CA2728767A1 - Alkynyl alcohols as kinase inhibitors - Google Patents
Alkynyl alcohols as kinase inhibitors Download PDFInfo
- Publication number
- CA2728767A1 CA2728767A1 CA2728767A CA2728767A CA2728767A1 CA 2728767 A1 CA2728767 A1 CA 2728767A1 CA 2728767 A CA2728767 A CA 2728767A CA 2728767 A CA2728767 A CA 2728767A CA 2728767 A1 CA2728767 A1 CA 2728767A1
- Authority
- CA
- Canada
- Prior art keywords
- alkylene
- bromo
- valance
- allowed
- mmol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- -1 Alkynyl alcohols Chemical class 0.000 title claims description 167
- 229940043355 kinase inhibitor Drugs 0.000 title description 2
- 239000003757 phosphotransferase inhibitor Substances 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 116
- 238000000034 method Methods 0.000 claims abstract description 62
- 150000003839 salts Chemical class 0.000 claims abstract description 18
- 238000011282 treatment Methods 0.000 claims abstract description 17
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 819
- 125000004432 carbon atom Chemical group C* 0.000 claims description 58
- 125000000217 alkyl group Chemical group 0.000 claims description 51
- 125000003118 aryl group Chemical group 0.000 claims description 35
- 125000000623 heterocyclic group Chemical group 0.000 claims description 27
- 125000003342 alkenyl group Chemical group 0.000 claims description 25
- 229910052757 nitrogen Inorganic materials 0.000 claims description 24
- 125000000304 alkynyl group Chemical group 0.000 claims description 22
- 229910052799 carbon Inorganic materials 0.000 claims description 22
- 125000001072 heteroaryl group Chemical group 0.000 claims description 21
- 125000001188 haloalkyl group Chemical group 0.000 claims description 20
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 19
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 19
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 19
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 17
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 13
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 13
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 11
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 10
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 10
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 10
- 125000002971 oxazolyl group Chemical group 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 10
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 10
- 125000000335 thiazolyl group Chemical group 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 239000003814 drug Substances 0.000 claims description 9
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 9
- 125000004076 pyridyl group Chemical group 0.000 claims description 9
- 206010035226 Plasma cell myeloma Diseases 0.000 claims description 8
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 8
- 206010003246 arthritis Diseases 0.000 claims description 8
- 125000002883 imidazolyl group Chemical group 0.000 claims description 8
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 8
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 8
- 125000002541 furyl group Chemical group 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 125000001544 thienyl group Chemical group 0.000 claims description 7
- 208000034578 Multiple myelomas Diseases 0.000 claims description 6
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 6
- 208000032839 leukemia Diseases 0.000 claims description 6
- 208000022559 Inflammatory bowel disease Diseases 0.000 claims description 5
- 206010025323 Lymphomas Diseases 0.000 claims description 5
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 2
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 claims description 2
- 239000002671 adjuvant Substances 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 208000006673 asthma Diseases 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 201000006417 multiple sclerosis Diseases 0.000 claims description 2
- 125000004043 oxo group Chemical group O=* 0.000 claims description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 claims description 2
- 125000004306 triazinyl group Chemical group 0.000 claims description 2
- 239000003981 vehicle Substances 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 6
- 230000004968 inflammatory condition Effects 0.000 claims 4
- 201000009273 Endometriosis Diseases 0.000 claims 1
- 206010052779 Transplant rejections Diseases 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 208000002551 irritable bowel syndrome Diseases 0.000 claims 1
- 206010039083 rhinitis Diseases 0.000 claims 1
- 102000019148 NF-kappaB-inducing kinase activity proteins Human genes 0.000 abstract description 37
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 11
- 230000001404 mediated effect Effects 0.000 abstract description 9
- 208000035475 disorder Diseases 0.000 abstract description 8
- 206010061218 Inflammation Diseases 0.000 abstract description 5
- 208000027866 inflammatory disease Diseases 0.000 abstract description 5
- 230000004054 inflammatory process Effects 0.000 abstract description 5
- 201000010099 disease Diseases 0.000 abstract description 3
- 238000011321 prophylaxis Methods 0.000 abstract description 3
- 239000000651 prodrug Substances 0.000 abstract 1
- 229940002612 prodrug Drugs 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 473
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 358
- 239000000203 mixture Substances 0.000 description 308
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 268
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 203
- 239000007787 solid Substances 0.000 description 201
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 183
- 239000000243 solution Substances 0.000 description 170
- 235000019439 ethyl acetate Nutrition 0.000 description 158
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 146
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 143
- 238000005481 NMR spectroscopy Methods 0.000 description 128
- 229910001868 water Inorganic materials 0.000 description 98
- 230000002829 reductive effect Effects 0.000 description 80
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 76
- 239000012267 brine Substances 0.000 description 72
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 66
- 229940126062 Compound A Drugs 0.000 description 61
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 61
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 61
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 60
- 238000001819 mass spectrum Methods 0.000 description 59
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 58
- 150000003254 radicals Chemical class 0.000 description 58
- 238000006243 chemical reaction Methods 0.000 description 54
- 239000000047 product Substances 0.000 description 51
- 238000003818 flash chromatography Methods 0.000 description 50
- 238000005160 1H NMR spectroscopy Methods 0.000 description 47
- 239000007832 Na2SO4 Substances 0.000 description 46
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 46
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 46
- 229910052938 sodium sulfate Inorganic materials 0.000 description 46
- 235000011152 sodium sulphate Nutrition 0.000 description 46
- 238000010898 silica gel chromatography Methods 0.000 description 43
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 41
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 41
- 239000003480 eluent Substances 0.000 description 41
- 238000003756 stirring Methods 0.000 description 40
- 239000003921 oil Substances 0.000 description 36
- 235000019198 oils Nutrition 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 33
- 239000012044 organic layer Substances 0.000 description 33
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 32
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Natural products CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 31
- 235000019341 magnesium sulphate Nutrition 0.000 description 31
- 239000000741 silica gel Substances 0.000 description 30
- 229910002027 silica gel Inorganic materials 0.000 description 30
- 238000010992 reflux Methods 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- 239000000706 filtrate Substances 0.000 description 26
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 26
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 26
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 25
- 210000004027 cell Anatomy 0.000 description 25
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 24
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 24
- 241000699670 Mus sp. Species 0.000 description 24
- 229920006395 saturated elastomer Polymers 0.000 description 24
- 238000010626 work up procedure Methods 0.000 description 24
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 23
- 229960000583 acetic acid Drugs 0.000 description 23
- 239000007864 aqueous solution Substances 0.000 description 23
- XKRFYHLGVUSROY-UHFFFAOYSA-N argon Substances [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 23
- LCNPRNSOGSLJFZ-UHFFFAOYSA-N 4,5-dichloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(Cl)=N1 LCNPRNSOGSLJFZ-UHFFFAOYSA-N 0.000 description 22
- 238000001816 cooling Methods 0.000 description 22
- 239000002904 solvent Substances 0.000 description 22
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- FJDQFPXHSGXQBY-UHFFFAOYSA-L Cs2CO3 Substances [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 21
- 238000001914 filtration Methods 0.000 description 21
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 17
- 239000002244 precipitate Substances 0.000 description 17
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 16
- 235000017557 sodium bicarbonate Nutrition 0.000 description 16
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 16
- 229910000104 sodium hydride Inorganic materials 0.000 description 16
- 239000005457 ice water Substances 0.000 description 15
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 15
- 239000007788 liquid Substances 0.000 description 15
- 102100036922 Tumor necrosis factor ligand superfamily member 13B Human genes 0.000 description 14
- 239000010410 layer Substances 0.000 description 14
- 101710181056 Tumor necrosis factor ligand superfamily member 13B Proteins 0.000 description 13
- 229910000024 caesium carbonate Inorganic materials 0.000 description 13
- 238000004587 chromatography analysis Methods 0.000 description 13
- 125000005843 halogen group Chemical group 0.000 description 13
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 13
- 239000006188 syrup Substances 0.000 description 13
- 235000020357 syrup Nutrition 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 101000617805 Homo sapiens Staphylococcal nuclease domain-containing protein 1 Proteins 0.000 description 12
- 101000830894 Homo sapiens Targeting protein for Xklp2 Proteins 0.000 description 12
- 101000942603 Schizosaccharomyces pombe (strain 972 / ATCC 24843) Condensin complex subunit 3 Proteins 0.000 description 12
- 102100021996 Staphylococcal nuclease domain-containing protein 1 Human genes 0.000 description 12
- 101000963191 Xenopus laevis Maternal DNA replication licensing factor mcm3 Proteins 0.000 description 12
- 229910052786 argon Inorganic materials 0.000 description 12
- 210000003719 b-lymphocyte Anatomy 0.000 description 12
- 229960004592 isopropanol Drugs 0.000 description 12
- 238000000746 purification Methods 0.000 description 12
- 239000011369 resultant mixture Substances 0.000 description 12
- 238000000926 separation method Methods 0.000 description 12
- 239000012298 atmosphere Substances 0.000 description 11
- 239000006185 dispersion Substances 0.000 description 11
- 239000012065 filter cake Substances 0.000 description 11
- 229910052740 iodine Inorganic materials 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 11
- QAMALVYKROEUKC-UHFFFAOYSA-N 6-bromo-1'-methylspiro[1,2-dihydroindole-3,4'-piperidine] Chemical compound C1CN(C)CCC11C2=CC=C(Br)C=C2NC1 QAMALVYKROEUKC-UHFFFAOYSA-N 0.000 description 10
- 101000979338 Homo sapiens Nuclear factor NF-kappa-B p100 subunit Proteins 0.000 description 10
- 206010028980 Neoplasm Diseases 0.000 description 10
- 102100023059 Nuclear factor NF-kappa-B p100 subunit Human genes 0.000 description 10
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- 239000003960 organic solvent Substances 0.000 description 10
- 125000004434 sulfur atom Chemical group 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 9
- JJSZXRDRSOBWAD-UHFFFAOYSA-N 4-chloro-5-fluoropyrimidin-2-amine Chemical compound NC1=NC=C(F)C(Cl)=N1 JJSZXRDRSOBWAD-UHFFFAOYSA-N 0.000 description 9
- DBGFGNCFYUNXLD-UHFFFAOYSA-N 4-chloropyrimidin-2-amine Chemical compound NC1=NC=CC(Cl)=N1 DBGFGNCFYUNXLD-UHFFFAOYSA-N 0.000 description 9
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- 125000004430 oxygen atom Chemical group O* 0.000 description 9
- 108090000623 proteins and genes Proteins 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 235000009518 sodium iodide Nutrition 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 9
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 9
