CA2641838A1 - Hair dye compositions - Google Patents
Hair dye compositions Download PDFInfo
- Publication number
- CA2641838A1 CA2641838A1 CA002641838A CA2641838A CA2641838A1 CA 2641838 A1 CA2641838 A1 CA 2641838A1 CA 002641838 A CA002641838 A CA 002641838A CA 2641838 A CA2641838 A CA 2641838A CA 2641838 A1 CA2641838 A1 CA 2641838A1
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- substituted
- hydrogen
- group
- cycloalkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 75
- 239000000118 hair dye Substances 0.000 title claims abstract description 47
- 210000004209 hair Anatomy 0.000 claims abstract description 22
- 238000000034 method Methods 0.000 claims abstract description 6
- 238000004040 coloring Methods 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 137
- 239000001257 hydrogen Substances 0.000 claims description 108
- 229910052739 hydrogen Inorganic materials 0.000 claims description 108
- 239000000975 dye Substances 0.000 claims description 66
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 59
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 54
- 125000003118 aryl group Chemical group 0.000 claims description 49
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 47
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 43
- 150000002431 hydrogen Chemical group 0.000 claims description 35
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 30
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 13
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 claims description 13
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 claims description 13
- 229910019142 PO4 Inorganic materials 0.000 claims description 13
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims description 13
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 claims description 13
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 13
- 239000010452 phosphate Substances 0.000 claims description 13
- -1 polyhydroxyalkyl Chemical group 0.000 claims description 13
- 239000007800 oxidant agent Substances 0.000 claims description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 claims description 11
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical group CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 claims description 10
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical group CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 claims description 10
- 239000007983 Tris buffer Substances 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- SOIIHESTBYNJRH-PMPSAXMXSA-N (3r,6r,8as)-6-(benzylsulfonylamino)-n-[3-(diaminomethylideneamino)propyl]-5-oxo-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxamide Chemical compound N([C@@H]1CC[C@@H]2SC[C@H](N2C1=O)C(=O)NCCCN=C(N)N)S(=O)(=O)CC1=CC=CC=C1 SOIIHESTBYNJRH-PMPSAXMXSA-N 0.000 claims description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 claims description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 2
- 125000005885 heterocycloalkylalkyl group Chemical group 0.000 claims description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 2
- 230000008878 coupling Effects 0.000 claims 1
- 238000010168 coupling process Methods 0.000 claims 1
- 238000005859 coupling reaction Methods 0.000 claims 1
- 239000002243 precursor Substances 0.000 claims 1
- 230000003647 oxidation Effects 0.000 description 11
- 238000007254 oxidation reaction Methods 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000003513 alkali Substances 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 238000004043 dyeing Methods 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000982 direct dye Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 239000001000 anthraquinone dye Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000001005 nitro dye Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 238000004061 bleaching Methods 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000002537 cosmetic Substances 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 239000001044 red dye Substances 0.000 description 3
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- QNWKSLSPYNPZFE-UHFFFAOYSA-N 2-[bis(methylamino)amino]ethanol Chemical compound CNN(NC)CCO QNWKSLSPYNPZFE-UHFFFAOYSA-N 0.000 description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 241000283707 Capra Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- XUMBMVFBXHLACL-UHFFFAOYSA-N Melanin Chemical compound O=C1C(=O)C(C2=CNC3=C(C(C(=O)C4=C32)=O)C)=C2C4=CNC2=C1C XUMBMVFBXHLACL-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- LUSZGTFNYDARNI-UHFFFAOYSA-N Sesamol Chemical compound OC1=CC=C2OCOC2=C1 LUSZGTFNYDARNI-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 2
- 150000004056 anthraquinones Chemical class 0.000 description 2
- 235000019646 color tone Nutrition 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229960004592 isopropanol Drugs 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000001024 permanent hair color Substances 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000001026 semi permanent hair color Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 description 2
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical group [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 1
- SBYDCEZCBVBMSI-UHFFFAOYSA-N 1,2-diamino-1-phenoxyethanol Chemical compound NCC(N)(O)OC1=CC=CC=C1 SBYDCEZCBVBMSI-UHFFFAOYSA-N 0.000 description 1
- XGNXYCFREOZBOL-UHFFFAOYSA-N 1,3-benzodioxol-5-amine Chemical compound NC1=CC=C2OCOC2=C1 XGNXYCFREOZBOL-UHFFFAOYSA-N 0.000 description 1
