nucleic acids and antigens packaged with disulfide-linked polyethyleneglycol/peptide conjugates |
| WO2012116714A1 (en) | 2011-03-02 | 2012-09-07 | Curevac Gmbh | Vaccination in elderly patients |
| WO2013059475A1 (en) * | 2011-10-18 | 2013-04-25 | Life Technologies Corporation | Alkynyl-derivatized cap analogs, preparation and uses thereof |
| WO2013103659A1 (en) | 2012-01-04 | 2013-07-11 | Board Of Supervisors Of Louisiana State University And Agricultural And Mechanical College | Stabilizing rna by incorporating chain-terminating nucleosides at the 3'-terminus |
| EP2623121A1 (en) | 2012-01-31 | 2013-08-07 | Bayer Innovation GmbH | Pharmaceutical composition comprising a polymeric carrier cargo complex and an antigen |
| WO2013113326A1 (en) | 2012-01-31 | 2013-08-08 | Curevac Gmbh | Pharmaceutical composition comprising a polymeric carrier cargo complex and at least one protein or peptide antigen |
| WO2013113325A1 (en) | 2012-01-31 | 2013-08-08 | Curevac Gmbh | Negatively charged nucleic acid comprising complexes for immunostimulation |
| WO2013120500A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded tumour antigen |
| WO2013120497A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded therapeutic protein |
| WO2013120499A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly (a) sequence or a polyadenylation signal for increasing the expression of an encoded pathogenic antigen |
| WO2013120498A1 (en) | 2012-02-15 | 2013-08-22 | Curevac Gmbh | Nucleic acid comprising or coding for a histone stem-loop and a poly(a) sequence or a polyadenylation signal for increasing the expression of an encoded allergenic antigen or an autoimmune self-antigen |
| RU2651498C2 (ru) | 2012-03-27 | 2018-04-19 | Кьюрвак Аг | Молекулы искусственной нуклеиновой кислоты |
| ES2969742T3 (es) | 2012-03-27 | 2024-05-22 | CureVac SE | Moléculas artificiales de ácido nucleico para la expresión mejorada de proteínas o péptidos |
| BR112014023898A2 (pt) | 2012-03-27 | 2017-07-11 | Curevac Gmbh | moléculas de ácido nucleico artificiais compreendendo 5''utr top |
| EP2854857B1 (en) | 2012-05-25 | 2018-11-28 | CureVac AG | Reversible immobilization and/or controlled release of nucleic acid containing nanoparticles by (biodegradable) polymer coatings |
| CA2892529C (en) * | 2012-11-26 | 2023-04-25 | Moderna Therapeutics, Inc. | Terminally modified rna |
| US9974845B2 (en) | 2013-02-22 | 2018-05-22 | Curevac Ag | Combination of vaccination and inhibition of the PD-1 pathway |
| MX2015011945A (es) * | 2013-03-14 | 2015-12-01 | Shire Human Genetic Therapies | Evaluacion cuantitativa para la eficacia de los casquetes de arn mensajero. |
| WO2015002667A1 (en) | 2013-07-01 | 2015-01-08 | Myq, Inc. | A location regulated point-of-sale system and enhancements |
| KR20160036065A (ko) | 2013-08-16 | 2016-04-01 | 라나 테라퓨틱스, 인크. | Rna를 조정하기 위한 조성물 및 방법 |
| CN105473157A (zh) | 2013-08-21 | 2016-04-06 | 库瑞瓦格股份公司 | 组合疫苗 |
| KR102354389B1 (ko) | 2013-08-21 | 2022-01-20 | 큐어백 아게 | Rna―암호화된 단백질의 발현을 증가시키는 방법 |
| RU2016109938A (ru) | 2013-08-21 | 2017-09-26 | Куревак Аг | Композиция и вакцина для лечения рака предстательной железы |
| CN110195072A (zh) | 2013-08-21 | 2019-09-03 | 库瑞瓦格股份公司 | 狂犬病疫苗 |