- GQAPXUSHLIKBIO-UHFFFAOYSA-N 6-bromo-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] Chemical compound C1N(C)CCC11C2=CC=C(Br)C=C2NC1 GQAPXUSHLIKBIO-UHFFFAOYSA-N 0.000 description 8
- HJBDQOZMIJOABX-UHFFFAOYSA-N 6-bromospiro[1,2-dihydroindole-3,4'-oxane] Chemical compound C=1C(Br)=CC=C2C=1NCC21CCOCC1 HJBDQOZMIJOABX-UHFFFAOYSA-N 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 230000004913 activation Effects 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Substances ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 229910052717 sulfur Inorganic materials 0.000 description 8
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 235000011114 ammonium hydroxide Nutrition 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 239000002480 mineral oil Substances 0.000 description 7
- 235000010446 mineral oil Nutrition 0.000 description 7
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 7
- 238000012545 processing Methods 0.000 description 7
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 7
- 230000011664 signaling Effects 0.000 description 7
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 7
- GQAPXUSHLIKBIO-GFCCVEGCSA-N (3r)-6-bromo-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] Chemical compound C1N(C)CC[C@]11C2=CC=C(Br)C=C2NC1 GQAPXUSHLIKBIO-GFCCVEGCSA-N 0.000 description 6
- KUJTZQXHTBKAMO-UHFFFAOYSA-N 1-fluoro-4-iodo-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(I)=CC=C1F KUJTZQXHTBKAMO-UHFFFAOYSA-N 0.000 description 6
- OMMNABHSUVLNEN-UHFFFAOYSA-N 6-bromo-1'-methylspiro[1h-indole-3,3'-pyrrolidine]-2-one Chemical compound C1N(C)CCC21C1=CC=C(Br)C=C1NC2=O OMMNABHSUVLNEN-UHFFFAOYSA-N 0.000 description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 150000005840 aryl radicals Chemical class 0.000 description 6
- 201000011510 cancer Diseases 0.000 description 6
- 150000001721 carbon Chemical group 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 6
- AGBBEQYZJNCGIZ-UHFFFAOYSA-N methyl 2-(4-bromo-2-nitrophenyl)prop-2-enoate Chemical compound COC(=O)C(=C)C1=CC=C(Br)C=C1[N+]([O-])=O AGBBEQYZJNCGIZ-UHFFFAOYSA-N 0.000 description 6
- YPKHKMWXGUOXNN-UHFFFAOYSA-N methyl 3-(4-bromo-2-nitrophenyl)-1-methylpyrrolidine-3-carboxylate Chemical compound C=1C=C(Br)C=C([N+]([O-])=O)C=1C1(C(=O)OC)CCN(C)C1 YPKHKMWXGUOXNN-UHFFFAOYSA-N 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 230000003287 optical effect Effects 0.000 description 6
- 230000037361 pathway Effects 0.000 description 6
- 235000015320 potassium carbonate Nutrition 0.000 description 6
- 239000008279 sol Substances 0.000 description 6
- 238000000967 suction filtration Methods 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 239000003039 volatile agent Substances 0.000 description 6
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 5
- RTDSBDMPNWSMTH-UHFFFAOYSA-N 2-bromo-5-phenylmethoxyaniline Chemical compound C1=C(Br)C(N)=CC(OCC=2C=CC=CC=2)=C1 RTDSBDMPNWSMTH-UHFFFAOYSA-N 0.000 description 5
- JKWJTDCHUSQNDX-UHFFFAOYSA-N 6-bromospiro[1,2-dihydroindole-3,4'-thiane] Chemical compound C=1C(Br)=CC=C2C=1NCC21CCSCC1 JKWJTDCHUSQNDX-UHFFFAOYSA-N 0.000 description 5
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 5
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 125000003282 alkyl amino group Chemical group 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 5
- NJAONFWUEGWOPG-UHFFFAOYSA-N dimethyl 2-(4-bromo-2-nitrophenyl)propanedioate Chemical compound COC(=O)C(C(=O)OC)C1=CC=C(Br)C=C1[N+]([O-])=O NJAONFWUEGWOPG-UHFFFAOYSA-N 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 5
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 210000005212 secondary lymphoid organ Anatomy 0.000 description 5
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 5
- AVIFOFZUXMOUNI-UHFFFAOYSA-N 1-(2-amino-5-chloropyrimidin-4-yl)spiro[2h-indole-3,3'-oxolane]-6-ol Chemical compound NC1=NC=C(Cl)C(N2C3=CC(O)=CC=C3C3(COCC3)C2)=N1 AVIFOFZUXMOUNI-UHFFFAOYSA-N 0.000 description 4
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 4
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- WMOXDGGNBLVQKL-UHFFFAOYSA-N 5-chloro-4-n-[5-iodo-2-(oxan-4-yloxy)phenyl]pyrimidine-2,4-diamine Chemical compound NC1=NC=C(Cl)C(NC=2C(=CC=C(I)C=2)OC2CCOCC2)=N1 WMOXDGGNBLVQKL-UHFFFAOYSA-N 0.000 description 4
- XRASQKRYBMIIAG-UHFFFAOYSA-N 5-chloro-n-[5-iodo-2-(oxan-4-yloxy)phenyl]pyrimidin-4-amine Chemical compound ClC1=CN=CN=C1NC1=CC(I)=CC=C1OC1CCOCC1 XRASQKRYBMIIAG-UHFFFAOYSA-N 0.000 description 4
- UGLOCJLUDFPKIF-QMMMGPOBSA-N 5-iodo-2-[(3s)-oxolan-3-yl]oxyaniline Chemical compound NC1=CC(I)=CC=C1O[C@@H]1COCC1 UGLOCJLUDFPKIF-QMMMGPOBSA-N 0.000 description 4
- RWPBRNVIISFNDT-UHFFFAOYSA-N 6-(6-bromospiro[2h-indole-3,4'-oxane]-1-yl)-n-methyl-7h-purin-2-amine Chemical compound C=12N=CNC2=NC(NC)=NC=1N(C1=CC(Br)=CC=C11)CC21CCOCC2 RWPBRNVIISFNDT-UHFFFAOYSA-N 0.000 description 4
- JARRYVQFBQVOBE-UHFFFAOYSA-N 6-bromo-1,3-dihydroindol-2-one Chemical compound BrC1=CC=C2CC(=O)NC2=C1 JARRYVQFBQVOBE-UHFFFAOYSA-N 0.000 description 4
- ABTRLWBSKIYPKP-UHFFFAOYSA-N 6-bromo-3-methyl-1,3-dihydroindol-2-one Chemical compound BrC1=CC=C2C(C)C(=O)NC2=C1 ABTRLWBSKIYPKP-UHFFFAOYSA-N 0.000 description 4
- YOLVLDSCEOFJKD-UHFFFAOYSA-N 6-bromospiro[1h-indole-3,3'-thietane]-2-one Chemical compound C=1C(Br)=CC=C2C=1NC(=O)C21CSC1 YOLVLDSCEOFJKD-UHFFFAOYSA-N 0.000 description 4
- RYYIULNRIVUMTQ-UHFFFAOYSA-N 6-chloroguanine Chemical compound NC1=NC(Cl)=C2N=CNC2=N1 RYYIULNRIVUMTQ-UHFFFAOYSA-N 0.000 description 4
- 101000611183 Homo sapiens Tumor necrosis factor Proteins 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- 235000019502 Orange oil Nutrition 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 102100040247 Tumor necrosis factor Human genes 0.000 description 4
- 102100029690 Tumor necrosis factor receptor superfamily member 13C Human genes 0.000 description 4
- 101710178300 Tumor necrosis factor receptor superfamily member 13C Proteins 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000001363 autoimmune Effects 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 125000001246 bromo group Chemical group Br* 0.000 description 4
- 230000001419 dependent effect Effects 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- 230000014509 gene expression Effects 0.000 description 4
- 239000008241 heterogeneous mixture Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- KHXUTOLCCFWPDH-UHFFFAOYSA-N methyl 2-(4-bromo-2-nitrophenyl)acetate Chemical compound COC(=O)CC1=CC=C(Br)C=C1[N+]([O-])=O KHXUTOLCCFWPDH-UHFFFAOYSA-N 0.000 description 4
- DZQCRHYFRWWGNC-UHFFFAOYSA-N n-(2-bromo-5-phenylmethoxyphenyl)-n-[(4-methoxyphenyl)methyl]oxolane-3-carboxamide Chemical compound C1=CC(OC)=CC=C1CN(C=1C(=CC=C(OCC=2C=CC=CC=2)C=1)Br)C(=O)C1COCC1 DZQCRHYFRWWGNC-UHFFFAOYSA-N 0.000 description 4
- LJNOBMFATRIWES-UHFFFAOYSA-N n-(2-bromo-5-phenylmethoxyphenyl)oxolane-3-carboxamide Chemical compound C1=C(NC(=O)C2COCC2)C(Br)=CC=C1OCC1=CC=CC=C1 LJNOBMFATRIWES-UHFFFAOYSA-N 0.000 description 4
- RXQUGHKLARHBKU-UHFFFAOYSA-N n-(6-bromo-1h-indol-4-yl)acetamide Chemical compound CC(=O)NC1=CC(Br)=CC2=C1C=CN2 RXQUGHKLARHBKU-UHFFFAOYSA-N 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 239000010502 orange oil Substances 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- YEMVNDWYHPHLKR-UHFFFAOYSA-N spiro[1,2-dihydroindole-3,3'-oxolane]-6-ol;hydrochloride Chemical compound Cl.C=1C(O)=CC=C2C=1NCC21CCOC1 YEMVNDWYHPHLKR-UHFFFAOYSA-N 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- 235000011149 sulphuric acid Nutrition 0.000 description 4
- BUHCGWDMEKZDGX-UHFFFAOYSA-N tert-butyl 1'-[(4-methoxyphenyl)methyl]-2'-oxo-6'-phenylmethoxyspiro[azetidine-3,3'-indole]-1-carboxylate Chemical compound C1=CC(OC)=CC=C1CN1C2=CC(OCC=3C=CC=CC=3)=CC=C2C2(CN(C2)C(=O)OC(C)(C)C)C1=O BUHCGWDMEKZDGX-UHFFFAOYSA-N 0.000 description 4
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 4
- VCSGTFWBQXJVTE-UHFFFAOYSA-N (2-fluoro-5-iodophenyl)-(1,2-thiazol-5-yl)methanol Chemical compound C=1C(I)=CC=C(F)C=1C(O)C1=CC=NS1 VCSGTFWBQXJVTE-UHFFFAOYSA-N 0.000 description 3
- QWGWZUDHQBXUHG-UHFFFAOYSA-N (2-fluoro-5-iodophenyl)-(1,2-thiazol-5-yl)methanone Chemical compound FC1=CC=C(I)C=C1C(=O)C1=CC=NS1 QWGWZUDHQBXUHG-UHFFFAOYSA-N 0.000 description 3
- XJAVIZGYIUENKL-MRVPVSSYSA-N (3r)-3-(4-iodo-2-nitrophenoxy)oxolane Chemical compound [O-][N+](=O)C1=CC(I)=CC=C1O[C@H]1COCC1 XJAVIZGYIUENKL-MRVPVSSYSA-N 0.000 description 3
- XJAVIZGYIUENKL-QMMMGPOBSA-N (3s)-3-(4-iodo-2-nitrophenoxy)oxolane Chemical compound [O-][N+](=O)C1=CC(I)=CC=C1O[C@@H]1COCC1 XJAVIZGYIUENKL-QMMMGPOBSA-N 0.000 description 3
- ZSNQXUOIEJCPCV-UHFFFAOYSA-N (6-bromo-3-methyl-1,2-dihydroindol-3-yl)methanol Chemical compound BrC1=CC=C2C(C)(CO)CNC2=C1 ZSNQXUOIEJCPCV-UHFFFAOYSA-N 0.000 description 3
- PNTCPNZWKVXYJV-UHFFFAOYSA-N 1'-methylspiro[1,2-dihydroindole-3,3'-azetidine]-6-ol;hydrochloride Chemical compound Cl.C1N(C)CC21C1=CC=C(O)C=C1NC2 PNTCPNZWKVXYJV-UHFFFAOYSA-N 0.000 description 3
- SHRKCNGFRUUICL-UHFFFAOYSA-N 1-(2-amino-5-fluoropyrimidin-4-yl)-6-bromo-4-methoxyindole-3-carbaldehyde Chemical compound C1=C(C=O)C=2C(OC)=CC(Br)=CC=2N1C1=NC(N)=NC=C1F SHRKCNGFRUUICL-UHFFFAOYSA-N 0.000 description 3
- CIGPDYVRWHVABX-UHFFFAOYSA-N 1-(6-bromospiro[2h-indole-3,3'-thietane]-1-yl)ethanone Chemical compound C12=CC=C(Br)C=C2N(C(=O)C)CC21CSC2 CIGPDYVRWHVABX-UHFFFAOYSA-N 0.000 description 3
- GJEMDAOVZIPGBX-UHFFFAOYSA-N 1-(6-bromospiro[2h-indole-3,4'-thiane]-1-yl)ethanone Chemical compound C12=CC=C(Br)C=C2N(C(=O)C)CC21CCSCC2 GJEMDAOVZIPGBX-UHFFFAOYSA-N 0.000 description 3
- ITYUOVQZYFFBMX-UHFFFAOYSA-N 1-(6-bromospiro[indene-3,4'-oxane]-1-yl)ethyl nitrate Chemical compound C12=CC=C(Br)C=C2C(C(O[N+]([O-])=O)C)=CC21CCOCC2 ITYUOVQZYFFBMX-UHFFFAOYSA-N 0.000 description 3
- LSKMWQNKSSYWRM-UHFFFAOYSA-N 1-(6-iodo-3,3-dimethyl-2h-indol-1-yl)ethanone Chemical compound C1=C(I)C=C2N(C(=O)C)CC(C)(C)C2=C1 LSKMWQNKSSYWRM-UHFFFAOYSA-N 0.000 description 3
- LKEXBDWKOKZZAB-UHFFFAOYSA-N 1-(bromomethyl)-4-iodo-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(I)=CC=C1CBr LKEXBDWKOKZZAB-UHFFFAOYSA-N 0.000 description 3
- PTRGEJNCADXMDA-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]-1'-(2-methylsulfonylethyl)-6-phenylmethoxyspiro[2h-indole-3,3'-azetidine] Chemical compound C1=CC(OC)=CC=C1CN1C2=CC(OCC=3C=CC=CC=3)=CC=C2C2(CN(CCS(C)(=O)=O)C2)C1 PTRGEJNCADXMDA-UHFFFAOYSA-N 0.000 description 3
- MPNJTQCZBXQQOQ-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]-6-phenylmethoxyspiro[2h-indole-3,3'-oxolane] Chemical compound C1=CC(OC)=CC=C1CN1C2=CC(OCC=3C=CC=CC=3)=CC=C2C2(COCC2)C1 MPNJTQCZBXQQOQ-UHFFFAOYSA-N 0.000 description 3
- XNFXQUHUFXJVSV-UHFFFAOYSA-N 2-fluoro-5-iodoaniline Chemical compound NC1=CC(I)=CC=C1F XNFXQUHUFXJVSV-UHFFFAOYSA-N 0.000 description 3
- MEJXQOIJYPLVEC-UHFFFAOYSA-N 3-(2-aminopyrimidin-4-yl)-5-bromo-n-(2-methoxyethyl)-1h-indole-2-carboxamide Chemical compound COCCNC(=O)C=1NC2=CC=C(Br)C=C2C=1C1=CC=NC(N)=N1 MEJXQOIJYPLVEC-UHFFFAOYSA-N 0.000 description 3
- YVZVBELHTIFXKV-UHFFFAOYSA-N 3-[(2-bromo-5-phenylmethoxyphenyl)carbamoyl]azetidine-1-carboxylic acid Chemical compound C1N(C(=O)O)CC1C(=O)NC1=CC(OCC=2C=CC=CC=2)=CC=C1Br YVZVBELHTIFXKV-UHFFFAOYSA-N 0.000 description 3
- OVAIFUWWNNLCSK-UHFFFAOYSA-N 3-acetyl-5-bromo-n-(2-methoxyethyl)-1h-indole-2-carboxamide Chemical compound C1=C(Br)C=C2C(C(C)=O)=C(C(=O)NCCOC)NC2=C1 OVAIFUWWNNLCSK-UHFFFAOYSA-N 0.000 description 3
- CXMQNVNVBMXEMN-UHFFFAOYSA-N 4-(4-iodo-2-nitrophenoxy)oxane Chemical compound [O-][N+](=O)C1=CC(I)=CC=C1OC1CCOCC1 CXMQNVNVBMXEMN-UHFFFAOYSA-N 0.000 description 3
- MDITUUBFZYHNMP-UHFFFAOYSA-N 4-(5-bromo-1h-indol-3-yl)-5-chloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(C=2C3=CC(Br)=CC=C3NC=2)=N1 MDITUUBFZYHNMP-UHFFFAOYSA-N 0.000 description 3
- RPOUFRITOYFTAD-UHFFFAOYSA-N 4-(5-bromo-1h-indol-3-yl)-5-iodopyrimidin-2-amine Chemical compound NC1=NC=C(I)C(C=2C3=CC(Br)=CC=C3NC=2)=N1 RPOUFRITOYFTAD-UHFFFAOYSA-N 0.000 description 3
- RDAOVRIZRLBWGS-UHFFFAOYSA-N 4-(6-bromo-2,3-dihydroindol-1-yl)-5-chloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(N2C3=CC(Br)=CC=C3CC2)=N1 RDAOVRIZRLBWGS-UHFFFAOYSA-N 0.000 description 3
- LQIYIHGIFOGLQT-UHFFFAOYSA-N 4-(6-bromo-4'-methylspiro[2h-indole-3,2'-morpholine]-1-yl)-5-chloropyrimidin-2-amine Chemical compound C1N(C)CCOC11C2=CC=C(Br)C=C2N(C=2C(=CN=C(N)N=2)Cl)C1 LQIYIHGIFOGLQT-UHFFFAOYSA-N 0.000 description 3
- VVNODLABJBPFKE-UHFFFAOYSA-N 4-(6-bromo-4-methoxyindol-1-yl)pyrimidin-2-amine Chemical compound C1=CC=2C(OC)=CC(Br)=CC=2N1C1=CC=NC(N)=N1 VVNODLABJBPFKE-UHFFFAOYSA-N 0.000 description 3
- MYXKBWNJMPIMHJ-UHFFFAOYSA-N 4-(6-bromospiro[2h-indole-3,4'-oxane]-1-yl)pyrimidin-2-amine Chemical compound NC1=NC=CC(N2C3=CC(Br)=CC=C3C3(CCOCC3)C2)=N1 MYXKBWNJMPIMHJ-UHFFFAOYSA-N 0.000 description 3
- KFTIYSGPIVRCLP-UHFFFAOYSA-N 4-(6-bromospiro[indene-3,4'-oxane]-1-yl)pyrimidin-2-amine Chemical compound NC1=NC=CC(C=2C3=CC(Br)=CC=C3C3(CCOCC3)C=2)=N1 KFTIYSGPIVRCLP-UHFFFAOYSA-N 0.000 description 3
- OHMAGLQYVCKDDN-UHFFFAOYSA-N 4-[(4-iodo-2-nitrophenyl)methyl]morpholine Chemical compound [O-][N+](=O)C1=CC(I)=CC=C1CN1CCOCC1 OHMAGLQYVCKDDN-UHFFFAOYSA-N 0.000 description 3
- XXMYDAZZHQSQCI-UHFFFAOYSA-N 4-[2-(2-methylsulfanylpyrimidin-4-yl)acetyl]benzonitrile Chemical compound CSC1=NC=CC(CC(=O)C=2C=CC(=CC=2)C#N)=N1 XXMYDAZZHQSQCI-UHFFFAOYSA-N 0.000 description 3