- VIXBPSTZNCRCJE-UHFFFAOYSA-N 1,3-bis[4-amino-n-(2-hydroxyethyl)anilino]propan-2-ol Chemical compound C1=CC(N)=CC=C1N(CCO)CC(O)CN(CCO)C1=CC=C(N)C=C1 VIXBPSTZNCRCJE-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- AQNZDXHBYRTSHA-UHFFFAOYSA-N 1,4-bis(2,3-dihydroxypropylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(NCC(O)CO)=CC=C2NCC(O)CO AQNZDXHBYRTSHA-UHFFFAOYSA-N 0.000 description 1
- DZXNARMBWJFBGD-UHFFFAOYSA-N 1,4-diamino-9,10-dioxoanthracene-2-sulfonic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=C(S(O)(=O)=O)C=C2N DZXNARMBWJFBGD-UHFFFAOYSA-N 0.000 description 1
- FBMQNRKSAWNXBT-UHFFFAOYSA-N 1,4-diaminoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=CC=C2N FBMQNRKSAWNXBT-UHFFFAOYSA-N 0.000 description 1
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-dioxonaphthalene Natural products C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- BOKGTLAJQHTOKE-UHFFFAOYSA-N 1,5-dihydroxynaphthalene Chemical compound C1=CC=C2C(O)=CC=CC2=C1O BOKGTLAJQHTOKE-UHFFFAOYSA-N 0.000 description 1
- XWIBNOGPNKMAPE-UHFFFAOYSA-N 1-(2-hydroxyethylamino)-4-(3-hydroxypropylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(NCCO)=CC=C2NCCCO XWIBNOGPNKMAPE-UHFFFAOYSA-N 0.000 description 1
- MSSQDESMUMSQEN-UHFFFAOYSA-N 1-amino-2-bromo-4-hydroxyanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(O)=CC(Br)=C2N MSSQDESMUMSQEN-UHFFFAOYSA-N 0.000 description 1
- LQZGMZCPBJVGNT-UHFFFAOYSA-N 1-amino-4-(methanesulfonamido)-9,10-dioxoanthracene-2-sulfonic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=C(S(O)(=O)=O)C=C2NS(=O)(=O)C LQZGMZCPBJVGNT-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- JAADWTSKUWWHLE-UHFFFAOYSA-N 1-hydroxy-4-[3-(4-methylmorpholin-4-ium-4-yl)propylamino]anthracene-9,10-dione;methyl sulfate Chemical compound COS([O-])(=O)=O.C=1C=C(O)C=2C(=O)C3=CC=CC=C3C(=O)C=2C=1NCCC[N+]1(C)CCOCC1 JAADWTSKUWWHLE-UHFFFAOYSA-N 0.000 description 1
- JHFAEUICJHBVHB-UHFFFAOYSA-N 1h-indol-2-ol Chemical compound C1=CC=C2NC(O)=CC2=C1 JHFAEUICJHBVHB-UHFFFAOYSA-N 0.000 description 1
- XAWPKHNOFIWWNZ-UHFFFAOYSA-N 1h-indol-6-ol Chemical compound OC1=CC=C2C=CNC2=C1 XAWPKHNOFIWWNZ-UHFFFAOYSA-N 0.000 description 1
- MJMRSGYLARBUDK-UHFFFAOYSA-N 2,4-dimethoxybenzene-1,3-diamine Chemical compound COC1=CC=C(N)C(OC)=C1N MJMRSGYLARBUDK-UHFFFAOYSA-N 0.000 description 1
- SYEYEGBZVSWYPK-UHFFFAOYSA-N 2,5,6-triamino-4-hydroxypyrimidine Chemical compound NC1=NC(N)=C(N)C(O)=N1 SYEYEGBZVSWYPK-UHFFFAOYSA-N 0.000 description 1
- BXBOXUNPNIJELB-UHFFFAOYSA-N 2,6-dimethoxypyridine-3,5-diamine Chemical compound COC1=NC(OC)=C(N)C=C1N BXBOXUNPNIJELB-UHFFFAOYSA-N 0.000 description 1
- MJAVQHPPPBDYAN-UHFFFAOYSA-N 2,6-dimethylbenzene-1,4-diamine Chemical compound CC1=CC(N)=CC(C)=C1N MJAVQHPPPBDYAN-UHFFFAOYSA-N 0.000 description 1
- BQHMISUMCDYQTR-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-ylamino)ethanol Chemical compound OCCNC1=CC=C2OCOC2=C1 BQHMISUMCDYQTR-UHFFFAOYSA-N 0.000 description 1
- UYSGYQWELAOJON-UHFFFAOYSA-N 2-(1,4-diamino-9,10-dioxoanthracen-2-yl)oxyethyl-trimethylazanium;methyl sulfate Chemical compound COS([O-])(=O)=O.C1=CC=C2C(=O)C3=C(N)C(OCC[N+](C)(C)C)=CC(N)=C3C(=O)C2=C1 UYSGYQWELAOJON-UHFFFAOYSA-N 0.000 description 1
- WAKHTALASRXZQS-UHFFFAOYSA-N 2-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)sulfanylethyl-trimethylazanium methyl sulfate Chemical compound COS(=O)(=O)[O-].NC1=C(C=C(C=2C(C3=CC=CC=C3C(C12)=O)=O)O)SCC[N+](C)(C)C WAKHTALASRXZQS-UHFFFAOYSA-N 0.000 description 1
- ZFFAFXDAFACVBX-UHFFFAOYSA-N 2-(2,4-diamino-5-methylphenoxy)ethanol Chemical compound CC1=CC(OCCO)=C(N)C=C1N ZFFAFXDAFACVBX-UHFFFAOYSA-N 0.000 description 1
- LCPVQAHEFVXVKT-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)pyridin-3-amine Chemical compound NC1=CC=CN=C1OC1=CC=C(F)C=C1F LCPVQAHEFVXVKT-UHFFFAOYSA-N 0.000 description 1
- KWSVXCAQFTWTEF-UHFFFAOYSA-N 2-(2,5-diaminophenyl)ethanol Chemical compound NC1=CC=C(N)C(CCO)=C1 KWSVXCAQFTWTEF-UHFFFAOYSA-N 0.000 description 1
- OABRBVCUJIJMOB-UHFFFAOYSA-N 2-(2-hydroxyethylamino)-4,6-dinitrophenol Chemical compound OCCNC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O OABRBVCUJIJMOB-UHFFFAOYSA-N 0.000 description 1
- SBUMIGFDXJIPLE-UHFFFAOYSA-N 2-(3-amino-4-methoxyanilino)ethanol Chemical compound COC1=CC=C(NCCO)C=C1N SBUMIGFDXJIPLE-UHFFFAOYSA-N 0.000 description 1
- LGZSBRSLVPLNTM-UHFFFAOYSA-N 2-(4-amino-2-methyl-5-nitroanilino)ethanol Chemical compound CC1=CC(N)=C([N+]([O-])=O)C=C1NCCO LGZSBRSLVPLNTM-UHFFFAOYSA-N 0.000 description 1
- SCZQUWZLEIYDBD-UHFFFAOYSA-N 2-(4-methyl-2-nitroanilino)ethanol Chemical compound CC1=CC=C(NCCO)C([N+]([O-])=O)=C1 SCZQUWZLEIYDBD-UHFFFAOYSA-N 0.000 description 1
- OJYWOOVHUFSZJP-UHFFFAOYSA-N 2-(4-nitroanilino)ethylurea Chemical compound NC(=O)NCCNC1=CC=C([N+]([O-])=O)C=C1 OJYWOOVHUFSZJP-UHFFFAOYSA-N 0.000 description 1
- QFPHNIHOSPNIJR-UHFFFAOYSA-N 2-(5-acetamido-1-amino-9,10-dioxoanthracen-2-yl)oxyethyl-trimethylazanium;methyl sulfate Chemical compound COS([O-])(=O)=O.O=C1C2=C(N)C(OCC[N+](C)(C)C)=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C QFPHNIHOSPNIJR-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- DEZOGYCXWGTILF-UHFFFAOYSA-N 2-[(4-chlorophenyl)methyl]pyrazole-3,4-diamine Chemical compound NC1=C(N)C=NN1CC1=CC=C(Cl)C=C1 DEZOGYCXWGTILF-UHFFFAOYSA-N 0.000 description 1
- HRCMGJSRHWSTEK-UHFFFAOYSA-N 2-[1-amino-4-(methanesulfonamido)-9,10-dioxoanthracen-2-yl]oxyethyl-trimethylazanium;methyl sulfate Chemical compound COS([O-])(=O)=O.C1=CC=C2C(=O)C3=C(N)C(OCC[N+](C)(C)C)=CC(NS(C)(=O)=O)=C3C(=O)C2=C1 HRCMGJSRHWSTEK-UHFFFAOYSA-N 0.000 description 1