| ES2747762T3 (es) | 2013-08-21 | 2020-03-11 | Curevac Ag | Vacuna contra el virus respiratorio sincitial (RSV) |
| SG11201510748PA (en) | 2013-08-21 | 2016-03-30 | Curevac Ag | Composition and vaccine for treating lung cancer |
| EP3052511A4 (en) * | 2013-10-02 | 2017-05-31 | Moderna Therapeutics, Inc. | Polynucleotide molecules and uses thereof |
| US20160264614A1 (en) | 2013-10-02 | 2016-09-15 | Moderna Therapeutics, Inc. | Polynucleotide molecules and uses thereof |
| ES2806575T3 (es) | 2013-11-01 | 2021-02-18 | Curevac Ag | ARN modificado con propiedades inmunoestimuladoras disminuidas |
| GB201320962D0 (en) * | 2013-11-27 | 2014-01-08 | Globalacorn Ltd | Compositions |
| AU2014375402B2 (en) | 2013-12-30 | 2020-10-01 | CureVac SE | Artificial nucleic acid molecules |
| JP6584414B2 (ja) | 2013-12-30 | 2019-10-02 | キュアバック アーゲー | 人工核酸分子 |
| SG11201604198YA (en) | 2013-12-30 | 2016-07-28 | Curevac Ag | Methods for rna analysis |
| DK3362461T3 (da) * | 2015-10-16 | 2022-05-09 | Modernatx Inc | Mrna-cap-analoger med modificeret phosphatbinding |
-
2016
- 2016-10-17 AU AU2016340183A patent/AU2016340183A1/en not_active Abandoned
- 2016-10-17 US US15/768,193 patent/US20190225644A1/en not_active Abandoned
- 2016-10-17 WO PCT/US2016/057405 patent/WO2017066793A1/en not_active Ceased
- 2016-10-17 EP EP16788887.4A patent/EP3362460A1/en not_active Withdrawn
- 2016-10-17 JP JP2018519312A patent/JP2018530587A/ja active Pending
- 2016-10-17 CA CA3001014A patent/CA3001014A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| JP2018530587A (ja) | 2018-10-18 |
| WO2017066793A1 (en) | 2017-04-20 |
| AU2016340183A1 (en) | 2018-04-19 |
| US20190225644A1 (en) | 2019-07-25 |
| EP3362460A1 (en) | 2018-08-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US10570388B2 (en) | Phosphate replacement MRNA cap analogs | |
| CA3001014A1 (en) | Mrna cap analogs and methods of mrna capping | |
| US11866754B2 (en) | Trinucleotide mRNA cap analogs | |
| WO2017066789A1 (en) | Mrna cap analogs with modified sugar | |
| WO2017066791A1 (en) | Sugar substituted mrna cap analogs | |
| WO2017066782A1 (en) | Hydrophobic mrna cap analogs | |
| AU2023200127A1 (en) | Modified nucleosides, nucleotides, and nucleic acids, and uses thereof | |
| JP2025061366A (ja) | 安定化尾部領域を含むポリヌクレオチド | |
| EP2918275B1 (en) | Alternative nucleic acid molecules and uses thereof | |
| WO2015196118A1 (en) | Alternative nucleic acid molecules and uses thereof | |
| EP3157572A2 (en) | Alternative nucleic acid molecules and uses thereof | |
| EP2931319A1 (en) | Modified nucleic acid molecules and uses thereof | |
| EP3157573A2 (en) | Alternative nucleic acid molecules and uses thereof | |
| US20220298516A1 (en) | Compositions and methods for delivery of nucleic acids | |
| WO2019036638A1 (en) | METHODS FOR PREPARING MODIFIED RNA | |
| HK40032374A (en) | Modified nucleosides, nucleotides, and nucleic acids, and uses thereof | |
| HK40032374B (en) | Modified nucleosides, nucleotides, and nucleic acids, and uses thereof | |
| NZ623476B2 (en) | Modified nucleosides, nucleotides, and nucleic acids, and uses thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |
Effective date: 20230110 |
|
| FZDE | Discontinued |
Effective date: 20230110 |