- QSQFKWUGLPFNIQ-UHFFFAOYSA-N 4-[2-(5-bromo-2-nitrophenyl)-2-(2-methylsulfanylpyrimidin-4-yl)acetyl]benzonitrile Chemical compound CSC1=NC=CC(C(C(=O)C=2C=CC(=CC=2)C#N)C=2C(=CC=C(Br)C=2)[N+]([O-])=O)=N1 QSQFKWUGLPFNIQ-UHFFFAOYSA-N 0.000 description 3
- YETGNNVAEYODOI-UHFFFAOYSA-N 4-bromospiro[1,2-dihydroindole-3,4'-thiane] Chemical compound C1=2C(Br)=CC=CC=2NCC21CCSCC2 YETGNNVAEYODOI-UHFFFAOYSA-N 0.000 description 3
- ZTXMCQDBWCXLCC-UHFFFAOYSA-N 4-bromospiro[indole-3,4'-thiane] Chemical compound C1=2C(Br)=CC=CC=2N=CC21CCSCC2 ZTXMCQDBWCXLCC-UHFFFAOYSA-N 0.000 description 3
- DHODYSUBPPNTIJ-UHFFFAOYSA-N 4-chloro-n-[4-(2-methoxyethoxy)phenyl]-1,3,5-triazin-2-amine Chemical compound C1=CC(OCCOC)=CC=C1NC1=NC=NC(Cl)=N1 DHODYSUBPPNTIJ-UHFFFAOYSA-N 0.000 description 3
- DFOSXEBMFPXXCW-UHFFFAOYSA-N 4-iodo-1-(2-methoxyethoxy)-2-nitrobenzene Chemical compound COCCOC1=CC=C(I)C=C1[N+]([O-])=O DFOSXEBMFPXXCW-UHFFFAOYSA-N 0.000 description 3
- JNHABRJDZLVXEX-UHFFFAOYSA-N 4-iodo-n-(2-methoxyethyl)-n-methyl-2-nitroaniline Chemical compound COCCN(C)C1=CC=C(I)C=C1[N+]([O-])=O JNHABRJDZLVXEX-UHFFFAOYSA-N 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 3
- CMQRWXUQAKCCAK-UHFFFAOYSA-N 5-bromo-1-(4-methylphenyl)sulfonylindole Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1C2=CC=C(Br)C=C2C=C1 CMQRWXUQAKCCAK-UHFFFAOYSA-N 0.000 description 3
- MXRJKAJGTPXBND-UHFFFAOYSA-N 5-bromo-2-methyl-3-pyridin-4-yl-1h-indole Chemical compound CC=1NC2=CC=C(Br)C=C2C=1C1=CC=NC=C1 MXRJKAJGTPXBND-UHFFFAOYSA-N 0.000 description 3
- KSZGPLNOORAMTB-UHFFFAOYSA-N 5-bromo-3-(1-bromoethyl)spiro[indene-1,4'-oxane] Chemical compound C12=CC=C(Br)C=C2C(C(Br)C)=CC21CCOCC2 KSZGPLNOORAMTB-UHFFFAOYSA-N 0.000 description 3
- SHDOREIQLLKWHM-UHFFFAOYSA-N 5-bromo-3-ethylspiro[indene-1,4'-oxane] Chemical compound C12=CC=C(Br)C=C2C(CC)=CC21CCOCC2 SHDOREIQLLKWHM-UHFFFAOYSA-N 0.000 description 3
- QOMRSNPTJFTQIG-UHFFFAOYSA-N 5-bromo-3-formyl-n,n-dimethylindole-1-carboxamide Chemical compound BrC1=CC=C2N(C(=O)N(C)C)C=C(C=O)C2=C1 QOMRSNPTJFTQIG-UHFFFAOYSA-N 0.000 description 3
- NFBWNSKAQGJNLW-UHFFFAOYSA-N 5-bromo-n-(2-methoxyethyl)-1h-indole-2-carboxamide Chemical compound BrC1=CC=C2NC(C(=O)NCCOC)=CC2=C1 NFBWNSKAQGJNLW-UHFFFAOYSA-N 0.000 description 3
- NQZCFOFDFKCIFW-UHFFFAOYSA-N 5-chloro-4-n-[5-iodo-2-(2-methoxyethoxy)phenyl]pyrimidine-2,4-diamine Chemical compound COCCOC1=CC=C(I)C=C1NC1=NC(N)=NC=C1Cl NQZCFOFDFKCIFW-UHFFFAOYSA-N 0.000 description 3
- HNPLLGSCNYZNGK-UHFFFAOYSA-N 5-iodo-2-(2-methoxyethoxy)aniline Chemical compound COCCOC1=CC=C(I)C=C1N HNPLLGSCNYZNGK-UHFFFAOYSA-N 0.000 description 3
- BQEHBPHJGPDNCW-UHFFFAOYSA-N 5-iodo-2-(morpholin-4-ylmethyl)aniline Chemical compound NC1=CC(I)=CC=C1CN1CCOCC1 BQEHBPHJGPDNCW-UHFFFAOYSA-N 0.000 description 3
- POTJJFCWFMEZJG-UHFFFAOYSA-N 5-iodo-2-(oxan-4-yloxy)aniline Chemical compound NC1=CC(I)=CC=C1OC1CCOCC1 POTJJFCWFMEZJG-UHFFFAOYSA-N 0.000 description 3
- UGLOCJLUDFPKIF-MRVPVSSYSA-N 5-iodo-2-[(3r)-oxolan-3-yl]oxyaniline Chemical compound NC1=CC(I)=CC=C1O[C@H]1COCC1 UGLOCJLUDFPKIF-MRVPVSSYSA-N 0.000 description 3
- IOEHXNCBPIBDBZ-UHFFFAOYSA-N 5-iodo-2-methylaniline Chemical compound CC1=CC=C(I)C=C1N IOEHXNCBPIBDBZ-UHFFFAOYSA-N 0.000 description 3
- SOWJEYXVGLHJTF-UHFFFAOYSA-N 6-bromo-1'-methylspiro[1h-indole-3,4'-piperidine]-2-one Chemical compound C1CN(C)CCC21C1=CC=C(Br)C=C1NC2=O SOWJEYXVGLHJTF-UHFFFAOYSA-N 0.000 description 3
- DBUWKSQHDKNTDN-UHFFFAOYSA-N 6-bromo-1,2-dihydropyrrolo[1,2-a]indol-3-one Chemical compound BrC1=CC=C2N(CCC3=O)C3=CC2=C1 DBUWKSQHDKNTDN-UHFFFAOYSA-N 0.000 description 3
- ADFAKQQFDXQBHS-UHFFFAOYSA-N 6-bromo-1-(5-chloropyrimidin-4-yl)spiro[2h-indole-3,4'-oxane] Chemical compound ClC1=CN=CN=C1N1C2=CC(Br)=CC=C2C2(CCOCC2)C1 ADFAKQQFDXQBHS-UHFFFAOYSA-N 0.000 description 3
- JMKGSXCQIMSGFI-UHFFFAOYSA-N 6-bromo-1-ethyl-2,3-dihydroinden-1-ol Chemical compound C1=C(Br)C=C2C(CC)(O)CCC2=C1 JMKGSXCQIMSGFI-UHFFFAOYSA-N 0.000 description 3
- YSPDDGYHBOVQHW-UHFFFAOYSA-N 6-bromo-1-pyrimidin-4-ylspiro[2h-indole-3,4'-oxane] Chemical compound C=1C(Br)=CC=C2C=1N(C=1N=CN=CC=1)CC21CCOCC1 YSPDDGYHBOVQHW-UHFFFAOYSA-N 0.000 description 3
- QCLBXWCVRSGLIE-UHFFFAOYSA-N 6-bromo-3,3-bis(hydroxymethyl)-1h-indol-2-one Chemical compound BrC1=CC=C2C(CO)(CO)C(=O)NC2=C1 QCLBXWCVRSGLIE-UHFFFAOYSA-N 0.000 description 3
- JSMUHVSOFKGJID-UHFFFAOYSA-N 6-bromo-3,3-dimethyl-1,2-dihydroindole Chemical compound BrC1=CC=C2C(C)(C)CNC2=C1 JSMUHVSOFKGJID-UHFFFAOYSA-N 0.000 description 3
- IAMVLDCLMITHLZ-UHFFFAOYSA-N 6-bromo-3-(methoxymethyl)-3-methyl-1,2-dihydroindole Chemical compound BrC1=CC=C2C(COC)(C)CNC2=C1 IAMVLDCLMITHLZ-UHFFFAOYSA-N 0.000 description 3
- XEIYLXKWHOWCKW-UHFFFAOYSA-N 6-bromo-4'-methylspiro[1,2-dihydroindole-3,2'-morpholine] Chemical compound C1N(C)CCOC11C2=CC=C(Br)C=C2NC1 XEIYLXKWHOWCKW-UHFFFAOYSA-N 0.000 description 3
- WPFDDPXFOMVGIN-UHFFFAOYSA-N 6-bromo-4-methoxy-1h-indole Chemical compound COC1=CC(Br)=CC2=C1C=CN2 WPFDDPXFOMVGIN-UHFFFAOYSA-N 0.000 description 3
- IFMRFSNEGLWMFZ-UHFFFAOYSA-N 6-bromo-4-methoxy-1h-indole-3-carbaldehyde Chemical compound COC1=CC(Br)=CC2=C1C(C=O)=CN2 IFMRFSNEGLWMFZ-UHFFFAOYSA-N 0.000 description 3
- KZYMTDHZMMOCIV-UHFFFAOYSA-N 6-bromo-4-methoxy-2,3-dihydro-1h-indole Chemical compound COC1=CC(Br)=CC2=C1CCN2 KZYMTDHZMMOCIV-UHFFFAOYSA-N 0.000 description 3
- HOCVRKMKIYIBEW-UHFFFAOYSA-N 6-bromo-n-(2-methoxyethyl)-n-methyl-2,3-dihydro-1h-pyrrolo[1,2-a]indol-3-amine Chemical compound BrC1=CC=C2N3CCC(N(C)CCOC)C3=CC2=C1 HOCVRKMKIYIBEW-UHFFFAOYSA-N 0.000 description 3
- LQGJRRNJTUQNFL-UHFFFAOYSA-N 6-bromospiro[1,2-dihydroindole-3,3'-thietane] Chemical compound C=1C(Br)=CC=C2C=1NCC21CSC1 LQGJRRNJTUQNFL-UHFFFAOYSA-N 0.000 description 3
- FQXOZFCOPUOKSR-UHFFFAOYSA-N 6-bromospiro[1,2-dihydroindole-3,3'-thietane] 1',1'-dioxide Chemical compound C=1C(Br)=CC=C2C=1NCC21CS(=O)(=O)C1 FQXOZFCOPUOKSR-UHFFFAOYSA-N 0.000 description 3
- WGDOZEMHDIATQE-UHFFFAOYSA-N 6-bromospiro[1h-indole-3,4'-oxane]-2-one Chemical compound C=1C(Br)=CC=C2C=1NC(=O)C21CCOCC1 WGDOZEMHDIATQE-UHFFFAOYSA-N 0.000 description 3
- HKRCAIPYOXUDDU-UHFFFAOYSA-N 6-bromospiro[indole-3,4'-thiane] Chemical compound C=1C(Br)=CC=C2C=1N=CC21CCSCC1 HKRCAIPYOXUDDU-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- 208000021386 Sjogren Syndrome Diseases 0.000 description 3
- FLWAOVRVZSTGFK-UHFFFAOYSA-N [1-(2-amino-5-chloropyrimidin-4-yl)-6-bromo-3-(hydroxymethyl)-2h-indol-3-yl]methanol Chemical compound NC1=NC=C(Cl)C(N2C3=CC(Br)=CC=C3C(CO)(CO)C2)=N1 FLWAOVRVZSTGFK-UHFFFAOYSA-N 0.000 description 3
- QMDCMPVIUZNHNK-UHFFFAOYSA-N [1-(2-amino-5-chloropyrimidin-4-yl)spiro[2h-indole-3,3'-oxolane]-6-yl] trifluoromethanesulfonate Chemical compound NC1=NC=C(Cl)C(N2C3=CC(OS(=O)(=O)C(F)(F)F)=CC=C3C3(COCC3)C2)=N1 QMDCMPVIUZNHNK-UHFFFAOYSA-N 0.000 description 3
- KSSVUAFLFPRHAG-UHFFFAOYSA-N [5-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]boronic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1C2=CC=C(Br)C=C2C(B(O)O)=C1 KSSVUAFLFPRHAG-UHFFFAOYSA-N 0.000 description 3
- CHEOWBUYSYUAKN-UHFFFAOYSA-N [6-bromo-3-(hydroxymethyl)-1,2-dihydroindol-3-yl]methanol Chemical compound BrC1=CC=C2C(CO)(CO)CNC2=C1 CHEOWBUYSYUAKN-UHFFFAOYSA-N 0.000 description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 3
- 230000033115 angiogenesis Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 125000004181 carboxyalkyl group Chemical group 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 230000011748 cell maturation Effects 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 230000002950 deficient Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- LZJWMCZPYZAHBG-UHFFFAOYSA-N dimethyl 2-(4-bromo-2-nitrophenyl)-2-methylpropanedioate Chemical compound COC(=O)C(C)(C(=O)OC)C1=CC=C(Br)C=C1[N+]([O-])=O LZJWMCZPYZAHBG-UHFFFAOYSA-N 0.000 description 3
- AZLPEJUVWWGLHA-UHFFFAOYSA-N ethyl acetate;hexane;methanol Chemical compound OC.CCCCCC.CCOC(C)=O AZLPEJUVWWGLHA-UHFFFAOYSA-N 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 229940099472 immunoglobulin a Drugs 0.000 description 3
- 230000002757 inflammatory effect Effects 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 210000001165 lymph node Anatomy 0.000 description 3
- LFNMGZCKOHKCQG-UHFFFAOYSA-N methyl 2-(4-bromo-2-nitrophenyl)-4-methylmorpholine-2-carboxylate Chemical compound C=1C=C(Br)C=C([N+]([O-])=O)C=1C1(C(=O)OC)CN(C)CCO1 LFNMGZCKOHKCQG-UHFFFAOYSA-N 0.000 description 3
- NXCAJSFWQZUZNK-UHFFFAOYSA-N methyl 2-(4-bromo-2-nitrophenyl)oxirane-2-carboxylate Chemical compound C=1C=C(Br)C=C([N+]([O-])=O)C=1C1(C(=O)OC)CO1 NXCAJSFWQZUZNK-UHFFFAOYSA-N 0.000 description 3
- RSHOHYVKYKIVTN-UHFFFAOYSA-N methyl 4-(4-bromo-2-nitrophenyl)oxane-4-carboxylate Chemical compound C=1C=C(Br)C=C([N+]([O-])=O)C=1C1(C(=O)OC)CCOCC1 RSHOHYVKYKIVTN-UHFFFAOYSA-N 0.000 description 3
- FKRBJDRTFKFUIQ-UHFFFAOYSA-N methyl 6-bromo-3-methyl-2-oxo-1h-indole-3-carboxylate Chemical compound BrC1=CC=C2C(C(=O)OC)(C)C(=O)NC2=C1 FKRBJDRTFKFUIQ-UHFFFAOYSA-N 0.000 description 3
- PLRMWBKMKJQJKG-UHFFFAOYSA-N n-(6-bromo-2,3-dihydro-1h-indol-4-yl)acetamide Chemical compound CC(=O)NC1=CC(Br)=CC2=C1CCN2 PLRMWBKMKJQJKG-UHFFFAOYSA-N 0.000 description 3
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 230000002018 overexpression Effects 0.000 description 3
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- HVVNJUAVDAZWCB-UHFFFAOYSA-N prolinol Chemical compound OCC1CCCN1 HVVNJUAVDAZWCB-UHFFFAOYSA-N 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000010791 quenching Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(I) nitrate Inorganic materials [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 3
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 3
- HHTFQQBWCBMSSX-UHFFFAOYSA-N tert-butyl 3-[(2-bromo-5-phenylmethoxyphenyl)-[(4-methoxyphenyl)methyl]carbamoyl]azetidine-1-carboxylate Chemical compound C1=CC(OC)=CC=C1CN(C=1C(=CC=C(OCC=2C=CC=CC=2)C=1)Br)C(=O)C1CN(C(=O)OC(C)(C)C)C1 HHTFQQBWCBMSSX-UHFFFAOYSA-N 0.000 description 3
- PFIZSSYAJJPDHX-UHFFFAOYSA-N tert-butyl 6-bromo-2-oxo-3h-indole-1-carboxylate Chemical compound C1=C(Br)C=C2N(C(=O)OC(C)(C)C)C(=O)CC2=C1 PFIZSSYAJJPDHX-UHFFFAOYSA-N 0.000 description 3
- VNVZSYYKYYDDMR-UHFFFAOYSA-N tert-butyl 6-bromo-3,3-bis(hydroxymethyl)-2-oxoindole-1-carboxylate Chemical compound C1=C(Br)C=C2N(C(=O)OC(C)(C)C)C(=O)C(CO)(CO)C2=C1 VNVZSYYKYYDDMR-UHFFFAOYSA-N 0.000 description 3
- GVDQDOXEFSOEIN-UHFFFAOYSA-N tert-butyl 6-bromo-3,3-bis(methylsulfonyloxymethyl)-2-oxoindole-1-carboxylate Chemical compound C1=C(Br)C=C2N(C(=O)OC(C)(C)C)C(=O)C(COS(C)(=O)=O)(COS(C)(=O)=O)C2=C1 GVDQDOXEFSOEIN-UHFFFAOYSA-N 0.000 description 3
- WCGGTMXOXFBAEO-UHFFFAOYSA-N tert-butyl 6-bromo-3-(hydroxymethyl)-3-methyl-2h-indole-1-carboxylate Chemical compound C1=C(Br)C=C2N(C(=O)OC(C)(C)C)CC(C)(CO)C2=C1 WCGGTMXOXFBAEO-UHFFFAOYSA-N 0.000 description 3
- KICUBRNBIHWKJI-UHFFFAOYSA-N tert-butyl 6-bromo-3-formyl-3-methyl-2h-indole-1-carboxylate Chemical compound C1=C(Br)C=C2N(C(=O)OC(C)(C)C)CC(C)(C=O)C2=C1 KICUBRNBIHWKJI-UHFFFAOYSA-N 0.000 description 3
- 229940124597 therapeutic agent Drugs 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- OPCKBADXWXDZHZ-UHFFFAOYSA-N 1'-(2-methoxyethyl)spiro[1,2-dihydroindole-3,3'-azetidine]-6-ol;hydrochloride Chemical compound Cl.C1N(CCOC)CC21C1=CC=C(O)C=C1NC2 OPCKBADXWXDZHZ-UHFFFAOYSA-N 0.000 description 2
- VJWZFPZYVCRMMW-UHFFFAOYSA-N 1'-(2-methylsulfonylethyl)spiro[1,2-dihydroindole-3,3'-azetidine]-6-ol;hydrochloride Chemical compound Cl.C1N(CCS(=O)(=O)C)CC21C1=CC=C(O)C=C1NC2 VJWZFPZYVCRMMW-UHFFFAOYSA-N 0.000 description 2
- CVKPULOCZZKLKZ-UHFFFAOYSA-N 1'-[(4-methoxyphenyl)methyl]-6'-phenylmethoxyspiro[azetidine-3,3'-indole]-2'-one Chemical compound C1=CC(OC)=CC=C1CN1C2=CC(OCC=3C=CC=CC=3)=CC=C2C2(CNC2)C1=O CVKPULOCZZKLKZ-UHFFFAOYSA-N 0.000 description 2
- JUJXDQDBBXGCCB-UHFFFAOYSA-N 1-(2-amino-5-chloropyrimidin-4-yl)-1'-(2-methoxyethyl)spiro[2h-indole-3,3'-azetidine]-6-ol Chemical compound C1N(CCOC)CC21C1=CC=C(O)C=C1N(C=1C(=CN=C(N)N=1)Cl)C2 JUJXDQDBBXGCCB-UHFFFAOYSA-N 0.000 description 2
- FWAOOIDUSBSMMX-UHFFFAOYSA-N 1-(2-amino-5-chloropyrimidin-4-yl)-1'-(2-methylsulfonylethyl)spiro[2h-indole-3,3'-azetidine]-6-ol Chemical compound C1N(CCS(=O)(=O)C)CC21C1=CC=C(O)C=C1N(C=1C(=CN=C(N)N=1)Cl)C2 FWAOOIDUSBSMMX-UHFFFAOYSA-N 0.000 description 2
- ULFUZOGIWPYDKS-UHFFFAOYSA-N 1-(2-amino-5-chloropyrimidin-4-yl)-1'-methylspiro[2h-indole-3,3'-azetidine]-6-ol Chemical compound C1N(C)CC21C1=CC=C(O)C=C1N(C=1C(=CN=C(N)N=1)Cl)C2 ULFUZOGIWPYDKS-UHFFFAOYSA-N 0.000 description 2
- OVKDSEBAVNZEDC-UHFFFAOYSA-N 1-(2-aminopyrimidin-4-yl)-6-bromoindol-4-ol Chemical compound NC1=NC=CC(N2C3=CC(Br)=CC(O)=C3C=C2)=N1 OVKDSEBAVNZEDC-UHFFFAOYSA-N 0.000 description 2
- IUZQWNJEYYGENX-UHFFFAOYSA-N 1-(2-methoxyethyl)-1'-[(4-methoxyphenyl)methyl]-6'-phenylmethoxyspiro[azetidine-3,3'-indole]-2'-one Chemical compound C1N(CCOC)CC21C1=CC=C(OCC=3C=CC=CC=3)C=C1N(CC=1C=CC(OC)=CC=1)C2=O IUZQWNJEYYGENX-UHFFFAOYSA-N 0.000 description 2
- RGBXTZYEHZFTJN-UHFFFAOYSA-N 1-(5-chloropyrimidin-4-yl)-6-iodospiro[2h-indole-3,4'-oxane] Chemical compound ClC1=CN=CN=C1N1C2=CC(I)=CC=C2C2(CCOCC2)C1 RGBXTZYEHZFTJN-UHFFFAOYSA-N 0.000 description 2
- PQSRTPNPQSPMNL-UHFFFAOYSA-N 1-(6-bromo-1',1'-dioxospiro[2h-indole-3,3'-thietane]-1-yl)ethanone Chemical compound C12=CC=C(Br)C=C2N(C(=O)C)CC21CS(=O)(=O)C2 PQSRTPNPQSPMNL-UHFFFAOYSA-N 0.000 description 2