- NJZCRXQWPNNJNB-UHFFFAOYSA-N 2-[2-nitro-4-(trifluoromethyl)anilino]ethanol Chemical compound OCCNC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O NJZCRXQWPNNJNB-UHFFFAOYSA-N 0.000 description 1
- FGYCMSFOZIRDLN-UHFFFAOYSA-N 2-[3-(2-hydroxyethylamino)-2-methylanilino]ethanol Chemical compound CC1=C(NCCO)C=CC=C1NCCO FGYCMSFOZIRDLN-UHFFFAOYSA-N 0.000 description 1
- WXGKXLXGYOYZMX-UHFFFAOYSA-N 2-[4-(2-aminoethylamino)-3-nitrophenoxy]ethanol Chemical compound NCCNC1=CC=C(OCCO)C=C1[N+]([O-])=O WXGKXLXGYOYZMX-UHFFFAOYSA-N 0.000 description 1
- YSVKKVUAUKQDBY-UHFFFAOYSA-N 2-[4-[(4-aminophenyl)diazenyl]-n-(2-hydroxyethyl)-3-methylanilino]ethanol Chemical compound CC1=CC(N(CCO)CCO)=CC=C1N=NC1=CC=C(N)C=C1 YSVKKVUAUKQDBY-UHFFFAOYSA-N 0.000 description 1
- NZKTVPCPQIEVQT-UHFFFAOYSA-N 2-[4-[(4-aminophenyl)diazenyl]-n-(2-hydroxyethyl)anilino]ethanol Chemical compound C1=CC(N)=CC=C1N=NC1=CC=C(N(CCO)CCO)C=C1 NZKTVPCPQIEVQT-UHFFFAOYSA-N 0.000 description 1
- ISCYHXYLVTWDJT-UHFFFAOYSA-N 2-[4-amino-n-(2-hydroxyethyl)anilino]ethanol Chemical compound NC1=CC=C(N(CCO)CCO)C=C1 ISCYHXYLVTWDJT-UHFFFAOYSA-N 0.000 description 1
- ZEARLPPIUCBHRP-UHFFFAOYSA-N 2-[4-chloro-5-(2-hydroxyethylamino)-2-nitroanilino]ethanol Chemical compound OCCNC1=CC(NCCO)=C([N+]([O-])=O)C=C1Cl ZEARLPPIUCBHRP-UHFFFAOYSA-N 0.000 description 1
- ADCWDMYESTYBBN-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)-3-methyl-4-[(4-nitrophenyl)diazenyl]anilino]ethanol Chemical compound CC1=CC(N(CCO)CCO)=CC=C1N=NC1=CC=C([N+]([O-])=O)C=C1 ADCWDMYESTYBBN-UHFFFAOYSA-N 0.000 description 1
- GTMWPZKEYRLDJV-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)-4-(2-methoxyethylamino)-3-nitroanilino]ethanol;hydrochloride Chemical compound Cl.COCCNC1=CC=C(N(CCO)CCO)C=C1[N+]([O-])=O GTMWPZKEYRLDJV-UHFFFAOYSA-N 0.000 description 1
- HCPJEHJGFKWRFM-UHFFFAOYSA-N 2-amino-5-methylphenol Chemical compound CC1=CC=C(N)C(O)=C1 HCPJEHJGFKWRFM-UHFFFAOYSA-N 0.000 description 1
- ALQKEYVDQYGZDN-UHFFFAOYSA-N 2-amino-6-methylphenol Chemical compound CC1=CC=CC(N)=C1O ALQKEYVDQYGZDN-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- BMTSZVZQNMNPCT-UHFFFAOYSA-N 2-aminopyridin-3-ol Chemical compound NC1=NC=CC=C1O BMTSZVZQNMNPCT-UHFFFAOYSA-N 0.000 description 1
- MGLZGLAFFOMWPB-UHFFFAOYSA-N 2-chloro-1,4-phenylenediamine Chemical compound NC1=CC=C(N)C(Cl)=C1 MGLZGLAFFOMWPB-UHFFFAOYSA-N 0.000 description 1
- CDFNUSAXZDSXKF-UHFFFAOYSA-N 2-chloro-6-(ethylamino)-4-nitrophenol Chemical compound CCNC1=CC([N+]([O-])=O)=CC(Cl)=C1O CDFNUSAXZDSXKF-UHFFFAOYSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- WVCHIGAIXREVNS-UHFFFAOYSA-N 2-hydroxy-1,4-naphthoquinone Chemical compound C1=CC=C2C(O)=CC(=O)C(=O)C2=C1 WVCHIGAIXREVNS-UHFFFAOYSA-N 0.000 description 1
- OBCSAIDCZQSFQH-UHFFFAOYSA-N 2-methyl-1,4-phenylenediamine Chemical compound CC1=CC(N)=CC=C1N OBCSAIDCZQSFQH-UHFFFAOYSA-N 0.000 description 1
- ZTMADXFOCUXMJE-UHFFFAOYSA-N 2-methylbenzene-1,3-diol Chemical compound CC1=C(O)C=CC=C1O ZTMADXFOCUXMJE-UHFFFAOYSA-N 0.000 description 1
- CXRMOOSWBWJUCI-UHFFFAOYSA-N 2-nitro-1-n-prop-2-enylbenzene-1,4-diamine Chemical compound NC1=CC=C(NCC=C)C([N+]([O-])=O)=C1 CXRMOOSWBWJUCI-UHFFFAOYSA-N 0.000 description 1
- HEMGYNNCNNODNX-UHFFFAOYSA-N 3,4-diaminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1N HEMGYNNCNNODNX-UHFFFAOYSA-N 0.000 description 1
- HWWIVWKTKZAORO-UHFFFAOYSA-N 3,4-dihydro-2h-1,4-benzoxazin-6-ol Chemical compound O1CCNC2=CC(O)=CC=C21 HWWIVWKTKZAORO-UHFFFAOYSA-N 0.000 description 1
- YCRGIOIOENCYMG-UHFFFAOYSA-N 3-(cyclopentylamino)phenol Chemical compound OC1=CC=CC(NC2CCCC2)=C1 YCRGIOIOENCYMG-UHFFFAOYSA-N 0.000 description 1
- OXEIXRNCCWLEFR-UHFFFAOYSA-N 3-(pyridin-3-yldiazenyl)pyridine-2,6-diamine Chemical compound NC1=NC(N)=CC=C1N=NC1=CC=CN=C1 OXEIXRNCCWLEFR-UHFFFAOYSA-N 0.000 description 1
- CDRHDQOGKXFJSA-UHFFFAOYSA-N 3-[3-(methylamino)-4-nitrophenoxy]propane-1,2-diol Chemical compound CNC1=CC(OCC(O)CO)=CC=C1[N+]([O-])=O CDRHDQOGKXFJSA-UHFFFAOYSA-N 0.000 description 1
- YHSOWKGIYXECIF-UHFFFAOYSA-N 3-[4-[bis(2-hydroxyethyl)amino]-2-nitroanilino]propan-1-ol Chemical compound OCCCNC1=CC=C(N(CCO)CCO)C=C1[N+]([O-])=O YHSOWKGIYXECIF-UHFFFAOYSA-N 0.000 description 1
- SYRZWFBWUASJJI-UHFFFAOYSA-N 3-amino-2,4-dichlorophenol Chemical compound NC1=C(Cl)C=CC(O)=C1Cl SYRZWFBWUASJJI-UHFFFAOYSA-N 0.000 description 1
- XYRDGCCCBJITBH-UHFFFAOYSA-N 3-amino-2-chloro-6-methylphenol Chemical compound CC1=CC=C(N)C(Cl)=C1O XYRDGCCCBJITBH-UHFFFAOYSA-N 0.000 description 1
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 1
- 229940105325 3-dimethylaminopropylamine Drugs 0.000 description 1
- XKXXASMSIPLSHL-UHFFFAOYSA-N 4-(1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl)oxybenzenesulfonyl chloride Chemical compound C1=C(O)C=2C(=O)C3=CC=CC=C3C(=O)C=2C(N)=C1OC1=CC=C(S(Cl)(=O)=O)C=C1 XKXXASMSIPLSHL-UHFFFAOYSA-N 0.000 description 1
- UXKLYBMQAHYULT-UHFFFAOYSA-N 4-(2-hydroxyethylamino)-3-nitrophenol Chemical compound OCCNC1=CC=C(O)C=C1[N+]([O-])=O UXKLYBMQAHYULT-UHFFFAOYSA-N 0.000 description 1
- HSDSBIUUVWRHTM-UHFFFAOYSA-N 4-(2-nitroanilino)phenol Chemical compound C1=CC(O)=CC=C1NC1=CC=CC=C1[N+]([O-])=O HSDSBIUUVWRHTM-UHFFFAOYSA-N 0.000 description 1
- NZDXSXLYLMHYJA-UHFFFAOYSA-M 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-n,n-dimethylaniline;chloride Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)C=CN1C NZDXSXLYLMHYJA-UHFFFAOYSA-M 0.000 description 1