- QUGDIQHTZPMNDO-UHFFFAOYSA-N 1-(6-bromospiro[indene-3,4'-oxane]-1-yl)ethanone Chemical compound C12=CC=C(Br)C=C2C(C(=O)C)=CC21CCOCC2 QUGDIQHTZPMNDO-UHFFFAOYSA-N 0.000 description 2
- VCNKJAHKFDBEIZ-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]-1'-methyl-6-phenylmethoxyspiro[2h-indole-3,3'-azetidine] Chemical compound C1=CC(OC)=CC=C1CN1C2=CC(OCC=3C=CC=CC=3)=CC=C2C2(CN(C)C2)C1 VCNKJAHKFDBEIZ-UHFFFAOYSA-N 0.000 description 2
- FOPPZTJMEVHTBV-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]-6-phenylmethoxyspiro[2h-indole-3,3'-azetidine] Chemical compound C1=CC(OC)=CC=C1CN1C2=CC(OCC=3C=CC=CC=3)=CC=C2C2(CNC2)C1 FOPPZTJMEVHTBV-UHFFFAOYSA-N 0.000 description 2
- BKWLGWWMGIULAA-UHFFFAOYSA-N 1-[6-bromo-3-[2-methoxyethyl(methyl)amino]-2,3-dihydro-1h-pyrrolo[1,2-a]indol-4-yl]ethanone Chemical compound BrC1=CC=C2N3CCC(N(C)CCOC)C3=C(C(C)=O)C2=C1 BKWLGWWMGIULAA-UHFFFAOYSA-N 0.000 description 2
- SVCWVZLKVOXSLL-UHFFFAOYSA-N 1-acetyl-6-bromo-3-methyl-3h-indol-2-one Chemical compound BrC1=CC=C2C(C)C(=O)N(C(C)=O)C2=C1 SVCWVZLKVOXSLL-UHFFFAOYSA-N 0.000 description 2
- FOZVXADQAHVUSV-UHFFFAOYSA-N 1-bromo-2-(2-bromoethoxy)ethane Chemical compound BrCCOCCBr FOZVXADQAHVUSV-UHFFFAOYSA-N 0.000 description 2
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 2
- FEYDZHNIIMENOB-UHFFFAOYSA-N 2,6-dibromopyridine Chemical compound BrC1=CC=CC(Br)=N1 FEYDZHNIIMENOB-UHFFFAOYSA-N 0.000 description 2
- NECBMBRAYJLMMF-UHFFFAOYSA-N 2-amino-5-fluoro-1h-pyrimidin-6-one Chemical compound NC1=NC=C(F)C(=O)N1 NECBMBRAYJLMMF-UHFFFAOYSA-N 0.000 description 2
- KOHBEDRJXKOYHL-UHFFFAOYSA-N 2-methoxy-n-methylethanamine Chemical compound CNCCOC KOHBEDRJXKOYHL-UHFFFAOYSA-N 0.000 description 2
- OZBOQMQZPKULIZ-UHFFFAOYSA-N 4-(5-bromo-1h-indol-3-yl)-5-fluoropyrimidin-2-amine Chemical compound NC1=NC=C(F)C(C=2C3=CC(Br)=CC=C3NC=2)=N1 OZBOQMQZPKULIZ-UHFFFAOYSA-N 0.000 description 2
- ROTTWTIZFSWPDS-UHFFFAOYSA-N 4-(5-bromo-1h-indol-3-yl)-n-methylpyrimidin-2-amine Chemical compound CNC1=NC=CC(C=2C3=CC(Br)=CC=C3NC=2)=N1 ROTTWTIZFSWPDS-UHFFFAOYSA-N 0.000 description 2
- PKQJCYXKRNGUKQ-UHFFFAOYSA-N 4-(5-bromo-1h-indol-3-yl)pyrimidin-2-amine Chemical compound NC1=NC=CC(C=2C3=CC(Br)=CC=C3NC=2)=N1 PKQJCYXKRNGUKQ-UHFFFAOYSA-N 0.000 description 2
- JKNFYCBITUKYLT-UHFFFAOYSA-N 4-(6-bromo-1'-methylspiro[2h-indole-3,3'-pyrrolidine]-1-yl)-5-chloropyrimidin-2-amine Chemical compound C1N(C)CCC21C1=CC=C(Br)C=C1N(C=1C(=CN=C(N)N=1)Cl)C2 JKNFYCBITUKYLT-UHFFFAOYSA-N 0.000 description 2
- BUCDQRQBNAXHQP-UHFFFAOYSA-N 4-(6-bromo-1'-methylspiro[2h-indole-3,3'-pyrrolidine]-1-yl)-5-fluoropyrimidin-2-amine Chemical compound C1N(C)CCC21C1=CC=C(Br)C=C1N(C=1C(=CN=C(N)N=1)F)C2 BUCDQRQBNAXHQP-UHFFFAOYSA-N 0.000 description 2
- VBBGAQQGFQCYRS-UHFFFAOYSA-N 4-(6-bromo-1'-methylspiro[2h-indole-3,3'-pyrrolidine]-1-yl)pyrimidin-2-amine Chemical compound C1N(C)CCC21C1=CC=C(Br)C=C1N(C=1N=C(N)N=CC=1)C2 VBBGAQQGFQCYRS-UHFFFAOYSA-N 0.000 description 2
- SGAWKONYUYWIBX-UHFFFAOYSA-N 4-(6-bromo-2,3-dihydroindol-1-yl)-n-[(4-methoxyphenyl)methyl]pyrimidin-2-amine Chemical compound C1=CC(OC)=CC=C1CNC1=NC=CC(N2C3=CC(Br)=CC=C3CC2)=N1 SGAWKONYUYWIBX-UHFFFAOYSA-N 0.000 description 2
- PGVVQWDCLLVBPQ-UHFFFAOYSA-N 4-(6-bromo-2,3-dihydroindol-1-yl)pyrimidin-2-amine Chemical compound NC1=NC=CC(N2C3=CC(Br)=CC=C3CC2)=N1 PGVVQWDCLLVBPQ-UHFFFAOYSA-N 0.000 description 2
- IVXUACJTGHWJQR-UHFFFAOYSA-N 4-(6-bromo-3,3-dimethyl-2h-indol-1-yl)-n-[4-(2-methoxyethoxy)phenyl]-1,3,5-triazin-2-amine Chemical compound C1=CC(OCCOC)=CC=C1NC1=NC=NC(N2C3=CC(Br)=CC=C3C(C)(C)C2)=N1 IVXUACJTGHWJQR-UHFFFAOYSA-N 0.000 description 2
- BALKTENQLPHWTJ-UHFFFAOYSA-N 4-(6-bromo-4-methoxy-2,3-dihydroindol-1-yl)-5-fluoropyrimidin-2-amine Chemical compound C1CC=2C(OC)=CC(Br)=CC=2N1C1=NC(N)=NC=C1F BALKTENQLPHWTJ-UHFFFAOYSA-N 0.000 description 2
- DUKMFMLLTODUEU-UHFFFAOYSA-N 4-(6-bromospiro[2h-indole-3,4'-oxane]-1-yl)-5-chloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(N2C3=CC(Br)=CC=C3C3(CCOCC3)C2)=N1 DUKMFMLLTODUEU-UHFFFAOYSA-N 0.000 description 2
- ZTGSICGSZVMZDH-UHFFFAOYSA-N 4-[1-(2-amino-5-chloropyrimidin-4-yl)-2,3-dihydroindol-6-yl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)but-3-yn-2-ol Chemical compound CC1=NOC(C(C)(O)C#CC=2C=C3N(CCC3=CC=2)C=2C(=CN=C(N)N=2)Cl)=N1 ZTGSICGSZVMZDH-UHFFFAOYSA-N 0.000 description 2
- VYBSJFCGXISFJF-UHFFFAOYSA-N 4-[1-(2-amino-5-chloropyrimidin-4-yl)-2,3-dihydroindol-6-yl]-2-(4-methylpyridin-2-yl)but-3-yn-2-ol Chemical compound CC1=CC=NC(C(C)(O)C#CC=2C=C3N(CCC3=CC=2)C=2C(=CN=C(N)N=2)Cl)=C1 VYBSJFCGXISFJF-UHFFFAOYSA-N 0.000 description 2
- OCXBDCUTFGZZCM-UHFFFAOYSA-N 4-[1-(2-amino-5-chloropyrimidin-4-yl)-2,3-dihydroindol-6-yl]-2-pyrazin-2-ylbut-3-yn-2-ol Chemical compound C=1N=CC=NC=1C(O)(C)C#CC(C=C12)=CC=C1CCN2C1=NC(N)=NC=C1Cl OCXBDCUTFGZZCM-UHFFFAOYSA-N 0.000 description 2
- ACDMMMNYKDEOEW-UHFFFAOYSA-N 4-[3-(2-aminopyrimidin-4-yl)-5-bromo-1h-indol-2-yl]benzonitrile Chemical compound NC1=NC=CC(C=2C3=CC(Br)=CC=C3NC=2C=2C=CC(=CC=2)C#N)=N1 ACDMMMNYKDEOEW-UHFFFAOYSA-N 0.000 description 2
- ORSFYVZNJYFHIP-UHFFFAOYSA-N 4-[5-bromo-1-(2-methoxyethyl)indol-3-yl]pyrimidin-2-amine Chemical compound C12=CC(Br)=CC=C2N(CCOC)C=C1C1=CC=NC(N)=N1 ORSFYVZNJYFHIP-UHFFFAOYSA-N 0.000 description 2
- SVLFGQAIJAJHFQ-UHFFFAOYSA-N 4-[5-bromo-1-(pyrrolidin-2-ylmethyl)indol-3-yl]-5-chloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(C=2C3=CC(Br)=CC=C3N(CC3NCCC3)C=2)=N1 SVLFGQAIJAJHFQ-UHFFFAOYSA-N 0.000 description 2
- LWOHVGXCNMKPJQ-UHFFFAOYSA-N 4-[5-iodo-1-(2-methoxyethyl)indol-3-yl]pyrimidin-2-amine Chemical compound C12=CC(I)=CC=C2N(CCOC)C=C1C1=CC=NC(N)=N1 LWOHVGXCNMKPJQ-UHFFFAOYSA-N 0.000 description 2
- YDWMIQPSZNSZEP-UHFFFAOYSA-N 4-[6-bromo-4-(2-methoxyethoxy)indol-1-yl]pyrimidin-2-amine Chemical compound C1=CC=2C(OCCOC)=CC(Br)=CC=2N1C1=CC=NC(N)=N1 YDWMIQPSZNSZEP-UHFFFAOYSA-N 0.000 description 2
- PVMNPAUTCMBOMO-UHFFFAOYSA-N 4-chloropyridine Chemical compound ClC1=CC=NC=C1 PVMNPAUTCMBOMO-UHFFFAOYSA-N 0.000 description 2
- DIYKCSZTAIQZME-UHFFFAOYSA-N 4-n-(6-bromopyridin-2-yl)-5-chloropyrimidine-2,4-diamine Chemical compound NC1=NC=C(Cl)C(NC=2N=C(Br)C=CC=2)=N1 DIYKCSZTAIQZME-UHFFFAOYSA-N 0.000 description 2
- IUUOWBAOSICGNO-UHFFFAOYSA-N 5-(5-bromo-1h-indol-3-yl)-1,3-oxazole Chemical compound C12=CC(Br)=CC=C2NC=C1C1=CN=CO1 IUUOWBAOSICGNO-UHFFFAOYSA-N 0.000 description 2
- NXGSZMANXMLTLT-UHFFFAOYSA-N 5-(5-iodo-1h-indazol-3-yl)-1,2-thiazole Chemical compound C12=CC(I)=CC=C2NN=C1C1=CC=NS1 NXGSZMANXMLTLT-UHFFFAOYSA-N 0.000 description 2
- HODJXSCHPMEIPO-UHFFFAOYSA-N 5-(6-iodo-3,3-dimethyl-2h-indol-1-yl)-1,2,4-thiadiazole Chemical compound C12=CC(I)=CC=C2C(C)(C)CN1C1=NC=NS1 HODJXSCHPMEIPO-UHFFFAOYSA-N 0.000 description 2
- DPFPOMBXYSPZBG-UHFFFAOYSA-N 5-bromo-3-ethyl-1h-indene Chemical compound C1=C(Br)C=C2C(CC)=CCC2=C1 DPFPOMBXYSPZBG-UHFFFAOYSA-N 0.000 description 2
- OOBMKTSOFSKCDU-UHFFFAOYSA-N 5-bromo-3-pyrimidin-4-yl-1h-indole Chemical compound C12=CC(Br)=CC=C2NC=C1C1=CC=NC=N1 OOBMKTSOFSKCDU-UHFFFAOYSA-N 0.000 description 2
- SBWOIANSLBOQRR-UHFFFAOYSA-N 5-bromo-n,n-dimethyl-3-(1,3-oxazol-5-yl)indole-1-carboxamide Chemical compound C12=CC(Br)=CC=C2N(C(=O)N(C)C)C=C1C1=CN=CO1 SBWOIANSLBOQRR-UHFFFAOYSA-N 0.000 description 2
- PUYTWORXVCZCIG-UHFFFAOYSA-N 5-bromo-n-(2-methoxyethyl)-1-methyl-3-pyrimidin-4-ylindole-2-carboxamide Chemical compound C12=CC(Br)=CC=C2N(C)C(C(=O)NCCOC)=C1C1=CC=NC=N1 PUYTWORXVCZCIG-UHFFFAOYSA-N 0.000 description 2
- JTTIMCBVMPTLCW-UHFFFAOYSA-N 5-bromo-n-pyrimidin-4-ylpyridine-3-carboxamide Chemical compound BrC1=CN=CC(C(=O)NC=2N=CN=CC=2)=C1 JTTIMCBVMPTLCW-UHFFFAOYSA-N 0.000 description 2
- NVBLFILSAYHNQF-UHFFFAOYSA-N 5-chloro-4-(6-iodo-2,3-dihydroindol-1-yl)pyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(N2C3=CC(I)=CC=C3CC2)=N1 NVBLFILSAYHNQF-UHFFFAOYSA-N 0.000 description 2
- KXOVAOGZPCSULS-UHFFFAOYSA-N 5-chloro-4-(6-iodo-4'-methylspiro[2h-indole-3,2'-morpholine]-1-yl)pyrimidin-2-amine Chemical compound C1N(C)CCOC11C2=CC=C(I)C=C2N(C=2C(=CN=C(N)N=2)Cl)C1 KXOVAOGZPCSULS-UHFFFAOYSA-N 0.000 description 2
- AENORXAEUVJXTF-UHFFFAOYSA-N 5-chloro-4-n-(5-iodo-2-methoxyphenyl)pyrimidine-2,4-diamine Chemical compound COC1=CC=C(I)C=C1NC1=NC(N)=NC=C1Cl AENORXAEUVJXTF-UHFFFAOYSA-N 0.000 description 2
- YXCQDMALOPCGND-UHFFFAOYSA-N 5-chloro-4-n-[5-iodo-2-(morpholin-4-ylmethyl)phenyl]pyrimidine-2,4-diamine Chemical compound NC1=NC=C(Cl)C(NC=2C(=CC=C(I)C=2)CN2CCOCC2)=N1 YXCQDMALOPCGND-UHFFFAOYSA-N 0.000 description 2
- QBAWDLMGZHMNNC-UHFFFAOYSA-N 5-chloro-4-n-[5-iodo-2-[2-methoxyethyl(methyl)amino]phenyl]pyrimidine-2,4-diamine Chemical compound COCCN(C)C1=CC=C(I)C=C1NC1=NC(N)=NC=C1Cl QBAWDLMGZHMNNC-UHFFFAOYSA-N 0.000 description 2
- YLHJFZZVJQAGFN-UHFFFAOYSA-N 5-chloro-n-[5-iodo-2-(2-methoxyethoxy)phenyl]pyrimidin-4-amine Chemical compound COCCOC1=CC=C(I)C=C1NC1=NC=NC=C1Cl YLHJFZZVJQAGFN-UHFFFAOYSA-N 0.000 description 2
- HNHQPSKAQRMADV-UHFFFAOYSA-N 5-iodo-1-methyl-3-pyrimidin-4-ylindole Chemical compound C12=CC(I)=CC=C2N(C)C=C1C1=CC=NC=N1 HNHQPSKAQRMADV-UHFFFAOYSA-N 0.000 description 2
- NNSMRXXPJGLSGS-UHFFFAOYSA-N 5-iodo-3-pyrimidin-4-yl-1h-indole Chemical compound C12=CC(I)=CC=C2NC=C1C1=CC=NC=N1 NNSMRXXPJGLSGS-UHFFFAOYSA-N 0.000 description 2
- SKNANUXIVNKZSI-UHFFFAOYSA-N 6-(5-iodo-2-methylanilino)pyridine-3-carbonitrile Chemical compound CC1=CC=C(I)C=C1NC1=CC=C(C#N)C=N1 SKNANUXIVNKZSI-UHFFFAOYSA-N 0.000 description 2
- MGPWEGXKHZCUPP-UHFFFAOYSA-N 6-(6-bromo-1'-methylspiro[2h-indole-3,3'-pyrrolidine]-1-yl)-7h-purin-2-amine Chemical compound C1N(C)CCC21C1=CC=C(Br)C=C1N(C=1C=3N=CNC=3N=C(N)N=1)C2 MGPWEGXKHZCUPP-UHFFFAOYSA-N 0.000 description 2
- XCZQJMYGAKYWPY-UHFFFAOYSA-N 6-[6-bromo-3-(methoxymethyl)-3-methyl-2h-indol-1-yl]-7h-purin-2-amine Chemical compound C12=CC(Br)=CC=C2C(COC)(C)CN1C1=NC(N)=NC2=C1N=CN2 XCZQJMYGAKYWPY-UHFFFAOYSA-N 0.000 description 2
- QDLUAFRVMDOILC-UHFFFAOYSA-N 6-bromo-1-(1,3,5-triazin-2-yl)spiro[2h-indole-3,4'-oxane] Chemical compound C=1C(Br)=CC=C2C=1N(C=1N=CN=CN=1)CC21CCOCC1 QDLUAFRVMDOILC-UHFFFAOYSA-N 0.000 description 2
- MTSYZAHZABCWMS-UHFFFAOYSA-N 6-bromo-2,3-dihydro-1h-indole Chemical compound BrC1=CC=C2CCNC2=C1 MTSYZAHZABCWMS-UHFFFAOYSA-N 0.000 description 2
- RKQJDMLYLRITBE-UHFFFAOYSA-N 6-bromo-3-(2-methoxyethoxymethyl)-3-methyl-1h-indol-2-one Chemical compound BrC1=CC=C2C(COCCOC)(C)C(=O)NC2=C1 RKQJDMLYLRITBE-UHFFFAOYSA-N 0.000 description 2
- JPTYVVNXEQTLBC-UHFFFAOYSA-N 6-bromo-3-(2-methoxyethyl)-3-methyl-1,2-dihydroindole Chemical compound BrC1=CC=C2C(CCOC)(C)CNC2=C1 JPTYVVNXEQTLBC-UHFFFAOYSA-N 0.000 description 2
- RYIFGDWLCOOQSX-UHFFFAOYSA-N 6-bromo-3-methyl-3-prop-2-enyl-1h-indol-2-one Chemical compound BrC1=CC=C2C(C)(CC=C)C(=O)NC2=C1 RYIFGDWLCOOQSX-UHFFFAOYSA-N 0.000 description 2
- QLFZHBGNWHHJQK-UHFFFAOYSA-N 6-bromo-n-(2-methoxyethyl)-n-methyl-4-pyrimidin-4-yl-2,3-dihydro-1h-pyrrolo[1,2-a]indol-3-amine Chemical compound COCCN(C)C1CCN(C2=CC=C(Br)C=C22)C1=C2C1=CC=NC=N1 QLFZHBGNWHHJQK-UHFFFAOYSA-N 0.000 description 2
- JXRBBEGBCZJEOR-UHFFFAOYSA-N 6-bromo-n-[3-(trifluoromethyl)pyridin-4-yl]pyridin-2-amine Chemical compound FC(F)(F)C1=CN=CC=C1NC1=CC=CC(Br)=N1 JXRBBEGBCZJEOR-UHFFFAOYSA-N 0.000 description 2
- UKLXAIYFEABKNB-UHFFFAOYSA-N 6-bromospiro[1,2-dihydroindole-3,4'-thiane] 1',1'-dioxide Chemical compound C=1C(Br)=CC=C2C=1NCC21CCS(=O)(=O)CC1 UKLXAIYFEABKNB-UHFFFAOYSA-N 0.000 description 2
- UNRIYCIDCQDGQE-UHFFFAOYSA-N 6-chloro-2-fluoro-7h-purine Chemical compound FC1=NC(Cl)=C2NC=NC2=N1 UNRIYCIDCQDGQE-UHFFFAOYSA-N 0.000 description 2
- JOLYEFCRKBKNMY-UHFFFAOYSA-N 6-iodo-1-pyrimidin-4-ylspiro[2h-indole-3,4'-oxane] Chemical compound C=1C(I)=CC=C2C=1N(C=1N=CN=CC=1)CC21CCOCC1 JOLYEFCRKBKNMY-UHFFFAOYSA-N 0.000 description 2
- ZHNDABACTRFWLL-UHFFFAOYSA-N 6-iodo-3,3-dimethyl-1,2-dihydroindole Chemical compound IC1=CC=C2C(C)(C)CNC2=C1 ZHNDABACTRFWLL-UHFFFAOYSA-N 0.000 description 2
- LITUVEUCZWHHFZ-UHFFFAOYSA-N 6-iodo-3,3-dimethyl-2h-indole-1-carbothioamide Chemical compound IC1=CC=C2C(C)(C)CN(C(N)=S)C2=C1 LITUVEUCZWHHFZ-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- 108010028006 B-Cell Activating Factor Proteins 0.000 description 2
- 229910015845 BBr3 Inorganic materials 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- GUDPJHONHNSJBI-PMMFOGROSA-N C([ClH]([2H])([2H])([2H])([2H])[2H])(Cl)(Cl)[2H] Chemical compound C([ClH]([2H])([2H])([2H])([2H])[2H])(Cl)(Cl)[2H] GUDPJHONHNSJBI-PMMFOGROSA-N 0.000 description 2
- 102000004127 Cytokines Human genes 0.000 description 2
- 108090000695 Cytokines Proteins 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- WDNRQAURQWHUPM-UHFFFAOYSA-N FC(C(=O)OCC)=CO.[Na] Chemical compound FC(C(=O)OCC)=CO.[Na] WDNRQAURQWHUPM-UHFFFAOYSA-N 0.000 description 2
- 208000034951 Genetic Translocation Diseases 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- 102000001291 MAP Kinase Kinase Kinase Human genes 0.000 description 2
- 108030005453 Mitogen-activated protein kinase kinase kinases Proteins 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 2
- 108700020796 Oncogene Proteins 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N Pd(PPh3)4 Substances [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WHBMMWSBFZVSSR-UHFFFAOYSA-N R3HBA Natural products CC(O)CC(O)=O WHBMMWSBFZVSSR-UHFFFAOYSA-N 0.000 description 2