- KEVCVWPVGPWWOI-UHFFFAOYSA-N 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]aniline;chloride Chemical compound [Cl-].CN1C=C[N+](C)=C1N=NC1=CC=C(N)C=C1 KEVCVWPVGPWWOI-UHFFFAOYSA-N 0.000 description 1
- AXDJCCTWPBKUKL-UHFFFAOYSA-N 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydron;chloride Chemical compound Cl.C1=CC(=N)C(C)=CC1=C(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 AXDJCCTWPBKUKL-UHFFFAOYSA-N 0.000 description 1
- MWKPYVXITDAZLL-UHFFFAOYSA-N 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1OCCCOC1=CC=C(N)C=C1N MWKPYVXITDAZLL-UHFFFAOYSA-N 0.000 description 1
- XWNSFEAWWGGSKJ-UHFFFAOYSA-N 4-acetyl-4-methylheptanedinitrile Chemical compound N#CCCC(C)(C(=O)C)CCC#N XWNSFEAWWGGSKJ-UHFFFAOYSA-N 0.000 description 1
- PZKNKZNLQYKXFV-UHFFFAOYSA-N 4-amino-2-(aminomethyl)phenol Chemical compound NCC1=CC(N)=CC=C1O PZKNKZNLQYKXFV-UHFFFAOYSA-N 0.000 description 1
- UPHYVIFVOBTQNW-UHFFFAOYSA-N 4-amino-2-[(2-hydroxyethylamino)methyl]phenol Chemical compound NC1=CC=C(O)C(CNCCO)=C1 UPHYVIFVOBTQNW-UHFFFAOYSA-N 0.000 description 1
- IQXUIDYRTHQTET-UHFFFAOYSA-N 4-amino-3-nitrophenol Chemical compound NC1=CC=C(O)C=C1[N+]([O-])=O IQXUIDYRTHQTET-UHFFFAOYSA-N 0.000 description 1
- JQVAPEJNIZULEK-UHFFFAOYSA-N 4-chlorobenzene-1,3-diol Chemical compound OC1=CC=C(Cl)C(O)=C1 JQVAPEJNIZULEK-UHFFFAOYSA-N 0.000 description 1
- SXQUESAFKTUGKZ-UHFFFAOYSA-N 4-ethoxy-2-methylbenzene-1,3-diamine Chemical compound NC1=C(C=CC(=C1C)N)OCC SXQUESAFKTUGKZ-UHFFFAOYSA-N 0.000 description 1
- GPMWAWDEZPFUTN-UHFFFAOYSA-N 4-fluoro-6-methylbenzene-1,3-diamine Chemical compound CC1=CC(F)=C(N)C=C1N GPMWAWDEZPFUTN-UHFFFAOYSA-N 0.000 description 1
- QGNGOGOOPUYKMC-UHFFFAOYSA-N 4-hydroxy-6-methylaniline Chemical compound CC1=CC(O)=CC=C1N QGNGOGOOPUYKMC-UHFFFAOYSA-N 0.000 description 1
- NLMQHXUGJIAKTH-UHFFFAOYSA-N 4-hydroxyindole Chemical compound OC1=CC=CC2=C1C=CN2 NLMQHXUGJIAKTH-UHFFFAOYSA-N 0.000 description 1
- ZFIQGRISGKSVAG-UHFFFAOYSA-N 4-methylaminophenol Chemical compound CNC1=CC=C(O)C=C1 ZFIQGRISGKSVAG-UHFFFAOYSA-N 0.000 description 1
- XCJRRZLPXALCIP-UHFFFAOYSA-N 4-n-(2-methoxyethyl)benzene-1,4-diamine Chemical compound COCCNC1=CC=C(N)C=C1 XCJRRZLPXALCIP-UHFFFAOYSA-N 0.000 description 1
- QZHXKQKKEBXYRG-UHFFFAOYSA-N 4-n-(4-aminophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C(N)C=C1 QZHXKQKKEBXYRG-UHFFFAOYSA-N 0.000 description 1
- RAUWPNXIALNKQM-UHFFFAOYSA-N 4-nitro-1,2-phenylenediamine Chemical compound NC1=CC=C([N+]([O-])=O)C=C1N RAUWPNXIALNKQM-UHFFFAOYSA-N 0.000 description 1
- YGRFRBUGAPOJDU-UHFFFAOYSA-N 5-(2-hydroxyethylamino)-2-methylphenol Chemical compound CC1=CC=C(NCCO)C=C1O YGRFRBUGAPOJDU-UHFFFAOYSA-N 0.000 description 1
- GMVGJPGHVIUINB-UHFFFAOYSA-N 5-(2-hydroxyethylamino)-4-methoxy-2-methylphenol Chemical compound COC1=CC(C)=C(O)C=C1NCCO GMVGJPGHVIUINB-UHFFFAOYSA-N 0.000 description 1
- VBVIZNHSOXAEQD-UHFFFAOYSA-N 5-acetamido-1-amino-9,10-dioxoanthracene-2-sulfonic acid Chemical compound O=C1C2=C(N)C(S(O)(=O)=O)=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C VBVIZNHSOXAEQD-UHFFFAOYSA-N 0.000 description 1
- DBFYESDCPWWCHN-UHFFFAOYSA-N 5-amino-2-methylphenol Chemical compound CC1=CC=C(N)C=C1O DBFYESDCPWWCHN-UHFFFAOYSA-N 0.000 description 1
- WDQMXRWYXILWPT-UHFFFAOYSA-N 5-amino-4-chloro-2-methylphenol Chemical compound CC1=CC(Cl)=C(N)C=C1O WDQMXRWYXILWPT-UHFFFAOYSA-N 0.000 description 1
- HEAQOCBITATQEW-UHFFFAOYSA-N 5-amino-4-fluoro-2-methylphenol Chemical compound CC1=CC(F)=C(N)C=C1O HEAQOCBITATQEW-UHFFFAOYSA-N 0.000 description 1
- LMIQERWZRIFWNZ-UHFFFAOYSA-N 5-hydroxyindole Chemical compound OC1=CC=C2NC=CC2=C1 LMIQERWZRIFWNZ-UHFFFAOYSA-N 0.000 description 1
- TUYBCLHMZFLWRY-UHFFFAOYSA-N 6-bromo-1,3-benzodioxol-5-ol Chemical compound C1=C(Br)C(O)=CC2=C1OCO2 TUYBCLHMZFLWRY-UHFFFAOYSA-N 0.000 description 1
- KIEGFAYDOKCBOK-UHFFFAOYSA-N 6-hydroxy-4,5-dimethyl-1h-pyridin-2-one Chemical compound CC1=CC(=O)NC(O)=C1C KIEGFAYDOKCBOK-UHFFFAOYSA-N 0.000 description 1
- ATCBPVDYYNJHSG-UHFFFAOYSA-N 6-methoxy-2-n-methylpyridine-2,3-diamine Chemical compound CNC1=NC(OC)=CC=C1N ATCBPVDYYNJHSG-UHFFFAOYSA-N 0.000 description 1
- WEPOCTWSRWLQLL-UHFFFAOYSA-N 6-methoxypyridine-2,3-diamine Chemical compound COC1=CC=C(N)C(N)=N1 WEPOCTWSRWLQLL-UHFFFAOYSA-N 0.000 description 1
- TWLMSPNQBKSXOP-UHFFFAOYSA-N 6358-09-4 Chemical compound NC1=CC([N+]([O-])=O)=CC(Cl)=C1O TWLMSPNQBKSXOP-UHFFFAOYSA-N 0.000 description 1
- JAJIPIAHCFBEPI-UHFFFAOYSA-N 9,10-dioxoanthracene-1-sulfonic acid Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2S(=O)(=O)O JAJIPIAHCFBEPI-UHFFFAOYSA-N 0.000 description 1
- CQPFMGBJSMSXLP-ZAGWXBKKSA-M Acid orange 7 Chemical compound OC1=C(C2=CC=CC=C2C=C1)/N=N/C1=CC=C(C=C1)S(=O)(=O)[O-].[Na+] CQPFMGBJSMSXLP-ZAGWXBKKSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- HMEKVHWROSNWPD-UHFFFAOYSA-N Erioglaucine A Chemical compound [NH4+].[NH4+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=2C(=CC=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 HMEKVHWROSNWPD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- MIWUTEVJIISHCP-UHFFFAOYSA-N HC Blue No. 2 Chemical compound OCCNC1=CC=C(N(CCO)CCO)C=C1[N+]([O-])=O MIWUTEVJIISHCP-UHFFFAOYSA-N 0.000 description 1
- GZGZVOLBULPDFD-UHFFFAOYSA-N HC Red No. 3 Chemical compound NC1=CC=C(NCCO)C([N+]([O-])=O)=C1 GZGZVOLBULPDFD-UHFFFAOYSA-N 0.000 description 1
- PNENOUKIPPERMY-UHFFFAOYSA-N HC Yellow No. 4 Chemical compound OCCNC1=CC=C([N+]([O-])=O)C=C1OCCO PNENOUKIPPERMY-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- BNUHAJGCKIQFGE-UHFFFAOYSA-N Nitroanisol Chemical compound COC1=CC=C([N+]([O-])=O)C=C1 BNUHAJGCKIQFGE-UHFFFAOYSA-N 0.000 description 1
- 239000004153 Potassium bromate Substances 0.000 description 1
- QPMIVFWZGPTDPN-UHFFFAOYSA-N Tetrabromophenol blue Chemical compound C1=C(Br)C(O)=C(Br)C=C1C1(C=2C=C(Br)C(O)=C(Br)C=2)C(C(Br)=C(Br)C(Br)=C2Br)=C2S(=O)(=O)O1 QPMIVFWZGPTDPN-UHFFFAOYSA-N 0.000 description 1
- RFQSMLBZXQOMKK-UHFFFAOYSA-N [3-[(4,8-diamino-6-bromo-1,5-dioxonaphthalen-2-yl)amino]phenyl]-trimethylazanium;chloride Chemical compound [Cl-].C[N+](C)(C)C1=CC=CC(NC=2C(C3=C(N)C=C(Br)C(=O)C3=C(N)C=2)=O)=C1 RFQSMLBZXQOMKK-UHFFFAOYSA-N 0.000 description 1
- HSWXSHNPRUMJKI-UHFFFAOYSA-N [8-[(2-methoxyphenyl)hydrazinylidene]-7-oxonaphthalen-2-yl]-trimethylazanium;chloride Chemical compound [Cl-].COC1=CC=CC=C1N\N=C/1C2=CC([N+](C)(C)C)=CC=C2C=CC\1=O HSWXSHNPRUMJKI-UHFFFAOYSA-N 0.000 description 1
- CMPPYVDBIJWGCB-UHFFFAOYSA-N [8-[(4-amino-3-nitrophenyl)hydrazinylidene]-7-oxonaphthalen-2-yl]-trimethylazanium;chloride Chemical compound [Cl-].C12=CC([N+](C)(C)C)=CC=C2C=CC(=O)\C1=N\NC1=CC=C(N)C([N+]([O-])=O)=C1 CMPPYVDBIJWGCB-UHFFFAOYSA-N 0.000 description 1
- UXEAWNJALIUYRH-UHFFFAOYSA-N [8-[(4-aminophenyl)hydrazinylidene]-7-oxonaphthalen-2-yl]-trimethylazanium;chloride Chemical compound [Cl-].C12=CC([N+](C)(C)C)=CC=C2C=CC(=O)\C1=N/NC1=CC=C(N)C=C1 UXEAWNJALIUYRH-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000000980 acid dye Substances 0.000 description 1
- 229940099540 acid violet 43 Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000002280 amphoteric surfactant Chemical class 0.000 description 1
- 239000003945 anionic surfactant Chemical class 0.000 description 1
- 125000002078 anthracen-1-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C([*])=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 229940064004 antiseptic throat preparations Drugs 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000006701 autoxidation reaction Methods 0.000 description 1
- 239000000981 basic dye Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 235000012745 brilliant blue FCF Nutrition 0.000 description 1
- 239000004161 brilliant blue FCF Substances 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-M bromate Chemical class [O-]Br(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-M 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- STIAPHVBRDNOAJ-UHFFFAOYSA-N carbamimidoylazanium;carbonate Chemical compound NC(N)=N.NC(N)=N.OC(O)=O STIAPHVBRDNOAJ-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- PZTQVMXMKVTIRC-UHFFFAOYSA-L chembl2028348 Chemical compound [Ca+2].[O-]S(=O)(=O)C1=CC(C)=CC=C1N=NC1=C(O)C(C([O-])=O)=CC2=CC=CC=C12 PZTQVMXMKVTIRC-UHFFFAOYSA-L 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- LQJVOKWHGUAUHK-UHFFFAOYSA-L disodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].OC1=C2C(N)=CC(S([O-])(=O)=O)=CC2=CC(S([O-])(=O)=O)=C1N=NC1=CC=CC=C1 LQJVOKWHGUAUHK-UHFFFAOYSA-L 0.000 description 1
- FPVGTPBMTFTMRT-UHFFFAOYSA-L disodium;2-amino-5-[(4-sulfonatophenyl)diazenyl]benzenesulfonate Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C(N)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 FPVGTPBMTFTMRT-UHFFFAOYSA-L 0.000 description 1
- FPAYXBWMYIMERV-UHFFFAOYSA-L disodium;5-methyl-2-[[4-(4-methyl-2-sulfonatoanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC(C)=CC=C1NC(C=1C(=O)C2=CC=CC=C2C(=O)C=11)=CC=C1NC1=CC=C(C)C=C1S([O-])(=O)=O FPAYXBWMYIMERV-UHFFFAOYSA-L 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- XNFVGEUMTFIVHQ-UHFFFAOYSA-N disodium;sulfide;hydrate Chemical compound O.[Na+].[Na+].[S-2] XNFVGEUMTFIVHQ-UHFFFAOYSA-N 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 235000019233 fast yellow AB Nutrition 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- CSFWPUWCSPOLJW-UHFFFAOYSA-N hydroxynaphthoquinone Natural products C1=CC=C2C(=O)C(O)=CC(=O)C2=C1 CSFWPUWCSPOLJW-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940102253 isopropanolamine Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- SXQCTESRRZBPHJ-UHFFFAOYSA-M lissamine rhodamine Chemical compound [Na+].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=C(S([O-])(=O)=O)C=C1S([O-])(=O)=O SXQCTESRRZBPHJ-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- KBOPZPXVLCULAV-UHFFFAOYSA-N mesalamine Chemical compound NC1=CC=C(O)C(C(O)=O)=C1 KBOPZPXVLCULAV-UHFFFAOYSA-N 0.000 description 1
- 229960004963 mesalazine Drugs 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- AFAJYBYVKUTWJK-UHFFFAOYSA-N n'-(5-methoxy-2-nitrophenyl)ethane-1,2-diamine;hydrochloride Chemical compound Cl.COC1=CC=C([N+]([O-])=O)C(NCCN)=C1 AFAJYBYVKUTWJK-UHFFFAOYSA-N 0.000 description 1
- BKEFUBHXUTWQED-UHFFFAOYSA-N n-(4-amino-3-hydroxyphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C(O)=C1 BKEFUBHXUTWQED-UHFFFAOYSA-N 0.000 description 1
- BDPJHSRXHQHQJY-UHFFFAOYSA-N n-[4-amino-3-[2-(dimethylamino)ethoxy]-9,10-dioxoanthracen-1-yl]methanesulfonamide Chemical compound C1=CC=C2C(=O)C3=C(N)C(OCCN(C)C)=CC(NS(C)(=O)=O)=C3C(=O)C2=C1 BDPJHSRXHQHQJY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- LLLILZLFKGJCCV-UHFFFAOYSA-M n-methyl-n-[(1-methylpyridin-1-ium-4-yl)methylideneamino]aniline;methyl sulfate Chemical compound COS([O-])(=O)=O.C=1C=CC=CC=1N(C)\N=C\C1=CC=[N+](C)C=C1 LLLILZLFKGJCCV-UHFFFAOYSA-M 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZUVBIBLYOCVYJU-UHFFFAOYSA-N naphthalene-1,7-diol Chemical compound C1=CC=C(O)C2=CC(O)=CC=C21 ZUVBIBLYOCVYJU-UHFFFAOYSA-N 0.000 description 1