- 108010077895 Sarcosine Proteins 0.000 description 2
- 102100033077 TNF receptor-associated factor 2 Human genes 0.000 description 2
- 108090000925 TNF receptor-associated factor 2 Proteins 0.000 description 2
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 2
- 229910052770 Uranium Inorganic materials 0.000 description 2
- YVRSCTRBERRMPV-AWEZNQCLSA-N [(3s)-1-(2-amino-5-chloropyrimidin-4-yl)-6-bromo-3-methyl-2h-indol-3-yl]methanol Chemical compound C([C@](C1=CC=C(Br)C=C11)(CO)C)N1C1=NC(N)=NC=C1Cl YVRSCTRBERRMPV-AWEZNQCLSA-N 0.000 description 2
- BJWWNWRJFHWLCG-UHFFFAOYSA-N [1-(2-amino-5-fluoropyrimidin-4-yl)-6-bromo-4-methoxyindol-3-yl]methanol Chemical compound C1=C(CO)C=2C(OC)=CC(Br)=CC=2N1C1=NC(N)=NC=C1F BJWWNWRJFHWLCG-UHFFFAOYSA-N 0.000 description 2
- OBYJEXCGHKKOMX-UHFFFAOYSA-N [6-bromo-3-(hydroxymethyl)-1-pyridin-4-yl-2h-indol-3-yl]methanol Chemical compound C12=CC(Br)=CC=C2C(CO)(CO)CN1C1=CC=NC=C1 OBYJEXCGHKKOMX-UHFFFAOYSA-N 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 230000001270 agonistic effect Effects 0.000 description 2
- 125000003418 alkyl amino alkoxy group Chemical group 0.000 description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 2
- 125000004471 alkyl aminosulfonyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 125000005466 alkylenyl group Chemical group 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
- 239000000427 antigen Substances 0.000 description 2
- 102000036639 antigens Human genes 0.000 description 2
- 108091007433 antigens Proteins 0.000 description 2
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 2
- 125000005110 aryl thio group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N benzopyrrole Natural products C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000001185 bone marrow Anatomy 0.000 description 2
- 229910000085 borane Inorganic materials 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 208000035269 cancer or benign tumor Diseases 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004296 chiral HPLC Methods 0.000 description 2
- 206010009887 colitis Diseases 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 230000001086 cytosolic effect Effects 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 description 2
- 125000004982 dihaloalkyl group Chemical group 0.000 description 2
- 125000004598 dihydrobenzofuryl group Chemical group O1C(CC2=C1C=CC=C2)* 0.000 description 2
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 2
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 2
- 125000005056 dihydrothiazolyl group Chemical group S1C(NC=C1)* 0.000 description 2
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 239000002158 endotoxin Substances 0.000 description 2
- CRQDMZXSIARAKL-UHFFFAOYSA-N ethyl 6-bromo-3-oxo-1,2-dihydropyrrolo[1,2-a]indole-2-carboxylate Chemical compound BrC1=CC=C2N3CC(C(=O)OCC)C(=O)C3=CC2=C1 CRQDMZXSIARAKL-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012091 fetal bovine serum Substances 0.000 description 2
- 230000002068 genetic effect Effects 0.000 description 2
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 125000004438 haloalkoxy group Chemical group 0.000 description 2
- 125000004995 haloalkylthio group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 2
- 125000005241 heteroarylamino group Chemical group 0.000 description 2
- 239000000833 heterodimer Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 125000002632 imidazolidinyl group Chemical group 0.000 description 2
- 230000001771 impaired effect Effects 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 125000005956 isoquinolyl group Chemical group 0.000 description 2
- 229920006008 lipopolysaccharide Polymers 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 210000004698 lymphocyte Anatomy 0.000 description 2
- 210000002540 macrophage Anatomy 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 210000003519 mature b lymphocyte Anatomy 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- SFXRMPFOBYGVES-UHFFFAOYSA-N methyl 2-(4-bromo-2-nitrophenyl)-2-hydroxy-3-[2-hydroxyethyl(methyl)amino]propanoate Chemical compound OCCN(C)CC(O)(C(=O)OC)C1=CC=C(Br)C=C1[N+]([O-])=O SFXRMPFOBYGVES-UHFFFAOYSA-N 0.000 description 2
- LANRHTWGKRUGKO-UHFFFAOYSA-N methyl 2-(6-bromo-3-methyl-2-oxo-1h-indol-3-yl)acetate Chemical compound BrC1=CC=C2C(CC(=O)OC)(C)C(=O)NC2=C1 LANRHTWGKRUGKO-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000012046 mixed solvent Substances 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- 201000000050 myeloid neoplasm Diseases 0.000 description 2
- HXRAMSFGUAOAJR-UHFFFAOYSA-N n,n,n',n'-tetramethyl-1-[(2-methylpropan-2-yl)oxy]methanediamine Chemical compound CN(C)C(N(C)C)OC(C)(C)C HXRAMSFGUAOAJR-UHFFFAOYSA-N 0.000 description 2
- COBUUOOCVVCMBQ-UHFFFAOYSA-N n-(6-bromopyridin-2-yl)-n-(2-morpholin-4-ylethyl)pyrimidin-4-amine Chemical compound BrC1=CC=CC(N(CCN2CCOCC2)C=2N=CN=CC=2)=N1 COBUUOOCVVCMBQ-UHFFFAOYSA-N 0.000 description 2
- HEUZIULFWAJLEI-UHFFFAOYSA-N n-(6-bromopyridin-2-yl)pyrimidin-4-amine Chemical compound BrC1=CC=CC(NC=2N=CN=CC=2)=N1 HEUZIULFWAJLEI-UHFFFAOYSA-N 0.000 description 2
- SQYXBUATYUQXHQ-UHFFFAOYSA-N n-(dimethylaminomethylidene)-6-iodo-3,3-dimethyl-2h-indole-1-carbothioamide Chemical compound C1=C(I)C=C2N(C(=S)N=CN(C)C)CC(C)(C)C2=C1 SQYXBUATYUQXHQ-UHFFFAOYSA-N 0.000 description 2
- KTSQIFQZKQYBFM-UHFFFAOYSA-N n-[1-(2-amino-5-chloropyrimidin-4-yl)-6-bromo-2,3-dihydroindol-4-yl]acetamide Chemical compound C1CC=2C(NC(=O)C)=CC(Br)=CC=2N1C1=NC(N)=NC=C1Cl KTSQIFQZKQYBFM-UHFFFAOYSA-N 0.000 description 2
- XFZSPEGGHGIPFN-UHFFFAOYSA-N n-[1-(2-aminopyrimidin-4-yl)-6-bromoindol-4-yl]acetamide Chemical compound C1=CC=2C(NC(=O)C)=CC(Br)=CC=2N1C1=CC=NC(N)=N1 XFZSPEGGHGIPFN-UHFFFAOYSA-N 0.000 description 2
- 230000005305 organ development Effects 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 210000002997 osteoclast Anatomy 0.000 description 2
- BOTREHHXSQGWTR-UHFFFAOYSA-N oxolane-3-carboxylic acid Chemical compound OC(=O)C1CCOC1 BOTREHHXSQGWTR-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Chemical group 0.000 description 2
- 230000008506 pathogenesis Effects 0.000 description 2
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 2
- 210000001986 peyer's patch Anatomy 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- 239000002953 phosphate buffered saline Substances 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 125000006684 polyhaloalkyl group Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000000770 proinflammatory effect Effects 0.000 description 2
- 230000001737 promoting effect Effects 0.000 description 2
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- OYRRZWATULMEPF-UHFFFAOYSA-N pyrimidin-4-amine Chemical compound NC1=CC=NC=N1 OYRRZWATULMEPF-UHFFFAOYSA-N 0.000 description 2
- YAAWASYJIRZXSZ-UHFFFAOYSA-N pyrimidine-2,4-diamine Chemical compound NC1=CC=NC(N)=N1 YAAWASYJIRZXSZ-UHFFFAOYSA-N 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 125000001422 pyrrolinyl group Chemical group 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- 229910052702 rhenium Inorganic materials 0.000 description 2
- 229940043230 sarcosine Drugs 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 125000003003 spiro group Chemical group 0.000 description 2
- NZHWYOLXENRFJZ-UHFFFAOYSA-N spiro[1h-indole-3,3'-azetidine]-2-one Chemical compound O=C1NC2=CC=CC=C2C11CNC1 NZHWYOLXENRFJZ-UHFFFAOYSA-N 0.000 description 2
- 210000000952 spleen Anatomy 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- MLNYRSOWDCEDIQ-UHFFFAOYSA-N tert-butyl 6-bromo-3-(2-cyanoethyl)-3-methyl-2h-indole-1-carboxylate Chemical compound C1=C(Br)C=C2N(C(=O)OC(C)(C)C)CC(C)(CCC#N)C2=C1 MLNYRSOWDCEDIQ-UHFFFAOYSA-N 0.000 description 2
- GVNXXEOURIMQRV-CMDGGOBGSA-N tert-butyl 6-bromo-3-[(e)-2-methoxyethenyl]-3-methyl-2h-indole-1-carboxylate Chemical compound BrC1=CC=C2C(/C=C/OC)(C)CN(C(=O)OC(C)(C)C)C2=C1 GVNXXEOURIMQRV-CMDGGOBGSA-N 0.000 description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 description 2
- 210000001541 thymus gland Anatomy 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 238000013518 transcription Methods 0.000 description 2
- 230000035897 transcription Effects 0.000 description 2
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 208000035408 type 1 diabetes mellitus 1 Diseases 0.000 description 2
- 238000003828 vacuum filtration Methods 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- RPYIPFXHIKXRKS-UHFFFAOYSA-N (3-bromophenyl)hydrazine;hydron;chloride Chemical compound Cl.NNC1=CC=CC(Br)=C1 RPYIPFXHIKXRKS-UHFFFAOYSA-N 0.000 description 1
- XDPCNPCKDGQBAN-SCSAIBSYSA-N (3r)-oxolan-3-ol Chemical compound O[C@@H]1CCOC1 XDPCNPCKDGQBAN-SCSAIBSYSA-N 0.000 description 1
- XDPCNPCKDGQBAN-BYPYZUCNSA-N (3s)-oxolan-3-ol Chemical compound O[C@H]1CCOC1 XDPCNPCKDGQBAN-BYPYZUCNSA-N 0.000 description 1
- RGGOWBBBHWTTRE-UHFFFAOYSA-N (4-bromophenyl)hydrazine;hydron;chloride Chemical compound Cl.NNC1=CC=C(Br)C=C1 RGGOWBBBHWTTRE-UHFFFAOYSA-N 0.000 description 1
- ZQKZTQNBOIUQDB-UHFFFAOYSA-N (5-bromo-1h-indol-2-yl)-morpholin-4-ylmethanone Chemical compound C=1C2=CC(Br)=CC=C2NC=1C(=O)N1CCOCC1 ZQKZTQNBOIUQDB-UHFFFAOYSA-N 0.000 description 1
- LHGWOIIPCMOTCI-UHFFFAOYSA-N (5-bromo-3-pyrimidin-4-yl-1h-indol-2-yl)-morpholin-4-ylmethanone Chemical compound C=1C=NC=NC=1C=1C2=CC(Br)=CC=C2NC=1C(=O)N1CCOCC1 LHGWOIIPCMOTCI-UHFFFAOYSA-N 0.000 description 1
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- IDPURXSQCKYKIJ-UHFFFAOYSA-N 1-(4-methoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1 IDPURXSQCKYKIJ-UHFFFAOYSA-N 0.000 description 1
- RMCQCVYGHWTDSP-UHFFFAOYSA-N 1-(5-bromo-1h-indol-3-yl)ethanone Chemical compound C1=C(Br)C=C2C(C(=O)C)=CNC2=C1 RMCQCVYGHWTDSP-UHFFFAOYSA-N 0.000 description 1
- FDFKETITWKJRNI-UHFFFAOYSA-N 1-(6-amino-3,3-dimethyl-2h-indol-1-yl)ethanone Chemical compound C1=C(N)C=C2N(C(=O)C)CC(C)(C)C2=C1 FDFKETITWKJRNI-UHFFFAOYSA-N 0.000 description 1
- DLLWBEVOKZGAKS-UHFFFAOYSA-N 1-(6-bromo-1',1'-dioxospiro[2h-indole-3,4'-thiane]-1-yl)ethanone Chemical compound C12=CC=C(Br)C=C2N(C(=O)C)CC21CCS(=O)(=O)CC2 DLLWBEVOKZGAKS-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- NCADHSLPNSTDMJ-UHFFFAOYSA-N 1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CC(C(O)=O)C1 NCADHSLPNSTDMJ-UHFFFAOYSA-N 0.000 description 1
- LXJBSLYINDELGE-UHFFFAOYSA-N 1-[5-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethanone Chemical compound C12=CC=C(Br)C=C2C(C(=O)C)=CN1S(=O)(=O)C1=CC=C(C)C=C1 LXJBSLYINDELGE-UHFFFAOYSA-N 0.000 description 1
- ZPVKRRZTUZZJRX-UHFFFAOYSA-N 1-[5-bromo-2-(morpholine-4-carbonyl)-1h-indol-3-yl]ethanone Chemical compound N1C2=CC=C(Br)C=C2C(C(=O)C)=C1C(=O)N1CCOCC1 ZPVKRRZTUZZJRX-UHFFFAOYSA-N 0.000 description 1
- QXQAPNSHUJORMC-UHFFFAOYSA-N 1-chloro-4-propylbenzene Chemical compound CCCC1=CC=C(Cl)C=C1 QXQAPNSHUJORMC-UHFFFAOYSA-N 0.000 description 1
- WUIJTQZXUURFQU-UHFFFAOYSA-N 1-methylsulfonylethene Chemical compound CS(=O)(=O)C=C WUIJTQZXUURFQU-UHFFFAOYSA-N 0.000 description 1
- ILRVKOYYFFNXDB-UHFFFAOYSA-N 1-pyridin-4-ylpropan-2-one Chemical compound CC(=O)CC1=CC=NC=C1 ILRVKOYYFFNXDB-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- OMRXVBREYFZQHU-UHFFFAOYSA-N 2,4-dichloro-1,3,5-triazine Chemical compound ClC1=NC=NC(Cl)=N1 OMRXVBREYFZQHU-UHFFFAOYSA-N 0.000 description 1
- XGLVDUUYFKXKPL-UHFFFAOYSA-N 2-(2-methoxyethoxy)-n,n-bis[2-(2-methoxyethoxy)ethyl]ethanamine Chemical compound COCCOCCN(CCOCCOC)CCOCCOC XGLVDUUYFKXKPL-UHFFFAOYSA-N 0.000 description 1
- HFPRLHLRQSULTC-UHFFFAOYSA-N 2-(6-bromo-3-methyl-1,2-dihydroindol-3-yl)ethanol Chemical compound BrC1=CC=C2C(C)(CCO)CNC2=C1 HFPRLHLRQSULTC-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- QYSFDNJZXYZDTR-UHFFFAOYSA-N 2-amino-4-(5-bromo-1h-indol-3-yl)pyrimidine-5-carbonitrile Chemical compound NC1=NC=C(C#N)C(C=2C3=CC(Br)=CC=C3NC=2)=N1 QYSFDNJZXYZDTR-UHFFFAOYSA-N 0.000 description 1
- XQCZBXHVTFVIFE-UHFFFAOYSA-N 2-amino-4-hydroxypyrimidine Chemical compound NC1=NC=CC(O)=N1 XQCZBXHVTFVIFE-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- JAUPUQRPBNDMDT-UHFFFAOYSA-N 2-chloropyridine-3-carbonitrile Chemical compound ClC1=NC=CC=C1C#N JAUPUQRPBNDMDT-UHFFFAOYSA-N 0.000 description 1
- BIRCCQCPGMMGPJ-UHFFFAOYSA-N 2-fluoro-5-iodobenzaldehyde Chemical compound FC1=CC=C(I)C=C1C=O BIRCCQCPGMMGPJ-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- OBXUKZGSGNXPSH-UHFFFAOYSA-N 2-phenoxy-1,3,5-triazine Chemical compound N=1C=NC=NC=1OC1=CC=CC=C1 OBXUKZGSGNXPSH-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- AXVYBJKOHAOZBN-UHFFFAOYSA-N 3-(6-bromo-3-methyl-1,2-dihydroindol-3-yl)propan-1-ol Chemical compound BrC1=CC=C2C(C)(CCCO)CNC2=C1 AXVYBJKOHAOZBN-UHFFFAOYSA-N 0.000 description 1
- WXXMDMUZOTZNDQ-UHFFFAOYSA-N 3-(6-bromo-3-methyl-1,2-dihydroindol-3-yl)propanenitrile Chemical compound BrC1=CC=C2C(C)(CCC#N)CNC2=C1 WXXMDMUZOTZNDQ-UHFFFAOYSA-N 0.000 description 1
- DYAGVPKVELUYPJ-UHFFFAOYSA-N 3-(trifluoromethyl)pyridin-4-amine Chemical compound NC1=CC=NC=C1C(F)(F)F DYAGVPKVELUYPJ-UHFFFAOYSA-N 0.000 description 1
- CEAJZIOXMJKHDY-UHFFFAOYSA-N 3-[1-(2-amino-5-chloropyrimidin-4-yl)-6-bromo-3-methyl-2h-indol-3-yl]propan-1-ol Chemical compound C12=CC(Br)=CC=C2C(C)(CCCO)CN1C1=NC(N)=NC=C1Cl CEAJZIOXMJKHDY-UHFFFAOYSA-N 0.000 description 1