- DFQICHCWIIJABH-UHFFFAOYSA-N naphthalene-2,7-diol Chemical compound C1=CC(O)=CC2=CC(O)=CC=C21 DFQICHCWIIJABH-UHFFFAOYSA-N 0.000 description 1
- CTIQLGJVGNGFEW-UHFFFAOYSA-L naphthol yellow S Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C([O-])=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 CTIQLGJVGNGFEW-UHFFFAOYSA-L 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- IPSIPYMEZZPCPY-UHFFFAOYSA-N new fuchsin Chemical compound [Cl-].C1=CC(=[NH2+])C(C)=CC1=C(C=1C=C(C)C(N)=CC=1)C1=CC=C(N)C(C)=C1 IPSIPYMEZZPCPY-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000002736 nonionic surfactant Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- GVKCHTBDSMQENH-UHFFFAOYSA-L phloxine B Chemical compound [Na+].[Na+].[O-]C(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C([O-])=C(Br)C=C21 GVKCHTBDSMQENH-UHFFFAOYSA-L 0.000 description 1
- QXYMVUZOGFVPGH-UHFFFAOYSA-N picramic acid Chemical compound NC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O QXYMVUZOGFVPGH-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000000419 plant extract Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229940094037 potassium bromate Drugs 0.000 description 1
- 235000019396 potassium bromate Nutrition 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 1
- 108090000623 proteins and genes Chemical class 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 1
- PZRKPUQWIFJRKZ-UHFFFAOYSA-N pyrimidine-2,4,5,6-tetramine Chemical compound NC1=NC(N)=C(N)C(N)=N1 PZRKPUQWIFJRKZ-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 1
- 229960001755 resorcinol Drugs 0.000 description 1
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- XUXNAKZDHHEHPC-UHFFFAOYSA-M sodium bromate Chemical compound [Na+].[O-]Br(=O)=O XUXNAKZDHHEHPC-UHFFFAOYSA-M 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- DJDYMAHXZBQZKH-UHFFFAOYSA-M sodium;1-amino-4-(cyclohexylamino)-9,10-dioxoanthracene-2-sulfonate Chemical compound [Na+].C1=2C(=O)C3=CC=CC=C3C(=O)C=2C(N)=C(S([O-])(=O)=O)C=C1NC1CCCCC1 DJDYMAHXZBQZKH-UHFFFAOYSA-M 0.000 description 1
- GTKIEPUIFBBXJQ-UHFFFAOYSA-M sodium;2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-5-methylbenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(C)=CC=C1NC1=CC=C(O)C2=C1C(=O)C1=CC=CC=C1C2=O GTKIEPUIFBBXJQ-UHFFFAOYSA-M 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- UJMBCXLDXJUMFB-GLCFPVLVSA-K tartrazine Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)C1=NN(C=2C=CC(=CC=2)S([O-])(=O)=O)C(=O)C1\N=N\C1=CC=C(S([O-])(=O)=O)C=C1 UJMBCXLDXJUMFB-GLCFPVLVSA-K 0.000 description 1
- 235000012756 tartrazine Nutrition 0.000 description 1
- 239000004149 tartrazine Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- DWKARHJHPSUOBW-UHFFFAOYSA-N trimethyl-[3-[(2e)-2-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)hydrazinyl]phenyl]azanium;chloride Chemical compound [Cl-].CC1=NN(C=2C=CC=CC=2)C(O)=C1N=NC1=CC=CC([N+](C)(C)C)=C1 DWKARHJHPSUOBW-UHFFFAOYSA-N 0.000 description 1
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- LLWJPGAKXJBKKA-UHFFFAOYSA-N victoria blue B Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC(=CC=1)N(C)C)=C(C=C1)C2=CC=CC=C2C1=[NH+]C1=CC=CC=C1 LLWJPGAKXJBKKA-UHFFFAOYSA-N 0.000 description 1
- ROVRRJSRRSGUOL-UHFFFAOYSA-N victoria blue bo Chemical compound [Cl-].C12=CC=CC=C2C(NCC)=CC=C1C(C=1C=CC(=CC=1)N(CC)CC)=C1C=CC(=[N+](CC)CC)C=C1 ROVRRJSRRSGUOL-UHFFFAOYSA-N 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/24—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings
- C07C225/26—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings having amino groups bound to carbon atoms of quinone rings or of condensed ring systems containing quinone rings
- C07C225/32—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings having amino groups bound to carbon atoms of quinone rings or of condensed ring systems containing quinone rings of condensed quinone ring systems formed by at least three rings
- C07C225/34—Amino anthraquinones
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/33—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing oxygen
- A61K8/35—Ketones, e.g. benzophenone
- A61K8/355—Quinones
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q5/00—Preparations for care of the hair
- A61Q5/10—Preparations for permanently dyeing the hair
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/24—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings
- C07C225/26—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings having amino groups bound to carbon atoms of quinone rings or of condensed ring systems containing quinone rings
- C07C225/32—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings having amino groups bound to carbon atoms of quinone rings or of condensed ring systems containing quinone rings of condensed quinone ring systems formed by at least three rings
- C07C225/34—Amino anthraquinones
- C07C225/36—Amino anthraquinones the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/16—Amino-anthraquinones
- C09B1/20—Preparation from starting materials already containing the anthracene nucleus
- C09B1/207—Dyes with amino groups and with onium groups
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/50—Amino-hydroxy-anthraquinones; Ethers and esters thereof
- C09B1/501—Amino-hydroxy-anthraquinones; Ethers and esters thereof containing onium groups
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B69/00—Dyes not provided for by a single group of this subclass