- IJDHZADLZKKPER-UHFFFAOYSA-N 3-[1-(2-amino-5-fluoropyrimidin-4-yl)-6-bromo-3-methyl-2h-indol-3-yl]propanenitrile Chemical compound C12=CC(Br)=CC=C2C(C)(CCC#N)CN1C1=NC(N)=NC=C1F IJDHZADLZKKPER-UHFFFAOYSA-N 0.000 description 1
- LDEDZSRWQWVMKU-UHFFFAOYSA-N 3-acetyl-5-bromo-n-cyclopropyl-1h-indole-2-carboxamide Chemical compound N1C2=CC=C(Br)C=C2C(C(=O)C)=C1C(=O)NC1CC1 LDEDZSRWQWVMKU-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- IGPFOKFDBICQMC-UHFFFAOYSA-N 3-phenylmethoxyaniline Chemical compound NC1=CC=CC(OCC=2C=CC=CC=2)=C1 IGPFOKFDBICQMC-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- NBJHDLKSWUDGJG-UHFFFAOYSA-N 4-(2-chloroethyl)morpholin-4-ium;chloride Chemical compound Cl.ClCCN1CCOCC1 NBJHDLKSWUDGJG-UHFFFAOYSA-N 0.000 description 1
- DIOBEQCFVVJJBU-UHFFFAOYSA-N 4-(2-methoxyethoxy)aniline Chemical compound COCCOC1=CC=C(N)C=C1 DIOBEQCFVVJJBU-UHFFFAOYSA-N 0.000 description 1
- DTAHDYXVOUBRRD-UHFFFAOYSA-N 4-(5-bromo-1-pyrrolidin-3-ylindol-3-yl)-5-chloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(C=2C3=CC(Br)=CC=C3N(C3CNCC3)C=2)=N1 DTAHDYXVOUBRRD-UHFFFAOYSA-N 0.000 description 1
- ZJNODYBJXPNRHE-UHFFFAOYSA-N 4-(5-bromo-1h-indol-3-yl)-5-chloro-n-methylpyrimidin-2-amine Chemical compound CNC1=NC=C(Cl)C(C=2C3=CC(Br)=CC=C3NC=2)=N1 ZJNODYBJXPNRHE-UHFFFAOYSA-N 0.000 description 1
- OPKMWWWEZGNNKW-UHFFFAOYSA-N 4-(6-bromo-1',1'-dioxospiro[2h-indole-3,3'-thietane]-1-yl)-5-chloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(N2C3=CC(Br)=CC=C3C3(CS(=O)(=O)C3)C2)=N1 OPKMWWWEZGNNKW-UHFFFAOYSA-N 0.000 description 1
- GMZHLXVJVVEVRR-UHFFFAOYSA-N 4-(6-bromo-1',1'-dioxospiro[2h-indole-3,4'-thiane]-1-yl)-5-chloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(N2C3=CC(Br)=CC=C3C3(CCS(=O)(=O)CC3)C2)=N1 GMZHLXVJVVEVRR-UHFFFAOYSA-N 0.000 description 1
- XLXRHPYJMNRJMB-UHFFFAOYSA-N 4-(6-bromo-2,3-dihydroindol-1-yl)-5-fluoropyrimidin-2-amine Chemical compound NC1=NC=C(F)C(N2C3=CC(Br)=CC=C3CC2)=N1 XLXRHPYJMNRJMB-UHFFFAOYSA-N 0.000 description 1
- CVGYNCZHBPTLON-UHFFFAOYSA-N 4-(6-bromo-3,3-dimethyl-2h-indol-1-yl)-5-fluoropyrimidin-2-amine Chemical compound C12=CC(Br)=CC=C2C(C)(C)CN1C1=NC(N)=NC=C1F CVGYNCZHBPTLON-UHFFFAOYSA-N 0.000 description 1
- YZDSCICSVXKIFG-UHFFFAOYSA-N 4-(6-bromo-4-methoxyindol-1-yl)-5-fluoropyrimidin-2-amine Chemical compound C1=CC=2C(OC)=CC(Br)=CC=2N1C1=NC(N)=NC=C1F YZDSCICSVXKIFG-UHFFFAOYSA-N 0.000 description 1
- LXIWWIBXXZSTCH-UHFFFAOYSA-N 4-(6-bromospiro[2h-indole-3,4'-oxane]-1-yl)-5-fluoropyrimidin-2-amine Chemical compound NC1=NC=C(F)C(N2C3=CC(Br)=CC=C3C3(CCOCC3)C2)=N1 LXIWWIBXXZSTCH-UHFFFAOYSA-N 0.000 description 1
- UAUCAXFRRJKTCZ-UHFFFAOYSA-N 4-(6-bromospiro[2h-indole-3,4'-thiane]-1-yl)-5-chloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(N2C3=CC(Br)=CC=C3C3(CCSCC3)C2)=N1 UAUCAXFRRJKTCZ-UHFFFAOYSA-N 0.000 description 1
- UFXKEFOXDJGPMD-UHFFFAOYSA-N 4-(6-bromospiro[indene-3,4'-oxane]-1-yl)-5-chloropyrimidin-2-amine Chemical compound NC1=NC=C(Cl)C(C=2C3=CC(Br)=CC=C3C3(CCOCC3)C=2)=N1 UFXKEFOXDJGPMD-UHFFFAOYSA-N 0.000 description 1
- UXEYNXKRVIMLPK-UHFFFAOYSA-N 4-[1-(2-amino-5-chloropyrimidin-4-yl)-2,3-dihydroindol-6-yl]-2-(4-fluoropyridin-2-yl)but-3-yn-2-ol Chemical compound C=1C(F)=CC=NC=1C(O)(C)C#CC(C=C12)=CC=C1CCN2C1=NC(N)=NC=C1Cl UXEYNXKRVIMLPK-UHFFFAOYSA-N 0.000 description 1
- GUBPSVPHXRWQSV-UHFFFAOYSA-N 4-[3-(2-aminopyrimidin-4-yl)-5-bromo-1h-indol-2-yl]-n-tert-butylbenzamide Chemical compound C1=CC(C(=O)NC(C)(C)C)=CC=C1C1=C(C=2N=C(N)N=CC=2)C2=CC(Br)=CC=C2N1 GUBPSVPHXRWQSV-UHFFFAOYSA-N 0.000 description 1
- YHPCOSFRWVTYNF-UHFFFAOYSA-N 4-[5-bromo-1-(2-methoxyethyl)indol-3-yl]-5-chloropyrimidin-2-amine Chemical compound C12=CC(Br)=CC=C2N(CCOC)C=C1C1=NC(N)=NC=C1Cl YHPCOSFRWVTYNF-UHFFFAOYSA-N 0.000 description 1
- OVTLVSINYMTSDX-UHFFFAOYSA-N 4-[5-bromo-3-(2-methylsulfanylpyrimidin-4-yl)-1h-indol-2-yl]-n-tert-butylbenzamide Chemical compound CSC1=NC=CC(C=2C3=CC(Br)=CC=C3NC=2C=2C=CC(=CC=2)C(=O)NC(C)(C)C)=N1 OVTLVSINYMTSDX-UHFFFAOYSA-N 0.000 description 1
- XWSRXBRPRUCOTN-UHFFFAOYSA-N 4-[5-bromo-3-(2-methylsulfanylpyrimidin-4-yl)-1h-indol-2-yl]benzonitrile Chemical compound CSC1=NC=CC(C=2C3=CC(Br)=CC=C3NC=2C=2C=CC(=CC=2)C#N)=N1 XWSRXBRPRUCOTN-UHFFFAOYSA-N 0.000 description 1
- NOIBVDVPQOVSSL-UHFFFAOYSA-N 4-[6-bromo-3-(2-methoxyethyl)-3-methyl-2h-indol-1-yl]-5-chloropyrimidin-2-amine Chemical compound C12=CC(Br)=CC=C2C(CCOC)(C)CN1C1=NC(N)=NC=C1Cl NOIBVDVPQOVSSL-UHFFFAOYSA-N 0.000 description 1
- UQEANKGXXSENNF-UHFFFAOYSA-N 4-bromo-1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Br)=CC=C1F UQEANKGXXSENNF-UHFFFAOYSA-N 0.000 description 1
- VQCWSOYHHXXWSP-UHFFFAOYSA-N 4-bromo-2-fluoro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Br)C=C1F VQCWSOYHHXXWSP-UHFFFAOYSA-N 0.000 description 1
- XGAFCCUNHIMIRV-UHFFFAOYSA-N 4-chloropyridine;hydron;chloride Chemical compound Cl.ClC1=CC=NC=C1 XGAFCCUNHIMIRV-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- 125000005274 4-hydroxybenzoic acid group Chemical group 0.000 description 1
- QLMRDNPXYNJQMQ-UHFFFAOYSA-N 4-iodo-1-methyl-2-nitrobenzene Chemical compound CC1=CC=C(I)C=C1[N+]([O-])=O QLMRDNPXYNJQMQ-UHFFFAOYSA-N 0.000 description 1
- MFGLAIXUBTYUCK-UHFFFAOYSA-N 4-iodo-2-N-(2-methoxyethyl)-2-N-methylbenzene-1,2-diamine Chemical compound IC=1C=C(C(=CC1)N)N(C)CCOC MFGLAIXUBTYUCK-UHFFFAOYSA-N 0.000 description 1
- UCERVHYBSTYCQS-UHFFFAOYSA-N 4-methyl-2-methylsulfanylpyrimidine Chemical compound CSC1=NC=CC(C)=N1 UCERVHYBSTYCQS-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- YAULOOYNCJDPPU-UHFFFAOYSA-N 5-bromo-1h-indole-2-carboxylic acid Chemical compound BrC1=CC=C2NC(C(=O)O)=CC2=C1 YAULOOYNCJDPPU-UHFFFAOYSA-N 0.000 description 1
- PEENKJZANBYXNB-UHFFFAOYSA-N 5-bromo-1h-indole-3-carbaldehyde Chemical compound BrC1=CC=C2NC=C(C=O)C2=C1 PEENKJZANBYXNB-UHFFFAOYSA-N 0.000 description 1
- DUFZASTWIVJXGA-UHFFFAOYSA-N 5-bromo-n-(2-methoxyethyl)-3-pyrimidin-4-yl-1h-indole-2-carboxamide Chemical compound COCCNC(=O)C=1NC2=CC=C(Br)C=C2C=1C1=CC=NC=N1 DUFZASTWIVJXGA-UHFFFAOYSA-N 0.000 description 1
- XIZMKHZLIPDYFY-UHFFFAOYSA-N 5-bromo-n-cyclopropyl-1h-indole-2-carboxamide Chemical compound C=1C2=CC(Br)=CC=C2NC=1C(=O)NC1CC1 XIZMKHZLIPDYFY-UHFFFAOYSA-N 0.000 description 1
- PEZYVFVLMOSJCQ-UHFFFAOYSA-N 5-bromo-n-cyclopropyl-3-pyrimidin-4-yl-1h-indole-2-carboxamide Chemical compound C=1C=NC=NC=1C=1C2=CC(Br)=CC=C2NC=1C(=O)NC1CC1 PEZYVFVLMOSJCQ-UHFFFAOYSA-N 0.000 description 1
- RTLIRCJGXBJCDC-UHFFFAOYSA-N 5-chloro-2-N-[5-iodo-2-(oxan-4-yloxy)phenyl]-4-N-methylpyrimidine-2,4-diamine Chemical compound ClC=1C(=NC(=NC1)NC1=C(C=CC(=C1)I)OC1CCOCC1)NC RTLIRCJGXBJCDC-UHFFFAOYSA-N 0.000 description 1
- VFWKKCAXTBHLRX-UHFFFAOYSA-N 5-chloro-4-(6-iodo-3,3-dimethyl-2h-indol-1-yl)pyrimidin-2-amine Chemical compound C12=CC(I)=CC=C2C(C)(C)CN1C1=NC(N)=NC=C1Cl VFWKKCAXTBHLRX-UHFFFAOYSA-N 0.000 description 1
- AWJIEDCDJXGKCY-UHFFFAOYSA-N 5-chloro-4-N-[5-iodo-2-(oxan-4-yloxy)phenyl]-2-N-methylpyrimidine-2,4-diamine Chemical compound ClC=1C(=NC(=NC1)NC)NC1=C(C=CC(=C1)I)OC1CCOCC1 AWJIEDCDJXGKCY-UHFFFAOYSA-N 0.000 description 1
- RTNGJVQEOOKQQV-UHFFFAOYSA-N 5-chloro-4-[5-iodo-1-(2-methoxyethyl)indol-3-yl]pyrimidin-2-amine Chemical compound C12=CC(I)=CC=C2N(CCOC)C=C1C1=NC(N)=NC=C1Cl RTNGJVQEOOKQQV-UHFFFAOYSA-N 0.000 description 1
- CEDLIQAJTGPXLF-UHFFFAOYSA-N 5-chloro-4-n-(2-fluoro-5-iodophenyl)pyrimidine-2,4-diamine Chemical compound NC1=NC=C(Cl)C(NC=2C(=CC=C(I)C=2)F)=N1 CEDLIQAJTGPXLF-UHFFFAOYSA-N 0.000 description 1
- NGEVQQAZZYHREP-UHFFFAOYSA-N 5-chloro-4-n-(5-iodo-2-methylphenyl)pyrimidine-2,4-diamine Chemical compound CC1=CC=C(I)C=C1NC1=NC(N)=NC=C1Cl NGEVQQAZZYHREP-UHFFFAOYSA-N 0.000 description 1
- KZLSPGYWWCMVIW-VIFPVBQESA-N 5-chloro-4-n-[5-iodo-2-[(3s)-oxolan-3-yl]oxyphenyl]pyrimidine-2,4-diamine Chemical compound NC1=NC=C(Cl)C(NC=2C(=CC=C(I)C=2)O[C@@H]2COCC2)=N1 KZLSPGYWWCMVIW-VIFPVBQESA-N 0.000 description 1
- KCAGMESWEMVFON-UHFFFAOYSA-N 5-iodo-2-methoxyaniline Chemical compound COC1=CC=C(I)C=C1N KCAGMESWEMVFON-UHFFFAOYSA-N 0.000 description 1
- SQBBGUZUTNTBIG-UHFFFAOYSA-N 6-(6-bromo-1'-methylspiro[2h-indole-3,4'-piperidine]-1-yl)-7h-purin-2-amine Chemical compound C1CN(C)CCC11C2=CC=C(Br)C=C2N(C=2C=3NC=NC=3N=C(N)N=2)C1 SQBBGUZUTNTBIG-UHFFFAOYSA-N 0.000 description 1
- ZQXKTZKHXLTGEF-UHFFFAOYSA-N 6-(6-bromo-2,3-dihydroindol-1-yl)-7h-purin-2-amine Chemical compound C1CC2=CC=C(Br)C=C2N1C1=C(N=CN2)C2=NC(N)=N1 ZQXKTZKHXLTGEF-UHFFFAOYSA-N 0.000 description 1
- MMSVRFZHAGSVSL-UHFFFAOYSA-N 6-(6-bromo-3,3-dimethyl-2h-indol-1-yl)-7h-purin-2-amine Chemical compound C12=CC(Br)=CC=C2C(C)(C)CN1C1=NC(N)=NC2=C1N=CN2 MMSVRFZHAGSVSL-UHFFFAOYSA-N 0.000 description 1
- XFUMRPBGAREPNB-UHFFFAOYSA-N 6-[6-bromo-3-(2-methoxyethoxymethyl)-3-methyl-2h-indol-1-yl]-7h-purin-2-amine Chemical compound C12=CC(Br)=CC=C2C(COCCOC)(C)CN1C1=NC(N)=NC2=C1N=CN2 XFUMRPBGAREPNB-UHFFFAOYSA-N 0.000 description 1
- XUXVHAHGCMQXDI-UHFFFAOYSA-N 6-bromo-1-(2-chloropyrimidin-4-yl)-2,3-dihydroindole Chemical compound ClC1=NC=CC(N2C3=CC(Br)=CC=C3CC2)=N1 XUXVHAHGCMQXDI-UHFFFAOYSA-N 0.000 description 1
- KLQFZHDLYGMBCX-UHFFFAOYSA-N 6-bromo-1h-indol-4-amine Chemical compound NC1=CC(Br)=CC2=C1C=CN2 KLQFZHDLYGMBCX-UHFFFAOYSA-N 0.000 description 1
- SEQHEDQNODAFIU-UHFFFAOYSA-N 6-bromo-2,3-dihydroinden-1-one Chemical compound BrC1=CC=C2CCC(=O)C2=C1 SEQHEDQNODAFIU-UHFFFAOYSA-N 0.000 description 1
- WTZHFVXDMHDAQA-UHFFFAOYSA-N 6-bromo-3-(2-methoxyethoxymethyl)-3-methyl-1,2-dihydroindole Chemical compound BrC1=CC=C2C(COCCOC)(C)CNC2=C1 WTZHFVXDMHDAQA-UHFFFAOYSA-N 0.000 description 1
- RFWCCWJKQNULPW-UHFFFAOYSA-N 6-bromo-3-(3-hydroxypropyl)-3-methyl-1h-indol-2-one Chemical compound BrC1=CC=C2C(C)(CCCO)C(=O)NC2=C1 RFWCCWJKQNULPW-UHFFFAOYSA-N 0.000 description 1
- KQCKQVUQXNMWMC-UHFFFAOYSA-N 6-bromo-3-oxo-1,2-dihydropyrrolo[1,2-a]indole-2-carboxylic acid Chemical compound BrC1=CC=C2N3CC(C(=O)O)C(=O)C3=CC2=C1 KQCKQVUQXNMWMC-UHFFFAOYSA-N 0.000 description 1
- KNICAMORFIELHR-UHFFFAOYSA-N 6-bromo-4'-methylspiro[1h-indole-3,2'-morpholine]-2-one Chemical compound C1N(C)CCOC21C1=CC=C(Br)C=C1NC2=O KNICAMORFIELHR-UHFFFAOYSA-N 0.000 description 1
- BKLJUYPLUWUEOQ-UHFFFAOYSA-N 6-bromopyridin-2-amine Chemical compound NC1=CC=CC(Br)=N1 BKLJUYPLUWUEOQ-UHFFFAOYSA-N 0.000 description 1
- VLMIYWBWHPPUCM-UHFFFAOYSA-N 6-iodo-3,3-dimethyl-1-(1,3,5-triazin-2-yl)-2h-indole Chemical compound C12=CC(I)=CC=C2C(C)(C)CN1C1=NC=NC=N1 VLMIYWBWHPPUCM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- AMKGKYQBASDDJB-UHFFFAOYSA-N 9$l^{2}-borabicyclo[3.3.1]nonane Chemical compound C1CCC2CCCC1[B]2 AMKGKYQBASDDJB-UHFFFAOYSA-N 0.000 description 1
- FEJUGLKDZJDVFY-UHFFFAOYSA-N 9-borabicyclo[3.3.1]nonane Substances C1CCC2CCCC1B2 FEJUGLKDZJDVFY-UHFFFAOYSA-N 0.000 description 1
- 208000009746 Adult T-Cell Leukemia-Lymphoma Diseases 0.000 description 1
- 208000016683 Adult T-cell leukemia/lymphoma Diseases 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 208000003950 B-cell lymphoma Diseases 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 206010051728 Bone erosion Diseases 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 208000011691 Burkitt lymphomas Diseases 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- IFXFLMUTXDVIOK-UHFFFAOYSA-N C12=CC(Br)=CC=C2C(C)(CCO)CN1C1=CC=NC=C1 Chemical compound C12=CC(Br)=CC=C2C(C)(CCO)CN1C1=CC=NC=C1 IFXFLMUTXDVIOK-UHFFFAOYSA-N 0.000 description 1
- 108010046080 CD27 Ligand Proteins 0.000 description 1
- 108010029697 CD40 Ligand Proteins 0.000 description 1
- 102100032937 CD40 ligand Human genes 0.000 description 1
- 102100025221 CD70 antigen Human genes 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 208000005623 Carcinogenesis Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- 102100030011 Endoribonuclease Human genes 0.000 description 1
- 101710199605 Endoribonuclease Proteins 0.000 description 1
- 206010014824 Endotoxic shock Diseases 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- 240000001414 Eucalyptus viminalis Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DSLZVSRJTYRBFB-UHFFFAOYSA-N Galactaric acid Natural products OC(=O)C(O)C(O)C(O)C(O)C(O)=O DSLZVSRJTYRBFB-UHFFFAOYSA-N 0.000 description 1
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 1
- 239000007821 HATU Substances 0.000 description 1
- 101150026303 HEX1 gene Proteins 0.000 description 1
- 108091008603 HGF receptors Proteins 0.000 description 1
- 102100021866 Hepatocyte growth factor Human genes 0.000 description 1
- 102100022623 Hepatocyte growth factor receptor Human genes 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 102000004083 Lymphotoxin-alpha Human genes 0.000 description 1
- 108090000542 Lymphotoxin-alpha Proteins 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- 101150028463 NIK1 gene Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 102100023050 Nuclear factor NF-kappa-B p105 subunit Human genes 0.000 description 1
- 208000003076 Osteolysis Diseases 0.000 description 1
- 108091000080 Phosphotransferase Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 102000004245 Proteasome Endopeptidase Complex Human genes 0.000 description 1
- 108090000708 Proteasome Endopeptidase Complex Proteins 0.000 description 1
- 102000010498 Receptor Activator of Nuclear Factor-kappa B Human genes 0.000 description 1
- 108010038036 Receptor Activator of Nuclear Factor-kappa B Proteins 0.000 description 1
- 241000219061 Rheum Species 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 206010040070 Septic Shock Diseases 0.000 description 1
- 101710113029 Serine/threonine-protein kinase Proteins 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 210000001744 T-lymphocyte Anatomy 0.000 description 1
- 239000012317 TBTU Substances 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- 102100024584 Tumor necrosis factor ligand superfamily member 12 Human genes 0.000 description 1
- 101710097155 Tumor necrosis factor ligand superfamily member 12 Proteins 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- NCFZPYCMGMYPIR-UHFFFAOYSA-N [1-(2-amino-5-chloropyrimidin-4-yl)-1'-(2-methoxyethyl)spiro[2h-indole-3,3'-azetidine]-6-yl] trifluoromethanesulfonate Chemical compound C1N(CCOC)CC21C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1N(C=1C(=CN=C(N)N=1)Cl)C2 NCFZPYCMGMYPIR-UHFFFAOYSA-N 0.000 description 1
- RRJJWHXUZVBOPW-UHFFFAOYSA-N [1-(2-amino-5-chloropyrimidin-4-yl)-1'-(2-methylsulfonylethyl)spiro[2h-indole-3,3'-azetidine]-6-yl] trifluoromethanesulfonate Chemical compound C1N(CCS(=O)(=O)C)CC21C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1N(C=1C(=CN=C(N)N=1)Cl)C2 RRJJWHXUZVBOPW-UHFFFAOYSA-N 0.000 description 1
- KWFIYMXFSFVUHR-UHFFFAOYSA-N [1-(2-amino-5-chloropyrimidin-4-yl)-1'-methylspiro[2h-indole-3,3'-azetidine]-6-yl] trifluoromethanesulfonate Chemical compound C1N(C)CC21C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1N(C=1C(=CN=C(N)N=1)Cl)C2 KWFIYMXFSFVUHR-UHFFFAOYSA-N 0.000 description 1
- YVRSCTRBERRMPV-UHFFFAOYSA-N [1-(2-amino-5-chloropyrimidin-4-yl)-6-bromo-3-methyl-2h-indol-3-yl]methanol Chemical compound C12=CC(Br)=CC=C2C(C)(CO)CN1C1=NC(N)=NC=C1Cl YVRSCTRBERRMPV-UHFFFAOYSA-N 0.000 description 1
- OTXINMZAWIJGSL-UHFFFAOYSA-N [1-(2-amino-5-chloropyrimidin-4-yl)-6-iodo-3-methyl-2h-indol-3-yl]methanol Chemical compound C12=CC(I)=CC=C2C(C)(CO)CN1C1=NC(N)=NC=C1Cl OTXINMZAWIJGSL-UHFFFAOYSA-N 0.000 description 1
- NQMWLXOSEHEILF-UHFFFAOYSA-N [1-(2-amino-5-fluoropyrimidin-4-yl)-6-bromo-3-methyl-2h-indol-3-yl]methanol Chemical compound C12=CC(Br)=CC=C2C(C)(CO)CN1C1=NC(N)=NC=C1F NQMWLXOSEHEILF-UHFFFAOYSA-N 0.000 description 1
- WMNUQYHPTGTUII-UHFFFAOYSA-N [1-(2-amino-7h-purin-6-yl)-6-bromo-3-methyl-2h-indol-3-yl]methanol Chemical compound C12=CC(Br)=CC=C2C(C)(CO)CN1C1=NC(N)=NC2=C1N=CN2 WMNUQYHPTGTUII-UHFFFAOYSA-N 0.000 description 1
- VYOTVOWSDGMMAE-UHFFFAOYSA-N [N].BrC1=CC=C2C(C)C(=O)N(C(C)=O)C2=C1 Chemical compound [N].BrC1=CC=C2C(C)C(=O)N(C(C)=O)C2=C1 VYOTVOWSDGMMAE-UHFFFAOYSA-N 0.000 description 1
- CLZISMQKJZCZDN-UHFFFAOYSA-N [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium Chemical compound C1=CC=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 CLZISMQKJZCZDN-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000001241 acetals Chemical group 0.000 description 1
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 1
- ZCHPKWUIAASXPV-UHFFFAOYSA-N acetic acid;methanol Chemical compound OC.CC(O)=O ZCHPKWUIAASXPV-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000033289 adaptive immune response Effects 0.000 description 1
- 238000011374 additional therapy Methods 0.000 description 1
- 201000006966 adult T-cell leukemia Diseases 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- IAJILQKETJEXLJ-RSJOWCBRSA-N aldehydo-D-galacturonic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-RSJOWCBRSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000005875 antibody response Effects 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 230000005784 autoimmunity Effects 0.000 description 1
- CELPHAGZKFMOMR-UHFFFAOYSA-N azanium;dichloromethane;methanol;hydroxide Chemical compound [NH4+].[OH-].OC.ClCCl CELPHAGZKFMOMR-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 230000036952 cancer formation Effects 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 231100000504 carcinogenesis Toxicity 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 208000037976 chronic inflammation Diseases 0.000 description 1
- 208000037893 chronic inflammatory disorder Diseases 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 230000001010 compromised effect Effects 0.000 description 1
- 230000006552 constitutive activation Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 238000011262 co‐therapy Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000009109 curative therapy Methods 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 210000000805 cytoplasm Anatomy 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 210000004443 dendritic cell Anatomy 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000006003 dichloroethyl group Chemical group 0.000 description 1
- 125000004774 dichlorofluoromethyl group Chemical group FC(Cl)(Cl)* 0.000 description 1
- LHUZAYREVYDAGJ-UHFFFAOYSA-N dichloromethane;ethyl acetate;methanol Chemical compound OC.ClCCl.CCOC(C)=O LHUZAYREVYDAGJ-UHFFFAOYSA-N 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000006001 difluoroethyl group Chemical group 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 125000004582 dihydrobenzothienyl group Chemical group S1C(CC2=C1C=CC=C2)* 0.000 description 1
- JMRYOSQOYJBDOI-UHFFFAOYSA-N dilithium;di(propan-2-yl)azanide Chemical compound [Li+].CC(C)[N-]C(C)C.CC(C)N([Li])C(C)C JMRYOSQOYJBDOI-UHFFFAOYSA-N 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- VDQVEACBQKUUSU-UHFFFAOYSA-M disodium;sulfanide Chemical compound [Na+].[Na+].[SH-] VDQVEACBQKUUSU-UHFFFAOYSA-M 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000004076 epigenetic alteration Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- VCYZVXRKYPKDQB-UHFFFAOYSA-N ethyl 2-fluoroacetate Chemical compound CCOC(=O)CF VCYZVXRKYPKDQB-UHFFFAOYSA-N 0.000 description 1
- LWRLKENDQISGEU-UHFFFAOYSA-N ethyl 5-bromo-1h-indole-2-carboxylate Chemical compound BrC1=CC=C2NC(C(=O)OCC)=CC2=C1 LWRLKENDQISGEU-UHFFFAOYSA-N 0.000 description 1
- PCPIANOJERKFJI-UHFFFAOYSA-N ethyl 5-bromopyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=CC(Br)=C1 PCPIANOJERKFJI-UHFFFAOYSA-N 0.000 description 1
- NBEMQPLNBYYUAZ-UHFFFAOYSA-N ethyl acetate;propan-2-one Chemical compound CC(C)=O.CCOC(C)=O NBEMQPLNBYYUAZ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000005469 ethylenyl group Chemical group 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- DSLZVSRJTYRBFB-DUHBMQHGSA-N galactaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O DSLZVSRJTYRBFB-DUHBMQHGSA-N 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000010363 gene targeting Methods 0.000 description 1
- 230000004077 genetic alteration Effects 0.000 description 1
- 229960004198 guanidine Drugs 0.000 description 1
- 229960000789 guanidine hydrochloride Drugs 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 125000006343 heptafluoro propyl group Chemical group 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid group Chemical group C(CCCCCC)(=O)O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 125000005553 heteroaryloxy group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid group Chemical group C(CCCCC)(=O)O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 210000003917 human chromosome Anatomy 0.000 description 1
- 230000028996 humoral immune response Effects 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N hydrogen peroxide Substances OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- IIXGBDGCPUYARL-UHFFFAOYSA-N hydroxysulfamic acid Chemical compound ONS(O)(=O)=O IIXGBDGCPUYARL-UHFFFAOYSA-N 0.000 description 1
- 206010020718 hyperplasia Diseases 0.000 description 1
- 230000002390 hyperplastic effect Effects 0.000 description 1
- 210000002865 immune cell Anatomy 0.000 description 1
- 230000036039 immunity Effects 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 229940072221 immunoglobulins Drugs 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000015788 innate immune response Effects 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 210000004561 lacrimal apparatus Anatomy 0.000 description 1
- 230000021633 leukocyte mediated immunity Effects 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 210000002751 lymph Anatomy 0.000 description 1
- 208000019420 lymphoid neoplasm Diseases 0.000 description 1
- 208000029791 lytic metastatic bone lesion Diseases 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000036210 malignancy Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- QZIQJVCYUQZDIR-UHFFFAOYSA-N mechlorethamine hydrochloride Chemical compound Cl.ClCCN(C)CCCl QZIQJVCYUQZDIR-UHFFFAOYSA-N 0.000 description 1
- 229960002868 mechlorethamine hydrochloride Drugs 0.000 description 1
- BCVXHSPFUWZLGQ-UHFFFAOYSA-N mecn acetonitrile Chemical compound CC#N.CC#N BCVXHSPFUWZLGQ-UHFFFAOYSA-N 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 229940087646 methanolamine Drugs 0.000 description 1
- SJFNDMHZXCUXSA-UHFFFAOYSA-M methoxymethyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(COC)C1=CC=CC=C1 SJFNDMHZXCUXSA-UHFFFAOYSA-M 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- KKZMIDYKRKGJHG-UHFFFAOYSA-N methyl 4-cyanobenzoate Chemical compound COC(=O)C1=CC=C(C#N)C=C1 KKZMIDYKRKGJHG-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- 125000006682 monohaloalkyl group Chemical group 0.000 description 1
- 238000010172 mouse model Methods 0.000 description 1
- 210000005088 multinucleated cell Anatomy 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- YFKAOVPMZLHAFC-UHFFFAOYSA-N n,n-dimethyl-1,1-bis(methylperoxy)methanamine Chemical compound COOC(N(C)C)OOC YFKAOVPMZLHAFC-UHFFFAOYSA-N 0.000 description 1
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 1
- PEECTLLHENGOKU-UHFFFAOYSA-N n,n-dimethylpyridin-4-amine Chemical compound CN(C)C1=CC=NC=C1.CN(C)C1=CC=NC=C1 PEECTLLHENGOKU-UHFFFAOYSA-N 0.000 description 1
- OYBFJIVYUBSWTE-UHFFFAOYSA-N n-(5-iodo-2-methylphenyl)pyridin-4-amine Chemical compound CC1=CC=C(I)C=C1NC1=CC=NC=C1 OYBFJIVYUBSWTE-UHFFFAOYSA-N 0.000 description 1
- HNPCDFJZADHNHD-UHFFFAOYSA-N n-(diformamidomethyl)formamide Chemical compound O=CNC(NC=O)NC=O HNPCDFJZADHNHD-UHFFFAOYSA-N 0.000 description 1
- VGYWHRYTKTUOTR-ZDUSSCGKSA-N n-[5-iodo-2-[(3s)-oxolan-3-yl]oxyphenyl]pyridin-4-amine Chemical compound C=1C=NC=CC=1NC1=CC(I)=CC=C1O[C@H]1CCOC1 VGYWHRYTKTUOTR-ZDUSSCGKSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000001613 neoplastic effect Effects 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 210000004940 nucleus Anatomy 0.000 description 1
- 230000008816 organ damage Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 238000012261 overproduction Methods 0.000 description 1
- LMYJGUNNJIDROI-UHFFFAOYSA-N oxan-4-ol Chemical compound OC1CCOCC1 LMYJGUNNJIDROI-UHFFFAOYSA-N 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 102000020233 phosphotransferase Human genes 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 238000009117 preventive therapy Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- AHRQYOSAXZQCIG-UHFFFAOYSA-N pyrimidine-5-carbonitrile Chemical compound N#CC1=C=NC=N[CH]1 AHRQYOSAXZQCIG-UHFFFAOYSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 210000001350 reed-sternberg cell Anatomy 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 210000003079 salivary gland Anatomy 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 230000007781 signaling event Effects 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 210000002536 stromal cell Anatomy 0.000 description 1
- 210000001913 submandibular gland Anatomy 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000005864 sulfonamidyl group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- WMOVHXAZOJBABW-UHFFFAOYSA-N tert-butyl acetate Chemical compound CC(=O)OC(C)(C)C WMOVHXAZOJBABW-UHFFFAOYSA-N 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- PHCBRBWANGJMHS-UHFFFAOYSA-J tetrasodium;disulfate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O PHCBRBWANGJMHS-UHFFFAOYSA-J 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- BQIZZLLLLJVFQT-UHFFFAOYSA-N thiane-4-carbaldehyde Chemical compound O=CC1CCSCC1 BQIZZLLLLJVFQT-UHFFFAOYSA-N 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000011830 transgenic mouse model Methods 0.000 description 1
- 230000005945 translocation Effects 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Substances C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 231100000588 tumorigenic Toxicity 0.000 description 1
- 230000000381 tumorigenic effect Effects 0.000 description 1
- 230000003827 upregulation Effects 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/02—Nasal agents, e.g. decongestants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/06—Antiasthmatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/88—Nitrogen atoms, e.g. allantoin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/08—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a carbon chain containing alicyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/10—Spiro-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/06—Peri-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/10—Spiro-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains three hetero rings
- C07D487/16—Peri-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/10—Spiro-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pulmonology (AREA)