- C09B69/001—Dyes containing an onium group attached to the dye skeleton via a bridge
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Emergency Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP06101466.8 | 2006-02-09 | ||
| EP06101466A EP1820826A1 (en) | 2006-02-09 | 2006-02-09 | Dyestuffs and Hair Dye Compositions |
| PCT/EP2007/051043 WO2007090800A2 (en) | 2006-02-09 | 2007-02-02 | Hair dye compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2641838A1 true CA2641838A1 (en) | 2007-08-16 |
Family
ID=36616886
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002641863A Abandoned CA2641863A1 (en) | 2006-02-09 | 2007-02-02 | Dyestuffs and hair dye compositions |
| CA002641838A Abandoned CA2641838A1 (en) | 2006-02-09 | 2007-02-02 | Hair dye compositions |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002641863A Abandoned CA2641863A1 (en) | 2006-02-09 | 2007-02-02 | Dyestuffs and hair dye compositions |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US7776106B2 (OSRAM) |
| EP (3) | EP1820826A1 (OSRAM) |
| JP (2) | JP5286567B2 (OSRAM) |
| KR (2) | KR20080093115A (OSRAM) |
| CN (2) | CN101379145A (OSRAM) |
| AU (2) | AU2007213796A1 (OSRAM) |
| CA (2) | CA2641863A1 (OSRAM) |
| RU (2) | RU2008136053A (OSRAM) |
| TW (2) | TWI412565B (OSRAM) |
| WO (2) | WO2007090800A2 (OSRAM) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2010070549A (ja) * | 2008-08-19 | 2010-04-02 | Kao Corp | 染毛剤組成物 |
| US8801808B2 (en) | 2010-12-20 | 2014-08-12 | L'oreal | Dye composition comprising benzyl alcohol, a monoalcohol and a particular direct dye |
| EP2468245A1 (en) * | 2010-12-27 | 2012-06-27 | KPSS-Kao Professional Salon Services GmbH | Dyeing composition for keratin fibers |
| DE102011089222A1 (de) | 2011-12-20 | 2013-06-20 | Henkel Ag & Co. Kgaa | Mittel zum Färben von keratinischen Fasern enthaltend kationische Anthrachinonfarbstoffe und Fettsäurediester von Alkandiolen |
| DE102011089218A1 (de) | 2011-12-20 | 2013-06-20 | Henkel Ag & Co. Kgaa | Färbemittel mit kationischen direktziehenden Farbstoffen und Lecithine |
| DE102011089223A1 (de) | 2011-12-20 | 2013-06-20 | Henkel Ag & Co. Kgaa | Färbemittel mit direktziehenden Farbstoffen und zwitterionischen Tensiden |
| DE102011089216A1 (de) * | 2011-12-20 | 2013-06-20 | Henkel Ag & Co. Kgaa | Färbemittel mit direktziehenden Farbstoffen und amphotere Tensiden |
| DE102011089221A1 (de) * | 2011-12-20 | 2013-06-20 | Henkel Ag & Co. Kgaa | Färbemittel mit direktziehenden Farbstoffen und Phospat-Tensiden |
| DE102011089220A1 (de) | 2011-12-20 | 2013-06-20 | Henkel Ag & Co. Kgaa | Mittel zum Färben von keratinischen Fasern enthaltend kationische Anthrachinonfarbstoffe und Fettsäuretriglyceride |
| DE102011089217A1 (de) | 2011-12-20 | 2013-06-20 | Henkel Ag & Co. Kgaa | Mittel zum Färben von keratinischen Fasern enthaltend hationische Anthrachinonfarbstoffe und anionische Polymere |
| DE102011089219A1 (de) | 2011-12-20 | 2013-06-20 | Henkel Ag & Co. Kgaa | Färbemittel mit direktziehenden Farbstoffen und nichtionischen Tensiden |
| RU2742123C1 (ru) * | 2017-09-20 | 2021-02-02 | Као Корпорейшн | Порошковая композиция, включающая прямые красители для волос |
| JP7579438B2 (ja) * | 2020-09-30 | 2024-11-07 | 花王株式会社 | 改善された耐久性を有する毛髪染色組成物 |
| TW202228635A (zh) * | 2020-09-30 | 2022-08-01 | 日商花王股份有限公司 | 包含直接染料之用於角蛋白纖維之漂白及著色組合物 |
| TW202228634A (zh) * | 2020-09-30 | 2022-08-01 | 日商花王股份有限公司 | 含藍色染料之染毛組合物 |
Family Cites Families (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR13564E (fr) * | 1908-06-25 | 1911-05-12 | Farbenfab Vorm Bayer F & Co | Procédé de production de nouveaux dérivés de la série de l'anthracène et les produits qui en résultent |
| US2737517A (en) * | 1954-05-25 | 1956-03-06 | Du Pont | Quaternary ammonium anthraquinone salts |
| DE1150652B (de) * | 1955-08-30 | 1963-06-27 | Bayer Ag | Faerben von Polyacrylnitrilfasern |
| BE581785A (OSRAM) * | 1957-06-13 | |||
| DE1286666B (de) * | 1962-04-05 | 1969-01-09 | Hoechst Ag | Verfahren zur Herstellung von wasserloeslichen, kationischen Farbstoffen |
| FR1363216A (fr) * | 1962-04-05 | 1964-06-12 | Hoechst Ag | Colorants cationiques hydrosolubles et leur préparation |
| GB1053536A (OSRAM) * | 1962-10-29 | |||
| DE1248865C2 (de) * | 1963-09-04 | 1975-01-09 | Henkel & Cie GmbH, 4000 Düsseldorf | Mittel zum faerben von haaren |
| DE1203915B (de) | 1963-09-04 | 1965-10-28 | Therachemie Chem Therapeut | Haarfaerbemittel |
| CH463666A (de) * | 1964-09-10 | 1968-10-15 | Sandoz Ag | Verfahren zur Herstellung von Farbstoffen |
| NL125671C (OSRAM) * | 1964-02-05 | |||
| CH476798A (de) | 1965-04-05 | 1969-08-15 | Allied Chem | Verfahren zur Herstellung von Anthrachinonfarbstoffen |
| CH488781A (de) * | 1966-07-04 | 1970-04-15 | Ciba Geigy | Verfahren zur Herstellung basischer Azofarbstoffe |
| DE1619365A1 (de) * | 1967-04-14 | 1969-09-04 | Basf Ag | Verfahren zum Faerben von sauer modifizierten Polyamiden |
| US3652601A (en) * | 1968-02-12 | 1972-03-28 | Sandoz Ltd | Anthraquinone dyes |
| GB1248652A (en) * | 1968-04-25 | 1971-10-06 | Du Pont | Water-insoluble dye salts |
| GB1270107A (en) * | 1968-05-15 | 1972-04-12 | Ici Ltd | Anthraquinone dyestuffs |
| GB1205365A (en) * | 1969-05-27 | 1970-09-16 | Gillette Industries Ltd | Anthraquinone dyes |
| DE2533428A1 (de) * | 1975-07-25 | 1977-02-10 | Bayer Ag | Kationische farbstoffe |
| GB1537253A (en) * | 1976-05-28 | 1978-12-29 | Ici Ltd | Disperse anthraquinone dyestuffs |
| FR2667788B1 (fr) * | 1990-10-12 | 1994-12-02 | Oreal | Utilisation d'hydroxyalkylamino-9,10-anthraquinones pour la teinture de fibres keratiniques humaines, composition cosmetique les contenant en association avec des colorants azouiques et nitres. |
| JP2561185B2 (ja) * | 1991-07-31 | 1996-12-04 | 株式会社粘土科学研究所 | プロテクトクリーム |
| DE4225644A1 (de) * | 1992-08-03 | 1994-02-10 | Koerber Ag | Vorrichtung zum Abstreifen von Tabakpartikeln von einem Förderer |
| US5486629A (en) * | 1992-09-01 | 1996-01-23 | Clairol, Inc. | Direct dyes having a quaternary center with a long aliphatic chain |
| GB9402607D0 (en) * | 1994-02-10 | 1994-04-06 | Zeneca Ltd | Process |
| JPH08217652A (ja) * | 1994-12-16 | 1996-08-27 | Yamahatsu Sangyo Kk | 酸化染毛剤組成物 |
| US5520707A (en) * | 1995-08-07 | 1996-05-28 | Clairol, Inc. | Methods for dyeing hair with anthraquinone hair dyes having a quaternary ammonium side chain |
| US5746779A (en) * | 1996-07-12 | 1998-05-05 | Bristol-Myers Squibb Company | Quaternized blue anthraqinone hair dyes in an isatin/amine dye system |
| EP0852136A1 (de) * | 1996-11-19 | 1998-07-08 | Ciba SC Holding AG | Verfahren zum Färben von keratinhaltigen Fasern |
| US5961664A (en) * | 1997-07-10 | 1999-10-05 | Bristol-Myers Squibb Company | Direct hair dye compositions and methods containing novel anthraquinone mixtures |
| JP3854736B2 (ja) * | 1998-11-06 | 2006-12-06 | ライオン株式会社 | 染毛剤組成物 |
| FR2786484B1 (fr) * | 1998-11-30 | 2001-01-05 | Oreal | Aminoanthraquinones cationiques, leur utilisation pour la teinture des fibres keratiniques, compositions tinctoriales les renfermant et procedes de teinture |
| JP4471051B2 (ja) * | 1999-06-22 | 2010-06-02 | ライオン株式会社 | 染毛剤組成物及びその製造方法 |
| DE10144882A1 (de) * | 2001-09-12 | 2003-03-27 | Wella Ag | Aufhellendes Haarfärbemittel mit direktziehenden Farbstoffen |
-
2006
- 2006-02-09 EP EP06101466A patent/EP1820826A1/en not_active Withdrawn
-
2007
- 2007-02-02 CN CNA2007800048348A patent/CN101379145A/zh active Pending
- 2007-02-02 AU AU2007213796A patent/AU2007213796A1/en not_active Abandoned
- 2007-02-02 JP JP2008553732A patent/JP5286567B2/ja active Active
- 2007-02-02 WO PCT/EP2007/051043 patent/WO2007090800A2/en not_active Ceased
- 2007-02-02 RU RU2008136053/04A patent/RU2008136053A/ru not_active Application Discontinuation
- 2007-02-02 US US12/279,003 patent/US7776106B2/en not_active Expired - Fee Related
- 2007-02-02 RU RU2008136055/04A patent/RU2008136055A/ru not_active Application Discontinuation
- 2007-02-02 CA CA002641863A patent/CA2641863A1/en not_active Abandoned
- 2007-02-02 CA CA002641838A patent/CA2641838A1/en not_active Abandoned
- 2007-02-02 EP EP07704328A patent/EP1984458A2/en not_active Withdrawn
- 2007-02-02 US US12/278,715 patent/US20090249564A1/en not_active Abandoned
- 2007-02-02 KR KR1020087018957A patent/KR20080093115A/ko not_active Ceased
- 2007-02-02 WO PCT/EP2007/051041 patent/WO2007090799A2/en not_active Ceased
- 2007-02-02 JP JP2008553733A patent/JP5176026B2/ja not_active Expired - Fee Related
- 2007-02-02 EP EP07704330A patent/EP1984459A2/en not_active Withdrawn
- 2007-02-02 KR KR1020087018980A patent/KR20080094674A/ko not_active Withdrawn
- 2007-02-02 AU AU2007213797A patent/AU2007213797A1/en not_active Abandoned
- 2007-02-02 CN CN2007800048244A patent/CN101379144B/zh not_active Expired - Fee Related
- 2007-02-07 TW TW096104463A patent/TWI412565B/zh active
- 2007-02-07 TW TW096104464A patent/TW200731994A/zh unknown
Also Published As
| Publication number | Publication date |
|---|---|
| WO2007090800A2 (en) | 2007-08-16 |
| CN101379144A (zh) | 2009-03-04 |
| AU2007213796A1 (en) | 2007-08-16 |
| EP1820826A1 (en) | 2007-08-22 |
| WO2007090799A2 (en) | 2007-08-16 |
| AU2007213797A1 (en) | 2007-08-16 |
| CN101379145A (zh) | 2009-03-04 |
| RU2008136055A (ru) | 2010-03-20 |
| EP1984458A2 (en) | 2008-10-29 |
| TW200731994A (en) | 2007-09-01 |
| TWI412565B (zh) | 2013-10-21 |
| JP2009531285A (ja) | 2009-09-03 |
| US7776106B2 (en) | 2010-08-17 |
| JP5286567B2 (ja) | 2013-09-11 |
| KR20080093115A (ko) | 2008-10-20 |
| TW200732427A (en) | 2007-09-01 |
| US20090217466A1 (en) | 2009-09-03 |
| KR20080094674A (ko) | 2008-10-23 |
| CN101379144B (zh) | 2012-08-22 |
| US20090249564A1 (en) | 2009-10-08 |
| EP1984459A2 (en) | 2008-10-29 |
| WO2007090800A3 (en) | 2007-12-21 |
| JP2009529582A (ja) | 2009-08-20 |
| CA2641863A1 (en) | 2007-08-16 |
| WO2007090799A3 (en) | 2008-01-10 |
| RU2008136053A (ru) | 2010-03-20 |
| JP5176026B2 (ja) | 2013-04-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2641838A1 (en) | Hair dye compositions | |
| JP4150484B2 (ja) | 毛髪用染色剤組成物 | |
| FR2822697A1 (fr) | Nouvelle composition tinctoriale pour la teinture des fibres keratiniques comprenant un colorant azoique cationique particulier | |
| EP1398020A1 (en) | Hair dye composition comprising an azo dye containing a dissociative proton, method and use | |
| EP1849454B1 (en) | Hair dye composition | |
| EP1407756B2 (en) | Hair dye composition comprising methine dye | |
| EP1352632A1 (en) | Hair dye composition | |
| AU2013222033B2 (en) | Dyestuffs and hair dye compositions | |
| EP1398021B1 (en) | Hair dye composition | |
| HK1125963A (en) | Hair dye compositions | |
| EP2108406A1 (en) | Anionic dyes and hair dye compositions containing them | |
| JP4463833B2 (ja) | 染毛剤組成物 | |
| HK1125397A (en) | Dyestuffs and hair dye compositions | |
| JP2006265158A (ja) | 染毛剤 | |
| JP2003012480A (ja) | 染毛剤組成物 | |
| JP2007077056A (ja) | 自己組織化化合物を含む毛髪化粧料 | |
| JP2007126484A (ja) | 染毛剤組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |
Effective date: 20130204 |