- Immunology (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Rheumatology (AREA)
- Dermatology (AREA)
- Physical Education & Sports Medicine (AREA)
- Pain & Pain Management (AREA)
- Oncology (AREA)
- Psychiatry (AREA)
- Transplantation (AREA)
- Hematology (AREA)
- Otolaryngology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Hospice & Palliative Care (AREA)
- Endocrinology (AREA)
- Reproductive Health (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13324908P | 2008-06-26 | 2008-06-26 | |
| US61/133,249 | 2008-06-26 | ||
| PCT/US2009/003803 WO2009158011A1 (en) | 2008-06-26 | 2009-06-26 | Alkynyl alcohols as kinase inhibitors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2728767A1 true CA2728767A1 (en) | 2009-12-30 |
Family
ID=41090264
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2728767A Abandoned CA2728767A1 (en) | 2008-06-26 | 2009-06-26 | Alkynyl alcohols as kinase inhibitors |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US20110086834A1 (https=) |
| EP (1) | EP2315751A1 (https=) |
| JP (1) | JP2011525915A (https=) |
| AU (1) | AU2009263037B2 (https=) |
| CA (1) | CA2728767A1 (https=) |
| MX (1) | MX2010013920A (https=) |
| WO (1) | WO2009158011A1 (https=) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MX336731B (es) | 2010-01-28 | 2016-01-28 | Harvard College | Composiciones y metodos para potenciar la actividad de proteasoma. |
| CA2819373A1 (en) * | 2010-12-09 | 2012-06-14 | Amgen Inc. | Bicyclic compounds as pim inhibitors |
| MX2013010513A (es) | 2011-03-16 | 2013-10-07 | Hoffmann La Roche | Compuestos de alcohol 6,5-heterociclil-propargilico y usos de los mismos. |
| EP2688886A1 (en) | 2011-03-22 | 2014-01-29 | Amgen Inc. | Azole compounds as pim inhibitors |
| WO2012135697A2 (en) * | 2011-03-30 | 2012-10-04 | H. Lee Moffitt Cancer Center & Research Institute Inc. | Novel rho kinase inhibitors and methods of use |
| DK2707101T3 (da) | 2011-05-12 | 2019-05-13 | Proteostasis Therapeutics Inc | Proteostaseregulatorer |
| EP2551670A1 (en) | 2011-07-27 | 2013-01-30 | Merck Patent GmbH | NIK inhibitors cell-based assay |
| US8921576B2 (en) | 2011-10-19 | 2014-12-30 | Kowa Company, Ltd. | Spiroindoline compound, and medicinal agent comprising same |
| JP2015507001A (ja) * | 2012-02-17 | 2015-03-05 | エフ.ホフマン−ラ ロシュ アーゲーF. Hoffmann−La Roche Aktiengesellschaft | 三環式化合物及びその使用方法 |
| US9849135B2 (en) | 2013-01-25 | 2017-12-26 | President And Fellows Of Harvard College | USP14 inhibitors for treating or preventing viral infections |
| TWI663166B (zh) * | 2013-04-24 | 2019-06-21 | 健生藥品公司 | 新化合物 |
| US20150057260A1 (en) * | 2013-08-22 | 2015-02-26 | Genentech, Inc. | Alkynyl alcohols and methods of use |
| US20160096850A9 (en) * | 2013-08-22 | 2016-04-07 | Genentech, Inc. | Alkynyl alcohols and methods of use |
| TWI704146B (zh) * | 2013-09-26 | 2020-09-11 | 比利時商健生藥品公司 | 用作NIK抑制劑之新的1-(4-嘧啶基)-1H-吡唑並[3,2-c]吡啶衍生物 |
| TWI627173B (zh) * | 2013-09-26 | 2018-06-21 | 比利時商健生藥品公司 | 作為NIK抑制劑的新穎3-(1H-吡唑-4-基)-1H-吡咯并[2,3-c]吡啶衍生物 |
| WO2015073528A1 (en) | 2013-11-12 | 2015-05-21 | Proteostasis Therapeutics, Inc. | Proteasome activity enhancing compounds |
| NZ725860A (en) | 2014-04-04 | 2019-08-30 | Iomet Pharma Ltd | Indole derivatives for use in medicine |
| KR101551313B1 (ko) * | 2014-07-28 | 2015-09-09 | 충남대학교산학협력단 | 신규한 인덴 유도체, 이의 제조방법 및 이를 유효성분으로 함유하는 망막 질환의 예방 또는 치료용 약학적 조성물 |
| BR112017008039B1 (pt) * | 2014-10-23 | 2023-04-11 | Janssen Pharmaceutica N.V. | Derivados de pirazol como inibidores de nik, seu uso no tratamento ou prevenção de câncer e composição farmacêutica que os compreende |
| AU2015334917B2 (en) * | 2014-10-23 | 2019-08-29 | Janssen Pharmaceutica Nv | New compounds as NIK inhibitors |
| MX371151B (es) * | 2014-10-23 | 2020-01-20 | Janssen Pharmaceutica Nv | NUEVOS DERIVADOS DE TIENOPIRIMIDINA EN CALIDAD DE INHIBIDORES DE LA CINASA INDUCTORA DE NF-kB (NIK). |
| JP6616412B2 (ja) * | 2014-10-23 | 2019-12-04 | ヤンセン ファーマシューティカ エヌ.ベー. | Nik阻害剤としての新規のピラゾロピリミジン誘導体 |
| JP2018510140A (ja) * | 2015-02-25 | 2018-04-12 | エフ.ホフマン−ラ ロシュ アーゲーF. Hoffmann−La Roche Aktiengesellschaft | アルキニルアルコール及び使用方法 |
| WO2016173438A1 (zh) * | 2015-04-29 | 2016-11-03 | 南京明德新药研发股份有限公司 | 稠环或三环芳基嘧啶化合物用作激酶抑制剂 |
| ES2775449T3 (es) | 2016-01-22 | 2020-07-27 | Janssen Pharmaceutica Nv | Nuevos derivados de cianoindolina sustituida como inhibidores de nik |
| EP3405464B1 (en) | 2016-01-22 | 2019-12-04 | Janssen Pharmaceutica NV | New 6-membered heteroaromatic substituted cyanoindoline derivatives as nik inhibitors |
| CN105769871A (zh) * | 2016-03-03 | 2016-07-20 | 东北师范大学 | Nik蛋白激酶抑制剂作为制备治疗肝病的药物的应用 |
| EA037358B1 (ru) * | 2016-03-10 | 2021-03-17 | Янссен Фармасьютика Нв | Новые замещённые производные цианиндолина в качестве nik-ингибиторов |
| WO2018002217A1 (en) * | 2016-06-30 | 2018-01-04 | Janssen Pharmaceutica Nv | Heteroaromatic derivatives as nik inhibitors |
| ES2837157T3 (es) | 2016-06-30 | 2021-06-29 | Janssen Pharmaceutica Nv | Derivados de cianoindolina como inhibidores de NIK |
| WO2018037059A1 (en) * | 2016-08-24 | 2018-03-01 | F. Hoffmann-La Roche Ag | 2-azabicyclo[3.1.0]hexan-3-one derivatives and methods of use |
| WO2018037058A1 (en) * | 2016-08-24 | 2018-03-01 | F. Hoffmann-La Roche Ag | 2-azabicyclo[3.1.0]hexan-3-one derivatives and methods of use |
| US10858319B2 (en) | 2016-10-03 | 2020-12-08 | Iomet Pharma Ltd. | Indole derivatives for use in medicine |
| CN110769830A (zh) | 2017-05-12 | 2020-02-07 | 马瓦隆治疗有限公司 | 作为ii组代谢型谷氨酸受体的别构调节剂的取代的杂环化合物 |
| CN109810110B (zh) * | 2017-11-22 | 2023-01-24 | 中国科学院上海药物研究所 | 一种具有2-氨基嘧啶结构的化合物,其制备方法和用途 |
| AU2019239952A1 (en) | 2018-03-20 | 2020-10-08 | Plexxikon Inc. | Compounds and methods for IDO and TDO modulation, and indications therefor |
| CN114222737B (zh) * | 2019-05-31 | 2024-07-26 | 詹森药业有限公司 | NF-κB诱导激酶的小分子抑制剂 |
| EP3782702A1 (en) * | 2019-08-21 | 2021-02-24 | AC BioScience SA | Compounds and use thereof for the treatment of infectious diseases and cancer |
| CA3185604A1 (en) * | 2020-06-12 | 2021-12-16 | Vertex Pharmaceuticals Incorporated | Inhibitors of apol1 and use of the same |
| CN113831325A (zh) * | 2020-06-23 | 2021-12-24 | 沈阳药科大学 | 新型吲哚类衍生物及其制备方法和应用 |
| CN111960983A (zh) * | 2020-08-31 | 2020-11-20 | 南通大学 | 一种n-甲基-3-(1-甲基吡咯烷-3-基)丙-1-胺及其合成方法 |
| CN112194609B (zh) * | 2020-10-22 | 2022-11-04 | 西北农林科技大学 | 3,3-二取代氧化吲哚类化合物及其制备方法与用途 |
| CN112174938A (zh) * | 2020-10-27 | 2021-01-05 | 浙江工业大学 | 4-吲哚-2-氨基嘧啶类化合物及其应用 |
| CN115215861B (zh) * | 2021-04-16 | 2024-03-15 | 上海翊石医药科技有限公司 | 一种芳杂环取代的炔烃类化合物及其制备方法和用途 |
Family Cites Families (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK429884A (da) * | 1983-10-07 | 1985-04-08 | Hoffmann La Roche | Heterocycliske forbindelser |
| GB8714537D0 (en) * | 1987-06-22 | 1987-07-29 | Ici Plc | Pyrazine derivatives |
| GB2208860B (en) * | 1987-08-20 | 1991-10-09 | Ici Plc | Pyrimidine derivatives |
| GB9016783D0 (en) * | 1989-09-01 | 1990-09-12 | Ici Plc | Agrochemical compositions |
| ES2228405T3 (es) * | 1993-07-21 | 2005-04-16 | Yamanouchi Pharmaceutical Co., Ltd. | Intermediarios para la produccion de derivados benzazepina condensados. |
| BR9506936A (pt) * | 1994-02-23 | 1997-09-09 | Pfizer | Derivados de quinazolina substituídos com 4-heterociclila processos para sua preparaçao e seu uso como agentes anticancerosos |
| US6063930A (en) * | 1996-04-03 | 2000-05-16 | Merck & Co., Inc. | Substituted imidazole compounds useful as farnesyl-protein transferase inhibitors |
| ZA986729B (en) * | 1997-07-29 | 1999-02-02 | Warner Lambert Co | Irreversible inhibitors of tyrosine kinases |
| GB9716446D0 (en) * | 1997-08-05 | 1997-10-08 | Agrevo Uk Ltd | Fungicides |
| CA2340701C (en) * | 1998-08-20 | 2009-05-26 | Sumitomo Pharmaceuticals Co., Ltd. | Oxindole derivatives as growth hormone releasers |
| UA71945C2 (en) * | 1999-01-27 | 2005-01-17 | Pfizer Prod Inc | Substituted bicyclic derivatives being used as anticancer agents |
| JP2002053561A (ja) * | 1999-12-08 | 2002-02-19 | Sumitomo Chem Co Ltd | ジフルオロメチルトリアゾロン化合物、その用途およびその製造中間体 |
| US6313310B1 (en) * | 1999-12-15 | 2001-11-06 | Hoffmann-La Roche Inc. | 4-and 5-alkynyloxindoles and 4-and 5-alkenyloxindoles |
| US20020019527A1 (en) * | 2000-04-27 | 2002-02-14 | Wei-Bo Wang | Substituted phenyl farnesyltransferase inhibitors |
| US7211595B2 (en) * | 2000-11-30 | 2007-05-01 | Abbott Laboratories | Farnesyltransferase inhibitors |
| US20020115640A1 (en) * | 2000-11-30 | 2002-08-22 | Claiborne Akiyo K. | Farnesyltransferase inhibitors |
| US6504034B2 (en) * | 2001-01-23 | 2003-01-07 | Hoffmann-La Roche Inc. | Naphthostyrils |
| GB0123589D0 (en) * | 2001-10-01 | 2001-11-21 | Syngenta Participations Ag | Organic compounds |
| BR0309486A (pt) * | 2002-04-26 | 2005-02-09 | Lilly Co Eli | Composto ou um seu sal farmaceuticamente aceitável, composição farmacêutica, e, método para o tratamento de uma condição associada com um excesso de taquicininas |
| KR100755577B1 (ko) * | 2002-04-26 | 2007-09-12 | 일라이 릴리 앤드 캄파니 | 타키키닌 수용체 길항제로서의 트리아졸 유도체 |
| US20030216441A1 (en) * | 2002-05-10 | 2003-11-20 | Gwaltney Stephen L. | Farnesyltransferase inhibitors |
| DE10229762A1 (de) * | 2002-07-03 | 2004-01-22 | Aventis Pharma Deutschland Gmbh | Pyrazoloisoquinolinenderivaten zur Inhibierung von NFkappaB-induzierende Kinase |
| US20050035498A1 (en) * | 2003-08-13 | 2005-02-17 | Stevens Randal Alan | Methods of making a negative hearing aid mold |
| PE20060426A1 (es) * | 2004-06-02 | 2006-06-28 | Schering Corp | DERIVADOS DE ACIDO TARTARICO COMO INHIBIDORES DE MMPs, ADAMs, TACE Y TNF-alfa |
| US20070167426A1 (en) * | 2004-06-02 | 2007-07-19 | Schering Corporation | Compounds for the treatment of inflammatory disorders and microbial diseases |
| US7396852B2 (en) * | 2005-11-16 | 2008-07-08 | Xerox Corporation | Compound having indolocarbazole moiety and divalent linkage |
| US7829727B2 (en) * | 2005-11-16 | 2010-11-09 | Xerox Corporation | Device containing compound having indolocarbazole moiety and divalent linkage |
| ATE548359T1 (de) * | 2004-06-17 | 2012-03-15 | Infinity Discovery Inc | Verbindungen und verfahren zur inhibierung der wechselwirkung von bcl-proteinen mit bindungspartnern |
| EP1819341A4 (en) * | 2004-11-10 | 2011-06-29 | Synta Pharmaceuticals Corp | IL-12 MODULATORY CONNECTIONS |
| US20060174937A1 (en) * | 2005-02-09 | 2006-08-10 | Zhang-Lin Zhou | High performance organic materials for solar cells |
| US20090227616A1 (en) * | 2005-11-10 | 2009-09-10 | Smithkline Beecham Corporation, A Corporation | Inhibitors of akt activity |
| US20080269131A1 (en) * | 2005-11-10 | 2008-10-30 | Smithkline Beecham Corporation | Inhibitors of Akt Activity |
| TW200736260A (en) * | 2005-11-10 | 2007-10-01 | Smithkline Beecham Corp | Inhibitors of Akt activity |
| AU2008210455A1 (en) * | 2007-01-31 | 2008-08-07 | Vertex Pharmaceuticals Incorporated | 2-aminopyridine derivatives useful as kinase inhibitors |
| US8343966B2 (en) * | 2008-01-11 | 2013-01-01 | Novartis Ag | Organic compounds |
-
2009
- 2009-06-26 AU AU2009263037A patent/AU2009263037B2/en not_active Ceased
- 2009-06-26 JP JP2011516311A patent/JP2011525915A/ja not_active Withdrawn
- 2009-06-26 EP EP09770549A patent/EP2315751A1/en not_active Withdrawn
- 2009-06-26 WO PCT/US2009/003803 patent/WO2009158011A1/en not_active Ceased
- 2009-06-26 CA CA2728767A patent/CA2728767A1/en not_active Abandoned
- 2009-06-26 US US12/997,868 patent/US20110086834A1/en not_active Abandoned
- 2009-06-26 MX MX2010013920A patent/MX2010013920A/es not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| MX2010013920A (es) | 2011-02-21 |
| EP2315751A1 (en) | 2011-05-04 |
| US20110086834A1 (en) | 2011-04-14 |
| JP2011525915A (ja) | 2011-09-29 |
| WO2009158011A1 (en) | 2009-12-30 |
| AU2009263037A1 (en) | 2009-12-30 |
| AU2009263037B2 (en) | 2011-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2728767A1 (en) | Alkynyl alcohols as kinase inhibitors | |
| JP7086395B2 (ja) | 置換インドールMcl-1阻害剤 | |
| AU2013344886B2 (en) | Bicyclic urea, thiourea, guanidine and cyanoguanidine compounds useful for the treatment of pain | |
| US7696229B2 (en) | Compounds having 5-HT6 receptor affinity | |
| JP2022050469A (ja) | リガンド依存性の標的タンパク質分解のための単官能性中間体 | |
| CA3029305C (en) | 2-(piperidin-1-yl)-pyrimidin-4(3h)-ones useful as tankyrase inhibitors | |
| KR20200092420A (ko) | 피페리딘 cxcr7 수용체 조절제 | |
| JP2026010047A (ja) | タンパク質の動員および/または分解を調節する化合物 | |
| MX2013012243A (es) | Compuestos heterociclicos biciclicos y sus usos en terapia. | |
| NZ569087A (en) | Polycyclic indazole derivatives that are ERK inhibitors | |
| AU2005266461A1 (en) | Heterocycle-substituted cyclic urea derivatives, preparation thereof and pharmaceutical use thereof as kinase inhibitors | |
| CN101595107A (zh) | 能提高p53活性的有取代哌啶及其用途 | |
| JP6305510B2 (ja) | ヤヌスキナーゼ阻害剤としての非環式シアノエチルピラゾロピリドン | |
| CA2643066A1 (en) | Pyrazole compounds | |
| JP7336506B2 (ja) | 置換トリアゾロキノキサリン誘導体 | |
| AU2008256859A1 (en) | 4' substituted compounds having 5-HT6 receptor affinity | |
| AU2008216032A1 (en) | 6 ' substituted indole and indazole derivatives having 5-HT6 receptor affinity | |
| WO2019062657A1 (zh) | 氮杂环类衍生物、其制备方法及其医药用途 | |
| CN101321726A (zh) | 新型稠合吡咯衍生物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |
Effective date: 20131105 |